Harpikser og understøtninger
- (56)
- (1)
- (1)
- (11)
- (2)
- (1)
- (19)
- (1)
- (4)
- (1)
- (26)
- (6)
- (1)
- (1)
- (5)
- (14)
- (15)
- (2)
- (2)
- (11)
- (4)
- (4)
- (7)
- (5)
- (9)
- (1)
- (4)
- (2)
- (2)
- (2)
- (1)
- (1)
- (1)
- (4)
- (6)
- (2)
- (3)
- (1)
- (1)
- (1)
- (12)
- (2)
- (4)
- (2)
- (4)
Filtrerede søgeresultater
Thermo Scientific Chemicals Agar pulver
CAS: 9002-18-0 Molekylær formel: C14H24O9 Molekylvægt (g/mol): 336.337 MDL nummer: MFCD00081288 InChI nøgle: GYYDPBCUIJTIBM-DYOGSRDZSA-N Synonym: agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol PubChem CID: 71571511 IUPAC navn: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxan-3,5-diol SMIL: CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O
| MDL nummer | MFCD00081288 |
|---|---|
| PubChem CID | 71571511 |
| Molekylvægt (g/mol) | 336.337 |
| CAS | 9002-18-0 |
| Synonym | agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol |
| SMIL | CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O |
| IUPAC navn | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxan-3,5-diol |
| InChI nøgle | GYYDPBCUIJTIBM-DYOGSRDZSA-N |
| Molekylær formel | C14H24O9 |
| MDL nummer | MFCD00145567 |
|---|---|
| CAS | 80747-90-6 |
Amberlite™ IRN-78, ion exchange resin, nuclear grade
CAS: 11128-95-3 Molekylær formel: Styrene-DVB MDL nummer: MFCD00145822
| MDL nummer | MFCD00145822 |
|---|---|
| CAS | 11128-95-3 |
| Molekylær formel | Styrene-DVB |
Amberlyst™ 15(H), wet, ion exchange resin
CAS: 39389-20-3 Molekylær formel: C18H18O3S Molekylvægt (g/mol): 314.399 MDL nummer: MFCD00145841 InChI nøgle: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC navn: 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre SMIL: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| MDL nummer | MFCD00145841 |
|---|---|
| PubChem CID | 170197 |
| Molekylvægt (g/mol) | 314.399 |
| CAS | 39389-20-3 |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| SMIL | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| IUPAC navn | 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre |
| InChI nøgle | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molekylær formel | C18H18O3S |
AmberChrom 50Wx8 100-200 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 MDL nummer: MFCD00132726 IUPAC navn: AmberChrom™ 50WX8 ionbytterharpiks
| MDL nummer | MFCD00132726 |
|---|---|
| CAS | 11119-67-8 |
| IUPAC navn | AmberChrom™ 50WX8 ionbytterharpiks |
Amberlyst™ 15(H), ionbytterharpiks, Thermo Scientific Chemicals
CAS: 39389-20-3 Molekylær formel: C18H18O3S Molekylvægt (g/mol): 314.399 MDL nummer: MFCD00145841 InChI nøgle: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC navn: 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre SMIL: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| MDL nummer | MFCD00145841 |
|---|---|
| PubChem CID | 170197 |
| Molekylvægt (g/mol) | 314.399 |
| CAS | 39389-20-3 |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| SMIL | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| IUPAC navn | 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre |
| InChI nøgle | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molekylær formel | C18H18O3S |
| MDL nummer | MFCD00145564 |
|---|---|
| CAS | 52439-77-7 |
| MDL nummer | MFCD00132704 |
|---|---|
| CAS | 37380-42-0 |
AmberChrom™ , 50WX8 200-400 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 MDL nummer: MFCD00132726 IUPAC navn: AmberChrom™ 50WX8 ionbytterharpiks
| MDL nummer | MFCD00132726 |
|---|---|
| CAS | 11119-67-8 |
| IUPAC navn | AmberChrom™ 50WX8 ionbytterharpiks |
| MDL nummer | MFCD00145842 |
|---|---|
| CAS | 9049-93-8 |
| MDL nummer | MFCD00132702 |
|---|---|
| CAS | 79620-28-3 |
| MDL nummer | MFCD00132710 |
|---|---|
| CAS | 9002-26-0 |
Amberlite™ IRN-77, ion exchange resin, nuclear grade
CAS: 11128-94-2 Molekylær formel: Styrene-DVB MDL nummer: MFCD00145822
| MDL nummer | MFCD00145822 |
|---|---|
| CAS | 11128-94-2 |
| Molekylær formel | Styrene-DVB |
Amberlite™ IRC-120(H), ionbytterharpiks, Thermo Scientific Chemicals
CAS: 78922-04-0 Molekylær formel: C13H10ClNO4S Molekylvægt (g/mol): 311.736 MDL nummer: MFCD00132707 InChI nøgle: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC navn: 3-[(3-chlorphenyl)sulfonylamino]benzoesyre SMIL: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| MDL nummer | MFCD00132707 |
|---|---|
| PubChem CID | 8190984 |
| Molekylvægt (g/mol) | 311.736 |
| CAS | 78922-04-0 |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| SMIL | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| IUPAC navn | 3-[(3-chlorphenyl)sulfonylamino]benzoesyre |
| InChI nøgle | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| Molekylær formel | C13H10ClNO4S |