Filtrerede søgeresultater
Thermo Scientific™ DNA AWAY™ Surface Decontaminant
Eliminate unwanted DNA and DNase from glassware and plasticware without affecting subsequent DNA samples. This surface decontaminant degrades DNA more quickly and effectively than autoclaving.
DL-α -Methoxyphenyleddikesyre, 99%, Thermo Scientific Chemicals
CAS: 7021-09-2 Molekylær formel: C9H10O3 Molekylvægt (g/mol): 166.18 InChI nøgle: DIWVBIXQCNRCFE-UHFFFAOYNA-N Synonym: methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid PubChem CID: 107202 IUPAC navn: 2-methoxy-2-phenyleddikesyre SMIL: COC(C1=CC=CC=C1)C(=O)O
| PubChem CID | 107202 |
|---|---|
| Molekylvægt (g/mol) | 166.18 |
| CAS | 7021-09-2 |
| Synonym | methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid |
| SMIL | COC(C1=CC=CC=C1)C(=O)O |
| IUPAC navn | 2-methoxy-2-phenyleddikesyre |
| InChI nøgle | DIWVBIXQCNRCFE-UHFFFAOYNA-N |
| Molekylær formel | C9H10O3 |
p-Anisic acid, 98%
CAS: 100-09-4 Molekylær formel: C8H8O3 Molekylvægt (g/mol): 152.15 MDL nummer: MFCD00002542 InChI nøgle: ZEYHEAKUIGZSGI-UHFFFAOYSA-N Synonym: p-anisic acid,anisic acid,p-methoxybenzoic acid,draconic acid,4-anisic acid,benzoic acid, 4-methoxy,anisic acid, para,4-methoxybenzoate,para-anisic acid,anisic acid, p-isomer PubChem CID: 7478 ChEBI: CHEBI:40813 IUPAC navn: 4-methoxybenzoesyre SMIL: COC1=CC=C(C=C1)C(O)=O
| MDL nummer | MFCD00002542 |
|---|---|
| PubChem CID | 7478 |
| Molekylvægt (g/mol) | 152.15 |
| CAS | 100-09-4 |
| ChEBI | CHEBI:40813 |
| Synonym | p-anisic acid,anisic acid,p-methoxybenzoic acid,draconic acid,4-anisic acid,benzoic acid, 4-methoxy,anisic acid, para,4-methoxybenzoate,para-anisic acid,anisic acid, p-isomer |
| SMIL | COC1=CC=C(C=C1)C(O)=O |
| IUPAC navn | 4-methoxybenzoesyre |
| InChI nøgle | ZEYHEAKUIGZSGI-UHFFFAOYSA-N |
| Molekylær formel | C8H8O3 |
Triphenylphosphine, 99%
CAS: 603-35-0 Molekylær formel: C18H15P Molekylvægt (g/mol): 262.29 MDL nummer: MFCD00003043 MFCD20489348 InChI nøgle: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC navn: triphenylphosphan SMIL: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00003043 MFCD20489348 |
|---|---|
| PubChem CID | 11776 |
| Molekylvægt (g/mol) | 262.29 |
| CAS | 603-35-0 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| SMIL | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | triphenylphosphan |
| InChI nøgle | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molekylær formel | C18H15P |
Phenylacetaldehyd, 98%, stabiliseret, Thermo Scientific Chemicals
CAS: 122-78-1 Molekylær formel: C8H8O Molekylvægt (g/mol): 120.15 MDL nummer: MFCD00006993 InChI nøgle: DTUQWGWMVIHBKE-UHFFFAOYSA-N Synonym: phenylacetaldehyde,benzeneacetaldehyde,hyacinthin,alpha-tolualdehyde,phenylethanal,2-phenylethanal,phenylacetic aldehyde,alpha-toluic aldehyde,acetaldehyde, phenyl,benzylcarboxaldehyde PubChem CID: 998 ChEBI: CHEBI:16424 IUPAC navn: 2-phenylacetaldehyd SMIL: O=CCC1=CC=CC=C1
| MDL nummer | MFCD00006993 |
|---|---|
| PubChem CID | 998 |
| Molekylvægt (g/mol) | 120.15 |
| CAS | 122-78-1 |
| ChEBI | CHEBI:16424 |
| Synonym | phenylacetaldehyde,benzeneacetaldehyde,hyacinthin,alpha-tolualdehyde,phenylethanal,2-phenylethanal,phenylacetic aldehyde,alpha-toluic aldehyde,acetaldehyde, phenyl,benzylcarboxaldehyde |
| SMIL | O=CCC1=CC=CC=C1 |
| IUPAC navn | 2-phenylacetaldehyd |
| InChI nøgle | DTUQWGWMVIHBKE-UHFFFAOYSA-N |
| Molekylær formel | C8H8O |
Iodobenzene diacetate, 98%
CAS: 3240-34-4 Molekylær formel: C10H11IO4 Molekylvægt (g/mol): 322.09 InChI nøgle: ZBIKORITPGTTGI-UHFFFAOYSA-N Synonym: iodobenzene diacetate,diacetoxyiodo benzene,iodosobenzene diacetate,phenyliodine diacetate,phenyliodo diacetate,phenyliodoso acetate,phenyliodosodiacetate,phenyliodoso diacetate,bis acetato phenyliodine,benzene, diacetoxyiodo PubChem CID: 76724 IUPAC navn: [acetyloxy(phenyl)-$1^{3}-iodanyl]acetat SMIL: CC(=O)OI(C1=CC=CC=C1)OC(=O)C
| PubChem CID | 76724 |
|---|---|
| Molekylvægt (g/mol) | 322.09 |
| CAS | 3240-34-4 |
| Synonym | iodobenzene diacetate,diacetoxyiodo benzene,iodosobenzene diacetate,phenyliodine diacetate,phenyliodo diacetate,phenyliodoso acetate,phenyliodosodiacetate,phenyliodoso diacetate,bis acetato phenyliodine,benzene, diacetoxyiodo |
| SMIL | CC(=O)OI(C1=CC=CC=C1)OC(=O)C |
| IUPAC navn | [acetyloxy(phenyl)-$1^{3}-iodanyl]acetat |
| InChI nøgle | ZBIKORITPGTTGI-UHFFFAOYSA-N |
| Molekylær formel | C10H11IO4 |
Benzhydrol, 99%
CAS: 91-01-0 Molekylær formel: C13H12O Molekylvægt (g/mol): 184.24 MDL nummer: MFCD00004488 InChI nøgle: QILSFLSDHQAZET-UHFFFAOYSA-N Synonym: benzhydrol,diphenylcarbinol,benzohydrol,benzhydryl alcohol,hydroxydiphenylmethane,diphenylmethyl alcohol,diphenyl carbinol,alpha-phenylbenzenemethanol,diphenyl-methanol,benzenemethanol, .alpha.-phenyl PubChem CID: 7037 IUPAC navn: diphenylmethanol SMIL: C1=CC=C(C=C1)C(C2=CC=CC=C2)O
| MDL nummer | MFCD00004488 |
|---|---|
| PubChem CID | 7037 |
| Molekylvægt (g/mol) | 184.24 |
| CAS | 91-01-0 |
| Synonym | benzhydrol,diphenylcarbinol,benzohydrol,benzhydryl alcohol,hydroxydiphenylmethane,diphenylmethyl alcohol,diphenyl carbinol,alpha-phenylbenzenemethanol,diphenyl-methanol,benzenemethanol, .alpha.-phenyl |
| SMIL | C1=CC=C(C=C1)C(C2=CC=CC=C2)O |
| IUPAC navn | diphenylmethanol |
| InChI nøgle | QILSFLSDHQAZET-UHFFFAOYSA-N |
| Molekylær formel | C13H12O |
Thermo Scientific Chemicals Grundlæggende Fuchsin
CAS: 632-99-5 Molekylær formel: C20H20ClN3 Molekylvægt (g/mol): 337.85 MDL nummer: MFCD00012569 InChI nøgle: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC navn: 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-yliden)methyl]anilin;hydrochlorid SMIL: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
| MDL nummer | MFCD00012569 |
|---|---|
| PubChem CID | 12447 |
| Molekylvægt (g/mol) | 337.85 |
| CAS | 632-99-5 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| SMIL | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| IUPAC navn | 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-yliden)methyl]anilin;hydrochlorid |
| InChI nøgle | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
| Molekylær formel | C20H20ClN3 |
| MDL nummer | MFCD00217672 |
|---|---|
| Kemisk navn eller materiale | Buffer solution pH 4 |
| CAS | 7487-94-7 |
| Formel vægt | 204.22 |
| Opløselighedsinformation | Solubility in water: miscible. |
| Koncentration | 1.0% (Potassium hydrogen phthalate) |
| Fysisk form | Væske |
| Molekylær formel | C8H5KO4 |
Sodium salicylate, 99%
CAS: 54-21-7 Molekylær formel: C7H5NaO3 Molekylvægt (g/mol): 160.104 MDL nummer: MFCD00002440 InChI nøgle: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC navn: natrium;2-hydroxybenzoat SMIL: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
| MDL nummer | MFCD00002440 |
|---|---|
| PubChem CID | 16760658 |
| Molekylvægt (g/mol) | 160.104 |
| CAS | 54-21-7 |
| ChEBI | CHEBI:9180 |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| SMIL | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| IUPAC navn | natrium;2-hydroxybenzoat |
| InChI nøgle | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molekylær formel | C7H5NaO3 |
Benzyl alcohol, specified according to requirements of Ph.Eur.
CAS: 100-51-6 Molekylær formel: C7H8O Molekylvægt (g/mol): 108.14 MDL nummer: MFCD00004599,MFCD03792087 InChI nøgle: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC navn: phenylmethanol SMIL: OCC1=CC=CC=C1
| MDL nummer | MFCD00004599,MFCD03792087 |
|---|---|
| PubChem CID | 244 |
| Molekylvægt (g/mol) | 108.14 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| SMIL | OCC1=CC=CC=C1 |
| IUPAC navn | phenylmethanol |
| InChI nøgle | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molekylær formel | C7H8O |
Molecular sieves, 4A, -8+12 (ca 2mm) beads
CAS: 70955-01-0 Molekylær formel: C20H25FN2O8 Molekylvægt (g/mol): 440.42 MDL nummer: MFCD00131613 InChI nøgle: FJUZEZRZKVMAMD-UHFFFAOYNA-N PubChem CID: 73906282 IUPAC navn: (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorphenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentansyre SMIL: COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC
| MDL nummer | MFCD00131613 |
|---|---|
| PubChem CID | 73906282 |
| Molekylvægt (g/mol) | 440.42 |
| CAS | 70955-01-0 |
| SMIL | COC(=O)C(C(C)C(NC(=O)C(CC1=CC(F)=CC=C1)NC(C)=O)C(O)=O)C(=O)OC |
| IUPAC navn | (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorphenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentansyre |
| InChI nøgle | FJUZEZRZKVMAMD-UHFFFAOYNA-N |
| Molekylær formel | C20H25FN2O8 |
Ethyl 4-aminobenzoate, 98%
CAS: 94-09-7 Molekylær formel: C9H11NO2 Molekylvægt (g/mol): 165.19 MDL nummer: MFCD00007892 InChI nøgle: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 IUPAC navn: ethyl-4-aminobenzoat SMIL: CCOC(=O)C1=CC=C(N)C=C1
| MDL nummer | MFCD00007892 |
|---|---|
| PubChem CID | 2337 |
| Molekylvægt (g/mol) | 165.19 |
| CAS | 94-09-7 |
| ChEBI | CHEBI:116735 |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| SMIL | CCOC(=O)C1=CC=C(N)C=C1 |
| IUPAC navn | ethyl-4-aminobenzoat |
| InChI nøgle | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molekylær formel | C9H11NO2 |