Harpikser og understøtninger
- (1)
- (50)
- (1)
- (2)
- (35)
- (13)
- (8)
- (4)
- (26)
- (3)
- (10)
- (19)
- (4)
- (7)
- (4)
- (45)
- (2)
- (1)
- (3)
- (6)
- (6)
- (3)
- (3)
- (1)
- (2)
- (12)
- (3)
- (3)
- (4)
- (3)
- (8)
- (3)
- (11)
- (6)
- (1)
- (2)
- (9)
- (1)
- (3)
- (3)
- (10)
- (6)
- (5)
- (34)
- (5)
- (1)
- (7)
- (6)
- (1)
- (1)
- (1)
- (20)
- (2)
- (2)
- (4)
Filtrerede søgeresultater
| MDL nummer | MFCD00132702 |
|---|---|
| CAS | 79620-28-3 |
| MDL nummer | MFCD00145564 |
|---|---|
| CAS | 52439-77-7 |
| MDL nummer | MFCD00145567 |
|---|---|
| CAS | 80747-90-6 |
Amberlite™ IRN-77, ion exchange resin, nuclear grade
CAS: 11128-94-2 Molekylær formel: Styrene-DVB MDL nummer: MFCD00145822
| MDL nummer | MFCD00145822 |
|---|---|
| CAS | 11128-94-2 |
| Molekylær formel | Styrene-DVB |
Amberlyst™ 15(H), wet, ion exchange resin
CAS: 39389-20-3 Molekylær formel: C18H18O3S Molekylvægt (g/mol): 314.399 MDL nummer: MFCD00145841 InChI nøgle: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC navn: 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre SMIL: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| MDL nummer | MFCD00145841 |
|---|---|
| PubChem CID | 170197 |
| Molekylvægt (g/mol) | 314.399 |
| CAS | 39389-20-3 |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| SMIL | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| IUPAC navn | 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre |
| InChI nøgle | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molekylær formel | C18H18O3S |
Amberlyst™ 15, (dry) ion-exchange resin
CAS: 9037-24-5 Molekylær formel: MFCD00145841 Molekylvægt (g/mol): 0.00 MDL nummer: MFCD00145841 InChI nøgle: YZUPZGFPHUVJKC-UHFFFAOYSA-N PubChem CID: 80972 SMIL: *
| MDL nummer | MFCD00145841 |
|---|---|
| PubChem CID | 80972 |
| Molekylvægt (g/mol) | 0.00 |
| CAS | 9037-24-5 |
| SMIL | * |
| InChI nøgle | YZUPZGFPHUVJKC-UHFFFAOYSA-N |
| Molekylær formel | MFCD00145841 |
Amberlyst™ 15(H), ionbytterharpiks, Thermo Scientific Chemicals
CAS: 39389-20-3 Molekylær formel: C18H18O3S Molekylvægt (g/mol): 314.399 MDL nummer: MFCD00145841 InChI nøgle: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC navn: 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre SMIL: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| MDL nummer | MFCD00145841 |
|---|---|
| PubChem CID | 170197 |
| Molekylvægt (g/mol) | 314.399 |
| CAS | 39389-20-3 |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| SMIL | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| IUPAC navn | 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre |
| InChI nøgle | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molekylær formel | C18H18O3S |
Amberlite™ IRN-78 ionbytterharpiks, OH-form, Thermo Scientific Chemicals
CAS: 11128-95-3 MDL nummer: MFCD00145822
| MDL nummer | MFCD00145822 |
|---|---|
| CAS | 11128-95-3 |
| MDL nummer | MFCD00132710 |
|---|---|
| CAS | 9002-26-0 |
| MDL nummer | MFCD00145842 |
|---|---|
| CAS | 9049-93-8 |
| MDL nummer | MFCD00145822 |
|---|---|
| Lugt | Odorless |
| Anbefalet opbevaring | Omgivende temperaturer |
| Sundhedsfare 3 | P280-P305+P351+P338-P310 |
| Sundhedsfare 1 | H318 |
| Opløselighedsinformation | Insoluble in water,acids and bases. |
| TSCA | Yes |
| Molekylær formel | Styrene-DVB |
| MDL nummer | MFCD00166430 |
|---|---|
| CAS | 39409-19-3 |
Amberlite™ IRC120 Na ion exchange resin
CAS: 78922-04-0 Molekylær formel: C13H10ClNO4S Molekylvægt (g/mol): 311.736 MDL nummer: MFCD00132707 InChI nøgle: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC navn: 3-[(3-chlorphenyl)sulfonylamino]benzoesyre SMIL: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| MDL nummer | MFCD00132707 |
|---|---|
| PubChem CID | 8190984 |
| Molekylvægt (g/mol) | 311.736 |
| CAS | 78922-04-0 |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| SMIL | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| IUPAC navn | 3-[(3-chlorphenyl)sulfonylamino]benzoesyre |
| InChI nøgle | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| Molekylær formel | C13H10ClNO4S |
Amberlite™ IRC-120(H), ionbytterharpiks, Thermo Scientific Chemicals
CAS: 78922-04-0 Molekylær formel: C13H10ClNO4S Molekylvægt (g/mol): 311.736 MDL nummer: MFCD00132707 InChI nøgle: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC navn: 3-[(3-chlorphenyl)sulfonylamino]benzoesyre SMIL: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| MDL nummer | MFCD00132707 |
|---|---|
| PubChem CID | 8190984 |
| Molekylvægt (g/mol) | 311.736 |
| CAS | 78922-04-0 |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| SMIL | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| IUPAC navn | 3-[(3-chlorphenyl)sulfonylamino]benzoesyre |
| InChI nøgle | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| Molekylær formel | C13H10ClNO4S |
| MDL nummer | MFCD00802695 |
|---|---|
| CAS | 197809-12-4 |