Benzoesyre
- (10)
- (3)
- (2)
- (1)
- (1)
- (3)
- (2)
- (1)
- (1)
- (1)
- (2)
- (1)
- (3)
- (2)
- (1)
- (2)
- (2)
- (3)
- (3)
- (3)
- (3)
- (4)
- (3)
- (2)
Filtrerede søgeresultater
Benzoic acid, ACS, 99.5% min
CAS: 65-85-0 Molekylær formel: C7H6O2 Molekylvægt (g/mol): 122.123 MDL nummer: MFCD00002398 InChI nøgle: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC navn: benzoesyre SMIL: C1=CC=C(C=C1)C(=O)O
| MDL nummer | MFCD00002398 |
|---|---|
| PubChem CID | 243 |
| Molekylvægt (g/mol) | 122.123 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| SMIL | C1=CC=C(C=C1)C(=O)O |
| IUPAC navn | benzoesyre |
| InChI nøgle | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molekylær formel | C7H6O2 |
Benzoesyre, 99%, Thermo Scientific Chemicals
CAS: 65-85-0 Molekylær formel: C7H6O2 Molekylvægt (g/mol): 122.123 MDL nummer: MFCD00002398 InChI nøgle: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC navn: benzoesyre SMIL: C1=CC=C(C=C1)C(=O)O
| MDL nummer | MFCD00002398 |
|---|---|
| PubChem CID | 243 |
| Molekylvægt (g/mol) | 122.123 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| SMIL | C1=CC=C(C=C1)C(=O)O |
| IUPAC navn | benzoesyre |
| InChI nøgle | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molekylær formel | C7H6O2 |
Benzoic acid, 99.5%, for analysis
CAS: 65-85-0 Molekylær formel: C7H6O2 Molekylvægt (g/mol): 122.123 MDL nummer: MFCD00002398 InChI nøgle: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC navn: benzoesyre SMIL: C1=CC=C(C=C1)C(=O)O
| MDL nummer | MFCD00002398 |
|---|---|
| PubChem CID | 243 |
| Molekylvægt (g/mol) | 122.123 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| SMIL | C1=CC=C(C=C1)C(=O)O |
| IUPAC navn | benzoesyre |
| InChI nøgle | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| Molekylær formel | C7H6O2 |
Benzoesyre, natriumsalt, 99+%, Thermo Scientific Chemicals
CAS: 532-32-1 Molekylær formel: C7H5NaO2 Molekylvægt (g/mol): 144.11 MDL nummer: MFCD00012463 InChI nøgle: WXMKPNITSTVMEF-UHFFFAOYSA-M Synonym: sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 PubChem CID: 517055 IUPAC navn: natrium;benzoat SMIL: [Na+].[O-]C(=O)C1=CC=CC=C1
| MDL nummer | MFCD00012463 |
|---|---|
| PubChem CID | 517055 |
| Molekylvægt (g/mol) | 144.11 |
| CAS | 532-32-1 |
| Synonym | sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 |
| SMIL | [Na+].[O-]C(=O)C1=CC=CC=C1 |
| IUPAC navn | natrium;benzoat |
| InChI nøgle | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Molekylær formel | C7H5NaO2 |
1,2,4-Benzenetricarboxylic Acid 1,2-Dibutyl Ester, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Ethyl 3,5-Dimethylbenzoate, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
4-Aminobenzoic acid (PABA), 98.5 to 101.5% (Dry Basis), Thermo Scientific™
CAS: 150-13-0 Molekylær formel: C7H7NO2 Molekylvægt (g/mol): 137.14 MDL nummer: MFCD00007894 InChI nøgle: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC navn: 4-aminobenzoic acid SMIL: NC1=CC=C(C=C1)C(O)=O
| MDL nummer | MFCD00007894 |
|---|---|
| PubChem CID | 978 |
| Molekylvægt (g/mol) | 137.14 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| SMIL | NC1=CC=C(C=C1)C(O)=O |
| IUPAC navn | 4-aminobenzoic acid |
| InChI nøgle | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
| Molekylær formel | C7H7NO2 |