Benzen og substituerede derivater
Filtrerede søgeresultater
Benzylalkohol, 99%, ren
CAS: 100-51-6 Molekylær formel: C7H8O Molekylvægt (g/mol): 108.14 MDL nummer: MFCD00004599,MFCD03792087 InChI nøgle: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC navn: phenylmethanol SMIL: OCC1=CC=CC=C1
| MDL nummer | MFCD00004599,MFCD03792087 |
|---|---|
| PubChem CID | 244 |
| Molekylvægt (g/mol) | 108.14 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| SMIL | OCC1=CC=CC=C1 |
| IUPAC navn | phenylmethanol |
| InChI nøgle | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molekylær formel | C7H8O |
p-Anisaldehyd, 99+%
CAS: 123-11-5 Molekylær formel: C8H8O2 Molekylvægt (g/mol): 136.15 MDL nummer: MFCD00003385 InChI nøgle: ZRSNZINYAWTAHE-UHFFFAOYSA-N Synonym: p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine PubChem CID: 31244 ChEBI: CHEBI:28235 IUPAC navn: 4-methoxybenzaldehyd SMIL: COC1=CC=C(C=C1)C=O
| MDL nummer | MFCD00003385 |
|---|---|
| PubChem CID | 31244 |
| Molekylvægt (g/mol) | 136.15 |
| CAS | 123-11-5 |
| ChEBI | CHEBI:28235 |
| Synonym | p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine |
| SMIL | COC1=CC=C(C=C1)C=O |
| IUPAC navn | 4-methoxybenzaldehyd |
| InChI nøgle | ZRSNZINYAWTAHE-UHFFFAOYSA-N |
| Molekylær formel | C8H8O2 |
2-Phenoxyethanol, 99%
CAS: 122-99-6 Molekylær formel: C8H10O2 Molekylvægt (g/mol): 138.17 MDL nummer: MFCD00002857 InChI nøgle: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC navn: 2-phenoxyethanol SMIL: C1=CC=C(C=C1)OCCO
| MDL nummer | MFCD00002857 |
|---|---|
| PubChem CID | 31236 |
| Molekylvægt (g/mol) | 138.17 |
| CAS | 122-99-6 |
| ChEBI | CHEBI:64275 |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
| SMIL | C1=CC=C(C=C1)OCCO |
| IUPAC navn | 2-phenoxyethanol |
| InChI nøgle | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
| Molekylær formel | C8H10O2 |
4-Aminobenzoesyre, 99%
CAS: 150-13-0 Molekylær formel: C7H7NO2 Molekylvægt (g/mol): 137.14 MDL nummer: MFCD00007894 InChI nøgle: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC navn: 4-aminobenzoesyre SMIL: NC1=CC=C(C=C1)C(O)=O
| MDL nummer | MFCD00007894 |
|---|---|
| PubChem CID | 978 |
| Molekylvægt (g/mol) | 137.14 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| SMIL | NC1=CC=C(C=C1)C(O)=O |
| IUPAC navn | 4-aminobenzoesyre |
| InChI nøgle | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
| Molekylær formel | C7H7NO2 |
4-Dimethylaminobenzaldehyd, ACS-reagens
CAS: 100-10-7 Molekylær formel: C9H11NO Molekylvægt (g/mol): 149.19 MDL nummer: MFCD00003381 InChI nøgle: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC navn: 4-(dimethylamino)benzaldehyd SMIL: CN(C)C1=CC=C(C=O)C=C1
| MDL nummer | MFCD00003381 |
|---|---|
| PubChem CID | 7479 |
| Molekylvægt (g/mol) | 149.19 |
| CAS | 100-10-7 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| SMIL | CN(C)C1=CC=C(C=O)C=C1 |
| IUPAC navn | 4-(dimethylamino)benzaldehyd |
| InChI nøgle | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
| Molekylær formel | C9H11NO |
trans-Anethole, 99%
CAS: 4180-23-8 Molekylær formel: C10H12O Molekylvægt (g/mol): 148.2 MDL nummer: MFCD00009284 InChI nøgle: RUVINXPYWBROJD-ONEGZZNKSA-N Synonym: anethole,trans-anethole,e-anethole,4-propenylanisole,anise camphor,trans-anethol,isoestragole,e-1-methoxy-4-prop-1-en-1-yl benzene,anethol,p-anethole PubChem CID: 637563 ChEBI: CHEBI:35616 IUPAC navn: 1-methoxy-4-[(E)-prop-1-enyl]benzen SMIL: CC=CC1=CC=C(C=C1)OC
| MDL nummer | MFCD00009284 |
|---|---|
| PubChem CID | 637563 |
| Molekylvægt (g/mol) | 148.2 |
| CAS | 4180-23-8 |
| ChEBI | CHEBI:35616 |
| Synonym | anethole,trans-anethole,e-anethole,4-propenylanisole,anise camphor,trans-anethol,isoestragole,e-1-methoxy-4-prop-1-en-1-yl benzene,anethol,p-anethole |
| SMIL | CC=CC1=CC=C(C=C1)OC |
| IUPAC navn | 1-methoxy-4-[(E)-prop-1-enyl]benzen |
| InChI nøgle | RUVINXPYWBROJD-ONEGZZNKSA-N |
| Molekylær formel | C10H12O |
Benzoesyre, 99%, ekstra ren
CAS: 65-85-0 Molekylær formel: C7H6O2 Molekylvægt (g/mol): 122.12 MDL nummer: MFCD00002398 InChI nøgle: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC navn: benzoesyre SMIL: C1=CC=C(C=C1)C(=O)O
| MDL nummer | MFCD00002398 |
|---|---|
| PubChem CID | 243 |
| Molekylvægt (g/mol) | 122.12 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| SMIL | C1=CC=C(C=C1)C(=O)O |
| IUPAC navn | benzoesyre |
| InChI nøgle | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molekylær formel | C7H6O2 |
Natriumsalicylat, 99%
CAS: 54-21-7 Molekylær formel: C7H5NaO3 Molekylvægt (g/mol): 160.104 MDL nummer: MFCD00002440 InChI nøgle: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC navn: natrium;2-hydroxybenzoat SMIL: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| MDL nummer | MFCD00002440 |
|---|---|
| PubChem CID | 16760658 |
| Molekylvægt (g/mol) | 160.104 |
| CAS | 54-21-7 |
| ChEBI | CHEBI:9180 |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| SMIL | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| IUPAC navn | natrium;2-hydroxybenzoat |
| InChI nøgle | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molekylær formel | C7H5NaO3 |
Thermo Scientific Chemicals Grundlæggende Fuchsin
CAS: 632-99-5 Molekylær formel: C20H20ClN3 Molekylvægt (g/mol): 337.85 MDL nummer: MFCD00012569 InChI nøgle: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC navn: 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-yliden)methyl]anilin;hydrochlorid SMIL: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
| MDL nummer | MFCD00012569 |
|---|---|
| PubChem CID | 12447 |
| Molekylvægt (g/mol) | 337.85 |
| CAS | 632-99-5 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| SMIL | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| IUPAC navn | 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-yliden)methyl]anilin;hydrochlorid |
| InChI nøgle | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
| Molekylær formel | C20H20ClN3 |
Dithizone, 98%
CAS: 60-10-6 Molekylær formel: C13H12N4S Molekylvægt (g/mol): 256.33 MDL nummer: MFCD00003025 InChI nøgle: UOFGSWVZMUXXIY-UHFFFAOYSA-N Synonym: dithizone,dithizon,ditizon,carbazone, diphenylthio,usaf ek-3092,diazenecarbothioic acid, phenyl-, 2-phenylhydrazide,1,5-diphenyl-3-mercaptoformazan,3-formazanthiol, 1,5-diphenyl,unii-njz2cj4d6p,1,5-diphenyl-3-thiocarbazone PubChem CID: 657262 SMIL: S=C(NNC1=CC=CC=C1)N=NC1=CC=CC=C1
| MDL nummer | MFCD00003025 |
|---|---|
| PubChem CID | 657262 |
| Molekylvægt (g/mol) | 256.33 |
| CAS | 60-10-6 |
| Synonym | dithizone,dithizon,ditizon,carbazone, diphenylthio,usaf ek-3092,diazenecarbothioic acid, phenyl-, 2-phenylhydrazide,1,5-diphenyl-3-mercaptoformazan,3-formazanthiol, 1,5-diphenyl,unii-njz2cj4d6p,1,5-diphenyl-3-thiocarbazone |
| SMIL | S=C(NNC1=CC=CC=C1)N=NC1=CC=CC=C1 |
| InChI nøgle | UOFGSWVZMUXXIY-UHFFFAOYSA-N |
| Molekylær formel | C13H12N4S |
DL-alfa-methoxyphenyleddikesyre, 99 %
CAS: 7021-09-2 Molekylær formel: C9H10O3 Molekylvægt (g/mol): 166.18 InChI nøgle: DIWVBIXQCNRCFE-UHFFFAOYNA-N Synonym: methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid PubChem CID: 107202 IUPAC navn: 2-methoxy-2-phenyleddikesyre SMIL: COC(C1=CC=CC=C1)C(=O)O
| PubChem CID | 107202 |
|---|---|
| Molekylvægt (g/mol) | 166.18 |
| CAS | 7021-09-2 |
| Synonym | methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid |
| SMIL | COC(C1=CC=CC=C1)C(=O)O |
| IUPAC navn | 2-methoxy-2-phenyleddikesyre |
| InChI nøgle | DIWVBIXQCNRCFE-UHFFFAOYNA-N |
| Molekylær formel | C9H10O3 |
Thermo Scientific Chemicals Tetrabromphenolphtalein ethylester, ren
CAS: 1176-74-5 Molekylær formel: C22H14Br4O4 Molekylvægt (g/mol): 661.96 MDL nummer: MFCD00066387 InChI nøgle: SQFXATUXPUCFFO-UHFFFAOYSA-N Synonym: tetrabromophenolphthalein ethyl ester,3',3,5',5-tetrabromophenolphthalein ethyl ester,ethyl tetrabromophenolphthalein,unii-6d91ns781o,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl benzoate,3 inverted exclamation marka,3 inverted exclamation marka,5 inverted exclamation marka,5 inverted exclamation marka-tetrabromophenolphthalein ethyl ester,benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester,benzoic acid,2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-,ethyl ester,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene methyl benzoate PubChem CID: 92873 IUPAC navn: ethyl-2-[(3,5-dibrom-4-hydroxyphenyl)-(3,5-dibrom-4-oxocyclohexa-2,5-dien-1-yliden)methyl]benzoat SMIL: CCOC(=O)C1=CC=CC=C1C(=C2C=C(C(=O)C(=C2)Br)Br)C3=CC(=C(C(=C3)Br)O)Br
| MDL nummer | MFCD00066387 |
|---|---|
| PubChem CID | 92873 |
| Molekylvægt (g/mol) | 661.96 |
| CAS | 1176-74-5 |
| Synonym | tetrabromophenolphthalein ethyl ester,3',3,5',5-tetrabromophenolphthalein ethyl ester,ethyl tetrabromophenolphthalein,unii-6d91ns781o,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl benzoate,3 inverted exclamation marka,3 inverted exclamation marka,5 inverted exclamation marka,5 inverted exclamation marka-tetrabromophenolphthalein ethyl ester,benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester,benzoic acid,2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-,ethyl ester,ethyl 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene methyl benzoate |
| SMIL | CCOC(=O)C1=CC=CC=C1C(=C2C=C(C(=O)C(=C2)Br)Br)C3=CC(=C(C(=C3)Br)O)Br |
| IUPAC navn | ethyl-2-[(3,5-dibrom-4-hydroxyphenyl)-(3,5-dibrom-4-oxocyclohexa-2,5-dien-1-yliden)methyl]benzoat |
| InChI nøgle | SQFXATUXPUCFFO-UHFFFAOYSA-N |
| Molekylær formel | C22H14Br4O4 |
p-Toluensulfonyl isocyanat, 96%
CAS: 4083-64-1 Molekylær formel: C8H7NO3S Molekylvægt (g/mol): 197.21 MDL nummer: MFCD00002030 InChI nøgle: VLJQDHDVZJXNQL-UHFFFAOYSA-N Synonym: tosyl isocyanate,p-toluenesulfonyl isocyanate,4-methylbenzenesulfonyl isocyanate,p-toluenesulphonyl isocyanate,benzenesulfonyl isocyanate, 4-methyl,tosylisocyanate,p-tolylsulfonyl isocyanate,unii-h9004fjx6v,p-toluenesulfonic acid, anhydride with isocyanic acid,p-toluene sulfonyl isocyanate PubChem CID: 77703 IUPAC navn: 4-methyl-N-(oxomethyliden)benzensulfonamid SMIL: CC1=CC=C(C=C1)S(=O)(=O)N=C=O
| MDL nummer | MFCD00002030 |
|---|---|
| PubChem CID | 77703 |
| Molekylvægt (g/mol) | 197.21 |
| CAS | 4083-64-1 |
| Synonym | tosyl isocyanate,p-toluenesulfonyl isocyanate,4-methylbenzenesulfonyl isocyanate,p-toluenesulphonyl isocyanate,benzenesulfonyl isocyanate, 4-methyl,tosylisocyanate,p-tolylsulfonyl isocyanate,unii-h9004fjx6v,p-toluenesulfonic acid, anhydride with isocyanic acid,p-toluene sulfonyl isocyanate |
| SMIL | CC1=CC=C(C=C1)S(=O)(=O)N=C=O |
| IUPAC navn | 4-methyl-N-(oxomethyliden)benzensulfonamid |
| InChI nøgle | VLJQDHDVZJXNQL-UHFFFAOYSA-N |
| Molekylær formel | C8H7NO3S |
Benzoesyre, 99,6%, ACS-reagens
CAS: 65-85-0 Molekylær formel: C7H6O2 Molekylvægt (g/mol): 122.12 InChI nøgle: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC navn: benzoesyre SMIL: C1=CC=C(C=C1)C(=O)O
| PubChem CID | 243 |
|---|---|
| Molekylvægt (g/mol) | 122.12 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| SMIL | C1=CC=C(C=C1)C(=O)O |
| IUPAC navn | benzoesyre |
| InChI nøgle | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molekylær formel | C7H6O2 |