Carboxylsyreestere
Filtrerede søgeresultater
2(5H)-Furanone, 96%
CAS: 497-23-4 Molekylær formel: C4H4O2 Molekylvægt (g/mol): 84.07 MDL nummer: MFCD00005376 InChI nøgle: VIHAEDVKXSOUAT-UHFFFAOYSA-N Synonym: 2 5h-furanone,furan-2 5h-one,butenolide,2-butenolide,gamma-crotonolactone,2-buten-4-olide,isocrotonolactone,2-oxo-2,5-dihydrofuran,crotonolactone,2-5h-furanone PubChem CID: 10341 ChEBI: CHEBI:38118 IUPAC navn: 2H-furan-5-on SMIL: O=C1OCC=C1
| MDL nummer | MFCD00005376 |
|---|---|
| PubChem CID | 10341 |
| Molekylvægt (g/mol) | 84.07 |
| CAS | 497-23-4 |
| ChEBI | CHEBI:38118 |
| Synonym | 2 5h-furanone,furan-2 5h-one,butenolide,2-butenolide,gamma-crotonolactone,2-buten-4-olide,isocrotonolactone,2-oxo-2,5-dihydrofuran,crotonolactone,2-5h-furanone |
| SMIL | O=C1OCC=C1 |
| IUPAC navn | 2H-furan-5-on |
| InChI nøgle | VIHAEDVKXSOUAT-UHFFFAOYSA-N |
| Molekylær formel | C4H4O2 |
Methylmethacrylat, 99%, stabiliseret, Thermo Scientific Chemicals
CAS: 80-62-6 Molekylær formel: C5H8O2 Molekylvægt (g/mol): 100.12 MDL nummer: MFCD00008587 InChI nøgle: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC navn: methyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OC
| MDL nummer | MFCD00008587 |
|---|---|
| PubChem CID | 6658 |
| Molekylvægt (g/mol) | 100.12 |
| CAS | 80-62-6 |
| ChEBI | CHEBI:34840 |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| SMIL | CC(=C)C(=O)OC |
| IUPAC navn | methyl-2-methylprop-2-enoat |
| InChI nøgle | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molekylær formel | C5H8O2 |
Isopropenylacetat, 99 %, Thermo Scientific Chemicals
CAS: 108-22-5 Molekylær formel: C5H8O2 Molekylvægt (g/mol): 100.12 MDL nummer: MFCD00008709 InChI nøgle: HETCEOQFVDFGSY-UHFFFAOYSA-N Synonym: isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate PubChem CID: 7916 IUPAC navn: prop-1-en-2-ylacetat SMIL: CC(=C)OC(C)=O
| MDL nummer | MFCD00008709 |
|---|---|
| PubChem CID | 7916 |
| Molekylvægt (g/mol) | 100.12 |
| CAS | 108-22-5 |
| Synonym | isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate |
| SMIL | CC(=C)OC(C)=O |
| IUPAC navn | prop-1-en-2-ylacetat |
| InChI nøgle | HETCEOQFVDFGSY-UHFFFAOYSA-N |
| Molekylær formel | C5H8O2 |
Methylmethoxyacetat, 99 %, Thermo Scientific Chemicals
CAS: 6290-49-9 Molekylær formel: C4H8O3 Molekylvægt (g/mol): 104.11 MDL nummer: MFCD00008451 InChI nøgle: QRMHDGWGLNLHMN-UHFFFAOYSA-N Synonym: methyl methoxyacetate,acetic acid, methoxy-, methyl ester,methoxyacetic acid methyl ester,methyl-2-methoxyacetate,methoxyacetic acid, methyl ester,acetic acid, 2-methoxy-, methyl ester,unii-n960nq69lf,methoxy acetic acid methyl ester,methyl metoxyacetate,methyl methoxylacetate PubChem CID: 80507 ChEBI: CHEBI:34841 IUPAC navn: methyl-2-methoxyacetat SMIL: COCC(=O)OC
| MDL nummer | MFCD00008451 |
|---|---|
| PubChem CID | 80507 |
| Molekylvægt (g/mol) | 104.11 |
| CAS | 6290-49-9 |
| ChEBI | CHEBI:34841 |
| Synonym | methyl methoxyacetate,acetic acid, methoxy-, methyl ester,methoxyacetic acid methyl ester,methyl-2-methoxyacetate,methoxyacetic acid, methyl ester,acetic acid, 2-methoxy-, methyl ester,unii-n960nq69lf,methoxy acetic acid methyl ester,methyl metoxyacetate,methyl methoxylacetate |
| SMIL | COCC(=O)OC |
| IUPAC navn | methyl-2-methoxyacetat |
| InChI nøgle | QRMHDGWGLNLHMN-UHFFFAOYSA-N |
| Molekylær formel | C4H8O3 |
Methyl tiglate, 98%
CAS: 6622-76-0 Molekylær formel: C6H10O2 Molekylvægt (g/mol): 114.14 MDL nummer: MFCD00016654 InChI nøgle: YYJWBYNQJLBIGS-PLNGDYQASA-N Synonym: methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e PubChem CID: 5323652 IUPAC navn: methyl-(E)-2-methylbut-2-enoat SMIL: COC(=O)C(\C)=C/C
| MDL nummer | MFCD00016654 |
|---|---|
| PubChem CID | 5323652 |
| Molekylvægt (g/mol) | 114.14 |
| CAS | 6622-76-0 |
| Synonym | methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e |
| SMIL | COC(=O)C(\C)=C/C |
| IUPAC navn | methyl-(E)-2-methylbut-2-enoat |
| InChI nøgle | YYJWBYNQJLBIGS-PLNGDYQASA-N |
| Molekylær formel | C6H10O2 |
2-Hydroxyethyl methacrylate, 97%, stab. with 4-methoxyphenol
CAS: 868-77-9 Molekylær formel: C6H10O3 Molekylvægt (g/mol): 130.143 MDL nummer: MFCD00002863 InChI nøgle: WOBHKFSMXKNTIM-UHFFFAOYSA-N Synonym: 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 PubChem CID: 13360 ChEBI: CHEBI:34288 IUPAC navn: 2-hydroxyethyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCCO
| MDL nummer | MFCD00002863 |
|---|---|
| PubChem CID | 13360 |
| Molekylvægt (g/mol) | 130.143 |
| CAS | 868-77-9 |
| ChEBI | CHEBI:34288 |
| Synonym | 2-hydroxyethyl methacrylate,glycol methacrylate,hydroxyethyl methacrylate,glycol monomethacrylate,hema,ethylene glycol methacrylate,2-methacryloyloxy ethanol,2-hydroxyethylmethacrylate,mhoromer,monomer mg-1 |
| SMIL | CC(=C)C(=O)OCCO |
| IUPAC navn | 2-hydroxyethyl-2-methylprop-2-enoat |
| InChI nøgle | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| Molekylær formel | C6H10O3 |
Methyl pyruvate, 98%
CAS: 600-22-6 Molekylær formel: C4H6O3 Molekylvægt (g/mol): 102.089 MDL nummer: MFCD00008754 InChI nøgle: CWKLZLBVOJRSOM-UHFFFAOYSA-N Synonym: methyl pyruvate,pyruvic acid, methyl ester,pyruvic acid methyl ester,methyl 2-oxopropionate,propanoic acid, 2-oxo-, methyl ester,methyl-pyruvate,methylglyoxylic acid methyl ester,unii-3kjm65g5xl,3kjm65g5xl,2-oxo-propionic acid methyl ester PubChem CID: 11748 ChEBI: CHEBI:51850 IUPAC navn: methyl-2-oxopropanoat SMIL: CC(=O)C(=O)OC
| MDL nummer | MFCD00008754 |
|---|---|
| PubChem CID | 11748 |
| Molekylvægt (g/mol) | 102.089 |
| CAS | 600-22-6 |
| ChEBI | CHEBI:51850 |
| Synonym | methyl pyruvate,pyruvic acid, methyl ester,pyruvic acid methyl ester,methyl 2-oxopropionate,propanoic acid, 2-oxo-, methyl ester,methyl-pyruvate,methylglyoxylic acid methyl ester,unii-3kjm65g5xl,3kjm65g5xl,2-oxo-propionic acid methyl ester |
| SMIL | CC(=O)C(=O)OC |
| IUPAC navn | methyl-2-oxopropanoat |
| InChI nøgle | CWKLZLBVOJRSOM-UHFFFAOYSA-N |
| Molekylær formel | C4H6O3 |
Ethylenglycoldimethacrylat, 98%, stab. med 100 ppm 4-methoxyphenol, Thermo Scientific Chemicals
CAS: 97-90-5 Molekylær formel: C10H14O4 Molekylvægt (g/mol): 198.22 MDL nummer: MFCD00008590 InChI nøgle: STVZJERGLQHEKB-UHFFFAOYSA-N Synonym: ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate PubChem CID: 7355 ChEBI: CHEBI:53436 IUPAC navn: 2-(2-methylprop-2-enoyloxy)ethyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCCOC(=O)C(C)=C
| MDL nummer | MFCD00008590 |
|---|---|
| PubChem CID | 7355 |
| Molekylvægt (g/mol) | 198.22 |
| CAS | 97-90-5 |
| ChEBI | CHEBI:53436 |
| Synonym | ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate |
| SMIL | CC(=C)C(=O)OCCOC(=O)C(C)=C |
| IUPAC navn | 2-(2-methylprop-2-enoyloxy)ethyl-2-methylprop-2-enoat |
| InChI nøgle | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Molekylær formel | C10H14O4 |
Hydroxypropyl methacrylate, mixture of isomers, 97+%, stab. with ca 0.02% 4-methoxyphenol
CAS: 27813-02-1 Molekylær formel: C7H12O3 Molekylvægt (g/mol): 144.17 MDL nummer: MFCD00004536 InChI nøgle: ZMARGGQEAJXRFP-UHFFFAOYNA-N Synonym: 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma PubChem CID: 13539 ChEBI: CHEBI:53440 IUPAC navn: 2-hydroxypropyl-2-methylprop-2-enoat SMIL: CC(CO)OC(=O)C(C)=C
| MDL nummer | MFCD00004536 |
|---|---|
| PubChem CID | 13539 |
| Molekylvægt (g/mol) | 144.17 |
| CAS | 27813-02-1 |
| ChEBI | CHEBI:53440 |
| Synonym | 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma |
| SMIL | CC(CO)OC(=O)C(C)=C |
| IUPAC navn | 2-hydroxypropyl-2-methylprop-2-enoat |
| InChI nøgle | ZMARGGQEAJXRFP-UHFFFAOYNA-N |
| Molekylær formel | C7H12O3 |
Vinylacetat, 99%, stab. med 8-12 ppm hydroquinon, Thermo Scientific Chemicals
CAS: 108-05-4 Molekylær formel: C4H6O2 Molekylvægt (g/mol): 86.09 MDL nummer: MFCD00008713 InChI nøgle: XTXRWKRVRITETP-UHFFFAOYSA-N Synonym: vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer PubChem CID: 7904 ChEBI: CHEBI:46916 IUPAC navn: ethenylacetat SMIL: CC(=O)OC=C
| MDL nummer | MFCD00008713 |
|---|---|
| PubChem CID | 7904 |
| Molekylvægt (g/mol) | 86.09 |
| CAS | 108-05-4 |
| ChEBI | CHEBI:46916 |
| Synonym | vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer |
| SMIL | CC(=O)OC=C |
| IUPAC navn | ethenylacetat |
| InChI nøgle | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Molekylær formel | C4H6O2 |
2,2,3,4,4,4-Hexafluorobutyl methacrylate, 96%, stab.
CAS: 36405-47-7 Molekylær formel: C8H8F6O2 Molekylvægt (g/mol): 250.14 MDL nummer: MFCD00042311 InChI nøgle: DFVPUWGVOPDJTC-UHFFFAOYSA-N Synonym: 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer PubChem CID: 549772 IUPAC navn: 2,2,3,4,4,4-hexafluorbutyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F
| MDL nummer | MFCD00042311 |
|---|---|
| PubChem CID | 549772 |
| Molekylvægt (g/mol) | 250.14 |
| CAS | 36405-47-7 |
| Synonym | 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer |
| SMIL | CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| IUPAC navn | 2,2,3,4,4,4-hexafluorbutyl-2-methylprop-2-enoat |
| InChI nøgle | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| Molekylær formel | C8H8F6O2 |
Ethyl 4-bromocrotonate, tech. 80%
CAS: 37746-78-4 Molekylær formel: C6H9BrO2 Molekylvægt (g/mol): 193.04 MDL nummer: MFCD00000247 InChI nøgle: FHGRPBSDPBRTLS-ONEGZZNKSA-N Synonym: ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate PubChem CID: 5373944 IUPAC navn: ethyl-(E)-4-brombut-2-enoat SMIL: CCOC(=O)C=CCBr
| MDL nummer | MFCD00000247 |
|---|---|
| PubChem CID | 5373944 |
| Molekylvægt (g/mol) | 193.04 |
| CAS | 37746-78-4 |
| Synonym | ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate |
| SMIL | CCOC(=O)C=CCBr |
| IUPAC navn | ethyl-(E)-4-brombut-2-enoat |
| InChI nøgle | FHGRPBSDPBRTLS-ONEGZZNKSA-N |
| Molekylær formel | C6H9BrO2 |
Methyl 2-fluoroacrylate, 95%, stab. with 1% BHT
CAS: 2343-89-7 Molekylær formel: C4H5FO2 Molekylvægt (g/mol): 104.08 MDL nummer: MFCD04039286 InChI nøgle: ZTZJVAOTIOAZGZ-UHFFFAOYSA-N Synonym: methyl 2-fluoroacrylate,methyl-2-fluoroacrylate,2-fluoroacrylic acid methyl ester,methyl fluoroacrylate,2-propenoic acid, 2-fluoro-, methyl ester,methyl a-fluoroacrylate,pubchem12658,methyl alpha-fluoroacrylate,acmc-209g3b,ksc493a9d PubChem CID: 2782524 IUPAC navn: methyl-2-fluorprop-2-enoat SMIL: COC(=O)C(=C)F
| MDL nummer | MFCD04039286 |
|---|---|
| PubChem CID | 2782524 |
| Molekylvægt (g/mol) | 104.08 |
| CAS | 2343-89-7 |
| Synonym | methyl 2-fluoroacrylate,methyl-2-fluoroacrylate,2-fluoroacrylic acid methyl ester,methyl fluoroacrylate,2-propenoic acid, 2-fluoro-, methyl ester,methyl a-fluoroacrylate,pubchem12658,methyl alpha-fluoroacrylate,acmc-209g3b,ksc493a9d |
| SMIL | COC(=O)C(=C)F |
| IUPAC navn | methyl-2-fluorprop-2-enoat |
| InChI nøgle | ZTZJVAOTIOAZGZ-UHFFFAOYSA-N |
| Molekylær formel | C4H5FO2 |
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate, 97%, stab.
CAS: 13695-31-3 Molekylær formel: C8H7F7O2 Molekylvægt (g/mol): 268.131 MDL nummer: MFCD00039251 InChI nøgle: VIEHKBXCWMMOOU-UHFFFAOYSA-N Synonym: heptafluorobutyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl methacrylate,1h,1h-heptafluorobutyl methacrylate,1h,1h-heptafluoro-n-butyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid 2,2,3,3,4,4,4-heptafluorobutyl ester,heptafluoropropylmethyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl 2-methylacrylate # PubChem CID: 83666 IUPAC navn: 2,2,3,3,4,4,4-heptafluorbutyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F
| MDL nummer | MFCD00039251 |
|---|---|
| PubChem CID | 83666 |
| Molekylvægt (g/mol) | 268.131 |
| CAS | 13695-31-3 |
| Synonym | heptafluorobutyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl methacrylate,1h,1h-heptafluorobutyl methacrylate,1h,1h-heptafluoro-n-butyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid 2,2,3,3,4,4,4-heptafluorobutyl ester,heptafluoropropylmethyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl 2-methylacrylate # |
| SMIL | CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F |
| IUPAC navn | 2,2,3,3,4,4,4-heptafluorbutyl-2-methylprop-2-enoat |
| InChI nøgle | VIEHKBXCWMMOOU-UHFFFAOYSA-N |
| Molekylær formel | C8H7F7O2 |
2,2,3,3,3-Pentafluoropropyl methacrylate, 97%, stab.
CAS: 45115-53-5 Molekylær formel: C7H7F5O2 Molekylvægt (g/mol): 218.123 MDL nummer: MFCD00039256 InChI nøgle: CLISWDZSTWQFNX-UHFFFAOYSA-N Synonym: 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 123516 IUPAC navn: 2,2,3,3,3-pentafluorpropyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCC(C(F)(F)F)(F)F
| MDL nummer | MFCD00039256 |
|---|---|
| PubChem CID | 123516 |
| Molekylvægt (g/mol) | 218.123 |
| CAS | 45115-53-5 |
| Synonym | 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| SMIL | CC(=C)C(=O)OCC(C(F)(F)F)(F)F |
| IUPAC navn | 2,2,3,3,3-pentafluorpropyl-2-methylprop-2-enoat |
| InChI nøgle | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| Molekylær formel | C7H7F5O2 |