Benzen og substituerede derivater
Filtrerede søgeresultater
Benzylalkohol, 99%, ren
CAS: 100-51-6 Molekylær formel: C7H8O Molekylvægt (g/mol): 108.14 MDL nummer: MFCD00004599,MFCD03792087 InChI nøgle: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC navn: phenylmethanol SMIL: OCC1=CC=CC=C1
| MDL nummer | MFCD00004599,MFCD03792087 |
|---|---|
| PubChem CID | 244 |
| Molekylvægt (g/mol) | 108.14 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| SMIL | OCC1=CC=CC=C1 |
| IUPAC navn | phenylmethanol |
| InChI nøgle | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molekylær formel | C7H8O |
p-Anisaldehyd, 99+%
CAS: 123-11-5 Molekylær formel: C8H8O2 Molekylvægt (g/mol): 136.15 MDL nummer: MFCD00003385 InChI nøgle: ZRSNZINYAWTAHE-UHFFFAOYSA-N Synonym: p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine PubChem CID: 31244 ChEBI: CHEBI:28235 IUPAC navn: 4-methoxybenzaldehyd SMIL: COC1=CC=C(C=C1)C=O
| MDL nummer | MFCD00003385 |
|---|---|
| PubChem CID | 31244 |
| Molekylvægt (g/mol) | 136.15 |
| CAS | 123-11-5 |
| ChEBI | CHEBI:28235 |
| Synonym | p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine |
| SMIL | COC1=CC=C(C=C1)C=O |
| IUPAC navn | 4-methoxybenzaldehyd |
| InChI nøgle | ZRSNZINYAWTAHE-UHFFFAOYSA-N |
| Molekylær formel | C8H8O2 |
4-Aminobenzoesyre, 99%
CAS: 150-13-0 Molekylær formel: C7H7NO2 Molekylvægt (g/mol): 137.14 MDL nummer: MFCD00007894 InChI nøgle: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC navn: 4-aminobenzoesyre SMIL: NC1=CC=C(C=C1)C(O)=O
| MDL nummer | MFCD00007894 |
|---|---|
| PubChem CID | 978 |
| Molekylvægt (g/mol) | 137.14 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| SMIL | NC1=CC=C(C=C1)C(O)=O |
| IUPAC navn | 4-aminobenzoesyre |
| InChI nøgle | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
| Molekylær formel | C7H7NO2 |
Methyl 4-hydroxybenzoat, 99%
CAS: 99-76-3 Molekylær formel: C8H8O3 Molekylvægt (g/mol): 152.149 MDL nummer: MFCD00002352 InChI nøgle: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC navn: methyl-4-hydroxybenzoat SMIL: COC(=O)C1=CC=C(C=C1)O
| MDL nummer | MFCD00002352 |
|---|---|
| PubChem CID | 7456 |
| Molekylvægt (g/mol) | 152.149 |
| CAS | 99-76-3 |
| ChEBI | CHEBI:31835 |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| SMIL | COC(=O)C1=CC=C(C=C1)O |
| IUPAC navn | methyl-4-hydroxybenzoat |
| InChI nøgle | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molekylær formel | C8H8O3 |
Benzoesyre, 99%, ekstra ren
CAS: 65-85-0 Molekylær formel: C7H6O2 Molekylvægt (g/mol): 122.12 MDL nummer: MFCD00002398 InChI nøgle: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC navn: benzoesyre SMIL: C1=CC=C(C=C1)C(=O)O
| MDL nummer | MFCD00002398 |
|---|---|
| PubChem CID | 243 |
| Molekylvægt (g/mol) | 122.12 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| SMIL | C1=CC=C(C=C1)C(=O)O |
| IUPAC navn | benzoesyre |
| InChI nøgle | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molekylær formel | C7H6O2 |
Ethyl 4-hydroxybenzoat, 99%
CAS: 120-47-8 Molekylær formel: C9H10O3 Molekylvægt (g/mol): 166.18 MDL nummer: MFCD00002353 InChI nøgle: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC navn: ethyl-4-hydroxybenzoat SMIL: CCOC(=O)C1=CC=C(C=C1)O
| MDL nummer | MFCD00002353 |
|---|---|
| PubChem CID | 8434 |
| Molekylvægt (g/mol) | 166.18 |
| CAS | 120-47-8 |
| ChEBI | CHEBI:86616 |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| SMIL | CCOC(=O)C1=CC=C(C=C1)O |
| IUPAC navn | ethyl-4-hydroxybenzoat |
| InChI nøgle | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Molekylær formel | C9H10O3 |
Thermo Scientific Chemicals Tetrabromphenolphtalein ethylester, ren
CAS: 1176-74-5 Molekylær formel: C22H14Br4O4 Molekylvægt (g/mol): 661.96 MDL nummer: MFCD00066387 InChI nøgle: SQFXATUXPUCFFO-UHFFFAOYSA-N Synonym: tetrabromophenolphthalein ethyl ester,3',3,5',5-tetrabromophenolphthalein ethyl ester,ethyl tetrabromophenolphthalein,unii-6d91ns781o,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl benzoate,3 inverted exclamation marka,3 inverted exclamation marka,5 inverted exclamation marka,5 inverted exclamation marka-tetrabromophenolphthalein ethyl ester,benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester,benzoic acid,2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-,ethyl ester,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene methyl benzoate PubChem CID: 92873 IUPAC navn: ethyl-2-[(3,5-dibrom-4-hydroxyphenyl)-(3,5-dibrom-4-oxocyclohexa-2,5-dien-1-yliden)methyl]benzoat SMIL: CCOC(=O)C1=CC=CC=C1C(=C2C=C(C(=O)C(=C2)Br)Br)C3=CC(=C(C(=C3)Br)O)Br
| MDL nummer | MFCD00066387 |
|---|---|
| PubChem CID | 92873 |
| Molekylvægt (g/mol) | 661.96 |
| CAS | 1176-74-5 |
| Synonym | tetrabromophenolphthalein ethyl ester,3',3,5',5-tetrabromophenolphthalein ethyl ester,ethyl tetrabromophenolphthalein,unii-6d91ns781o,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl benzoate,3 inverted exclamation marka,3 inverted exclamation marka,5 inverted exclamation marka,5 inverted exclamation marka-tetrabromophenolphthalein ethyl ester,benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester,benzoic acid,2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-,ethyl ester,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene methyl benzoate |
| SMIL | CCOC(=O)C1=CC=CC=C1C(=C2C=C(C(=O)C(=C2)Br)Br)C3=CC(=C(C(=C3)Br)O)Br |
| IUPAC navn | ethyl-2-[(3,5-dibrom-4-hydroxyphenyl)-(3,5-dibrom-4-oxocyclohexa-2,5-dien-1-yliden)methyl]benzoat |
| InChI nøgle | SQFXATUXPUCFFO-UHFFFAOYSA-N |
| Molekylær formel | C22H14Br4O4 |
trans-Anethole, 99%
CAS: 4180-23-8 Molekylær formel: C10H12O Molekylvægt (g/mol): 148.2 MDL nummer: MFCD00009284 InChI nøgle: RUVINXPYWBROJD-ONEGZZNKSA-N Synonym: anethole,trans-anethole,e-anethole,4-propenylanisole,anise camphor,trans-anethol,isoestragole,e-1-methoxy-4-prop-1-en-1-yl benzene,anethol,p-anethole PubChem CID: 637563 ChEBI: CHEBI:35616 IUPAC navn: 1-methoxy-4-[(E)-prop-1-enyl]benzen SMIL: CC=CC1=CC=C(C=C1)OC
| MDL nummer | MFCD00009284 |
|---|---|
| PubChem CID | 637563 |
| Molekylvægt (g/mol) | 148.2 |
| CAS | 4180-23-8 |
| ChEBI | CHEBI:35616 |
| Synonym | anethole,trans-anethole,e-anethole,4-propenylanisole,anise camphor,trans-anethol,isoestragole,e-1-methoxy-4-prop-1-en-1-yl benzene,anethol,p-anethole |
| SMIL | CC=CC1=CC=C(C=C1)OC |
| IUPAC navn | 1-methoxy-4-[(E)-prop-1-enyl]benzen |
| InChI nøgle | RUVINXPYWBROJD-ONEGZZNKSA-N |
| Molekylær formel | C10H12O |
5,5'-Dithiobis (2-nitrobenzoesyre), 99%
CAS: 69-78-3 Molekylær formel: C14H8N2O8S2 Molekylvægt (g/mol): 396.34 MDL nummer: MFCD00007140 InChI nøgle: KIUMMUBSPKGMOY-UHFFFAOYSA-N Synonym: dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid PubChem CID: 6254 ChEBI: CHEBI:86228 IUPAC navn: 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoesyre SMIL: OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O
| MDL nummer | MFCD00007140 |
|---|---|
| PubChem CID | 6254 |
| Molekylvægt (g/mol) | 396.34 |
| CAS | 69-78-3 |
| ChEBI | CHEBI:86228 |
| Synonym | dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid |
| SMIL | OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
| IUPAC navn | 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoesyre |
| InChI nøgle | KIUMMUBSPKGMOY-UHFFFAOYSA-N |
| Molekylær formel | C14H8N2O8S2 |
Thermo Scientific Chemicals Grundlæggende Fuchsin
CAS: 632-99-5 Molekylær formel: C20H20ClN3 Molekylvægt (g/mol): 337.85 MDL nummer: MFCD00012569 InChI nøgle: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC navn: 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-yliden)methyl]anilin;hydrochlorid SMIL: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
| MDL nummer | MFCD00012569 |
|---|---|
| PubChem CID | 12447 |
| Molekylvægt (g/mol) | 337.85 |
| CAS | 632-99-5 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| SMIL | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| IUPAC navn | 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-yliden)methyl]anilin;hydrochlorid |
| InChI nøgle | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
| Molekylær formel | C20H20ClN3 |
Trifenylfosfin, 99+%
CAS: 603-35-0 Molekylær formel: C18H15P Molekylvægt (g/mol): 262.29 MDL nummer: MFCD00003043 MFCD20489348 InChI nøgle: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC navn: triphenylphosphan SMIL: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00003043 MFCD20489348 |
|---|---|
| PubChem CID | 11776 |
| Molekylvægt (g/mol) | 262.29 |
| CAS | 603-35-0 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| SMIL | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | triphenylphosphan |
| InChI nøgle | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molekylær formel | C18H15P |
Methylsalicylat, 98%
CAS: 119-36-8 Molekylær formel: C8H8O3 Molekylvægt (g/mol): 152.149 MDL nummer: MFCD00002214 InChI nøgle: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC navn: methyl-2-hydroxybenzoat SMIL: COC(=O)C1=CC=CC=C1O
| MDL nummer | MFCD00002214 |
|---|---|
| PubChem CID | 4133 |
| Molekylvægt (g/mol) | 152.149 |
| CAS | 119-36-8 |
| ChEBI | CHEBI:31832 |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| SMIL | COC(=O)C1=CC=CC=C1O |
| IUPAC navn | methyl-2-hydroxybenzoat |
| InChI nøgle | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
| Molekylær formel | C8H8O3 |
2,4-Dichlorophenoxyeddikesyre, 97%
CAS: 94-75-7 Molekylær formel: C8H6Cl2O3 Molekylvægt (g/mol): 221.033 MDL nummer: MFCD00004300 InChI nøgle: OVSKIKFHRZPJSS-UHFFFAOYSA-N Synonym: 2,4-dichlorophenoxyacetic acid,2-2,4-dichlorophenoxy acetic acid,2,4-dichlorophenoxy acetic acid,hedonal,rhodia,agrotect,fernesta,fernimine,netagrone,tributon PubChem CID: 1486 ChEBI: CHEBI:28854 IUPAC navn: 2-(2,4-dichlorphenoxy)eddikesyre SMIL: C1=CC(=C(C=C1Cl)Cl)OCC(=O)O
| MDL nummer | MFCD00004300 |
|---|---|
| PubChem CID | 1486 |
| Molekylvægt (g/mol) | 221.033 |
| CAS | 94-75-7 |
| ChEBI | CHEBI:28854 |
| Synonym | 2,4-dichlorophenoxyacetic acid,2-2,4-dichlorophenoxy acetic acid,2,4-dichlorophenoxy acetic acid,hedonal,rhodia,agrotect,fernesta,fernimine,netagrone,tributon |
| SMIL | C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |
| IUPAC navn | 2-(2,4-dichlorphenoxy)eddikesyre |
| InChI nøgle | OVSKIKFHRZPJSS-UHFFFAOYSA-N |
| Molekylær formel | C8H6Cl2O3 |