Organometalliske forbindelser
Filtrerede søgeresultater
3-(Trimethoxysilyl)propyl methacrylate, 98%
CAS: 2530-85-0 Molekylær formel: C10H20O5Si Molekylvægt (g/mol): 248.35 MDL nummer: MFCD00008593 InChI nøgle: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC navn: 3-trimethoxysilylpropyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| MDL nummer | MFCD00008593 |
|---|---|
| PubChem CID | 17318 |
| Molekylvægt (g/mol) | 248.35 |
| CAS | 2530-85-0 |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| SMIL | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| IUPAC navn | 3-trimethoxysilylpropyl-2-methylprop-2-enoat |
| InChI nøgle | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| Molekylær formel | C10H20O5Si |
Zinkmononatriumsalt, Thermo Scientific Chemicals
CAS: 62625-22-3 Molekylær formel: C20H16N4NaO6S Molekylvægt (g/mol): 463.42 MDL nummer: MFCD00064385 InChI nøgle: IABRINWJUBAIIE-JJECXDOKSA-N PubChem CID: 131856391 IUPAC navn: 2-[2-[(Z)-N-[(Z)-(6-oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesyre;natrium SMIL: C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na]
| MDL nummer | MFCD00064385 |
|---|---|
| PubChem CID | 131856391 |
| Molekylvægt (g/mol) | 463.42 |
| CAS | 62625-22-3 |
| SMIL | C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na] |
| IUPAC navn | 2-[2-[(Z)-N-[(Z)-(6-oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesyre;natrium |
| InChI nøgle | IABRINWJUBAIIE-JJECXDOKSA-N |
| Molekylær formel | C20H16N4NaO6S |
Chlorophyllin, coppered trisodium salt
CAS: 11006-34-1 Molekylær formel: C34H31CuN4Na3O6 MDL nummer: MFCD00012149
| MDL nummer | MFCD00012149 |
|---|---|
| CAS | 11006-34-1 |
| Molekylær formel | C34H31CuN4Na3O6 |
Diisobutylaluminium hydride, 1M solution in hexane, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AlH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.701 |
| Sundhedsfare 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Sundhedsfare 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Solubility in water: reacts |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Navn note | 1M Solution in Hexane |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.7010g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 110-54-3 |
| Smeltepunkt | -70.0°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | −23°C |
| Molekylær formel | C8H19Al |
Chlortrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 75-77-4 Molekylær formel: C3H9ClSi Molekylvægt (g/mol): 108.64 MDL nummer: MFCD00000502 InChI nøgle: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC navn: chlor(trimethyl)silan SMIL: C[Si](C)(C)Cl
| MDL nummer | MFCD00000502 |
|---|---|
| PubChem CID | 6397 |
| Molekylvægt (g/mol) | 108.64 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| SMIL | C[Si](C)(C)Cl |
| IUPAC navn | chlor(trimethyl)silan |
| InChI nøgle | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
| Molekylær formel | C3H9ClSi |
Tetraethyl orthosilicate, 98%
CAS: 78-10-4 Molekylær formel: C8H20O4Si Molekylvægt (g/mol): 208.33 MDL nummer: MFCD00009062 InChI nøgle: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC navn: tetraethylsilicat SMIL: CCO[Si](OCC)(OCC)OCC
| MDL nummer | MFCD00009062 |
|---|---|
| PubChem CID | 6517 |
| Molekylvægt (g/mol) | 208.33 |
| CAS | 78-10-4 |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| SMIL | CCO[Si](OCC)(OCC)OCC |
| IUPAC navn | tetraethylsilicat |
| InChI nøgle | BOTDANWDWHJENH-UHFFFAOYSA-N |
| Molekylær formel | C8H20O4Si |
N,O-Bis(trimethylsilyl)trifluoroacetamide, with 1% trimethylsilyl chloride
CAS: 25561-30-2 Molekylær formel: C8H18F3NOSi2 Molekylvægt (g/mol): 257.4 MDL nummer: MFCD00008269 InChI nøgle: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC navn: trimethylsilyl (1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat SMIL: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| MDL nummer | MFCD00008269 |
|---|---|
| PubChem CID | 9601896 |
| Molekylvægt (g/mol) | 257.4 |
| CAS | 25561-30-2 |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| SMIL | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| IUPAC navn | trimethylsilyl (1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat |
| InChI nøgle | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| Molekylær formel | C8H18F3NOSi2 |
Bis[3-(triethoxysilyl)propyl]tetrasulfide, S 22.3% (typical)
CAS: 40372-72-3 Molekylær formel: C18H42O6S4Si2 Molekylvægt (g/mol): 538.94 MDL nummer: MFCD00053751 InChI nøgle: VTHOKNTVYKTUPI-UHFFFAOYSA-N Synonym: bis 3-triethoxysilyl propyl tetrasulfide,4,4,15,15-tetraethoxy-3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane,unii-j98v193zry,bis 3-triethoxysilyl propyl tetrasulphide,3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy,silane coupler kh-858,acmc-1akw5,dsstox_cid_9362 PubChem CID: 162012 IUPAC navn: triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silan SMIL: CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC
| MDL nummer | MFCD00053751 |
|---|---|
| PubChem CID | 162012 |
| Molekylvægt (g/mol) | 538.94 |
| CAS | 40372-72-3 |
| Synonym | bis 3-triethoxysilyl propyl tetrasulfide,4,4,15,15-tetraethoxy-3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane,unii-j98v193zry,bis 3-triethoxysilyl propyl tetrasulphide,3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy,silane coupler kh-858,acmc-1akw5,dsstox_cid_9362 |
| SMIL | CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| IUPAC navn | triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silan |
| InChI nøgle | VTHOKNTVYKTUPI-UHFFFAOYSA-N |
| Molekylær formel | C18H42O6S4Si2 |
(3-Chloropropyl)triethoxysilane, 97+%
CAS: 5089-70-3 Molekylær formel: C9H21ClO3Si Molekylvægt (g/mol): 240.8 MDL nummer: MFCD00018985 InChI nøgle: KSCAZPYHLGGNPZ-UHFFFAOYSA-N Synonym: 3-chloropropyl triethoxysilane,3-chloropropyl triethoxy silane,silane, 3-chloropropyl triethoxy,unii-x7rb20518m,triethoxy gamma-chloropropyl silane,gamma-chloropropyltriethoxysilane,triethoxy .gamma.-chloropropyl silane,chloropropyl triethoxysilane,dynasylan cpteo PubChem CID: 78771 IUPAC navn: 3-chlorpropyl(triethoxy)silan SMIL: CCO[Si](CCCCl)(OCC)OCC
| MDL nummer | MFCD00018985 |
|---|---|
| PubChem CID | 78771 |
| Molekylvægt (g/mol) | 240.8 |
| CAS | 5089-70-3 |
| Synonym | 3-chloropropyl triethoxysilane,3-chloropropyl triethoxy silane,silane, 3-chloropropyl triethoxy,unii-x7rb20518m,triethoxy gamma-chloropropyl silane,gamma-chloropropyltriethoxysilane,triethoxy .gamma.-chloropropyl silane,chloropropyl triethoxysilane,dynasylan cpteo |
| SMIL | CCO[Si](CCCCl)(OCC)OCC |
| IUPAC navn | 3-chlorpropyl(triethoxy)silan |
| InChI nøgle | KSCAZPYHLGGNPZ-UHFFFAOYSA-N |
| Molekylær formel | C9H21ClO3Si |
Octadecyltrimethoxysilan, 90 %, Tech ., Thermo Scientific Chemicals
CAS: 3069-42-9 Molekylær formel: C21H46O3Si Molekylvægt (g/mol): 374.69 MDL nummer: MFCD00043060 InChI nøgle: SLYCYWCVSGPDFR-UHFFFAOYSA-N Synonym: octadecyltrimethoxysilane,trimethoxy octadecyl silane,n-octadecyltrimethoxysilane,stearyltrimethoxysilane,silane, trimethoxyoctadecyl,octadecyl-trimethoxysilane,acmc-209hi7,ksc491g4l,trimethoxy octadecyl silane, technical grade PubChem CID: 76486 IUPAC navn: trimethoxy(octadecyl)silan SMIL: CCCCCCCCCCCCCCCCCC[Si](OC)(OC)OC
| MDL nummer | MFCD00043060 |
|---|---|
| PubChem CID | 76486 |
| Molekylvægt (g/mol) | 374.69 |
| CAS | 3069-42-9 |
| Synonym | octadecyltrimethoxysilane,trimethoxy octadecyl silane,n-octadecyltrimethoxysilane,stearyltrimethoxysilane,silane, trimethoxyoctadecyl,octadecyl-trimethoxysilane,acmc-209hi7,ksc491g4l,trimethoxy octadecyl silane, technical grade |
| SMIL | CCCCCCCCCCCCCCCCCC[Si](OC)(OC)OC |
| IUPAC navn | trimethoxy(octadecyl)silan |
| InChI nøgle | SLYCYWCVSGPDFR-UHFFFAOYSA-N |
| Molekylær formel | C21H46O3Si |
Sodium tetraethylborate, 97%, pure, Thermo Scientific Chemicals
CAS: 15523-24-7 Molekylær formel: C8H20BNa Molekylvægt (g/mol): 150.04 MDL nummer: MFCD00061547 InChI nøgle: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC navn: natrium;tetraethylboranuid SMIL: [B-](CC)(CC)(CC)CC.[Na+]
| MDL nummer | MFCD00061547 |
|---|---|
| PubChem CID | 23681030 |
| Molekylvægt (g/mol) | 150.04 |
| CAS | 15523-24-7 |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| SMIL | [B-](CC)(CC)(CC)CC.[Na+] |
| IUPAC navn | natrium;tetraethylboranuid |
| InChI nøgle | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
| Molekylær formel | C8H20BNa |
3-Aminopropyltriethoxysilane, 99%
CAS: 919-30-2 Molekylær formel: C9H23NO3Si Molekylvægt (g/mol): 221.37 MDL nummer: MFCD00008207,MFCD01324904 InChI nøgle: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC navn: 3-triethoxysilylpropan-1-amin SMIL: CCO[Si](CCCN)(OCC)OCC
| MDL nummer | MFCD00008207,MFCD01324904 |
|---|---|
| PubChem CID | 13521 |
| Molekylvægt (g/mol) | 221.37 |
| CAS | 919-30-2 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| SMIL | CCO[Si](CCCN)(OCC)OCC |
| IUPAC navn | 3-triethoxysilylpropan-1-amin |
| InChI nøgle | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| Molekylær formel | C9H23NO3Si |
Lithium-bis(trimethylsilyl)amid, 1 M opløsning i THF/ethylbenzen, AcroSeal™ , Thermo Scientific Chemicals
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| MDL nummer | MFCD00008261 |
|---|---|
| Kemisk navn eller materiale | Lithium bis(trimethylsilyl)amide |
| Specifik vægtfylde | 0.89 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or ha |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. Highly flammable liquid and vapor. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides.<br/ |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 167.33 |
| Opløselighedsinformation | Solubility in water: decomposes |
| Procent renhed | 18 to 22% active base (as LiNSi) |
| Fysisk form | Uklar løsning |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| Farve | Gul til Brun |
| Navn note | 1M Solution in THF/Ethylbenzene |
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.33 |
| Tæthed | 0.8900g/mL |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| EINECS nummer | 223-725-6 |
| CAS | 100-41-4 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| TSCA | TSCA |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Flammepunkt | −21°C |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Lineær formel | ((CH3)3Si)2NLi |
|---|---|
| Kemisk navn eller materiale | Lithium bis(trimethylsilyl)amide |
| Specifik vægtfylde | 0.9 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 167.33 |
| Opløselighedsinformation | Solubility in water: reacts. |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.33 |
| Tæthed | 0.9000g/mL |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| EINECS nummer | 223-725-6 |
| CAS | 109-99-9 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Kogepunkt | 65.0°C |
| Flammepunkt | −21°C |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
N-Methyl-N-(trimethylsilyl)trifluoroacetamide, 97%
CAS: 24589-78-4 Molekylær formel: C6H12F3NOSi Molekylvægt (g/mol): 199.25 MDL nummer: MFCD00000411 InChI nøgle: MSPCIZMDDUQPGJ-UHFFFAOYSA-N Synonym: mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm PubChem CID: 32510 ChEBI: CHEBI:85064 IUPAC navn: 2,2,2-trifluor-N-methyl-N-trimethylsilylacetamid SMIL: CN(C(=O)C(F)(F)F)[Si](C)(C)C
| MDL nummer | MFCD00000411 |
|---|---|
| PubChem CID | 32510 |
| Molekylvægt (g/mol) | 199.25 |
| CAS | 24589-78-4 |
| ChEBI | CHEBI:85064 |
| Synonym | mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm |
| SMIL | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| IUPAC navn | 2,2,2-trifluor-N-methyl-N-trimethylsilylacetamid |
| InChI nøgle | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
| Molekylær formel | C6H12F3NOSi |