Filtrerede søgeresultater
Hydrogen chloride, 1M soln. in ethyl acetate
CAS: 7647-01-0 Molekylær formel: ClH Molekylvægt (g/mol): 36.46 MDL nummer: MFCD00011324 MFCD00792839 InChI nøgle: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 SMIL: Cl
| MDL nummer | MFCD00011324 MFCD00792839 |
|---|---|
| PubChem CID | 313 |
| Molekylvægt (g/mol) | 36.46 |
| CAS | 7647-01-0 |
| ChEBI | CHEBI:17883 |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| SMIL | Cl |
| InChI nøgle | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molekylær formel | ClH |
| MDL nummer | MFCD00003407 |
|---|---|
| Lineær formel | Ag2SO4 |
| Sundhedsfare 3 | GHS P Statement: IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Sundhedsfare 2 | GHS H Statement: Causes severe skin burns and eye damage. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 311.79 |
| Emballage | Glasflaske |
| IUPAC navn | disilver(1+) svovlsyre |
| Grad | Ren |
| Navn note | 10g/L Solution in Sulfuric Acid |
| PubChem CID | 159865 |
| Molekylvægt (g/mol) | 313.81 |
| Tæthed | 1.8400g/mL |
| Fieser | 01,1015; 03,254; 04,435 |
| SMIL | [Ag+].[Ag+].OS(O)(=O)=O |
| InChI nøgle | YPNVIBVEFVRZPJ-UHFFFAOYSA-N |
| Kemisk navn eller materiale | Silver sulfate |
| Specifik vægtfylde | 1.84 |
| Merck Index | 15, 8668 |
| Fysisk form | Væske |
| Farve | Farveløs |
| EINECS nummer | 233-653-7 |
| CAS | 7664-93-9 |
| Synonym | silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt |
| TSCA | TSCA |
| Molekylær formel | Ag2H2O4S |
Barium chloride, 0.5N Standardized Solution
CAS: 10361-37-2 Molekylær formel: BaCl2 Molekylvægt (g/mol): 208.23 MDL nummer: MFCD00003445 InChI nøgle: WDIHJSXYQDMJHN-UHFFFAOYSA-L Synonym: barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 PubChem CID: 25204 ChEBI: CHEBI:63317 IUPAC navn: barium(2+);dichlorid SMIL: [Cl-].[Cl-].[Ba++]
| MDL nummer | MFCD00003445 |
|---|---|
| PubChem CID | 25204 |
| Molekylvægt (g/mol) | 208.23 |
| CAS | 10361-37-2 |
| ChEBI | CHEBI:63317 |
| Synonym | barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 |
| SMIL | [Cl-].[Cl-].[Ba++] |
| IUPAC navn | barium(2+);dichlorid |
| InChI nøgle | WDIHJSXYQDMJHN-UHFFFAOYSA-L |
| Molekylær formel | BaCl2 |
Benzyltrimethylammonium hydroxide, 40 wt% solution in methanol
CAS: 100-85-6 Molekylær formel: C10H17NO Molekylvægt (g/mol): 167.252 MDL nummer: MFCD00008281 InChI nøgle: NDKBVBUGCNGSJJ-UHFFFAOYSA-M Synonym: benzyltrimethylammonium hydroxide,triton b,n,n,n-trimethyl-1-phenylmethanaminium hydroxide,trimethylbenzylammonium hydroxide,benzyl trimethylammonium hydroxide,benzyl trimethyl ammonium hydroxide,trimethyl benzylammonium hydroxide,sumquat 2311,benzyltrimetylammonium hydroxide,n,n,n-trimethylbenzenemethanaminium hydroxide PubChem CID: 66854 IUPAC navn: benzyl(trimethyl)azaniumhydroxid SMIL: C[N+](C)(C)CC1=CC=CC=C1.[OH-]
| MDL nummer | MFCD00008281 |
|---|---|
| PubChem CID | 66854 |
| Molekylvægt (g/mol) | 167.252 |
| CAS | 100-85-6 |
| Synonym | benzyltrimethylammonium hydroxide,triton b,n,n,n-trimethyl-1-phenylmethanaminium hydroxide,trimethylbenzylammonium hydroxide,benzyl trimethylammonium hydroxide,benzyl trimethyl ammonium hydroxide,trimethyl benzylammonium hydroxide,sumquat 2311,benzyltrimetylammonium hydroxide,n,n,n-trimethylbenzenemethanaminium hydroxide |
| SMIL | C[N+](C)(C)CC1=CC=CC=C1.[OH-] |
| IUPAC navn | benzyl(trimethyl)azaniumhydroxid |
| InChI nøgle | NDKBVBUGCNGSJJ-UHFFFAOYSA-M |
| Molekylær formel | C10H17NO |
Dess-Martin periodinane, 15 wt.% solution in dichloromethane
Dess-Martin periodinane, 10 to 15%, C13H13IO8, CAS Number-87413-09-0, 75-09-2, dess martin, dess-martin, dess-martinperiodinane, dess-martin periodinane, 1,1,1-triacetoxy-1,1-dihydro-1,2-benziodoxol-3 1h-one, dess martin periodinane, dess-martin periodane, dess-martin reagent, triacetoxyperiodinane | CAS: 87413-09-0 | C13H13IO8 | 424.14 g/mol
| MDL nummer | MFCD00130127 |
|---|---|
| Kemisk navn eller materiale | Dess-Martin periodinane |
| Specifik vægtfylde | 1.362 |
| PubChem CID | 159087 |
| Molekylvægt (g/mol) | 424.14 |
| Tæthed | 1.3620g/mL |
| CAS | 75-09-2 |
| Formel vægt | 424.15 |
| Synonym | dess-martin periodinane,triacetoxyperiodinane,1,1,1-triacetoxy-1,1-dihydro-1,2-benziodoxol-3 1h-one,dess-martin reagent,dess-martinperiodinane,dess-martin,dess martin periodinane,dess martin,dess-martin periodane |
| SMIL | CC(=O)O[I]1(OC(C)=O)(OC(C)=O)OC(=O)C2=CC=CC=C12 |
| InChI nøgle | NKLCNNUWBJBICK-UHFFFAOYSA-N |
| Molekylær formel | C13H13IO8 |
Hydrogen chloride, 1M in diethyl ether
CAS: 7647-01-0 Molekylær formel: ClH Molekylvægt (g/mol): 36.46 MDL nummer: MFCD00011324 MFCD00792839 InChI nøgle: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC navn: hydrogenchlorid SMIL: Cl
| MDL nummer | MFCD00011324 MFCD00792839 |
|---|---|
| PubChem CID | 313 |
| Molekylvægt (g/mol) | 36.46 |
| CAS | 7647-01-0 |
| ChEBI | CHEBI:17883 |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| SMIL | Cl |
| IUPAC navn | hydrogenchlorid |
| InChI nøgle | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molekylær formel | ClH |
| MDL nummer | MFCD00011081 |
|---|---|
| Lineær formel | Li2CuCl4 |
| Kemisk navn eller materiale | Dilithium tetrachlorocuprate |
| Specifik vægtfylde | 0.91 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Call a POISON CENTER or doctor/physician if you feel unwell. Wash face, hands and any exposed skin thoroughly after handling. If eye irritation persists: Get medical advice/attention. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Wear protective gloves/protective clothing/eye protection/face protection. |
| Sundhedsfare 2 | GHS H Statement May cause respiratory irritation. Causes serious eye irritation. Highly flammable liquid and vapor. May form explosive peroxides. Suspected of causing cancer. Harmful if swallowed. May cause drowsiness or dizziness. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 219.24 |
| Emballage | Glasflaske |
| Koncentration | 0.09 to 0.12M |
| Fysisk form | Væske |
| IUPAC navn | dilithium;tetrachlorkobber(2-) |
| Farve | Farveløs |
| Navn note | 0.1M Solution in THF |
| PubChem CID | 11074879 |
| Molekylvægt (g/mol) | 219.226 |
| Tæthed | 0.9100g/mL |
| Fieser | 04,163; 05,226; 06,203; 07,114; 08,176; 11,190; 12,195 |
| CAS | 109-99-9 |
| SMIL | [Li+].[Li+].Cl[Cu-2](Cl)(Cl)Cl |
| Flammepunkt | −17°C |
| InChI nøgle | HCJWWBBBSCXJMS-UHFFFAOYSA-J |
| Molekylær formel | Cl4CuLi2 |
Kaliumhydrogenphthalat, 0,05N standardiseret opløsning, Thermo Scientific Chemicals
CAS: 877-24-7 Molekylær formel: C8H5KO4 Molekylvægt (g/mol): 204.222 MDL nummer: MFCD00013070 InChI nøgle: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC navn: kalium;2-carboxybenzoat SMIL: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| MDL nummer | MFCD00013070 |
|---|---|
| PubChem CID | 23676735 |
| Molekylvægt (g/mol) | 204.222 |
| CAS | 877-24-7 |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| SMIL | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| IUPAC navn | kalium;2-carboxybenzoat |
| InChI nøgle | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molekylær formel | C8H5KO4 |
Kaliumbis(trimethylsilyl)amid, 0,7 M opløsning i toluen, +99,4 %, Thermo Scientific Chemicals
CAS: 40949-94-8 | C6H18KNSi2 | 199.485 g/mol
| MDL nummer | MFCD00010330 |
|---|---|
| Lineær formel | [(CH3)3Si]2NK |
| Kemisk navn eller materiale | Potassium bis(trimethylsilyl)amide |
| Sundhedsfare 3 | GHS P Statement IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. Obtain special instructions before use. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Avoid release to the environment. |
| Sundhedsfare 2 | GHS P Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause drowsiness or dizziness. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. Highly flammable liquid and vapor. Suspected of causing cancer. Suspected of causing genetic defects if inhaled. Harmful to aquatic life with long lasting effects. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 199.49 |
| Procent renhed | 0.6 to 0.8 M (Total base) |
| Koncentration | 0.6 to 0.8M (Total base) |
| Fysisk form | Væske |
| IUPAC navn | kalium;bis(trimethylsilyl)azanid |
| Farve | Gul |
| Navn note | 0.5M solution in toluene |
| PubChem CID | 3251421 |
| Molekylvægt (g/mol) | 199.485 |
| Tæthed | 0.8760g/mL |
| CAS | 108-88-3 |
| Synonym | potassium bis trimethylsilyl amide,khmds,potassium hexamethyldisilazide,hexamethyldisilazane potassium salt,potassium bis trimethylsilyl azanide,potassium bis trimethylsilyl amide 1m sol. in thf,potassiumbis trimethylsilyl amide,hexamethyldislazane potassium salt,1,1,1,3,3,3-hexamethyldisilazane potassium salt,potassium bis-trimethylsilylamide |
| SMIL | C[Si](C)(C)[N-][Si](C)(C)C.[K+] |
| InChI nøgle | IUBQJLUDMLPAGT-UHFFFAOYSA-N |
| Molekylær formel | C6H18KNSi2 |
| MDL nummer | MFCD00008327 |
|---|---|
| Lineær formel | (CH3)3N |
| Kemisk navn eller materiale | Trimethylamine |
| Specifik vægtfylde | 0.86 |
| Sundhedsfare 1 | Danger |
| Formel vægt | 59.11 |
| Opløselighedsinformation | Solubility in water: freely soluble. Other solubilities: soluble in alcohol, ether, benzene, toluene,, xylene, ethylbenzene and chloroform |
| ChEBI | CHEBI:18139 |
| Procent renhed | 48 to 52% (total base) |
| Fysisk form | Væske |
| IUPAC navn | N,N-dimethylmethanamin |
| Farve | Farveløs |
| Grad | Ren |
| PubChem CID | 1146 |
| Molekylvægt (g/mol) | 59.11 |
| Tæthed | 0.8600g/mL |
| CAS | 7732-18-5 |
| Smeltepunkt | -2.0°C |
| Synonym | trimethylamine,methanamine, n,n-dimethyl,dimethylmethaneamine,n-trimethylamine,trimethylamine solution,ch3 3n,trimethyl amine,trimethylamin,trimethyl-amine,fema number 3241 |
| SMIL | CN(C)C |
| Kogepunkt | 30.0°C to 100.0°C |
| Flammepunkt | −45°C |
| InChI nøgle | GETQZCLCWQTVFV-UHFFFAOYSA-N |
| Molekylær formel | C3H9N |
Bariumchlorid, 10% w/v aq. soln., Thermo Scientific Chemicals
CAS: 10361-37-2 Molekylær formel: BaCl2 Molekylvægt (g/mol): 208.23 MDL nummer: MFCD00003445 InChI nøgle: WDIHJSXYQDMJHN-UHFFFAOYSA-L Synonym: barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 PubChem CID: 25204 ChEBI: CHEBI:63317 IUPAC navn: barium(2+);dichlorid SMIL: [Cl-].[Cl-].[Ba++]
| MDL nummer | MFCD00003445 |
|---|---|
| PubChem CID | 25204 |
| Molekylvægt (g/mol) | 208.23 |
| CAS | 10361-37-2 |
| ChEBI | CHEBI:63317 |
| Synonym | barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 |
| SMIL | [Cl-].[Cl-].[Ba++] |
| IUPAC navn | barium(2+);dichlorid |
| InChI nøgle | WDIHJSXYQDMJHN-UHFFFAOYSA-L |
| Molekylær formel | BaCl2 |
| MDL nummer | MFCD00011418 |
|---|---|
| Lineær formel | NH3 |
| Kemisk navn eller materiale | Ammonia |
| Specifik vægtfylde | 1.023 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Do not breathe dust/fume/gas/mist/vapors/spray. Wash face, hands and any exposed skin thoroughly after handling. Use personal protective equipment as required. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes serious eye irritation. May cause respiratory irritation. Suspected of causing cancer. Repeated exposure may cause skin dryness or cracking. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 17.03 |
| Opløselighedsinformation | Solubility in water: soluble. |
| ChEBI | CHEBI:16134 |
| Merck Index | 15, 488 |
| Koncentration | 0.4 to 0.6M |
| Fysisk form | Væske |
| Farve | Farveløs |
| Navn note | 0.5M solution in 1, 4-dioxane |
| PubChem CID | 222 |
| Molekylvægt (g/mol) | 17.03 |
| Tæthed | 1.0230g/mL |
| Fieser | 05,15 |
| CAS | 123-91-1 |
| Synonym | ammonia,ammonia gas,spirit of hartshorn,nitro-sil,ammoniakgas,ammonia anhydrous,anhydrous ammonia,ammonia, anhydrous,ammoniak,am-fol |
| SMIL | N |
| Flammepunkt | 11°C |
| InChI nøgle | QGZKDVFQNNGYKY-UHFFFAOYSA-N |
| Molekylær formel | H3N |
Kaliumhydroxid, Acculute Standard Volumetrisk Solution, Slutkoncentration 0,5N, Thermo Scientific Chemicals
CAS: 1310-58-3 Molekylær formel: HKO Molekylvægt (g/mol): 56.11 MDL nummer: MFCD00003553 InChI nøgle: KWYUFKZDYYNOTN-UHFFFAOYSA-M Synonym: potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 PubChem CID: 14797 ChEBI: CHEBI:32035 IUPAC navn: kalium;hydroxid SMIL: [OH-].[K+]
| MDL nummer | MFCD00003553 |
|---|---|
| PubChem CID | 14797 |
| Molekylvægt (g/mol) | 56.11 |
| CAS | 1310-58-3 |
| ChEBI | CHEBI:32035 |
| Synonym | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| SMIL | [OH-].[K+] |
| IUPAC navn | kalium;hydroxid |
| InChI nøgle | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| Molekylær formel | HKO |
Natriumborhydrid, 0,5 M opløsning i diglyme, AcroSeal™ , Thermo Scientific Chemicals
CAS: 16940-66-2 | BH4Na | 37.83 g/mol
Lithiumaluminiumhydrid, 1M opløsning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 16853-85-3 | AlH4Li | 37.95 g/mol
| MDL nummer | MFCD00011075 |
|---|---|
| Lineær formel | LiAlH4 |
| Kemisk navn eller materiale | Lithium Aluminum hydride |
| Specifik vægtfylde | 0.9 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Sundhedsfare 2 | GHS H Statement May cause respiratory irritation. Causes skin irritation. Causes serious eye damage. Highly flammable liquid and vapor. In contact with water releases flammable gases which may ignite spontaneously. May form explosive peroxides. Suspected of causing cancer. Harmful if swallowed. May cause drowsiness or dizziness. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 37.95 |
| Opløselighedsinformation | Solubility in water: vigorous reaction. |
| Procent renhed | 3.9 to 4.5% (as LiAlH4) |
| Merck Index | 15, 344 |
| Fysisk form | Uklar løsning |
| IUPAC navn | lithium(1+)-aluminium |
| Farve | Grå |
| PubChem CID | 21226445 |
| Molekylvægt (g/mol) | 37.95 |
| Tæthed | 0.9000g/mL |
| Fieser | 01,581; 02,242; 03,176; 04,291; 05,382; 06,325; 07,196; 08,286; 09,274; 10,236; 11,289; 12,272; 13,61; 14,190; 15,184; 16,133; 17,162 |
| CAS | 109-99-9 |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| SMIL | [Li+].[AlH4-] |
| Flammepunkt | −17°C |
| InChI nøgle | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| Molekylær formel | AlH4Li |