Organiske iltforbindelser
Filtrerede søgeresultater
Thermo Scientific Chemicals D-(+)-maltosemonohydrat, 95 %
CAS: 6363-53-7 Molekylær formel: C12H24O12 Molekylvægt (g/mol): 360.31 MDL nummer: MFCD00149343 InChI nøgle: HBDJFVFTHLOSDW-UHFFFAOYNA-N Synonym: d-+-maltose monohydrate,unii-dm477ee40d,2r,3r,4r,5r-2,3,5,6-tetrahydroxy-4-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxy hexanal hydrate,beta-maltose monohydrate,d-+-maltosemonohydrate,69-79-4 anhydrous,d +-maltose monohydrate,d-+-maltose monohydrate, puriss.,d-+-maltose monohydrate, analytical standard,d-+-maltose monohydrate, bioxtra IUPAC navn: 2,3,5,6-tetrahydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanalhydrat SMIL: O.OCC(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)C(O)C=O
| MDL nummer | MFCD00149343 |
|---|---|
| Molekylvægt (g/mol) | 360.31 |
| CAS | 6363-53-7 |
| Synonym | d-+-maltose monohydrate,unii-dm477ee40d,2r,3r,4r,5r-2,3,5,6-tetrahydroxy-4-2r,3r,4s,5s,6r-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxy hexanal hydrate,beta-maltose monohydrate,d-+-maltosemonohydrate,69-79-4 anhydrous,d +-maltose monohydrate,d-+-maltose monohydrate, puriss.,d-+-maltose monohydrate, analytical standard,d-+-maltose monohydrate, bioxtra |
| SMIL | O.OCC(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)C(O)C=O |
| IUPAC navn | 2,3,5,6-tetrahydroxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanalhydrat |
| InChI nøgle | HBDJFVFTHLOSDW-UHFFFAOYNA-N |
| Molekylær formel | C12H24O12 |
Diethylenglycol, certificeret AR til analyse, Fisher Chemical™
CAS: 111-46-6 Molekylær formel: C4H10O3 Molekylvægt (g/mol): 106.12 MDL nummer: MFCD00002882 InChI nøgle: MTHSVFCYNBDYFN-UHFFFAOYSA-N Synonym: diethylene glycol,2,2'-oxydiethanol,diglycol,diethylenglykol,2-hydroxyethyl ether,bis 2-hydroxyethyl ether,ethanol, 2,2'-oxybis,2,2'-oxybisethanol,2-2-hydroxyethoxy ethanol,digol PubChem CID: 8117 ChEBI: CHEBI:46807 IUPAC navn: 2-(2-hydroxyethoxy)ethanol SMIL: OCCOCCO
| MDL nummer | MFCD00002882 |
|---|---|
| PubChem CID | 8117 |
| Molekylvægt (g/mol) | 106.12 |
| CAS | 111-46-6 |
| ChEBI | CHEBI:46807 |
| Synonym | diethylene glycol,2,2'-oxydiethanol,diglycol,diethylenglykol,2-hydroxyethyl ether,bis 2-hydroxyethyl ether,ethanol, 2,2'-oxybis,2,2'-oxybisethanol,2-2-hydroxyethoxy ethanol,digol |
| SMIL | OCCOCCO |
| IUPAC navn | 2-(2-hydroxyethoxy)ethanol |
| InChI nøgle | MTHSVFCYNBDYFN-UHFFFAOYSA-N |
| Molekylær formel | C4H10O3 |
Isatin, 98%
CAS: 91-56-5 Molekylær formel: C8H5NO2 Molekylvægt (g/mol): 147.13 MDL nummer: MFCD00005718 InChI nøgle: JXDYKVIHCLTXOP-UHFFFAOYSA-N Synonym: isatin,indoline-2,3-dione,2,3-indolinedione,indole-2,3-dione,isatine,2,3-dioxoindoline,pseudoisatin,tribulin,isotin,isatic acid lactam PubChem CID: 7054 ChEBI: CHEBI:27539 IUPAC navn: 1H-indol-2,3-dion SMIL: C1=CC=C2C(=C1)C(=O)C(=O)N2
| MDL nummer | MFCD00005718 |
|---|---|
| PubChem CID | 7054 |
| Molekylvægt (g/mol) | 147.13 |
| CAS | 91-56-5 |
| ChEBI | CHEBI:27539 |
| Synonym | isatin,indoline-2,3-dione,2,3-indolinedione,indole-2,3-dione,isatine,2,3-dioxoindoline,pseudoisatin,tribulin,isotin,isatic acid lactam |
| SMIL | C1=CC=C2C(=C1)C(=O)C(=O)N2 |
| IUPAC navn | 1H-indol-2,3-dion |
| InChI nøgle | JXDYKVIHCLTXOP-UHFFFAOYSA-N |
| Molekylær formel | C8H5NO2 |
L-(+)-Ascorbic acid, 99+%
CAS: 50-81-7 Molekylær formel: C6H8O6 Molekylvægt (g/mol): 176.12 MDL nummer: MFCD00064328 InChI nøgle: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 SMIL: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| MDL nummer | MFCD00064328 |
|---|---|
| PubChem CID | 54670067 |
| Molekylvægt (g/mol) | 176.12 |
| CAS | 50-81-7 |
| ChEBI | CHEBI:29073 |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| SMIL | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| InChI nøgle | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molekylær formel | C6H8O6 |
DL-alpha-Tocopherol, 97+%
CAS: 10191-41-0 Molekylær formel: C29H50O2 Molekylvægt (g/mol): 430.72 MDL nummer: MFCD00072051 InChI nøgle: GVJHHUAWPYXKBD-IEOSBIPESA-N Synonym: vitamin e,alpha-tocopherol,d-alpha-tocopherol,5,7,8-trimethyltocol,+-alpha-tocopherol,r,r,r-alpha-tocopherol,phytogermine,eprolin,2r,4'r,8'r-alpha-tocopherol,dl-a-tocopherol PubChem CID: 14985 ChEBI: CHEBI:18145 IUPAC navn: (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol SMIL: CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(O)=C(C)C(C)=C2O1
| MDL nummer | MFCD00072051 |
|---|---|
| PubChem CID | 14985 |
| Molekylvægt (g/mol) | 430.72 |
| CAS | 10191-41-0 |
| ChEBI | CHEBI:18145 |
| Synonym | vitamin e,alpha-tocopherol,d-alpha-tocopherol,5,7,8-trimethyltocol,+-alpha-tocopherol,r,r,r-alpha-tocopherol,phytogermine,eprolin,2r,4'r,8'r-alpha-tocopherol,dl-a-tocopherol |
| SMIL | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(O)=C(C)C(C)=C2O1 |
| IUPAC navn | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| InChI nøgle | GVJHHUAWPYXKBD-IEOSBIPESA-N |
| Molekylær formel | C29H50O2 |
L(+)-askorbinsyre, 99 %, Thermo Scientific Chemicals
CAS: 50-81-7 Molekylær formel: C6H8O6 Molekylvægt (g/mol): 176.12 MDL nummer: MFCD00064328 InChI nøgle: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 IUPAC navn: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on SMIL: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| MDL nummer | MFCD00064328 |
|---|---|
| PubChem CID | 54670067 |
| Molekylvægt (g/mol) | 176.12 |
| CAS | 50-81-7 |
| ChEBI | CHEBI:29073 |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| SMIL | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| IUPAC navn | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on |
| InChI nøgle | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molekylær formel | C6H8O6 |
Thermo Scientific Chemicals myo-inositol, 98+%
CAS: 87-89-8 Molekylær formel: C6H12O6 Molekylvægt (g/mol): 180.156 MDL nummer: MFCD00077932 InChI nøgle: CDAISMWEOUEBRE-UHFFFAOYSA-N Synonym: scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol PubChem CID: 892 ChEBI: CHEBI:24848 IUPAC navn: cyclohexan-1,2,3,4,5,6-hexol SMIL: C1(C(C(C(C(C1O)O)O)O)O)O
| MDL nummer | MFCD00077932 |
|---|---|
| PubChem CID | 892 |
| Molekylvægt (g/mol) | 180.156 |
| CAS | 87-89-8 |
| ChEBI | CHEBI:24848 |
| Synonym | scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol |
| SMIL | C1(C(C(C(C(C1O)O)O)O)O)O |
| IUPAC navn | cyclohexan-1,2,3,4,5,6-hexol |
| InChI nøgle | CDAISMWEOUEBRE-UHFFFAOYSA-N |
| Molekylær formel | C6H12O6 |
1,4-Butanediol, 99%
CAS: 110-63-4 Molekylær formel: C4H10O2 Molekylvægt (g/mol): 90.12 MDL nummer: MFCD00002968 InChI nøgle: WERYXYBDKMZEQL-UHFFFAOYSA-N Synonym: 1,4-butanediol,1,4-butylene glycol,tetramethylene glycol,1,4-dihydroxybutane,1,4-tetramethylene glycol,tetramethylene 1,4-diol,sucol b,diol 14b,agrisynth b1d,unii-7xoo2le6g3 PubChem CID: 8064 ChEBI: CHEBI:41189 IUPAC navn: butan-1,4-diol SMIL: OCCCCO
| MDL nummer | MFCD00002968 |
|---|---|
| PubChem CID | 8064 |
| Molekylvægt (g/mol) | 90.12 |
| CAS | 110-63-4 |
| ChEBI | CHEBI:41189 |
| Synonym | 1,4-butanediol,1,4-butylene glycol,tetramethylene glycol,1,4-dihydroxybutane,1,4-tetramethylene glycol,tetramethylene 1,4-diol,sucol b,diol 14b,agrisynth b1d,unii-7xoo2le6g3 |
| SMIL | OCCCCO |
| IUPAC navn | butan-1,4-diol |
| InChI nøgle | WERYXYBDKMZEQL-UHFFFAOYSA-N |
| Molekylær formel | C4H10O2 |
Thermo Scientific Chemicals Glyoxal, ren, 40 vægt% opløsning i vand
CAS: 107-22-2 | C2H2O2 | 58.04 g/mol
| MDL nummer | MFCD00006957 |
|---|---|
| Lineær formel | HCOCHO |
| Sundhedsfare 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. IF ON SKIN: Wash with plenty of soap and water. If skin irritatio |
| Sundhedsfare 2 | GHS H Statement Suspected of causing genetic defects if inhaled. Harmful if inhaled. Causes serious eye irritation. Causes skin irritation. May cause an allergic skin reaction. May cause respiratory irritation. |
| Sundhedsfare 1 | GHS-signalord: Advarsel |
| Formel vægt | 58.04 |
| ChEBI | CHEBI:34779 |
| Procent renhed | 39 to 41% (Titrimetry other) |
| IUPAC navn | oxaldehyd |
| Grad | Ren |
| Navn note | 40 wt.% Solution in Water |
| PubChem CID | 7860 |
| Anbefalet opbevaring | Kan blive mørkere under opbevaring |
| Molekylvægt (g/mol) | 58.04 |
| Tæthed | 1.2650g/mL |
| Fieser | 01,413 |
| Smeltepunkt | -14.0°C |
| SMIL | C(=O)C=O |
| Kogepunkt | 104.0°C |
| Flammepunkt | >104°C |
| InChI nøgle | LEQAOMBKQFMDFZ-UHFFFAOYSA-N |
| Kemisk navn eller materiale | Glyoxal |
| Specifik vægtfylde | 1.265 |
| Opløselighedsinformation | Solubility in water: miscible. |
| Viskositet | 8 mPa.s (20°C) |
| Merck Index | 15, 4544 |
| Fysisk form | Væske |
| Farve | Farveløs til gul |
| EINECS nummer | 203-474-9 |
| CAS | 7732-18-5 |
| Synonym | glyoxal,ethanedial,oxalaldehyde,1,2-ethanedione,glyoxylaldehyde,biformal,biformyl,diformal,diformyl,aerotex glyoxal 40 |
| Beilstein | 01, 759 |
| Molekylær formel | C2H2O2 |
Thermo Scientific Chemicals D-fruktose, 99 %
CAS: 57-48-7 Molekylær formel: C6H12O6 Molekylvægt (g/mol): 180.156 MDL nummer: MFCD00148910 InChI nøgle: BJHIKXHVCXFQLS-UYFOZJQFSA-N Synonym: d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 PubChem CID: 5984 ChEBI: CHEBI:48095 IUPAC navn: (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-on SMIL: C(C(C(C(C(=O)CO)O)O)O)O
| MDL nummer | MFCD00148910 |
|---|---|
| PubChem CID | 5984 |
| Molekylvægt (g/mol) | 180.156 |
| CAS | 57-48-7 |
| ChEBI | CHEBI:48095 |
| Synonym | d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 |
| SMIL | C(C(C(C(C(=O)CO)O)O)O)O |
| IUPAC navn | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-on |
| InChI nøgle | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Molekylær formel | C6H12O6 |
Ethandiol, Extra Pure, SLR, Fisher Chemical™
CAS: 107-21-1 Molekylær formel: C2H6O2 Molekylvægt (g/mol): 62.068 MDL nummer: 2885 InChI nøgle: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC navn: ethan-1,2-diol SMIL: C(CO)O
| MDL nummer | 2885 |
|---|---|
| PubChem CID | 174 |
| Molekylvægt (g/mol) | 62.068 |
| CAS | 107-21-1 |
| ChEBI | CHEBI:30742 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| SMIL | C(CO)O |
| IUPAC navn | ethan-1,2-diol |
| InChI nøgle | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molekylær formel | C2H6O2 |
Phorbol 12-myristat 13-acetat,> 94 %, Thermo Scientific Chemicals
CAS: 16561-29-8 Molekylær formel: C36H56O8 Molekylvægt (g/mol): 616.84 MDL nummer: MFCD00036736 InChI nøgle: PHEDXBVPIONUQT-RGYGYFBISA-N Synonym: phorbol 12-myristate 13-acetate,phorbol ester,12-o-tetradecanoylphorbol-13-acetate,12-o-tetradecanoylphorbol 13-acetate,factor a1,tetradecanoylphorbol acetate,12-tetradecanoylphorbol 13-acetate,factor a1 croton oil,phorbol 13-acetate 12-myristate,phorbol-12-myristate-13-acetate PubChem CID: 27924 ChEBI: CHEBI:37537 IUPAC navn: (1S,2S,6R,10S,11R,13S,14R,15R)-13-(acetyloxy)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxotetracyclo[8.5.0.0²,6,013-dien-1-1-1-1-1-1-1-4,1-3,3-1-4, 1-4, 1-4 tetradecanoat SMIL: CCCCCCCCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@]2(O)[C@@H]3C=C(C)C(=O)[C@@]3(O)CC(CO)=C[C@H]2[C@@H]2C(C)(C)[C@]12OC(C)=O
| MDL nummer | MFCD00036736 |
|---|---|
| PubChem CID | 27924 |
| Molekylvægt (g/mol) | 616.84 |
| CAS | 16561-29-8 |
| ChEBI | CHEBI:37537 |
| Synonym | phorbol 12-myristate 13-acetate,phorbol ester,12-o-tetradecanoylphorbol-13-acetate,12-o-tetradecanoylphorbol 13-acetate,factor a1,tetradecanoylphorbol acetate,12-tetradecanoylphorbol 13-acetate,factor a1 croton oil,phorbol 13-acetate 12-myristate,phorbol-12-myristate-13-acetate |
| SMIL | CCCCCCCCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@]2(O)[C@@H]3C=C(C)C(=O)[C@@]3(O)CC(CO)=C[C@H]2[C@@H]2C(C)(C)[C@]12OC(C)=O |
| IUPAC navn | (1S,2S,6R,10S,11R,13S,14R,15R)-13-(acetyloxy)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxotetracyclo[8.5.0.0²,6,013-dien-1-1-1-1-1-1-1-4,1-3,3-1-4, 1-4, 1-4 tetradecanoat |
| InChI nøgle | PHEDXBVPIONUQT-RGYGYFBISA-N |
| Molekylær formel | C36H56O8 |
2(2-Ethoxyethoxy)ethanol, 98+%, Thermo Scientific Chemicals
CAS: 111-90-0 MDL nummer: MFCD00002872 InChI nøgle: XXJWXESWEXIICW-UHFFFAOYSA-N Synonym: diethylene glycol monoethyl ether,2-2-ethoxyethoxy ethanol,carbitol,transcutol,ethoxy diglycol,dioxitol,ethyl carbitol,ethyl digol,carbitol solvent,ethanol, 2-2-ethoxyethoxy PubChem CID: 8146 ChEBI: CHEBI:40572 IUPAC navn: 2-(2-ethoxyethoxy)ethanol SMIL: CCOCCOCCO
| MDL nummer | MFCD00002872 |
|---|---|
| PubChem CID | 8146 |
| CAS | 111-90-0 |
| ChEBI | CHEBI:40572 |
| Synonym | diethylene glycol monoethyl ether,2-2-ethoxyethoxy ethanol,carbitol,transcutol,ethoxy diglycol,dioxitol,ethyl carbitol,ethyl digol,carbitol solvent,ethanol, 2-2-ethoxyethoxy |
| SMIL | CCOCCOCCO |
| IUPAC navn | 2-(2-ethoxyethoxy)ethanol |
| InChI nøgle | XXJWXESWEXIICW-UHFFFAOYSA-N |
Ninhydrin, 99%
CAS: 485-47-2 Molekylær formel: C9H6O4 Molekylvægt (g/mol): 178.143 MDL nummer: MFCD00003791 InChI nøgle: FEMOMIGRRWSMCU-UHFFFAOYSA-N Synonym: ninhydrin,ninhydrin hydrate,1,2,3-indantrione monohydrate,ninhydrine,2,2-dihydroxy-1h-indene-1,3 2h-dione,2,2-dihydroxy-1,3-indandione,triketohydrindene hydrate,1h-indene-1,3 2h-dione, 2,2-dihydroxy,1,2,3-indantrione, 2-hydrate,2,2-dihydroxyindane-1,3-dione PubChem CID: 10236 ChEBI: CHEBI:86374 IUPAC navn: 2,2-dihydroxyinden-1,3-dion SMIL: C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O
| MDL nummer | MFCD00003791 |
|---|---|
| PubChem CID | 10236 |
| Molekylvægt (g/mol) | 178.143 |
| CAS | 485-47-2 |
| ChEBI | CHEBI:86374 |
| Synonym | ninhydrin,ninhydrin hydrate,1,2,3-indantrione monohydrate,ninhydrine,2,2-dihydroxy-1h-indene-1,3 2h-dione,2,2-dihydroxy-1,3-indandione,triketohydrindene hydrate,1h-indene-1,3 2h-dione, 2,2-dihydroxy,1,2,3-indantrione, 2-hydrate,2,2-dihydroxyindane-1,3-dione |
| SMIL | C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O |
| IUPAC navn | 2,2-dihydroxyinden-1,3-dion |
| InChI nøgle | FEMOMIGRRWSMCU-UHFFFAOYSA-N |
| Molekylær formel | C9H6O4 |
Ethandiol, certificeret AR til analyse, Fisher Chemical™
CAS: 107-21-1 Molekylær formel: C2H6O2 Molekylvægt (g/mol): 62.068 MDL nummer: 2885 InChI nøgle: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC navn: ethan-1,2-diol SMIL: C(CO)O
| MDL nummer | 2885 |
|---|---|
| PubChem CID | 174 |
| Molekylvægt (g/mol) | 62.068 |
| CAS | 107-21-1 |
| ChEBI | CHEBI:30742 |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| SMIL | C(CO)O |
| IUPAC navn | ethan-1,2-diol |
| InChI nøgle | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molekylær formel | C2H6O2 |