Filtrerade sökresultat
| CAS | 111-90-0 |
|---|
HYDRANAL™ - Vatten Standard KF-ugn, 150-160 °C, Honeywell Fluka™
Standard för Karl Fischer ugnskontroll (vatteninnehåll∼ 5,0 %, exakt värde på analysrapport)
Natriumklorid, Puriss. pa, ACS-reagens, Reag. ISO, Reag. Ph. Eur.,≥ 99,5 %, Honeywell Fluka™
CAS: 7647-14-5 Molekylformel: ClNa Molekylvikt (g/mol): 58.44 MDL-nummer: MFCD00003477 InChI-nyckel: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 LEDER: [Na+].[Cl-]
| Molekylformel | ClNa |
|---|---|
| PubChem CID | 5234 |
| MDL-nummer | MFCD00003477 |
| CAS | 7647-14-5 |
| InChI-nyckel | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| LEDER | [Na+].[Cl-] |
| ChEBI | CHEBI:26710 |
| Molekylvikt (g/mol) | 58.44 |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
Citronsyra, 99,5 till 100,5 % (baserat på vattenfritt ämne), Honeywell Fluka™
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
CAS: 77-92-9 Molekylformel: C6H8O7 Molekylvikt (g/mol): 192.12 MDL-nummer: MFCD00011669 InChI-nyckel: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonym: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy PubChem CID: 311 ChEBI: CHEBI:30769 IUPAC-namn: 2-hydroxipropan-1,2,3-trikarboxylsyra LEDER: OC(=O)CC(O)(CC(O)=O)C(O)=O
| Molekylformel | C6H8O7 |
|---|---|
| PubChem CID | 311 |
| MDL-nummer | MFCD00011669 |
| IUPAC-namn | 2-hydroxipropan-1,2,3-trikarboxylsyra |
| CAS | 77-92-9 |
| InChI-nyckel | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| LEDER | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| ChEBI | CHEBI:30769 |
| Molekylvikt (g/mol) | 192.12 |
| Synonym | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
Silica Gel Rubin, Honeywell Fluka™
CAS: 112926-00-8 Molekylformel: O2Si Molekylvikt (g/mol): 60.083 MDL-nummer: MFCD00011232 InChI-nyckel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-namn: dioxosilan LEDER: O=[Si]=O
| Molekylformel | O2Si |
|---|---|
| PubChem CID | 24261 |
| MDL-nummer | MFCD00011232 |
| IUPAC-namn | dioxosilan |
| CAS | 112926-00-8 |
| InChI-nyckel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| LEDER | O=[Si]=O |
| ChEBI | CHEBI:30563 |
| Molekylvikt (g/mol) | 60.083 |
Citronsyra monohydrat, Honeywell Fluka™
CAS: 5949-29-1 Molekylformel: C6H10O8 Molekylvikt (g/mol): 210.14 InChI-nyckel: YASYEJJMZJALEJ-UHFFFAOYSA-N PubChem CID: 22230 ChEBI: CHEBI:31404 IUPAC-namn: 2-hydroxipropan-1,2,3-trikarboxylsyrahydrat LEDER: O.OC(=O)CC(O)(CC(O)=O)C(O)=O
| Molekylformel | C6H10O8 |
|---|---|
| PubChem CID | 22230 |
| IUPAC-namn | 2-hydroxipropan-1,2,3-trikarboxylsyrahydrat |
| CAS | 5949-29-1 |
| InChI-nyckel | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| LEDER | O.OC(=O)CC(O)(CC(O)=O)C(O)=O |
| ChEBI | CHEBI:31404 |
| Molekylvikt (g/mol) | 210.14 |
Natriumbikarbonat, Honeywell Fluka™
CAS: 144-55-8 Molekylformel: CHNaO3 Molekylvikt (g/mol): 84.01 MDL-nummer: MFCD00003528 InChI-nyckel: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 LEDER: [Na+].OC([O-])=O
| Molekylformel | CHNaO3 |
|---|---|
| PubChem CID | 516892 |
| MDL-nummer | MFCD00003528 |
| CAS | 144-55-8 |
| InChI-nyckel | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| LEDER | [Na+].OC([O-])=O |
| ChEBI | CHEBI:32139 |
| Molekylvikt (g/mol) | 84.01 |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
Järn(II)sulfatheptahydrat, Puriss., uppfyller analytiska specifikationer. av BP, FCC, Ph. Eur., USP , 99,5-104,5 % (manganometrisk), Honeywell Fluka™
SureTRACE
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
Supporting your traceability needs through proactive availability of certificates and change notifications.
Learn More
CAS: 7782-63-0 Molekylformel: FeH14O11S Molekylvikt (g/mol): 278.01 MDL-nummer: MFCD00149719 InChI-nyckel: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 IUPAC-namn: järn(2+);sulfat;heptahydrat LEDER: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| Molekylformel | FeH14O11S |
|---|---|
| PubChem CID | 62662 |
| MDL-nummer | MFCD00149719 |
| IUPAC-namn | järn(2+);sulfat;heptahydrat |
| CAS | 7782-63-0 |
| InChI-nyckel | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| LEDER | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| ChEBI | CHEBI:75836 |
| Molekylvikt (g/mol) | 278.01 |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| CAS | 7446-09-5 |
|---|---|
| Hälsofara 2 | P210-P280-P304 + P340 + P312-P305 + P351 + P338 + P310-P370 + P378-P403 + P235 |
| UN-nummer | UN1230 |
| DOT-information | Transport Hazard Class: 3; Packing Group:3: II; Proper Shipping Name: Methanol Solution |
|---|---|
| Rekommenderad förvaring | Rumstemp |
| Densitet | 0.980 g/cm3 |
| Hållbarhet | 1800 days from date of manufacture |
| CAS Min % | ≥20.0000% |
| Kokpunkt | 64°C |
| UN-nummer | UN1230 |
| Kvalitet | Karl Fischer |
| Förpackning | Glasflaska |
| Flampunkt | 13°C |
| CAS | 57-55-6 |
| Namnnotering | Reagent for coulometric KF titration with oven (anolyte solution), for cells with and without diaphragm |
| Kemiskt namn eller material | HYDRANAL™ - Coulomat AG-Oven |
| CAS Max % | <10.0000% |