Organiske syrer og derivater
Filtrerede søgeresultater
Urea, 99.5%, for analysis
CAS: 57-13-6 Molekylær formel: CH4N2O Molekylvægt (g/mol): 60.06 InChI nøgle: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC navn: urinstof SMIL: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| Molekylvægt (g/mol) | 60.06 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| SMIL | C(=O)(N)N |
| IUPAC navn | urinstof |
| InChI nøgle | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molekylær formel | CH4N2O |
Methyl formate, 98%, for spectroscopy
CAS: 107-31-3 Molekylær formel: C2H4O2 Molekylvægt (g/mol): 60.05 MDL nummer: MFCD00003291 InChI nøgle: TZIHFWKZFHZASV-UHFFFAOYSA-N Synonym: formic acid, methyl ester,methyl methanoate,methylformiat,formic acid methyl ester,formiate de methyle,methylformiaat,mravencan methylnaty,methylformate,caswell no. 570,hcooch3 PubChem CID: 7865 ChEBI: CHEBI:77699 IUPAC navn: methylformiat SMIL: COC=O
| MDL nummer | MFCD00003291 |
|---|---|
| PubChem CID | 7865 |
| Molekylvægt (g/mol) | 60.05 |
| CAS | 107-31-3 |
| ChEBI | CHEBI:77699 |
| Synonym | formic acid, methyl ester,methyl methanoate,methylformiat,formic acid methyl ester,formiate de methyle,methylformiaat,mravencan methylnaty,methylformate,caswell no. 570,hcooch3 |
| SMIL | COC=O |
| IUPAC navn | methylformiat |
| InChI nøgle | TZIHFWKZFHZASV-UHFFFAOYSA-N |
| Molekylær formel | C2H4O2 |
Isopropyl acetate, 99+%, for analysis
CAS: 108-21-4 Molekylær formel: C5H10O2 Molekylvægt (g/mol): 102.13 MDL nummer: MFCD00008877 InChI nøgle: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC navn: propan-2-ylacetat SMIL: CC(C)OC(=O)C
| MDL nummer | MFCD00008877 |
|---|---|
| PubChem CID | 7915 |
| Molekylvægt (g/mol) | 102.13 |
| CAS | 108-21-4 |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| SMIL | CC(C)OC(=O)C |
| IUPAC navn | propan-2-ylacetat |
| InChI nøgle | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molekylær formel | C5H10O2 |
n-Butyl acetate, 99+%, for spectroscopy
CAS: 123-86-4 Molekylær formel: C6H12O2 Molekylvægt (g/mol): 116.16 MDL nummer: MFCD00009445 InChI nøgle: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC navn: butylacetat SMIL: CCCCOC(C)=O
| MDL nummer | MFCD00009445 |
|---|---|
| PubChem CID | 31272 |
| Molekylvægt (g/mol) | 116.16 |
| CAS | 123-86-4 |
| ChEBI | CHEBI:31328 |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| SMIL | CCCCOC(C)=O |
| IUPAC navn | butylacetat |
| InChI nøgle | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molekylær formel | C6H12O2 |
Citric acid, monosodium salt, 99%, for analysis, anhydrous
CAS: 18996-35-5 Molekylær formel: C6H7NaO7 Molekylvægt (g/mol): 214.11 InChI nøgle: SLWOXBQHKZPUNY-UHFFFAOYSA-N Synonym: bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? PubChem CID: 131675399 IUPAC navn: 2-hydroxypropan-1,2,3-tricarboxylsyre; molekylært hydrogen; natrium SMIL: [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na]
| PubChem CID | 131675399 |
|---|---|
| Molekylvægt (g/mol) | 214.11 |
| CAS | 18996-35-5 |
| Synonym | bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? |
| SMIL | [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na] |
| IUPAC navn | 2-hydroxypropan-1,2,3-tricarboxylsyre; molekylært hydrogen; natrium |
| InChI nøgle | SLWOXBQHKZPUNY-UHFFFAOYSA-N |
| Molekylær formel | C6H7NaO7 |
Sodium oxalate, 99.5%, for analysis, Thermo Scientific Chemicals
CAS: 62-76-0 Molekylær formel: C2Na2O4 Molekylvægt (g/mol): 134.00 MDL nummer: MFCD00012465 InChI nøgle: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC navn: dinatrium;oxalat SMIL: [Na+].[Na+].[O-]C(=O)C([O-])=O
| MDL nummer | MFCD00012465 |
|---|---|
| PubChem CID | 6125 |
| Molekylvægt (g/mol) | 134.00 |
| CAS | 62-76-0 |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| SMIL | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| IUPAC navn | dinatrium;oxalat |
| InChI nøgle | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molekylær formel | C2Na2O4 |
n-Butyl acetate, 99.5%, for biochemistry, AcroSeal™
CAS: 123-86-4 Molekylær formel: C6H12O2 Molekylvægt (g/mol): 116.16 MDL nummer: MFCD00009445 InChI nøgle: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC navn: butylacetat SMIL: CCCCOC(C)=O
| MDL nummer | MFCD00009445 |
|---|---|
| PubChem CID | 31272 |
| Molekylvægt (g/mol) | 116.16 |
| CAS | 123-86-4 |
| ChEBI | CHEBI:31328 |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| SMIL | CCCCOC(C)=O |
| IUPAC navn | butylacetat |
| InChI nøgle | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molekylær formel | C6H12O2 |
N,N-Dimethylformamide, 99.9%, for biochemistry, AcroSeal™
CAS: 68-12-2 Molekylær formel: C3H7NO Molekylvægt (g/mol): 73.10 MDL nummer: MFCD00003284 InChI nøgle: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC navn: N,N-dimethylformamid SMIL: CN(C)C=O
| MDL nummer | MFCD00003284 |
|---|---|
| PubChem CID | 6228 |
| Molekylvægt (g/mol) | 73.10 |
| CAS | 68-12-2 |
| ChEBI | CHEBI:17741 |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| SMIL | CN(C)C=O |
| IUPAC navn | N,N-dimethylformamid |
| InChI nøgle | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molekylær formel | C3H7NO |
Sodium oxalate, For ACS analysis, 99.96%, MP Biomedicals™
Molekylær formel: C2Na2O4 Molekylvægt (g/mol): 134 MDL nummer: MFCD00012465 InChI nøgle: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC navn: dinatriumoxalat SMIL: [Na+].[Na+].[O-]C(=O)C([O-])=O
| MDL nummer | MFCD00012465 |
|---|---|
| PubChem CID | 6125 |
| Molekylvægt (g/mol) | 134 |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| SMIL | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| IUPAC navn | dinatriumoxalat |
| InChI nøgle | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molekylær formel | C2Na2O4 |
1-Heptanesulfonic acid sodium salt monohydrate, HPLC grade
Greener Choice Product
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
This product offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More About the Greener Choice Program
CAS: 207300-90-1 InChI nøgle: XWZCREJRXRKIRQ-UHFFFAOYSA-M Synonym: sodium heptane-1-sulfonate hydrate,1-heptanesulfonic acid sodium salt monohydrate,sodium 1-heptanesulfonate monohydrate,sodium 1-heptanesulfonate hydrate,sodium1-heptanesulfonatemonohydrate,potassium heptane-1-sulfonate hydrate,sodium heptane-1-sulfonate-water 1/1/1,sodium 1-heptanesulfonate monohydrate t,sodium 1-heptanesulfonate monohydrate, for hplc PubChem CID: 23687711 IUPAC navn: natrium;heptan-1-sulfonat;hydrat SMIL: CCCCCCCS(=O)(=O)[O-].O.[Na+]
| PubChem CID | 23687711 |
|---|---|
| CAS | 207300-90-1 |
| Synonym | sodium heptane-1-sulfonate hydrate,1-heptanesulfonic acid sodium salt monohydrate,sodium 1-heptanesulfonate monohydrate,sodium 1-heptanesulfonate hydrate,sodium1-heptanesulfonatemonohydrate,potassium heptane-1-sulfonate hydrate,sodium heptane-1-sulfonate-water 1/1/1,sodium 1-heptanesulfonate monohydrate t,sodium 1-heptanesulfonate monohydrate, for hplc |
| SMIL | CCCCCCCS(=O)(=O)[O-].O.[Na+] |
| IUPAC navn | natrium;heptan-1-sulfonat;hydrat |
| InChI nøgle | XWZCREJRXRKIRQ-UHFFFAOYSA-M |
Natrium 1-heptansulfonat monohydrat, 99%, Thermo Scientific Chemicals
CAS: 207300-90-1 Molekylær formel: C7H17NaO4S Molekylvægt (g/mol): 220.259 MDL nummer: MFCD00149550 InChI nøgle: XWZCREJRXRKIRQ-UHFFFAOYSA-M Synonym: sodium heptane-1-sulfonate hydrate,1-heptanesulfonic acid sodium salt monohydrate,sodium 1-heptanesulfonate monohydrate,sodium 1-heptanesulfonate hydrate,sodium1-heptanesulfonatemonohydrate,potassium heptane-1-sulfonate hydrate,sodium heptane-1-sulfonate-water 1/1/1,sodium 1-heptanesulfonate monohydrate t,sodium 1-heptanesulfonate monohydrate, for hplc PubChem CID: 23687711 IUPAC navn: natrium;heptan-1-sulfonat;hydrat SMIL: CCCCCCCS(=O)(=O)[O-].O.[Na+]
| MDL nummer | MFCD00149550 |
|---|---|
| PubChem CID | 23687711 |
| Molekylvægt (g/mol) | 220.259 |
| CAS | 207300-90-1 |
| Synonym | sodium heptane-1-sulfonate hydrate,1-heptanesulfonic acid sodium salt monohydrate,sodium 1-heptanesulfonate monohydrate,sodium 1-heptanesulfonate hydrate,sodium1-heptanesulfonatemonohydrate,potassium heptane-1-sulfonate hydrate,sodium heptane-1-sulfonate-water 1/1/1,sodium 1-heptanesulfonate monohydrate t,sodium 1-heptanesulfonate monohydrate, for hplc |
| SMIL | CCCCCCCS(=O)(=O)[O-].O.[Na+] |
| IUPAC navn | natrium;heptan-1-sulfonat;hydrat |
| InChI nøgle | XWZCREJRXRKIRQ-UHFFFAOYSA-M |
| Molekylær formel | C7H17NaO4S |
1,2-diaminocyclohexantetraeddikesyre monohydrat, Honeywell Fluka™
CAS: 145819-99-4 Molekylær formel: C14H24N2O9 Molekylvægt (g/mol): 364.351 MDL nummer: MFCD00150952 InChI nøgle: VASZYFIKPKYGNC-UHFFFAOYSA-N Synonym: cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky PubChem CID: 18674933 IUPAC navn: 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]eddikesyre;hydrat SMIL: C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O
| MDL nummer | MFCD00150952 |
|---|---|
| PubChem CID | 18674933 |
| Molekylvægt (g/mol) | 364.351 |
| CAS | 145819-99-4 |
| Synonym | cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky |
| SMIL | C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O |
| IUPAC navn | 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]eddikesyre;hydrat |
| InChI nøgle | VASZYFIKPKYGNC-UHFFFAOYSA-N |
| Molekylær formel | C14H24N2O9 |