Filtrerede søgeresultater
Tris(dibenzylidenacetone)dipalladium(0), 97 %, Thermo Scientific Chemicals
CAS: 51364-51-3 Molekylær formel: C51H42O3Pd2 Molekylvægt (g/mol): 915.73 MDL nummer: MFCD00013310 InChI nøgle: CYPYTURSJDMMMP-UHFFFAOYSA-N Synonym: tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium PubChem CID: 9811564 IUPAC navn: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-on; palladium SMIL: [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1
| MDL nummer | MFCD00013310 |
|---|---|
| PubChem CID | 9811564 |
| Molekylvægt (g/mol) | 915.73 |
| CAS | 51364-51-3 |
| Synonym | tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium |
| SMIL | [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1 |
| IUPAC navn | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-on; palladium |
| InChI nøgle | CYPYTURSJDMMMP-UHFFFAOYSA-N |
| Molekylær formel | C51H42O3Pd2 |
Allylpalladium chloride dimer, 98%
CAS: 12012-95-2 Molekylær formel: C6H10Cl2Pd2 Molekylvægt (g/mol): 365.89 MDL nummer: MFCD00044874 InChI nøgle: PENAXHPKEVTBLF-UHFFFAOYSA-L Synonym: allylpalladium chloride dimer,bis allyl dichlorodipalladium,diallyldipalladium dichloride,palladium allyl chloride dimer,diallydichlorodipalladium,pi-allyl palladium chloride,allylpalladium ii chloride,bis chloro-pi-allylpalladium,allyl palladium chloride dimer,bis pi-allyl chloropalladium PubChem CID: 61538 IUPAC navn: chlorpalladium(1+);prop-1-en SMIL: Cl[Pd].Cl[Pd].c:c:c.c:c:c
| MDL nummer | MFCD00044874 |
|---|---|
| PubChem CID | 61538 |
| Molekylvægt (g/mol) | 365.89 |
| CAS | 12012-95-2 |
| Synonym | allylpalladium chloride dimer,bis allyl dichlorodipalladium,diallyldipalladium dichloride,palladium allyl chloride dimer,diallydichlorodipalladium,pi-allyl palladium chloride,allylpalladium ii chloride,bis chloro-pi-allylpalladium,allyl palladium chloride dimer,bis pi-allyl chloropalladium |
| SMIL | Cl[Pd].Cl[Pd].c:c:c.c:c:c |
| IUPAC navn | chlorpalladium(1+);prop-1-en |
| InChI nøgle | PENAXHPKEVTBLF-UHFFFAOYSA-L |
| Molekylær formel | C6H10Cl2Pd2 |
Palladium(II) acetate, 99.9%, (trace metal basis)
CAS: 3375-31-3 Molekylær formel: C4H6O4Pd Molekylvægt (g/mol): 224.51 MDL nummer: MFCD00012453 InChI nøgle: YJVFFLUZDVXJQI-UHFFFAOYSA-L Synonym: palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate PubChem CID: 167845 IUPAC navn: palladium(2+);diacetat SMIL: [Pd++].CC([O-])=O.CC([O-])=O
| MDL nummer | MFCD00012453 |
|---|---|
| PubChem CID | 167845 |
| Molekylvægt (g/mol) | 224.51 |
| CAS | 3375-31-3 |
| Synonym | palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate |
| SMIL | [Pd++].CC([O-])=O.CC([O-])=O |
| IUPAC navn | palladium(2+);diacetat |
| InChI nøgle | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| Molekylær formel | C4H6O4Pd |
Palladium wire, 0.5mm (0.02in) dia, Premion™, 99.99+% (metals basis)
CAS: 5-3-7440 Molekylær formel: Pd Molekylvægt (g/mol): 106.42 MDL nummer: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI nøgle: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC navn: palladium SMIL: [Pd]
| MDL nummer | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
|---|---|
| PubChem CID | 23938 |
| Molekylvægt (g/mol) | 106.42 |
| CAS | 5-3-7440 |
| ChEBI | CHEBI:33363 |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| SMIL | [Pd] |
| IUPAC navn | palladium |
| InChI nøgle | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molekylær formel | Pd |
Tetrakis(triphenylphosphin)palladium(0), 99 %, Thermo Scientific Chemicals
CAS: 14221-01-3 Molekylær formel: C72H60P4Pd Molekylvægt (g/mol): 1155.59 MDL nummer: MFCD00010012 InChI nøgle: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC navn: palladium;triphenylphosphan SMIL: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00010012 |
|---|---|
| PubChem CID | 11979704 |
| Molekylvægt (g/mol) | 1155.59 |
| CAS | 14221-01-3 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| SMIL | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | palladium;triphenylphosphan |
| InChI nøgle | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molekylær formel | C72H60P4Pd |
Bis(triphenylphosphine)palladium(II) chloride, for analysis, 15% Pd
CAS: 13965-03-2 Molekylær formel: C36H30Cl2P2Pd Molekylvægt (g/mol): 701.90 MDL nummer: MFCD00009593 InChI nøgle: YNHIGQDRGKUECZ-UHFFFAOYSA-L Synonym: bis triphenylphosphine palladium ii dichloride,bis triphenylphosphine palladium ii chloride,dichlorobis triphenylphosphine palladium,bis triphenylphosphine palladium chloride,bis triphenylphosphine palladiuml ii dichloride,palladium 2+ ; triphenylphosphane; dichloride,trans-dichlorobis triphenylphosphine palladium ii 1g PubChem CID: 131664180 IUPAC navn: ethan;methan;palladium(2+);triphenylphosphan;dichlorid SMIL: [Cl-].[Cl-].[Pd++].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00009593 |
|---|---|
| PubChem CID | 131664180 |
| Molekylvægt (g/mol) | 701.90 |
| CAS | 13965-03-2 |
| Synonym | bis triphenylphosphine palladium ii dichloride,bis triphenylphosphine palladium ii chloride,dichlorobis triphenylphosphine palladium,bis triphenylphosphine palladium chloride,bis triphenylphosphine palladiuml ii dichloride,palladium 2+ ; triphenylphosphane; dichloride,trans-dichlorobis triphenylphosphine palladium ii 1g |
| SMIL | [Cl-].[Cl-].[Pd++].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | ethan;methan;palladium(2+);triphenylphosphan;dichlorid |
| InChI nøgle | YNHIGQDRGKUECZ-UHFFFAOYSA-L |
| Molekylær formel | C36H30Cl2P2Pd |
Palladium(II) nitrate hydrate
CAS: 207596-32-5 Molekylær formel: N2O6Pd Molekylvægt (g/mol): 230.43 MDL nummer: MFCD00149818 InChI nøgle: GPNDARIEYHPYAY-UHFFFAOYSA-N Synonym: palladium ii nitrate hydrate,palladium nitrate hydrate,palladium 2+ hydrate dinitrate,acmc-1bnae,palladous nitrate hydrate,palladium dinitrate hydrate,2no3.pd.h2o,ksc492s0r,palladium ii nitrate,hydrate,palladium,diaquabis nitrato-o-9ci PubChem CID: 16211503 SMIL: [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| MDL nummer | MFCD00149818 |
|---|---|
| PubChem CID | 16211503 |
| Molekylvægt (g/mol) | 230.43 |
| CAS | 207596-32-5 |
| Synonym | palladium ii nitrate hydrate,palladium nitrate hydrate,palladium 2+ hydrate dinitrate,acmc-1bnae,palladous nitrate hydrate,palladium dinitrate hydrate,2no3.pd.h2o,ksc492s0r,palladium ii nitrate,hydrate,palladium,diaquabis nitrato-o-9ci |
| SMIL | [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| InChI nøgle | GPNDARIEYHPYAY-UHFFFAOYSA-N |
| Molekylær formel | N2O6Pd |
Palladium(II) chloride, 99.999%, (trace metal basis)
CAS: 7647-10-1 Molekylær formel: Cl2Pd Molekylvægt (g/mol): 177.32 MDL nummer: MFCD00003558 InChI nøgle: PIBWKRNGBLPSSY-UHFFFAOYSA-L Synonym: palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 PubChem CID: 24290 ChEBI: CHEBI:53434 SMIL: [Cl-].[Cl-].[Pd++]
| MDL nummer | MFCD00003558 |
|---|---|
| PubChem CID | 24290 |
| Molekylvægt (g/mol) | 177.32 |
| CAS | 7647-10-1 |
| ChEBI | CHEBI:53434 |
| Synonym | palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 |
| SMIL | [Cl-].[Cl-].[Pd++] |
| InChI nøgle | PIBWKRNGBLPSSY-UHFFFAOYSA-L |
| Molekylær formel | Cl2Pd |
Palladiumtråd, 0,203 mm (0,008 tommer) dia., hård, 99,95% (metalbasis), Thermo Scientific Chemicals
CAS: 5-3-7440 Molekylær formel: Pd Molekylvægt (g/mol): 106.42 MDL nummer: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI nøgle: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC navn: palladium SMIL: [Pd]
| MDL nummer | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
|---|---|
| PubChem CID | 23938 |
| Molekylvægt (g/mol) | 106.42 |
| CAS | 5-3-7440 |
| ChEBI | CHEBI:33363 |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| SMIL | [Pd] |
| IUPAC navn | palladium |
| InChI nøgle | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molekylær formel | Pd |
Palladium on 2-4 mm alumina pellets, 0.5% Pd
CAS: 5-3-7440 Molekylær formel: Pd Molekylvægt (g/mol): 106.42 MDL nummer: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI nøgle: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC navn: palladium SMIL: [Pd]
| MDL nummer | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
|---|---|
| PubChem CID | 23938 |
| Molekylvægt (g/mol) | 106.42 |
| CAS | 5-3-7440 |
| ChEBI | CHEBI:33363 |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| SMIL | [Pd] |
| IUPAC navn | palladium |
| InChI nøgle | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molekylær formel | Pd |
Bis(triphenylphosphin)palladium(II)chlorid, 98 %, Thermo Scientific Chemicals
CAS: 13965-03-2 Molekylær formel: C36H30Cl2P2Pd Molekylvægt (g/mol): 701.90 MDL nummer: MFCD00009593 InChI nøgle: YNHIGQDRGKUECZ-UHFFFAOYSA-L Synonym: bis triphenylphosphine palladium ii dichloride,bis triphenylphosphine palladium ii chloride,dichlorobis triphenylphosphine palladium,bis triphenylphosphine palladium chloride,bis triphenylphosphine palladiuml ii dichloride,palladium 2+ ; triphenylphosphane; dichloride,trans-dichlorobis triphenylphosphine palladium ii 1g PubChem CID: 131664180 IUPAC navn: ethan;methan;palladium(2+);triphenylphosphan;dichlorid SMIL: [Cl-].[Cl-].[Pd++].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00009593 |
|---|---|
| PubChem CID | 131664180 |
| Molekylvægt (g/mol) | 701.90 |
| CAS | 13965-03-2 |
| Synonym | bis triphenylphosphine palladium ii dichloride,bis triphenylphosphine palladium ii chloride,dichlorobis triphenylphosphine palladium,bis triphenylphosphine palladium chloride,bis triphenylphosphine palladiuml ii dichloride,palladium 2+ ; triphenylphosphane; dichloride,trans-dichlorobis triphenylphosphine palladium ii 1g |
| SMIL | [Cl-].[Cl-].[Pd++].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | ethan;methan;palladium(2+);triphenylphosphan;dichlorid |
| InChI nøgle | YNHIGQDRGKUECZ-UHFFFAOYSA-L |
| Molekylær formel | C36H30Cl2P2Pd |
Palladium(II) acetate, 47.5% Pd
CAS: 3375-31-3 Molekylær formel: C4H6O4Pd Molekylvægt (g/mol): 224.51 MDL nummer: MFCD00012453 InChI nøgle: YJVFFLUZDVXJQI-UHFFFAOYSA-L Synonym: palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate PubChem CID: 167845 SMIL: [Pd++].CC([O-])=O.CC([O-])=O
| MDL nummer | MFCD00012453 |
|---|---|
| PubChem CID | 167845 |
| Molekylvægt (g/mol) | 224.51 |
| CAS | 3375-31-3 |
| Synonym | palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate |
| SMIL | [Pd++].CC([O-])=O.CC([O-])=O |
| InChI nøgle | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| Molekylær formel | C4H6O4Pd |
Palladium on activated carbon, unreduced, 5% Pd
CAS: 7440-05-3 Molekylær formel: Pd Molekylvægt (g/mol): 106.42 MDL nummer: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI nøgle: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC navn: palladium SMIL: [Pd]
| MDL nummer | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
|---|---|
| PubChem CID | 23938 |
| Molekylvægt (g/mol) | 106.42 |
| CAS | 7440-05-3 |
| ChEBI | CHEBI:33363 |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| SMIL | [Pd] |
| IUPAC navn | palladium |
| InChI nøgle | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molekylær formel | Pd |
Palladium powder, APS 0.35-0.8 micron, 99.95% (metals basis)
CAS: 5-3-7440 Molekylær formel: Pd Molekylvægt (g/mol): 106.42 MDL nummer: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI nøgle: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC navn: palladium SMIL: [Pd]
| MDL nummer | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
|---|---|
| PubChem CID | 23938 |
| Molekylvægt (g/mol) | 106.42 |
| CAS | 5-3-7440 |
| ChEBI | CHEBI:33363 |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| SMIL | [Pd] |
| IUPAC navn | palladium |
| InChI nøgle | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molekylær formel | Pd |
Palladium(II) oxide, 99.995%, (trace metal basis)
CAS: 1314-08-5 Molekylær formel: OPd Molekylvægt (g/mol): 122.42 MDL nummer: MFCD00011172 InChI nøgle: JQPTYAILLJKUCY-UHFFFAOYSA-N Synonym: palladium ii oxide,palladium oxide pdo,acmc-1bqvh,palladium oxide, pdo,palladium ii oxide, anhydrous,palladium ii oxide-pd,11113-77-2 cpd with unspecified mf,palladium oxide ? inverted exclamation mark-?,palladium ii oxide trace metals basis PubChem CID: 5083724 IUPAC navn: palladium(2+)oxidandiid SMIL: [O--].[Pd++]
| MDL nummer | MFCD00011172 |
|---|---|
| PubChem CID | 5083724 |
| Molekylvægt (g/mol) | 122.42 |
| CAS | 1314-08-5 |
| Synonym | palladium ii oxide,palladium oxide pdo,acmc-1bqvh,palladium oxide, pdo,palladium ii oxide, anhydrous,palladium ii oxide-pd,11113-77-2 cpd with unspecified mf,palladium oxide ? inverted exclamation mark-?,palladium ii oxide trace metals basis |
| SMIL | [O--].[Pd++] |
| IUPAC navn | palladium(2+)oxidandiid |
| InChI nøgle | JQPTYAILLJKUCY-UHFFFAOYSA-N |
| Molekylær formel | OPd |