Carboxylsyrer og derivater
Filtrerede søgeresultater
Isopropylacetat, Puriss pa,≥ 99,5 % (GC), Honeywell Riedel-de Haën™
CAS: 108-21-4 Molekylær formel: C5H10O2 Molekylvægt (g/mol): 102.133 MDL nummer: MFCD00008877 InChI nøgle: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC navn: propan-2-ylacetat SMIL: CC(C)OC(=O)C
| MDL nummer | MFCD00008877 |
|---|---|
| PubChem CID | 7915 |
| Molekylvægt (g/mol) | 102.133 |
| CAS | 108-21-4 |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| SMIL | CC(C)OC(=O)C |
| IUPAC navn | propan-2-ylacetat |
| InChI nøgle | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molekylær formel | C5H10O2 |
Butylacetat, puriss. pa, ACS-reagens,≥ 99,5 % (GC), Honeywell Riedel-de Haën™
CAS: 123-86-4 Molekylær formel: C6H12O2 Molekylvægt (g/mol): 116.16 MDL nummer: MFCD00009445 InChI nøgle: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC navn: butylacetat SMIL: CCCCOC(C)=O
| MDL nummer | MFCD00009445 |
|---|---|
| PubChem CID | 31272 |
| Molekylvægt (g/mol) | 116.16 |
| CAS | 123-86-4 |
| ChEBI | CHEBI:31328 |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| SMIL | CCCCOC(C)=O |
| IUPAC navn | butylacetat |
| InChI nøgle | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molekylær formel | C6H12O2 |
Ethylendiamintetraeddikesyre, Honeywell Fluka™
CAS: 60-00-4 Molekylær formel: C10H16N2O8 Molekylvægt (g/mol): 292.24 MDL nummer: MFCD00003541 InChI nøgle: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 SMIL: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| MDL nummer | MFCD00003541 |
|---|---|
| PubChem CID | 6049 |
| Molekylvægt (g/mol) | 292.24 |
| CAS | 60-00-4 |
| ChEBI | CHEBI:42191 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| SMIL | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| InChI nøgle | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molekylær formel | C10H16N2O8 |
1,2-diaminocyclohexantetraeddikesyre monohydrat, Honeywell Fluka™
CAS: 145819-99-4 Molekylær formel: C14H24N2O9 Molekylvægt (g/mol): 364.351 MDL nummer: MFCD00150952 InChI nøgle: VASZYFIKPKYGNC-UHFFFAOYSA-N Synonym: cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky PubChem CID: 18674933 IUPAC navn: 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]eddikesyre;hydrat SMIL: C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O
| MDL nummer | MFCD00150952 |
|---|---|
| PubChem CID | 18674933 |
| Molekylvægt (g/mol) | 364.351 |
| CAS | 145819-99-4 |
| Synonym | cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky |
| SMIL | C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O |
| IUPAC navn | 2-[[2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]eddikesyre;hydrat |
| InChI nøgle | VASZYFIKPKYGNC-UHFFFAOYSA-N |
| Molekylær formel | C14H24N2O9 |
Butylacetat, CHROMASOLV™ Plus, for HPLC, 99,7 %, Honeywell Riedel-de Haën™
CAS: 123-86-4 Molekylær formel: C6H12O2 Molekylvægt (g/mol): 116.16 MDL nummer: MFCD00009445 InChI nøgle: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC navn: butylacetat SMIL: CCCCOC(C)=O
| MDL nummer | MFCD00009445 |
|---|---|
| PubChem CID | 31272 |
| Molekylvægt (g/mol) | 116.16 |
| CAS | 123-86-4 |
| ChEBI | CHEBI:31328 |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| SMIL | CCCCOC(C)=O |
| IUPAC navn | butylacetat |
| InChI nøgle | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molekylær formel | C6H12O2 |
Ethylenediaminetetraacetic acid diammonium salt hydrate
CAS: 20824-56-0 Molekylær formel: C10H24N4O9 Molekylvægt (g/mol): 344.321 MDL nummer: MFCD00150463 InChI nøgle: WRSUMHYBOYWMTD-UHFFFAOYSA-N Synonym: ethylenediaminetetraacetic acid diammonium salt hydrate,edetic acid diamine hydrate,diazanium,2-2-bis carboxymethyl amino ethyl-carboxylatome,ammonium 2,2-2-bis carboxymethyl amino ethyl azanediyl diacetate hydrate PubChem CID: 71311375 IUPAC navn: azan;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]eddikesyre;hydrat SMIL: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.N.N.O
| MDL nummer | MFCD00150463 |
|---|---|
| PubChem CID | 71311375 |
| Molekylvægt (g/mol) | 344.321 |
| CAS | 20824-56-0 |
| Synonym | ethylenediaminetetraacetic acid diammonium salt hydrate,edetic acid diamine hydrate,diazanium,2-2-bis carboxymethyl amino ethyl-carboxylatome,ammonium 2,2-2-bis carboxymethyl amino ethyl azanediyl diacetate hydrate |
| SMIL | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.N.N.O |
| IUPAC navn | azan;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]eddikesyre;hydrat |
| InChI nøgle | WRSUMHYBOYWMTD-UHFFFAOYSA-N |
| Molekylær formel | C10H24N4O9 |
Triethyl citrate, 99%
CAS: 77-93-0 Molekylær formel: C12H20O7 Molekylvægt (g/mol): 276.29 InChI nøgle: DOOTYTYQINUNNV-UHFFFAOYSA-N Synonym: triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester PubChem CID: 6506 IUPAC navn: triethyl-2-hydroxypropan-1,2,3-tricarboxylat SMIL: CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O
| PubChem CID | 6506 |
|---|---|
| Molekylvægt (g/mol) | 276.29 |
| CAS | 77-93-0 |
| Synonym | triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| SMIL | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| IUPAC navn | triethyl-2-hydroxypropan-1,2,3-tricarboxylat |
| InChI nøgle | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Molekylær formel | C12H20O7 |
Dimethyl Phthalate, 99%
CAS: 131-11-3 Molekylær formel: C10H10O4 Molekylvægt (g/mol): 194.19 MDL nummer: MFCD00008425 InChI nøgle: NIQCNGHVCWTJSM-UHFFFAOYSA-N Synonym: dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm PubChem CID: 8554 ChEBI: CHEBI:4609 IUPAC navn: dimethylbenzen-1,2-dicarboxylat SMIL: COC(=O)C1=CC=CC=C1C(=O)OC
| MDL nummer | MFCD00008425 |
|---|---|
| PubChem CID | 8554 |
| Molekylvægt (g/mol) | 194.19 |
| CAS | 131-11-3 |
| ChEBI | CHEBI:4609 |
| Synonym | dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm |
| SMIL | COC(=O)C1=CC=CC=C1C(=O)OC |
| IUPAC navn | dimethylbenzen-1,2-dicarboxylat |
| InChI nøgle | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
| Molekylær formel | C10H10O4 |
Octyl 4-methoxycinnamat, 98%, stabiliseret, Thermo Scientific Chemicals
CAS: 5466-77-3 Molekylær formel: C18H26O3 Molekylvægt (g/mol): 290.40 MDL nummer: MFCD00072582 InChI nøgle: YBGZDTIWKVFICR-UHFFFAOYNA-N Synonym: bidd:er0152,octyl methoxy cinnamate omc,unii-4y5p7mud51 component,2s-2-ethylhexyl 2e-3-4-methoxyphenyl prop-2-enoate PubChem CID: 11044481 IUPAC navn: [(2S)-2-ethylhexyl] (E)-3-(4-methoxyphenyl)prop-2-enoat SMIL: CCCCC(CC)COC(=O)C=CC1=CC=C(OC)C=C1
| MDL nummer | MFCD00072582 |
|---|---|
| PubChem CID | 11044481 |
| Molekylvægt (g/mol) | 290.40 |
| CAS | 5466-77-3 |
| Synonym | bidd:er0152,octyl methoxy cinnamate omc,unii-4y5p7mud51 component,2s-2-ethylhexyl 2e-3-4-methoxyphenyl prop-2-enoate |
| SMIL | CCCCC(CC)COC(=O)C=CC1=CC=C(OC)C=C1 |
| IUPAC navn | [(2S)-2-ethylhexyl] (E)-3-(4-methoxyphenyl)prop-2-enoat |
| InChI nøgle | YBGZDTIWKVFICR-UHFFFAOYNA-N |
| Molekylær formel | C18H26O3 |
Propionic acid, 99%, pure
CAS: 79-09-4 InChI nøgle: XBDQKXXYIPTUBI-UHFFFAOYSA-N Synonym: propionic acid,ethylformic acid,methylacetic acid,carboxyethane,ethanecarboxylic acid,pseudoacetic acid,metacetonic acid,monoprop,luprosil,prozoin PubChem CID: 1032 ChEBI: CHEBI:30768 IUPAC navn: propansyre SMIL: CCC(=O)O
| PubChem CID | 1032 |
|---|---|
| CAS | 79-09-4 |
| ChEBI | CHEBI:30768 |
| Synonym | propionic acid,ethylformic acid,methylacetic acid,carboxyethane,ethanecarboxylic acid,pseudoacetic acid,metacetonic acid,monoprop,luprosil,prozoin |
| SMIL | CCC(=O)O |
| IUPAC navn | propansyre |
| InChI nøgle | XBDQKXXYIPTUBI-UHFFFAOYSA-N |
Ethylendimethacrylat, 98%, stabiliseret, Thermo Scientific Chemicals
CAS: 97-90-5 Molekylær formel: C10H14O4 Molekylvægt (g/mol): 198.22 MDL nummer: MFCD00008590 InChI nøgle: STVZJERGLQHEKB-UHFFFAOYSA-N Synonym: ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate PubChem CID: 7355 ChEBI: CHEBI:53436 SMIL: CC(=C)C(=O)OCCOC(=O)C(C)=C
| MDL nummer | MFCD00008590 |
|---|---|
| PubChem CID | 7355 |
| Molekylvægt (g/mol) | 198.22 |
| CAS | 97-90-5 |
| ChEBI | CHEBI:53436 |
| Synonym | ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate |
| SMIL | CC(=C)C(=O)OCCOC(=O)C(C)=C |
| InChI nøgle | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Molekylær formel | C10H14O4 |
Dimethyl oxalate, 99%
CAS: 553-90-2 Molekylær formel: C4H6O4 Molekylvægt (g/mol): 118.09 MDL nummer: MFCD00008442 InChI nøgle: LOMVENUNSWAXEN-UHFFFAOYSA-N Synonym: methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid PubChem CID: 11120 ChEBI: CHEBI:6859 IUPAC navn: dimethyloxalat SMIL: COC(=O)C(=O)OC
| MDL nummer | MFCD00008442 |
|---|---|
| PubChem CID | 11120 |
| Molekylvægt (g/mol) | 118.09 |
| CAS | 553-90-2 |
| ChEBI | CHEBI:6859 |
| Synonym | methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid |
| SMIL | COC(=O)C(=O)OC |
| IUPAC navn | dimethyloxalat |
| InChI nøgle | LOMVENUNSWAXEN-UHFFFAOYSA-N |
| Molekylær formel | C4H6O4 |
Trimethylacetic acid, 99%
CAS: 75-98-9 Molekylær formel: C5H10O2 Molekylvægt (g/mol): 102.13 MDL nummer: MFCD00004194 InChI nøgle: IUGYQRQAERSCNH-UHFFFAOYSA-N Synonym: pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid PubChem CID: 6417 ChEBI: CHEBI:45133 IUPAC navn: 2,2-dimethylpropansyre SMIL: CC(C)(C)C(=O)O
| MDL nummer | MFCD00004194 |
|---|---|
| PubChem CID | 6417 |
| Molekylvægt (g/mol) | 102.13 |
| CAS | 75-98-9 |
| ChEBI | CHEBI:45133 |
| Synonym | pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid |
| SMIL | CC(C)(C)C(=O)O |
| IUPAC navn | 2,2-dimethylpropansyre |
| InChI nøgle | IUGYQRQAERSCNH-UHFFFAOYSA-N |
| Molekylær formel | C5H10O2 |