Salte og uorganiske stoffer
En række uorganiske salte og elementære metaller, der kan bruges til store, industrielle formål og daglige laboratorieanvendelser. Produkter er tilgængelige i en række kemiske sammensætninger, mængder, renheder og reagenskvaliteter.
Uorganiske stoffer er grundstoffer og forbindelser, herunder carbonmonoxid, carbondioxid, carbonater, cyanider, cyanater og carbider, der ikke indeholder en carbon-hydrogenbinding. Denne gruppe omfatter også carbonallotroper såsom grafit og grafen.
Fordi organiske kemikalier omfatter kun dem, der indeholder kulstofatomer bundet til brintatomer, størstedelen af grundstofferne i det periodiske system og de fleste stoffer i den materielle verden anses for at være uorganiske kemikalier.
Filtrerede søgeresultater
Gallium metal, packaged in polyethylene bottle, 99.9% (metals basis)
CAS: 7440-55-3 Molekylær formel: Ga Molekylvægt (g/mol): 69.72 MDL nummer: MFCD00134045 InChI nøgle: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC navn: gallium SMIL: [Ga]
| MDL nummer | MFCD00134045 |
|---|---|
| PubChem CID | 5360835 |
| Molekylvægt (g/mol) | 69.72 |
| CAS | 7440-55-3 |
| ChEBI | CHEBI:49631 |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| SMIL | [Ga] |
| IUPAC navn | gallium |
| InChI nøgle | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molekylær formel | Ga |
Gallium metal, packaged in poylethylene bottle, 99.999% (metals basis)
CAS: 7440-55-3 Molekylær formel: Ga Molekylvægt (g/mol): 69.72 MDL nummer: MFCD00134045 InChI nøgle: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC navn: gallium SMIL: [Ga]
| MDL nummer | MFCD00134045 |
|---|---|
| PubChem CID | 5360835 |
| Molekylvægt (g/mol) | 69.72 |
| CAS | 7440-55-3 |
| ChEBI | CHEBI:49631 |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| SMIL | [Ga] |
| IUPAC navn | gallium |
| InChI nøgle | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molekylær formel | Ga |
(3-Chloropropyl)trimethoxysilane, 97+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 2530-87-2 Molekylær formel: C6H15ClO3Si Molekylvægt (g/mol): 198.718 MDL nummer: MFCD00000997 InChI nøgle: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC navn: 3-chlorpropyl(trimethoxy)silan SMIL: CO[Si](CCCCl)(OC)OC
| MDL nummer | MFCD00000997 |
|---|---|
| PubChem CID | 62449 |
| Molekylvægt (g/mol) | 198.718 |
| CAS | 2530-87-2 |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| SMIL | CO[Si](CCCCl)(OC)OC |
| IUPAC navn | 3-chlorpropyl(trimethoxy)silan |
| InChI nøgle | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molekylær formel | C6H15ClO3Si |
Zinc chloride, 1M in diethyl ether, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 7646-85-7 Molekylær formel: Cl2Zn Molekylvægt (g/mol): 136.28 MDL nummer: MFCD00011295 InChI nøgle: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC navn: dichlorzink SMIL: Cl[Zn]Cl
| MDL nummer | MFCD00011295 |
|---|---|
| PubChem CID | 5727 |
| Molekylvægt (g/mol) | 136.28 |
| CAS | 7646-85-7 |
| ChEBI | CHEBI:49976 |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| SMIL | Cl[Zn]Cl |
| IUPAC navn | dichlorzink |
| InChI nøgle | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molekylær formel | Cl2Zn |
Boron trifluoride-dimethyl sulfide complex, purified, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 353-43-5 Molekylær formel: C2H6BF3S Molekylvægt (g/mol): 129.94 MDL nummer: MFCD00013193 InChI nøgle: BRWZPVRDOUWXKE-UHFFFAOYSA-N Synonym: boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles PubChem CID: 71311438 IUPAC navn: dimethylsulfonio(trifluor)boranuid SMIL: CSC.FB(F)F
| MDL nummer | MFCD00013193 |
|---|---|
| PubChem CID | 71311438 |
| Molekylvægt (g/mol) | 129.94 |
| CAS | 353-43-5 |
| Synonym | boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles |
| SMIL | CSC.FB(F)F |
| IUPAC navn | dimethylsulfonio(trifluor)boranuid |
| InChI nøgle | BRWZPVRDOUWXKE-UHFFFAOYSA-N |
| Molekylær formel | C2H6BF3S |
Lithium bis(trimethylsilyl)amide, 20% (ca 1.06M) soln. in THF/ethylbenzene, packaged in resealable septum cap bottle
CAS: 4039-32-1 Molekylær formel: C6H18LiNSi2 Molekylvægt (g/mol): 167.327 MDL nummer: MFCD00008261 InChI nøgle: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC navn: lithium;bis(trimethylsilyl)azanid SMIL: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| MDL nummer | MFCD00008261 |
|---|---|
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.327 |
| CAS | 4039-32-1 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
Bortrifluorid-diethyletherat, 46,5 % BF{3} min, pakket under argon i genlukkelig ChemSeal™ flasker, Thermo Scientific Chemicals
CAS: 109-63-7 Molekylær formel: C4H10BF3O Molekylvægt (g/mol): 141.93 MDL nummer: MFCD00013194 InChI nøgle: KZMGYPLQYOPHEL-UHFFFAOYSA-N PubChem CID: 8000 SMIL: FB(F)F.CCOCC
| MDL nummer | MFCD00013194 |
|---|---|
| PubChem CID | 8000 |
| Molekylvægt (g/mol) | 141.93 |
| CAS | 109-63-7 |
| SMIL | FB(F)F.CCOCC |
| InChI nøgle | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molekylær formel | C4H10BF3O |
Natriumthiosulfatopløsning 0,1 M (0,1 N), NIST Standardløsning klar til brug til volumetrisk analyse, Fisher Chemical™
CAS: 7772-98-7 Molekylær formel: Na2O3S2 Molekylvægt (g/mol): 158.10 MDL nummer: MFCD00003499 InChI nøgle: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC navn: dinatriumsulfanidsulfonat SMIL: [Na+].[Na+].[O-]S([S-])(=O)=O
| MDL nummer | MFCD00003499 |
|---|---|
| PubChem CID | 61475 |
| Molekylvægt (g/mol) | 158.10 |
| CAS | 7772-98-7 |
| ChEBI | CHEBI:32150 |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| SMIL | [Na+].[Na+].[O-]S([S-])(=O)=O |
| IUPAC navn | dinatriumsulfanidsulfonat |
| InChI nøgle | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molekylær formel | Na2O3S2 |
| MDL nummer | MFCD00003414 |
|---|---|
| Lineær formel | AgNO3 |
| Sundhedsfare 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. If skin irritation occurs: Get medical advice/attention. IF IN EYES: Rinse cautiously with wa |
| Sundhedsfare 2 | GHS H Statement May be corrosive to metals. Causes skin irritation. Causes serious eye irritation. Very toxic to aquatic life with long lasting effects. |
| Sundhedsfare 1 | GHS-signalord: Advarsel |
| Formel vægt | 169.87 |
| Emballage | HDPE flaske |
| ChEBI | CHEBI:32130 |
| IUPAC navn | sølv(1+)nitrat |
| Grad | Ren |
| Navn note | 0.1 N Standard Solution |
| PubChem CID | 24470 |
| Tæthed | 1.0150g/mL |
| Molekylvægt (g/mol) | 169.87 |
| Fieser | 01,1008; 02,366; 03,252; 04,429; 05,582; 07,321; 09,411; 10,350; 11,268; 12,257; 14,350; 15,39 |
| SMIL | [Ag+].[O-][N+]([O-])=O |
| InChI nøgle | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Kemisk navn eller materiale | Silver nitrate |
| Specifik vægtfylde | 1.015 |
| Opløselighedsinformation | Solubility in water: miscible. |
| Merck Index | 15, 8657 |
| Fysisk form | Væske |
| Farve | Farveløs |
| Koncentration eller sammensætning (efter analyt eller komponenter) | 0.0998 to 0.1002N (20°C) |
| EINECS nummer | 231-853-9 |
| CAS | 7732-18-5 |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| Molekylær formel | AgNO3 |
Natriumthiosulfatopløsning 0,1 M (0,1 N), NIST Standardløsning klar til brug til volumetrisk analyse, Fisher Chemical™
H10Na2O8S2, CAS-nummer-10102-17-7, ametox, antichlor, ccris 3952, dinatriumthiosulfatpentahydrat, natriumhyposulfitpentahydrat, natriumthiosulfatpentahydrat, natriumthiosulfat, pentahydrat, thiosulfuric acid, tinverta, dinatriumsalt, tinverta, dinatriumsalt unii-hx1032v43m, 1L, CHEBI:32150
Natriumhypochlorit, teknisk, opløsning, Fisher Chemical™
CAS: 7681-52-9 Molekylær formel: ClNaO Molekylvægt (g/mol): 74.439 MDL nummer: 11120 InChI nøgle: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonym: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution PubChem CID: 23665760 ChEBI: CHEBI:32146 IUPAC navn: natrium; hypochlorit SMIL: [O-]Cl.[Na+]
| MDL nummer | 11120 |
|---|---|
| PubChem CID | 23665760 |
| Molekylvægt (g/mol) | 74.439 |
| CAS | 7681-52-9 |
| ChEBI | CHEBI:32146 |
| Synonym | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| SMIL | [O-]Cl.[Na+] |
| IUPAC navn | natrium; hypochlorit |
| InChI nøgle | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| Molekylær formel | ClNaO |
Orthophosphorsyre, 85+%, certificeret AR til analyse, Fisher Chemical™
CAS: 7664-38-2 Molekylær formel: H3O4P Molekylvægt (g/mol): 97.994 MDL nummer: 11340 InChI nøgle: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC navn: fosforsyre SMIL: OP(=O)(O)O
| MDL nummer | 11340 |
|---|---|
| PubChem CID | 1004 |
| Molekylvægt (g/mol) | 97.994 |
| CAS | 7664-38-2 |
| ChEBI | CHEBI:26078 |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| SMIL | OP(=O)(O)O |
| IUPAC navn | fosforsyre |
| InChI nøgle | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molekylær formel | H3O4P |
| MDL nummer | 11428 |
|---|
Orthophosphorsyre, 85+%, ekstra ren, spejlreflekskamera, Fisher Chemical™
CAS: 7664-38-2 Molekylær formel: H3O4P Molekylvægt (g/mol): 97.994 MDL nummer: 11340 InChI nøgle: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC navn: fosforsyre SMIL: OP(=O)(O)O
| MDL nummer | 11340 |
|---|---|
| PubChem CID | 1004 |
| Molekylvægt (g/mol) | 97.994 |
| CAS | 7664-38-2 |
| ChEBI | CHEBI:26078 |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| SMIL | OP(=O)(O)O |
| IUPAC navn | fosforsyre |
| InChI nøgle | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molekylær formel | H3O4P |