Filtrerede søgeresultater
Jodopløsning 0,05 M (0,1 N), NIST Standardløsning klar til brug, til volumetrisk analyse, opfylder analytiske specifikationer fra Ph.Eur., BP, Fisher Chemical™
CAS: 7553-56-2 Molekylær formel: I2 Molekylvægt (g/mol): 253.81 MDL nummer: MFCD00011355 MFCD00164163 InChI nøgle: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC navn: molekylært jod SMIL: II
| MDL nummer | MFCD00011355 MFCD00164163 |
|---|---|
| PubChem CID | 807 |
| Molekylvægt (g/mol) | 253.81 |
| CAS | 7553-56-2 |
| ChEBI | CHEBI:17606 |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
| SMIL | II |
| IUPAC navn | molekylært jod |
| InChI nøgle | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molekylær formel | I2 |
Hydrogenperoxid 6 % (vægt/volumen) (20 volumener), ekstra rent spejlreflekskamera, Fisher Chemical™
CAS: 7722-84-1 Molekylær formel: H2O2 Molekylvægt (g/mol): 34.014 MDL nummer: 11333 InChI nøgle: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC navn: hydrogenperoxid SMIL: OO
| MDL nummer | 11333 |
|---|---|
| PubChem CID | 784 |
| Molekylvægt (g/mol) | 34.014 |
| CAS | 7722-84-1 |
| ChEBI | CHEBI:16240 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
| SMIL | OO |
| IUPAC navn | hydrogenperoxid |
| InChI nøgle | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| Molekylær formel | H2O2 |
Thermo Scientific Chemicals Ethidium bromid affarvningsposer, med aktiveringsopløsning.
Ethylendiamintetraeddikesyre (0,5 M opløsning/pH 8,0), Fisher BioReagents
CAS: 60-00-4 Molekylær formel: C10H16N2O8 Molekylvægt (g/mol): 292.24 MDL nummer: MFCD00003541 InChI nøgle: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC navn: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]eddikesyre SMIL: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| MDL nummer | MFCD00003541 |
|---|---|
| PubChem CID | 6049 |
| Molekylvægt (g/mol) | 292.24 |
| CAS | 60-00-4 |
| ChEBI | CHEBI:42191 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| SMIL | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| IUPAC navn | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]eddikesyre |
| InChI nøgle | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molekylær formel | C10H16N2O8 |
Sølvnitratopløsning 0,1M (0,1N), NIST Standardløsning klar til brug, til volumetrisk analyse, opfylder analytiske specifikationer for pH.Eur., Bp, Usp, Fisher Chemical™
CAS: 7761-88-8 Molekylær formel: AgNO3 Molekylvægt (g/mol): 169.87 MDL nummer: MFCD00003414 InChI nøgle: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC navn: sølv(1+)nitrat SMIL: [Ag+].[O-][N+]([O-])=O
| MDL nummer | MFCD00003414 |
|---|---|
| PubChem CID | 24470 |
| Molekylvægt (g/mol) | 169.87 |
| CAS | 7761-88-8 |
| ChEBI | CHEBI:32130 |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| SMIL | [Ag+].[O-][N+]([O-])=O |
| IUPAC navn | sølv(1+)nitrat |
| InChI nøgle | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molekylær formel | AgNO3 |
Hydrogenperoxid 30-32 % (vægt/vægt) (100 volumener), certificeret AR til analyse, Fisher Chemical™
CAS: 7722-84-1 Molekylær formel: H2O2 Molekylvægt (g/mol): 34.014 MDL nummer: 11333 InChI nøgle: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC navn: hydrogenperoxid SMIL: OO
| MDL nummer | 11333 |
|---|---|
| PubChem CID | 784 |
| Molekylvægt (g/mol) | 34.014 |
| CAS | 7722-84-1 |
| ChEBI | CHEBI:16240 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
| SMIL | OO |
| IUPAC navn | hydrogenperoxid |
| InChI nøgle | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| Molekylær formel | H2O2 |
Methyllithium, 1,6M sol. i diethylether (± 5 % vægt/volumen), AcroSeal™ , Thermo Scientific Chemicals
CAS: 917-54-4 Molekylær formel: CH3Li Molekylvægt (g/mol): 21.98 MDL nummer: MFCD00008253 InChI nøgle: DVSDBMFJEQPWNO-UHFFFAOYSA-N Synonym: methyllithium,lithium, methyl,methyl lithium,lithium methanide,meli,lithium methyl,lithium carbanide,lithium methide,methllithium,methyllithum PubChem CID: 2724049 SMIL: [Li]C
| MDL nummer | MFCD00008253 |
|---|---|
| PubChem CID | 2724049 |
| Molekylvægt (g/mol) | 21.98 |
| CAS | 917-54-4 |
| Synonym | methyllithium,lithium, methyl,methyl lithium,lithium methanide,meli,lithium methyl,lithium carbanide,lithium methide,methllithium,methyllithum |
| SMIL | [Li]C |
| InChI nøgle | DVSDBMFJEQPWNO-UHFFFAOYSA-N |
| Molekylær formel | CH3Li |
Blykoncentrat, 100 ppm, EP-kvalitet, Reagecon™
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Hydrogenperoxid 30 % (vægt/volumen) (100 volumener), ekstra rent spejlreflekskamera, Fisher Chemical™
CAS: 7722-84-1 Molekylær formel: H2O2 Molekylvægt (g/mol): 34.014 MDL nummer: 11333 InChI nøgle: MHAJPDPJQMAIIY-UHFFFAOYSA-N Synonym: oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone PubChem CID: 784 ChEBI: CHEBI:16240 IUPAC navn: hydrogenperoxid SMIL: OO
| MDL nummer | 11333 |
|---|---|
| PubChem CID | 784 |
| Molekylvægt (g/mol) | 34.014 |
| CAS | 7722-84-1 |
| ChEBI | CHEBI:16240 |
| Synonym | oxydol,perhydrol,superoxol,interox,hydrogen dioxide,inhibine,peroxaan,albone,hioxyl,kastone |
| SMIL | OO |
| IUPAC navn | hydrogenperoxid |
| InChI nøgle | MHAJPDPJQMAIIY-UHFFFAOYSA-N |
| Molekylær formel | H2O2 |
Borane-tetrahydrofuran complex, 1M solution in THF, Stabilized, AcroSeal™
CAS: 14044-65-6 | C4H11BO | 85.94 g/mol
| MDL nummer | MFCD00012429 |
|---|---|
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Sundhedsfare 2 | GHS H Statement May cause respiratory irritation. Causes serious eye damage. In contact with water releases flammable gases which may ignite spontaneously. Causes skin irritation. Harmful if swallowed. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides. May cause drowsiness or dizziness. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 85.94 |
| Emballage | AcroSeal™ Glasflaske |
| IUPAC navn | oxolan boran |
| Navn note | 1M solution in tetrahydrofuran, stabilized |
| PubChem CID | 11062302 |
| Molekylvægt (g/mol) | 85.94 |
| Tæthed | 0.8760g/mL |
| Fieser | 01,199; 02,106; 03,76; 04,124; 05,184; 06,161; 07,89; 12,65; 17,101 |
| SMIL | B.C1CCOC1 |
| Flammepunkt | −22°C |
| InChI nøgle | RMCYTHFAWCWRFA-UHFFFAOYSA-N |
| Behandling(er) | Stabilized |
| Kemisk navn eller materiale | Borane-tetrahydrofuran complex |
| Specifik vægtfylde | 0.876 |
| Opløselighedsinformation | Solubility in water: reacts. |
| Merck Index | 15, 1336 |
| Koncentration | 0.96 to 1.08M |
| Fysisk form | Væske |
| Farve | Farveløs |
| EINECS nummer | 237-881-8 |
| CAS | 109-99-9 |
| Synonym | borane-tetrahydrofuran complex,tetrahydrofuran borane,bh3.thf,borane tetrahydrofuran complex solution,borane-d3-thf complex solution,borane-tetrahydrofuran,unii-5ear4err1l,oxolane borane,boron; oxolane,borane thf |
| TSCA | TSCA |
| Molekylær formel | C4H11BO |
Lithium aluminiumhydrid, 2,4M opløsning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 16853-85-3 | AlH4Li | 37.95 g/mol
| MDL nummer | MFCD00011075 |
|---|---|
| Lineær formel | LiAlH4 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Sundhedsfare 2 | GHS H Statement In contact with water releases flammable gases which may ignite spontaneously. Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. May form explosive peroxides. Suspected of causing cancer. Harmful if swallowed. May cause drowsiness or dizziness. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 37.95 |
| Procent renhed | 9.2 to 10.5% (as LiAlH4) |
| IUPAC navn | lithium(1+)-aluminium |
| Navn note | 2.4M Solution in THF |
| PubChem CID | 21226445 |
| Molekylvægt (g/mol) | 37.95 |
| Tæthed | 0.9000g/mL |
| SMIL | [Li+].[AlH4-] |
| Flammepunkt | −17°C |
| InChI nøgle | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| FN nummer | 1411 |
| Kemisk navn eller materiale | Lithium Aluminum hydride |
| Specifik vægtfylde | 0.9 |
| Opløselighedsinformation | Solubility in water: vigorous reaction. |
| Merck Index | 15, 344 |
| Koncentration | 9.5 to 10.5% (as LiAlH4) |
| Fysisk form | Viskøs væske |
| Farve | Gul |
| CAS | 109-99-9 |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| Molekylær formel | AlH4Li |