Organiske forbindelser
Organiske forbindelser er en klasse af kemiske forbindelser, der indeholder et eller flere carbonatomer kovalent bundet til hinanden og atomer af andre grundstoffer såsom brint, oxygen, nitrogen, svovl osv.
Forbindelser eller allotroper af carbon, der kun indeholder carbonatomer, klassificeres som uorganiske forbindelser og udviser nye egenskaber.
Denne klasse af kemikalier har en bred vifte af anvendelser og omfatter grafit, diamant og det nyere opdagede grafen, fullerener og andre kulstofnanorør. Faktisk er størstedelen af grundstofferne i det periodiske system af grundstoffer uorganiske forbindelser.
Filtrerede søgeresultater
Tetrakis(triphenylphosphin)palladium(0), 99 %, Thermo Scientific Chemicals
CAS: 14221-01-3 Molekylær formel: C72H60P4Pd Molekylvægt (g/mol): 1155.59 MDL nummer: MFCD00010012 InChI nøgle: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC navn: palladium;triphenylphosphan SMIL: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00010012 |
|---|---|
| PubChem CID | 11979704 |
| Molekylvægt (g/mol) | 1155.59 |
| CAS | 14221-01-3 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| SMIL | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | palladium;triphenylphosphan |
| InChI nøgle | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molekylær formel | C72H60P4Pd |
Bis(dibenzylidenacetone)palladium(0), Thermo Scientific Chemicals
CAS: 32005-36-0 Molekylær formel: C34H28O2Pd Molekylvægt (g/mol): 575.02 MDL nummer: MFCD00051942 InChI nøgle: UKSZBOKPHAQOMP-SVLSSHOZSA-N Synonym: bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 PubChem CID: 6505921 IUPAC navn: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-on; palladium SMIL: [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1
| MDL nummer | MFCD00051942 |
|---|---|
| PubChem CID | 6505921 |
| Molekylvægt (g/mol) | 575.02 |
| CAS | 32005-36-0 |
| Synonym | bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 |
| SMIL | [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| IUPAC navn | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-on; palladium |
| InChI nøgle | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| Molekylær formel | C34H28O2Pd |
Bis(tri-tert-butylphosphine)palladium(0)
CAS: 53199-31-8 Molekylær formel: C24H54P2Pd Molekylvægt (g/mol): 511.06 MDL nummer: MFCD03094580 InChI nøgle: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 IUPAC navn: palladium; tritert-butylphosphan SMIL: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| MDL nummer | MFCD03094580 |
|---|---|
| PubChem CID | 2734558 |
| Molekylvægt (g/mol) | 511.06 |
| CAS | 53199-31-8 |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| SMIL | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| IUPAC navn | palladium; tritert-butylphosphan |
| InChI nøgle | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molekylær formel | C24H54P2Pd |
Bis(tricyclohexylphosphine)palladium(0), 97% min
CAS: 33309-88-5 Molekylær formel: C36H66P2Pd Molekylvægt (g/mol): 667.29 MDL nummer: MFCD01073796 InChI nøgle: JGBZTJWQMWZVNX-UHFFFAOYSA-N Synonym: bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o PubChem CID: 2734559 IUPAC navn: palladium;tricyclohexylphosphan SMIL: [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| MDL nummer | MFCD01073796 |
|---|---|
| PubChem CID | 2734559 |
| Molekylvægt (g/mol) | 667.29 |
| CAS | 33309-88-5 |
| Synonym | bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o |
| SMIL | [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| IUPAC navn | palladium;tricyclohexylphosphan |
| InChI nøgle | JGBZTJWQMWZVNX-UHFFFAOYSA-N |
| Molekylær formel | C36H66P2Pd |
Bis(tri-tert-butylphosphine)palladium(0), 98%
CAS: 53199-31-8 Molekylær formel: C24H54P2Pd Molekylvægt (g/mol): 511.06 MDL nummer: MFCD03094580 InChI nøgle: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 SMIL: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| MDL nummer | MFCD03094580 |
|---|---|
| PubChem CID | 2734558 |
| Molekylvægt (g/mol) | 511.06 |
| CAS | 53199-31-8 |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| SMIL | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| InChI nøgle | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molekylær formel | C24H54P2Pd |
Bis[1,2-bis(diphenylphosphino)ethan]palladium(0), Thermo Scientific Chemicals
CAS: 31277-98-2 Molekylær formel: C52H48P4Pd Molekylvægt (g/mol): 903.27 MDL nummer: MFCD00009880 InChI nøgle: FAFGMAGIYHHRKN-UHFFFAOYSA-N Synonym: bis 1,2-bis diphenylphosphino ethane palladium 0,pd dppe 2,pd diphos 2,bis diphos palladium 0,bis 1,2-bis diphenylphosphino ethane palladium,bis diphos palladium,bis 1,2-bis diphenylphosphino ethane-palladium 0,bis 1,2-bis diphenylphosphino ethane-palladium PubChem CID: 2724231 IUPAC navn: 2-diphenylphosphanylethyl(diphenyl)phosphan;palladium SMIL: [Pd].C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00009880 |
|---|---|
| PubChem CID | 2724231 |
| Molekylvægt (g/mol) | 903.27 |
| CAS | 31277-98-2 |
| Synonym | bis 1,2-bis diphenylphosphino ethane palladium 0,pd dppe 2,pd diphos 2,bis diphos palladium 0,bis 1,2-bis diphenylphosphino ethane palladium,bis diphos palladium,bis 1,2-bis diphenylphosphino ethane-palladium 0,bis 1,2-bis diphenylphosphino ethane-palladium |
| SMIL | [Pd].C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | 2-diphenylphosphanylethyl(diphenyl)phosphan;palladium |
| InChI nøgle | FAFGMAGIYHHRKN-UHFFFAOYSA-N |
| Molekylær formel | C52H48P4Pd |
Bis(3,5,3',5'-dimethoxydibenzylidenacetone)palladium(0), 97 %, Thermo Scientific Chemicals
CAS: 811862-77-8 Molekylær formel: C42H44O10Pd Molekylvægt (g/mol): 815.22 MDL nummer: MFCD07369799 InChI nøgle: RTGAJOPJZJDWAX-UHFFFAOYSA-N Synonym: bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium PubChem CID: 24777333 SMIL: [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1
| MDL nummer | MFCD07369799 |
|---|---|
| PubChem CID | 24777333 |
| Molekylvægt (g/mol) | 815.22 |
| CAS | 811862-77-8 |
| Synonym | bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium |
| SMIL | [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1 |
| InChI nøgle | RTGAJOPJZJDWAX-UHFFFAOYSA-N |
| Molekylær formel | C42H44O10Pd |
Tetrakis(triphenylphosphine)palladium(0), 99.9%, (trace metal basis)
CAS: 14221-01-3 Molekylær formel: C72H60P4Pd Molekylvægt (g/mol): 1155.59 MDL nummer: MFCD00010012 InChI nøgle: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC navn: palladium;triphenylphosphan SMIL: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00010012 |
|---|---|
| PubChem CID | 11979704 |
| Molekylvægt (g/mol) | 1155.59 |
| CAS | 14221-01-3 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| SMIL | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | palladium;triphenylphosphan |
| InChI nøgle | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molekylær formel | C72H60P4Pd |
Bis(di-tert-butyl-phenylphosphine)palladium(0), 98%
CAS: 52359-17-8 Molekylær formel: C28H46P2Pd Molekylvægt (g/mol): 551.04 MDL nummer: MFCD15071400 InChI nøgle: KJTQUBRAVOMHKY-UHFFFAOYSA-N Synonym: palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium PubChem CID: 71365671 IUPAC navn: ditert-butyl(phenyl)phosphan; palladium SMIL: [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C
| MDL nummer | MFCD15071400 |
|---|---|
| PubChem CID | 71365671 |
| Molekylvægt (g/mol) | 551.04 |
| CAS | 52359-17-8 |
| Synonym | palladium, bis bis 1,1-dimethylethyl phenylphosphine,di-tert-butyl phenyl phosphane-palladium 2/1,bis di-tert-butyl phenyl phosphane palladium |
| SMIL | [Pd].CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C.CC(C)(C)P(C1=CC=CC=C1)C(C)(C)C |
| IUPAC navn | ditert-butyl(phenyl)phosphan; palladium |
| InChI nøgle | KJTQUBRAVOMHKY-UHFFFAOYSA-N |
| Molekylær formel | C28H46P2Pd |
Bis(tri-o-tolylphosphine)palladium(0), Pd 14.9%
CAS: 69861-71-8 Molekylær formel: C42H42P2Pd Molekylvægt (g/mol): 715.166 MDL nummer: MFCD12911908 InChI nøgle: CUBIJGNGGJBNOC-UHFFFAOYSA-N Synonym: bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium PubChem CID: 10952654 IUPAC navn: palladium;tris(2-methylphenyl)phosphan SMIL: CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd]
| MDL nummer | MFCD12911908 |
|---|---|
| PubChem CID | 10952654 |
| Molekylvægt (g/mol) | 715.166 |
| CAS | 69861-71-8 |
| Synonym | bis tri-o-tolylphosphine palladium 0,pd o-tol 3p 2,bis tris 2-methylphenyl phosphine palladium,bis tris 2-tolyl phosphine palladium,palladium, bis tris 2-methylphenyl phosphine,bis tris 2-methylphenyl phosphane palladium |
| SMIL | CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C.[Pd] |
| IUPAC navn | palladium;tris(2-methylphenyl)phosphan |
| InChI nøgle | CUBIJGNGGJBNOC-UHFFFAOYSA-N |
| Molekylær formel | C42H42P2Pd |
Tetrakis(triphenylphosphine)palladium(0), 99.8% (metals basis), Pd 9% min
CAS: 14221-01-3 Molekylær formel: C72H60P4Pd Molekylvægt (g/mol): 1155.59 MDL nummer: MFCD00010012 InChI nøgle: NFHFRUOZVGFOOS-UHFFFAOYSA-N PubChem CID: 11979704 SMIL: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00010012 |
|---|---|
| PubChem CID | 11979704 |
| Molekylvægt (g/mol) | 1155.59 |
| CAS | 14221-01-3 |
| SMIL | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| InChI nøgle | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molekylær formel | C72H60P4Pd |
Bis[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(0), Pd 16.7%
CAS: 1233717-68-4 Molekylær formel: C32H56N2P2Pd Molekylvægt (g/mol): 637.182 MDL nummer: MFCD15071402 InChI nøgle: SSPOQURGNAWORH-UHFFFAOYSA-N Synonym: bis di-tert-butyl 4-dimethylaminophenyl phosphine palladium 0,bis 4-n,n-dimethylamino phenyl di-t-butylphosphino palladium 0,bis 4-di-tert-butylphosphanyl-n,n-dimethylaniline palladium PubChem CID: 46900632 IUPAC navn: 4-ditert-butylphosphanyl-N,N-dimethylanilin; palladium SMIL: CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.[Pd]
| MDL nummer | MFCD15071402 |
|---|---|
| PubChem CID | 46900632 |
| Molekylvægt (g/mol) | 637.182 |
| CAS | 1233717-68-4 |
| Synonym | bis di-tert-butyl 4-dimethylaminophenyl phosphine palladium 0,bis 4-n,n-dimethylamino phenyl di-t-butylphosphino palladium 0,bis 4-di-tert-butylphosphanyl-n,n-dimethylaniline palladium |
| SMIL | CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.[Pd] |
| IUPAC navn | 4-ditert-butylphosphanyl-N,N-dimethylanilin; palladium |
| InChI nøgle | SSPOQURGNAWORH-UHFFFAOYSA-N |
| Molekylær formel | C32H56N2P2Pd |
Tetrakis(triphenylphosphine)palladium(0), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Tris(dibenzylidenacetone)dipalladium(0), 97 %, Thermo Scientific Chemicals
CAS: 51364-51-3 Molekylær formel: C51H42O3Pd2 Molekylvægt (g/mol): 915.73 MDL nummer: MFCD00013310 InChI nøgle: CYPYTURSJDMMMP-UHFFFAOYSA-N Synonym: tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium PubChem CID: 9811564 IUPAC navn: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-on; palladium SMIL: [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1
| MDL nummer | MFCD00013310 |
|---|---|
| PubChem CID | 9811564 |
| Molekylvægt (g/mol) | 915.73 |
| CAS | 51364-51-3 |
| Synonym | tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium |
| SMIL | [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1 |
| IUPAC navn | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-on; palladium |
| InChI nøgle | CYPYTURSJDMMMP-UHFFFAOYSA-N |
| Molekylær formel | C51H42O3Pd2 |