Carboxylsyrer og derivater
Filtrerede søgeresultater
Natriumpyruvat, 99%, Thermo Scientific Chemicals
CAS: 113-24-6 Molekylær formel: C3H3NaO3 Molekylvægt (g/mol): 110.044 MDL nummer: MFCD00002586 InChI nøgle: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC navn: natrium;2-oxopropanoat SMIL: CC(=O)C(=O)[O-].[Na+]
| MDL nummer | MFCD00002586 |
|---|---|
| PubChem CID | 23662274 |
| Molekylvægt (g/mol) | 110.044 |
| CAS | 113-24-6 |
| ChEBI | CHEBI:50144 |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| SMIL | CC(=O)C(=O)[O-].[Na+] |
| IUPAC navn | natrium;2-oxopropanoat |
| InChI nøgle | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molekylær formel | C3H3NaO3 |
L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 Molekylær formel: C6H7NaO6 Molekylvægt (g/mol): 198.11 MDL nummer: MFCD00082340 InChI nøgle: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC navn: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on; molekylært hydrogen; natrium SMIL: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| MDL nummer | MFCD00082340 |
|---|---|
| PubChem CID | 131674100 |
| Molekylvægt (g/mol) | 198.11 |
| CAS | 134-03-2 |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| SMIL | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| IUPAC navn | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on; molekylært hydrogen; natrium |
| InChI nøgle | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molekylær formel | C6H7NaO6 |
2-aminoethylmethacrylathydrochlorid, 90%, stabiliseret, Thermo Scientific Chemicals
CAS: 2420-94-2 Molekylær formel: C6H11NO2·HCl Molekylvægt (g/mol): 165.62 MDL nummer: MFCD00078260 InChI nøgle: XSHISXQEKIKSGC-UHFFFAOYSA-N Synonym: 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 PubChem CID: 75495 IUPAC navn: 2-aminoethyl-2-methylprop-2-enoat;hydrochlorid SMIL: CC(=C)C(=O)OCCN.Cl
| MDL nummer | MFCD00078260 |
|---|---|
| PubChem CID | 75495 |
| Molekylvægt (g/mol) | 165.62 |
| CAS | 2420-94-2 |
| Synonym | 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 |
| SMIL | CC(=C)C(=O)OCCN.Cl |
| IUPAC navn | 2-aminoethyl-2-methylprop-2-enoat;hydrochlorid |
| InChI nøgle | XSHISXQEKIKSGC-UHFFFAOYSA-N |
| Molekylær formel | C6H11NO2·HCl |
2-Phenylethylacetat, 98 %, Thermo Scientific Chemicals
CAS: 103-45-7 Molekylær formel: C10H12O2 Molekylvægt (g/mol): 164.20 MDL nummer: MFCD00008720 InChI nøgle: MDHYEMXUFSJLGV-UHFFFAOYSA-N Synonym: phenethyl acetate,2-phenethyl acetate,acetic acid, 2-phenylethyl ester,benzylcarbinyl acetate,beta-phenylethyl acetate,acetic acid, phenethyl ester,phenethyl alcohol, acetate,phenylethyl acetate,acetic acid phenethyl ester,ethanol, 2-phenyl-, acetate PubChem CID: 7654 ChEBI: CHEBI:31988 IUPAC navn: 2-phenylethylacetat SMIL: CC(=O)OCCC1=CC=CC=C1
| MDL nummer | MFCD00008720 |
|---|---|
| PubChem CID | 7654 |
| Molekylvægt (g/mol) | 164.20 |
| CAS | 103-45-7 |
| ChEBI | CHEBI:31988 |
| Synonym | phenethyl acetate,2-phenethyl acetate,acetic acid, 2-phenylethyl ester,benzylcarbinyl acetate,beta-phenylethyl acetate,acetic acid, phenethyl ester,phenethyl alcohol, acetate,phenylethyl acetate,acetic acid phenethyl ester,ethanol, 2-phenyl-, acetate |
| SMIL | CC(=O)OCCC1=CC=CC=C1 |
| IUPAC navn | 2-phenylethylacetat |
| InChI nøgle | MDHYEMXUFSJLGV-UHFFFAOYSA-N |
| Molekylær formel | C10H12O2 |
Sodium oxalate, 99%
CAS: 62-76-0 Molekylær formel: C2Na2O4 Molekylvægt (g/mol): 134.00 MDL nummer: MFCD00012465 InChI nøgle: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC navn: dinatrium;oxalat SMIL: [Na+].[Na+].[O-]C(=O)C([O-])=O
| MDL nummer | MFCD00012465 |
|---|---|
| PubChem CID | 6125 |
| Molekylvægt (g/mol) | 134.00 |
| CAS | 62-76-0 |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| SMIL | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| IUPAC navn | dinatrium;oxalat |
| InChI nøgle | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molekylær formel | C2Na2O4 |
Ammonium formate, 97%
CAS: 540-69-2 Molekylær formel: CH5NO2 Molekylvægt (g/mol): 63.056 MDL nummer: MFCD00013103 InChI nøgle: VZTDIZULWFCMLS-UHFFFAOYSA-N Synonym: ammonium formate,formic acid, ammonium salt,formic acid ammonium salt,ammoniumformate,azanium formate,ammonium formiate,formic acid, ammonium salt 1:1,mravencan amonny czech,hsdb 479,mravencan amonny PubChem CID: 2723923 ChEBI: CHEBI:63050 IUPAC navn: azanium;formiat SMIL: C(=O)[O-].[NH4+]
| MDL nummer | MFCD00013103 |
|---|---|
| PubChem CID | 2723923 |
| Molekylvægt (g/mol) | 63.056 |
| CAS | 540-69-2 |
| ChEBI | CHEBI:63050 |
| Synonym | ammonium formate,formic acid, ammonium salt,formic acid ammonium salt,ammoniumformate,azanium formate,ammonium formiate,formic acid, ammonium salt 1:1,mravencan amonny czech,hsdb 479,mravencan amonny |
| SMIL | C(=O)[O-].[NH4+] |
| IUPAC navn | azanium;formiat |
| InChI nøgle | VZTDIZULWFCMLS-UHFFFAOYSA-N |
| Molekylær formel | CH5NO2 |
Ethylendiamintetraeddikesyre, 99%, Thermo Scientific Chemicals
CAS: 60-00-4 Molekylær formel: C10H16N2O8 Molekylvægt (g/mol): 292.24 MDL nummer: MFCD00003541 InChI nøgle: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC navn: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]eddikesyre SMIL: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| MDL nummer | MFCD00003541 |
|---|---|
| PubChem CID | 6049 |
| Molekylvægt (g/mol) | 292.24 |
| CAS | 60-00-4 |
| ChEBI | CHEBI:42191 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| SMIL | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| IUPAC navn | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]eddikesyre |
| InChI nøgle | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molekylær formel | C10H16N2O8 |
Ethylendiamintetraeddikesyre dinatriumsaltdihydrat, ACS, 99,0-101,0 %, Thermo Scientific Chemicals
CAS: 6381-92-6 Molekylær formel: C10H18N2Na2O10 Molekylvægt (g/mol): 372.24 MDL nummer: MFCD00150037,MFCD00003541 InChI nøgle: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC navn: dinatrium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;dihydrat SMIL: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| MDL nummer | MFCD00150037,MFCD00003541 |
|---|---|
| PubChem CID | 44120005 |
| Molekylvægt (g/mol) | 372.24 |
| CAS | 6381-92-6 |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| SMIL | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC navn | dinatrium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;dihydrat |
| InChI nøgle | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molekylær formel | C10H18N2Na2O10 |
Thermo Scientific Chemicals Ethylendiamintetraeddikesyre, dinatriumsaltdihydrat, 99+%, til molekylærbiologi, DNAse-, RNAse- og proteasefri
CAS: 6381-92-6 Molekylær formel: C10H18N2Na2O10 Molekylvægt (g/mol): 372.24 MDL nummer: MFCD00150037,MFCD00003541 InChI nøgle: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC navn: dinatrium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;dihydrat SMIL: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| MDL nummer | MFCD00150037,MFCD00003541 |
|---|---|
| PubChem CID | 44120005 |
| Molekylvægt (g/mol) | 372.24 |
| CAS | 6381-92-6 |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| SMIL | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC navn | dinatrium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;dihydrat |
| InChI nøgle | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molekylær formel | C10H18N2Na2O10 |
Acetazolamide, 99%
CAS: 59-66-5 Molekylær formel: C4H6N4O3S2 Molekylvægt (g/mol): 222.24 MDL nummer: MFCD00003105 InChI nøgle: BZKPWHYZMXOIDC-UHFFFAOYSA-N Synonym: acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran PubChem CID: 1986 ChEBI: CHEBI:27690 IUPAC navn: N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamid SMIL: CC(=O)NC1=NN=C(S1)S(N)(=O)=O
| MDL nummer | MFCD00003105 |
|---|---|
| PubChem CID | 1986 |
| Molekylvægt (g/mol) | 222.24 |
| CAS | 59-66-5 |
| ChEBI | CHEBI:27690 |
| Synonym | acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran |
| SMIL | CC(=O)NC1=NN=C(S1)S(N)(=O)=O |
| IUPAC navn | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamid |
| InChI nøgle | BZKPWHYZMXOIDC-UHFFFAOYSA-N |
| Molekylær formel | C4H6N4O3S2 |
Nicotinamide, 99%
CAS: 98-92-0 Molekylær formel: C6H6N2O Molekylvægt (g/mol): 122.127 MDL nummer: MFCD00006395 InChI nøgle: DFPAKSUCGFBDDF-UHFFFAOYSA-N Synonym: nicotinamide,niacinamide,3-pyridinecarboxamide,vitamin pp,nicotinic acid amide,papulex,aminicotin,amixicotyn,nicobion,nicotylamide PubChem CID: 936 ChEBI: CHEBI:17154 IUPAC navn: pyridin-3-carboxamid SMIL: C1=CC(=CN=C1)C(=O)N
| MDL nummer | MFCD00006395 |
|---|---|
| PubChem CID | 936 |
| Molekylvægt (g/mol) | 122.127 |
| CAS | 98-92-0 |
| ChEBI | CHEBI:17154 |
| Synonym | nicotinamide,niacinamide,3-pyridinecarboxamide,vitamin pp,nicotinic acid amide,papulex,aminicotin,amixicotyn,nicobion,nicotylamide |
| SMIL | C1=CC(=CN=C1)C(=O)N |
| IUPAC navn | pyridin-3-carboxamid |
| InChI nøgle | DFPAKSUCGFBDDF-UHFFFAOYSA-N |
| Molekylær formel | C6H6N2O |
Diacetone acrylamide, 99%
CAS: 2873-97-4 Molekylær formel: C9H15NO2 Molekylvægt (g/mol): 169.22 MDL nummer: MFCD00008788 InChI nøgle: OMNKZBIFPJNNIO-UHFFFAOYSA-N Synonym: diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 PubChem CID: 17888 IUPAC navn: N-(2-methyl-4-oxopentan-2-yl)prop-2-enamid SMIL: CC(=O)CC(C)(C)NC(=O)C=C
| MDL nummer | MFCD00008788 |
|---|---|
| PubChem CID | 17888 |
| Molekylvægt (g/mol) | 169.22 |
| CAS | 2873-97-4 |
| Synonym | diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 |
| SMIL | CC(=O)CC(C)(C)NC(=O)C=C |
| IUPAC navn | N-(2-methyl-4-oxopentan-2-yl)prop-2-enamid |
| InChI nøgle | OMNKZBIFPJNNIO-UHFFFAOYSA-N |
| Molekylær formel | C9H15NO2 |
Dimethyl oxalate, 99%
CAS: 553-90-2 Molekylær formel: C4H6O4 Molekylvægt (g/mol): 118.09 MDL nummer: MFCD00008442 InChI nøgle: LOMVENUNSWAXEN-UHFFFAOYSA-N Synonym: methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid PubChem CID: 11120 ChEBI: CHEBI:6859 IUPAC navn: dimethyloxalat SMIL: COC(=O)C(=O)OC
| MDL nummer | MFCD00008442 |
|---|---|
| PubChem CID | 11120 |
| Molekylvægt (g/mol) | 118.09 |
| CAS | 553-90-2 |
| ChEBI | CHEBI:6859 |
| Synonym | methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid |
| SMIL | COC(=O)C(=O)OC |
| IUPAC navn | dimethyloxalat |
| InChI nøgle | LOMVENUNSWAXEN-UHFFFAOYSA-N |
| Molekylær formel | C4H6O4 |
Gluconic acid, sodium salt, 98%
CAS: 527-07-1 Molekylær formel: C6H11NaO7 Molekylvægt (g/mol): 218.137 MDL nummer: MFCD00064210 InChI nøgle: UPMFZISCCZSDND-JJKGCWMISA-M Synonym: sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t PubChem CID: 23672301 ChEBI: CHEBI:84997 IUPAC navn: natrium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoat SMIL: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+]
| MDL nummer | MFCD00064210 |
|---|---|
| PubChem CID | 23672301 |
| Molekylvægt (g/mol) | 218.137 |
| CAS | 527-07-1 |
| ChEBI | CHEBI:84997 |
| Synonym | sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t |
| SMIL | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
| IUPAC navn | natrium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoat |
| InChI nøgle | UPMFZISCCZSDND-JJKGCWMISA-M |
| Molekylær formel | C6H11NaO7 |
Ethyl oleate, 98%, mixture of homologeous fatty acid esters
CAS: 111-62-6 Molekylær formel: C20H38O2 Molekylvægt (g/mol): 310.51 InChI nøgle: LVGKNOAMLMIIKO-QXMHVHEDSA-N Synonym: ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 PubChem CID: 5363269 ChEBI: CHEBI:84940 IUPAC navn: ethyl (Z)-octadec-9-enoat SMIL: CCCCCCCCC=CCCCCCCCC(=O)OCC
| PubChem CID | 5363269 |
|---|---|
| Molekylvægt (g/mol) | 310.51 |
| CAS | 111-62-6 |
| ChEBI | CHEBI:84940 |
| Synonym | ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 |
| SMIL | CCCCCCCCC=CCCCCCCCC(=O)OCC |
| IUPAC navn | ethyl (Z)-octadec-9-enoat |
| InChI nøgle | LVGKNOAMLMIIKO-QXMHVHEDSA-N |
| Molekylær formel | C20H38O2 |