Buffere og standarder
Hydrogenionbuffere omfattende en blanding af en svag syre og dens konjugatbase eller omvendt og anvendt til at stabilisere pH; også fortyndingsmidler, vaskeopløsninger og standardværdiopløsninger, der anvendes til en bred vifte af videnskabelige kalibreringsformål.
De buffere, der bruges til at kalibrere pH-målere, kan være certificeret og/eller sporbare til National Institute of Standards and Technology (NIST). Disse buffere kan også være farvekodede for nem identifikation:
- Rød: pH 4,0 Gul:
- pH 7,0 Blå:
- pH 10,0
Filtrerede søgeresultater
HEPES (fine hvide krystaller/molekylærbiologi), Fisher BioReagents™
Almindelig anvendt buffermiddel.
| Analyseprocentområde | ≥99 % |
|---|---|
| MDL nummer | MFCD00006158 |
| Kemisk navn eller materiale | HEPES |
| Sundhedsfare 3 | Emergency Overview Causes eye, skin, and respiratory tract irritation. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Do not induce vomiting. Obtain medical attention. Obtain medical attention. . NFPA Health:2 Flammability:1 Instability:1 |
| Sundhedsfare 2 | WARNING! |
| Opløselighedsinformation | Soluble in water |
| ChEBI | CHEBI:42334 |
| Absorbans | 0.01 max. (0.1M solution) at 280nm |
| DNase | DNase fri |
| Procent renhed | ≥99% |
| Merck Index | 15, 4689 |
| Identifikation | Pass Test |
| Farve | Hvid |
| Grad | Molekylær biologi |
| PubChem CID | 23831 |
| Anbefalet opbevaring | RT |
| Molekylvægt (g/mol) | 238.30 |
| CAS | 7365-45-9 |
| Protease | Protease free |
| pH | 5.0 to 6.5 |
| SMIL | OCCN1CCN(CCS(O)(=O)=O)CC1 |
| Renhedsgrad noter | DNase-, RNase- and Protease-Free |
| InChI nøgle | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| Molekylær formel | C8H18N2O4S |
| ChemAlert Opbevaringssymbol | Gray |
| Kemisk navn eller materiale | Tris-EDTA |
|---|---|
| Sundhedsfare 3 | Emergency Overview May cause eye, skin, and respiratory tract irritation. Avoid contact with skin and eyes. Do not breathe dust. Do not breathe vapors or spray mist. Wash off immediately with soap and plenty of water removing all contaminated clothes and shoes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Remove from exposure, lie down. Move to fresh air. If breathing is difficult, give oxygen. If not breathing, give artificial respiration. If not breathing, give artificial respiration. Obtain medical attention. NFPA Health:1 Flammability:0 Instability:0 |
| Sundhedsfare 2 | CAUTION! |
| DNase | DNase fri |
| Fysisk form | Væske |
| Farve | Farveløs |
| Grad | Molekylær biologi |
| Navn note | 1X Solution, pH 8.0 |
| Anbefalet opbevaring | RT |
| CAS | 7732-18-5 |
| Protease | Protease free |
| Gennemfiltreret | Filtreret gennem et 5-mikron filter. |
| pH | 7.4 to 8.1 |
| Synonym | TE |
| ChemAlert Opbevaringssymbol | Gray |
MOPS (Fine White Crystals/Molecular Biology), Fisher BioReagents™
CAS: 1132-61-2 Molekylær formel: C7H15NO4S Molekylvægt (g/mol): 209.26 MDL nummer: MFCD00006183 InChI nøgle: DVLFYONBTKHTER-UHFFFAOYSA-N Synonym: 3-(4-Morpholino)propane sulfonic acid PubChem CID: 70807 ChEBI: CHEBI:44115 IUPAC navn: 3-morpholin-4-ylpropan-1-sulfonsyre SMIL: [O-]S(=O)(=O)CCC[NH+]1CCOCC1
| MDL nummer | MFCD00006183 |
|---|---|
| PubChem CID | 70807 |
| Molekylvægt (g/mol) | 209.26 |
| CAS | 1132-61-2 |
| ChEBI | CHEBI:44115 |
| Synonym | 3-(4-Morpholino)propane sulfonic acid |
| SMIL | [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
| IUPAC navn | 3-morpholin-4-ylpropan-1-sulfonsyre |
| InChI nøgle | DVLFYONBTKHTER-UHFFFAOYSA-N |
| Molekylær formel | C7H15NO4S |
Phenol, mættet (pH 6,6/7,9, flydende), Fisher BioReagents™
CAS: 108-95-2 Molekylær formel: C6H6O Molekylvægt (g/mol): 94.11 MDL nummer: MFCD00002143 InChI nøgle: ISWSIDIOOBJBQZ-UHFFFAOYSA-N Synonym: carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol PubChem CID: 996 ChEBI: CHEBI:15882 IUPAC navn: phenol SMIL: OC1=CC=CC=C1
| MDL nummer | MFCD00002143 |
|---|---|
| PubChem CID | 996 |
| Molekylvægt (g/mol) | 94.11 |
| CAS | 108-95-2 |
| ChEBI | CHEBI:15882 |
| Synonym | carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol |
| SMIL | OC1=CC=CC=C1 |
| IUPAC navn | phenol |
| InChI nøgle | ISWSIDIOOBJBQZ-UHFFFAOYSA-N |
| Molekylær formel | C6H6O |
TE-buffer, Tris-EDTA, 100X opløsning, pH 8,0, molekylærbiologi, Fisher BioReagents™
| Navn note | 100X Solution |
|---|---|
| Kemisk navn eller materiale | Tris-EDTA |
| Anbefalet opbevaring | RT |
| Sundhedsfare 3 | Emergency Overview Irritating to eyes and skin. Wear personal protective equipment. Ensure adequate ventilation. Avoid contact with skin, eyes and clothing. Avoid ingestion and inhalation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur. Get medical attention immediately if symptoms occur. Do not induce vomiting. NFPA Health:2 Flammability:0 Instability:0 |
| Sundhedsfare 2 | WARNING! |
| CAS | 7732-18-5 |
| Protease | Protease free |
| Gennemfiltreret | Filtreret gennem et 0,2 mikron filter. |
| DNase | DNase fri |
| Fysisk form | Væske |
| Farve | Ikke udpeget |
| ChemAlert Opbevaringssymbol | Gray |
| Grad | Molekylær biologi |
Thermo Scientific Chemicals TRIS-pufret saltvand (TBS 10X) pH 7,4, for Western blot
CAS: 77-86-1 Molekylær formel: C4H11NO3 Molekylvægt (g/mol): 121.136 MDL nummer: MFCD00004679 InChI nøgle: LENZDBCJOHFCAS-UHFFFAOYSA-N PubChem CID: 6503 ChEBI: CHEBI:9754 IUPAC navn: 2-amino-2-(hydroxymethyl)propan-1,3-diol SMIL: C(C(CO)(CO)N)O
| MDL nummer | MFCD00004679 |
|---|---|
| PubChem CID | 6503 |
| Molekylvægt (g/mol) | 121.136 |
| CAS | 77-86-1 |
| ChEBI | CHEBI:9754 |
| SMIL | C(C(CO)(CO)N)O |
| IUPAC navn | 2-amino-2-(hydroxymethyl)propan-1,3-diol |
| InChI nøgle | LENZDBCJOHFCAS-UHFFFAOYSA-N |
| Molekylær formel | C4H11NO3 |
CAPS (Fine White Crystals), Fisher BioReagents
CAS: 1135-40-6 Molekylær formel: C9H19NO3S Molekylvægt (g/mol): 221.32 MDL nummer: MFCD00003837 InChI nøgle: PJWWRFATQTVXHA-UHFFFAOYSA-N Synonym: 3-Cyclohexylamino-1-propanesulfonic Acid PubChem CID: 70815 IUPAC navn: 3-(cyclohexylamino)propane-1-sulfonic acid SMIL: OS(=O)(=O)CCCNC1CCCCC1
| MDL nummer | MFCD00003837 |
|---|---|
| PubChem CID | 70815 |
| Molekylvægt (g/mol) | 221.32 |
| CAS | 1135-40-6 |
| Synonym | 3-Cyclohexylamino-1-propanesulfonic Acid |
| SMIL | OS(=O)(=O)CCCNC1CCCCC1 |
| IUPAC navn | 3-(cyclohexylamino)propane-1-sulfonic acid |
| InChI nøgle | PJWWRFATQTVXHA-UHFFFAOYSA-N |
| Molekylær formel | C9H19NO3S |
Phenol, Saturated (pH 4.3, Liq.), Fisher BioReagents
CAS: 108-95-2 Molekylær formel: C6H6O Molekylvægt (g/mol): 94.11 MDL nummer: MFCD00002143 InChI nøgle: ISWSIDIOOBJBQZ-UHFFFAOYSA-N Synonym: carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol PubChem CID: 996 ChEBI: CHEBI:15882 IUPAC navn: phenol SMIL: OC1=CC=CC=C1
| MDL nummer | MFCD00002143 |
|---|---|
| PubChem CID | 996 |
| Molekylvægt (g/mol) | 94.11 |
| CAS | 108-95-2 |
| ChEBI | CHEBI:15882 |
| Synonym | carbolic acid,hydroxybenzene,phenic acid,phenylic acid,oxybenzene,benzenol,phenyl hydrate,monophenol,phenyl hydroxide,phenylic alcohol |
| SMIL | OC1=CC=CC=C1 |
| IUPAC navn | phenol |
| InChI nøgle | ISWSIDIOOBJBQZ-UHFFFAOYSA-N |
| Molekylær formel | C6H6O |
HEPES Sodium Salt (White Powder), Fisher BioReagents
CAS: 75277-39-3 Molekylær formel: C8H17N2NaO4S Molekylvægt (g/mol): 260.28 MDL nummer: MFCD00036463 InChI nøgle: RDZTWEVXRGYCFV-UHFFFAOYSA-M PubChem CID: 2724248 ChEBI: CHEBI:46758 IUPAC navn: sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate SMIL: [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1
| MDL nummer | MFCD00036463 |
|---|---|
| PubChem CID | 2724248 |
| Molekylvægt (g/mol) | 260.28 |
| CAS | 75277-39-3 |
| ChEBI | CHEBI:46758 |
| SMIL | [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| IUPAC navn | sodium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate |
| InChI nøgle | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| Molekylær formel | C8H17N2NaO4S |