Metalloid salte
Filtrerede søgeresultater
Boron trifluoride, 12% (1.5M) in methanol
Boron trifluoride, 12% (1.5M) in methanol, Quantity: 500g, Packaging: Glass bottle, Boiling Point: 65.0 deg.C, CAS: 373-57-9, 67-56-1, Amber to Colorless, Melting Point: -98.0 deg.C, Molecular Formula: BF3, Molecular Weight: 67.81, Percent Purity: 10 to 15% (w/v BF3) | CAS: 373-57-9 | BF3 | 67.81 g/mol
| MDL nummer | MFCD00011316 |
|---|---|
| Lineær formel | BF3 |
| Sundhedsfare 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 67.81 |
| Emballage | Glasflaske |
| Procent renhed | 10 to 15% (w/v BF3) |
| Navn note | 1.5M solution in methanol |
| PubChem CID | 11062313 |
| Tæthed | 0.8700g/mL |
| Molekylvægt (g/mol) | 67.81 |
| Smeltepunkt | -98.0°C |
| SMIL | FB(F)F |
| Kogepunkt | 65.0°C |
| Flammepunkt | 4°C |
| InChI nøgle | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Kemisk navn eller materiale | Boron trifluoride |
| Specifik vægtfylde | 0.87 |
| Opløselighedsinformation | Solubility in water: may decompose |
| RTECS nummer | ED2275000 |
| Merck Index | 14, 1349 |
| Fysisk form | Løsning |
| Farve | Rav til farveløs |
| EINECS nummer | 206-766-4 |
| CAS | 67-56-1 |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| TSCA | TSCA |
| Molekylær formel | BF3 |
(Jodmethyl)trimethylsilan, 99 %, Thermo Scientific Chemicals
CAS: 4206-67-1 Molekylær formel: C4H11ISi Molekylvægt (g/mol): 214.121 MDL nummer: MFCD00001077 InChI nøgle: VZNYXGQMDSRJAL-UHFFFAOYSA-N Synonym: iodomethyl trimethylsilane,iodomethyl-trimethylsilane,iodomethyl trimethyl silane,trimethylsilyl methyl iodide,sila-neopentyliodide,trimethylsilylmethyl iodide,acmc-209jn7,trimethyl iodomethyl silane,iodanylmethyl trimethyl silane PubChem CID: 77877 IUPAC navn: iodmethyl(trimethyl)silan SMIL: C[Si](C)(C)CI
| MDL nummer | MFCD00001077 |
|---|---|
| PubChem CID | 77877 |
| Molekylvægt (g/mol) | 214.121 |
| CAS | 4206-67-1 |
| Synonym | iodomethyl trimethylsilane,iodomethyl-trimethylsilane,iodomethyl trimethyl silane,trimethylsilyl methyl iodide,sila-neopentyliodide,trimethylsilylmethyl iodide,acmc-209jn7,trimethyl iodomethyl silane,iodanylmethyl trimethyl silane |
| SMIL | C[Si](C)(C)CI |
| IUPAC navn | iodmethyl(trimethyl)silan |
| InChI nøgle | VZNYXGQMDSRJAL-UHFFFAOYSA-N |
| Molekylær formel | C4H11ISi |
(3-Aminopropyl)triethoxysilane, 98%
CAS: 919-30-2 Molekylær formel: C9H23NO3Si Molekylvægt (g/mol): 221.37 MDL nummer: MFCD00008207,MFCD01324904 InChI nøgle: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC navn: 3-triethoxysilylpropan-1-amin SMIL: CCO[Si](CCCN)(OCC)OCC
| MDL nummer | MFCD00008207,MFCD01324904 |
|---|---|
| PubChem CID | 13521 |
| Molekylvægt (g/mol) | 221.37 |
| CAS | 919-30-2 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| SMIL | CCO[Si](CCCN)(OCC)OCC |
| IUPAC navn | 3-triethoxysilylpropan-1-amin |
| InChI nøgle | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| Molekylær formel | C9H23NO3Si |
Tetramethylsilan, 99,9 %, Thermo Scientific Chemicals
CAS: 75-76-3 Molekylær formel: C4H12Si Molekylvægt (g/mol): 88.23 MDL nummer: MFCD00008274 InChI nøgle: CZDYPVPMEAXLPK-UHFFFAOYSA-N Synonym: silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 PubChem CID: 6396 ChEBI: CHEBI:85361 IUPAC navn: tetramethylsilan SMIL: C[Si](C)(C)C
| MDL nummer | MFCD00008274 |
|---|---|
| PubChem CID | 6396 |
| Molekylvægt (g/mol) | 88.23 |
| CAS | 75-76-3 |
| ChEBI | CHEBI:85361 |
| Synonym | silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 |
| SMIL | C[Si](C)(C)C |
| IUPAC navn | tetramethylsilan |
| InChI nøgle | CZDYPVPMEAXLPK-UHFFFAOYSA-N |
| Molekylær formel | C4H12Si |
Silicon(IV) oxide, powder, 0.5 micron, 99.9%
CAS: 7631-86-9 Molekylær formel: O2Si Molekylvægt (g/mol): 60.08 MDL nummer: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI nøgle: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC navn: dioxosilan SMIL: O=[Si]=O
| MDL nummer | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
|---|---|
| PubChem CID | 24261 |
| Molekylvægt (g/mol) | 60.08 |
| CAS | 7631-86-9 |
| ChEBI | CHEBI:30563 |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| SMIL | O=[Si]=O |
| IUPAC navn | dioxosilan |
| InChI nøgle | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molekylær formel | O2Si |
Antimony(III) oxide, 99.9% (metals basis)
CAS: 1309-64-4 Molekylær formel: O3Sb2 Molekylvægt (g/mol): 291.52 MDL nummer: MFCD00011214 InChI nøgle: GHPGOEFPKIHBNM-UHFFFAOYSA-N IUPAC navn: diantimon(3+)trioxidandiid SMIL: [O--].[O--].[O--].[Sb+3].[Sb+3]
| MDL nummer | MFCD00011214 |
|---|---|
| Molekylvægt (g/mol) | 291.52 |
| CAS | 1309-64-4 |
| SMIL | [O--].[O--].[O--].[Sb+3].[Sb+3] |
| IUPAC navn | diantimon(3+)trioxidandiid |
| InChI nøgle | GHPGOEFPKIHBNM-UHFFFAOYSA-N |
| Molekylær formel | O3Sb2 |
Kaliumtetrafluorborat, 98 %, Thermo Scientific Chemicals
CAS: 14075-53-7 Molekylær formel: BF4K Molekylvægt (g/mol): 125.90 MDL nummer: MFCD00011395 InChI nøgle: AKEBROIVCDHVSD-UHFFFAOYSA-N Synonym: potassium tetrafluoroborate,potassium fluoroborate,potassium fluoborate,potassium borofluoride,avogadrite,potassium boron fluoride,potassium fluorohydroborate,potassium hydrofluoroborate,boron potassium fluoride,potassium boride fluoride PubChem CID: 518872 IUPAC navn: kaliumtetrafluorboranid SMIL: [K+].F[B-](F)(F)F
| MDL nummer | MFCD00011395 |
|---|---|
| PubChem CID | 518872 |
| Molekylvægt (g/mol) | 125.90 |
| CAS | 14075-53-7 |
| Synonym | potassium tetrafluoroborate,potassium fluoroborate,potassium fluoborate,potassium borofluoride,avogadrite,potassium boron fluoride,potassium fluorohydroborate,potassium hydrofluoroborate,boron potassium fluoride,potassium boride fluoride |
| SMIL | [K+].F[B-](F)(F)F |
| IUPAC navn | kaliumtetrafluorboranid |
| InChI nøgle | AKEBROIVCDHVSD-UHFFFAOYSA-N |
| Molekylær formel | BF4K |
Arsenic(III) oxide, 99.5% (metals basis)
CAS: 1327-53-3 Molekylær formel: As2O3 Molekylvægt (g/mol): 197.84 MDL nummer: MFCD00003433 InChI nøgle: IKWTVSLWAPBBKU-UHFFFAOYSA-N Synonym: Arsenic trioxide IUPAC navn: diarsorosooxidan SMIL: O=[As]O[As]=O
| MDL nummer | MFCD00003433 |
|---|---|
| Molekylvægt (g/mol) | 197.84 |
| CAS | 1327-53-3 |
| Synonym | Arsenic trioxide |
| SMIL | O=[As]O[As]=O |
| IUPAC navn | diarsorosooxidan |
| InChI nøgle | IKWTVSLWAPBBKU-UHFFFAOYSA-N |
| Molekylær formel | As2O3 |
Tellur(IV)iodid, 99% (metalbasis), Thermo Scientific Chemicals
CAS: 7790-48-9 Molekylær formel: I4Te Molekylvægt (g/mol): 635.218 MDL nummer: MFCD00049578 InChI nøgle: XCOKHDCPVWVFKS-UHFFFAOYSA-N Synonym: tellurium tetraiodide,tellurium iv iodide,tellurium iodide tei4 , t-4,unii-zb48i033v5,tetraiodo-,e4-tellane,tei4,tellurium iv iodide-te PubChem CID: 82255 SMIL: [Te](I)(I)(I)I
| MDL nummer | MFCD00049578 |
|---|---|
| PubChem CID | 82255 |
| Molekylvægt (g/mol) | 635.218 |
| CAS | 7790-48-9 |
| Synonym | tellurium tetraiodide,tellurium iv iodide,tellurium iodide tei4 , t-4,unii-zb48i033v5,tetraiodo-,e4-tellane,tei4,tellurium iv iodide-te |
| SMIL | [Te](I)(I)(I)I |
| InChI nøgle | XCOKHDCPVWVFKS-UHFFFAOYSA-N |
| Molekylær formel | I4Te |
Nitrosonium tetrafluoroborate, 98%
CAS: 14635-75-7 Molekylær formel: BF4HNO2 Molekylvægt (g/mol): 133.82 MDL nummer: MFCD00011433 InChI nøgle: XYRQURYIJKJVSF-UHFFFAOYSA-N Synonym: nitrosonium tetrafluoroborate,nitrosyl tetrafluoroborate,nitrosyltetrafluoroborate,nobf4,nitrilooxonium tetrafluoroborate,azanylidyneoxidanium tetrafluoroborate PubChem CID: 11137142 IUPAC navn: azanylidynoxidanium;tetrafluorborat SMIL: [O-][NH+]=O.F[B-](F)(F)F
| MDL nummer | MFCD00011433 |
|---|---|
| PubChem CID | 11137142 |
| Molekylvægt (g/mol) | 133.82 |
| CAS | 14635-75-7 |
| Synonym | nitrosonium tetrafluoroborate,nitrosyl tetrafluoroborate,nitrosyltetrafluoroborate,nobf4,nitrilooxonium tetrafluoroborate,azanylidyneoxidanium tetrafluoroborate |
| SMIL | [O-][NH+]=O.F[B-](F)(F)F |
| IUPAC navn | azanylidynoxidanium;tetrafluorborat |
| InChI nøgle | XYRQURYIJKJVSF-UHFFFAOYSA-N |
| Molekylær formel | BF4HNO2 |
Triethylsilanol, 97 %, Thermo Scientific Chemicals
CAS: 597-52-4 Molekylær formel: C6H16OSi Molekylvægt (g/mol): 132.278 MDL nummer: MFCD00042640 InChI nøgle: WVMSIBFANXCZKT-UHFFFAOYSA-N Synonym: triethylsilanol,silanol, triethyl,hydroxytriethylsilane,silanol, 1,1,1-triethyl,triethyl hydroxy silane,triethyl hydroxy silicon,tesoh,c2h5 3sioh,acmc-1an47 PubChem CID: 69005 IUPAC navn: triethyl(hydroxy)silan SMIL: CC[Si](CC)(CC)O
| MDL nummer | MFCD00042640 |
|---|---|
| PubChem CID | 69005 |
| Molekylvægt (g/mol) | 132.278 |
| CAS | 597-52-4 |
| Synonym | triethylsilanol,silanol, triethyl,hydroxytriethylsilane,silanol, 1,1,1-triethyl,triethyl hydroxy silane,triethyl hydroxy silicon,tesoh,c2h5 3sioh,acmc-1an47 |
| SMIL | CC[Si](CC)(CC)O |
| IUPAC navn | triethyl(hydroxy)silan |
| InChI nøgle | WVMSIBFANXCZKT-UHFFFAOYSA-N |
| Molekylær formel | C6H16OSi |
2,4,6,8-Tetramethylcyclotetrasiloxane, 99%
CAS: 2370-88-9 Molekylær formel: C4H12O4Si4 Molekylvægt (g/mol): 236.476 MDL nummer: MFCD00039567 InChI nøgle: WZJUBBHODHNQPW-UHFFFAOYSA-N Synonym: 2,4,6,8-tetramethylcyclotetrasiloxane,1,3,5,7-tetramethylcyclotetrasiloxane,tetramethylcyclotetrasiloxane,tmcts,cyclotetrasiloxane, 2,4,6,8-tetramethyl,2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane,1,2,5,7-tetramethylcyclotetrasiloxane,2,4,6,8-tetramethyl-cyclotetrasiloxan,2,4,6,8-tetramethylcyclotetrasiloxne,1,3,5,7-tetramethyl cyclotetrasiloxane PubChem CID: 6327421 IUPAC navn: 2,4,6,8-tetramethyl-5,7-dioxa-1,3-dioxonia-2,4-disila-6,8-disilanidacycloocta-1,3-dien SMIL: C[Si-]1O[Si-]([O+]=[Si]([O+]=[Si](O1)C)C)C
| MDL nummer | MFCD00039567 |
|---|---|
| PubChem CID | 6327421 |
| Molekylvægt (g/mol) | 236.476 |
| CAS | 2370-88-9 |
| Synonym | 2,4,6,8-tetramethylcyclotetrasiloxane,1,3,5,7-tetramethylcyclotetrasiloxane,tetramethylcyclotetrasiloxane,tmcts,cyclotetrasiloxane, 2,4,6,8-tetramethyl,2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane,1,2,5,7-tetramethylcyclotetrasiloxane,2,4,6,8-tetramethyl-cyclotetrasiloxan,2,4,6,8-tetramethylcyclotetrasiloxne,1,3,5,7-tetramethyl cyclotetrasiloxane |
| SMIL | C[Si-]1O[Si-]([O+]=[Si]([O+]=[Si](O1)C)C)C |
| IUPAC navn | 2,4,6,8-tetramethyl-5,7-dioxa-1,3-dioxonia-2,4-disila-6,8-disilanidacycloocta-1,3-dien |
| InChI nøgle | WZJUBBHODHNQPW-UHFFFAOYSA-N |
| Molekylær formel | C4H12O4Si4 |
(Trimethylsilyl)acetylene, 98%
CAS: 1066-54-2 Molekylær formel: C5H10Si Molekylvægt (g/mol): 98.22 MDL nummer: MFCD00008569 InChI nøgle: CWMFRHBXRUITQE-UHFFFAOYSA-N Synonym: trimethylsilylacetylene,trimethylsilyl acetylene,silane, ethynyltrimethyl,ethynyl-trimethyl-silane,ethynyl trimethyl silane,tms acetylene,ethynyltrimethyl silane,trimethylsilyl-acetylene,tmsacetylene PubChem CID: 66111 IUPAC navn: ethynyl(trimethyl)silan SMIL: C[Si](C)(C)C#C
| MDL nummer | MFCD00008569 |
|---|---|
| PubChem CID | 66111 |
| Molekylvægt (g/mol) | 98.22 |
| CAS | 1066-54-2 |
| Synonym | trimethylsilylacetylene,trimethylsilyl acetylene,silane, ethynyltrimethyl,ethynyl-trimethyl-silane,ethynyl trimethyl silane,tms acetylene,ethynyltrimethyl silane,trimethylsilyl-acetylene,tmsacetylene |
| SMIL | C[Si](C)(C)C#C |
| IUPAC navn | ethynyl(trimethyl)silan |
| InChI nøgle | CWMFRHBXRUITQE-UHFFFAOYSA-N |
| Molekylær formel | C5H10Si |
Nitronium tetrafluoroborate, 96%
CAS: 13826-86-3 Molekylær formel: BF4NO2 Molekylvægt (g/mol): 132.81 MDL nummer: MFCD00011432 InChI nøgle: XYRQURYIJKJVSF-UHFFFAOYSA-N Synonym: nitronium tetrafluoroborate,nitronium ion tetrafluoroborate,nitronium tetrafluoroboron,nitroniumtetrafluoroborate,nitronium.tetrafluoroborate,nitronium tetrafluoroborate, 0.3-0.5m solution in sulfolane PubChem CID: 11073463 SMIL: [O-][NH+]=O.F[B-](F)(F)F
| MDL nummer | MFCD00011432 |
|---|---|
| PubChem CID | 11073463 |
| Molekylvægt (g/mol) | 132.81 |
| CAS | 13826-86-3 |
| Synonym | nitronium tetrafluoroborate,nitronium ion tetrafluoroborate,nitronium tetrafluoroboron,nitroniumtetrafluoroborate,nitronium.tetrafluoroborate,nitronium tetrafluoroborate, 0.3-0.5m solution in sulfolane |
| SMIL | [O-][NH+]=O.F[B-](F)(F)F |
| InChI nøgle | XYRQURYIJKJVSF-UHFFFAOYSA-N |
| Molekylær formel | BF4NO2 |
4-Trimethylsilyl-3-butyn-2-ol, 97%
CAS: 6999-19-5 Molekylær formel: C7H14OSi Molekylvægt (g/mol): 142.273 MDL nummer: MFCD00190213 InChI nøgle: HJJSDJHRTMFJLP-UHFFFAOYSA-N Synonym: 4-trimethylsilyl-3-butyn-2-ol,4-trimethylsilyl but-3-yn-2-ol,1-trimethylsilylbut-1-yne-3-ol,+/-4-trimethylsilyl-3-butyn-2-ol,acmc-20mpjc,3-butyn-2-ol, 4-trimethylsilyl-, 2s,acmc-1bfey,hjjsdjhrtmfjlp-uhfffaoysa,3-butyn-2-ol,4-trimethylsilyl PubChem CID: 2760828 IUPAC navn: 4-trimethylsilylbut-3-yn-2-ol SMIL: CC(C#C[Si](C)(C)C)O
| MDL nummer | MFCD00190213 |
|---|---|
| PubChem CID | 2760828 |
| Molekylvægt (g/mol) | 142.273 |
| CAS | 6999-19-5 |
| Synonym | 4-trimethylsilyl-3-butyn-2-ol,4-trimethylsilyl but-3-yn-2-ol,1-trimethylsilylbut-1-yne-3-ol,+/-4-trimethylsilyl-3-butyn-2-ol,acmc-20mpjc,3-butyn-2-ol, 4-trimethylsilyl-, 2s,acmc-1bfey,hjjsdjhrtmfjlp-uhfffaoysa,3-butyn-2-ol,4-trimethylsilyl |
| SMIL | CC(C#C[Si](C)(C)C)O |
| IUPAC navn | 4-trimethylsilylbut-3-yn-2-ol |
| InChI nøgle | HJJSDJHRTMFJLP-UHFFFAOYSA-N |
| Molekylær formel | C7H14OSi |