Carboxylsyreestere
- (4)
- (2)
- (2)
- (3)
- (3)
- (4)
- (2)
- (3)
- (1)
- (4)
- (3)
- (2)
- (3)
- (6)
- (3)
- (2)
- (2)
- (2)
- (1)
- (3)
- (4)
- (3)
- (3)
- (3)
- (4)
- (3)
- (1)
- (3)
- (5)
- (1)
- (3)
- (1)
- (2)
- (2)
- (2)
- (2)
- (1)
- (2)
- (1)
- (6)
- (1)
- (3)
- (2)
- (12)
- (14)
- (4)
- (3)
- (2)
- (4)
- (14)
Filtrerede søgeresultater
Dimethyl oxalate, 99%
CAS: 553-90-2 Molekylær formel: C4H6O4 Molekylvægt (g/mol): 118.09 MDL nummer: MFCD00008442 InChI nøgle: LOMVENUNSWAXEN-UHFFFAOYSA-N Synonym: methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid PubChem CID: 11120 ChEBI: CHEBI:6859 IUPAC navn: dimethyloxalat SMIL: COC(=O)C(=O)OC
| MDL nummer | MFCD00008442 |
|---|---|
| PubChem CID | 11120 |
| Molekylvægt (g/mol) | 118.09 |
| CAS | 553-90-2 |
| ChEBI | CHEBI:6859 |
| Synonym | methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid |
| SMIL | COC(=O)C(=O)OC |
| IUPAC navn | dimethyloxalat |
| InChI nøgle | LOMVENUNSWAXEN-UHFFFAOYSA-N |
| Molekylær formel | C4H6O4 |
Vinyl acetate, 99+%, stabilized
CAS: 108-05-4 Molekylær formel: C4H6O2 Molekylvægt (g/mol): 86.09 InChI nøgle: XTXRWKRVRITETP-UHFFFAOYSA-N Synonym: vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer PubChem CID: 7904 ChEBI: CHEBI:46916 IUPAC navn: ethenylacetat SMIL: CC(=O)OC=C
| PubChem CID | 7904 |
|---|---|
| Molekylvægt (g/mol) | 86.09 |
| CAS | 108-05-4 |
| ChEBI | CHEBI:46916 |
| Synonym | vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer |
| SMIL | CC(=O)OC=C |
| IUPAC navn | ethenylacetat |
| InChI nøgle | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Molekylær formel | C4H6O2 |
Methyl bromoacetate, 99%
CAS: 96-32-2 Molekylær formel: C3H5BrO2 Molekylvægt (g/mol): 152.98 MDL nummer: MFCD00000189 InChI nøgle: YDCHPLOFQATIDS-UHFFFAOYSA-N Synonym: methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech PubChem CID: 60984 IUPAC navn: methyl-2-bromacetat SMIL: COC(=O)CBr
| MDL nummer | MFCD00000189 |
|---|---|
| PubChem CID | 60984 |
| Molekylvægt (g/mol) | 152.98 |
| CAS | 96-32-2 |
| Synonym | methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech |
| SMIL | COC(=O)CBr |
| IUPAC navn | methyl-2-bromacetat |
| InChI nøgle | YDCHPLOFQATIDS-UHFFFAOYSA-N |
| Molekylær formel | C3H5BrO2 |
Methylbromacetat, 98+%, Thermo Scientific Chemicals
CAS: 96-32-2 Molekylær formel: C3H5BrO2 Molekylvægt (g/mol): 152.975 MDL nummer: MFCD00000189 InChI nøgle: YDCHPLOFQATIDS-UHFFFAOYSA-N Synonym: methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech PubChem CID: 60984 IUPAC navn: methyl-2-bromacetat SMIL: COC(=O)CBr
| MDL nummer | MFCD00000189 |
|---|---|
| PubChem CID | 60984 |
| Molekylvægt (g/mol) | 152.975 |
| CAS | 96-32-2 |
| Synonym | methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech |
| SMIL | COC(=O)CBr |
| IUPAC navn | methyl-2-bromacetat |
| InChI nøgle | YDCHPLOFQATIDS-UHFFFAOYSA-N |
| Molekylær formel | C3H5BrO2 |
Isopropenylacetat, 99 %, Thermo Scientific Chemicals
CAS: 108-22-5 Molekylær formel: C5H8O2 Molekylvægt (g/mol): 100.12 MDL nummer: MFCD00008709 InChI nøgle: HETCEOQFVDFGSY-UHFFFAOYSA-N Synonym: isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate PubChem CID: 7916 IUPAC navn: prop-1-en-2-ylacetat SMIL: CC(=C)OC(C)=O
| MDL nummer | MFCD00008709 |
|---|---|
| PubChem CID | 7916 |
| Molekylvægt (g/mol) | 100.12 |
| CAS | 108-22-5 |
| Synonym | isopropenyl acetate,2-acetoxypropene,1-methylvinyl acetate,2-acetoxypropylene,methylvinyl acetate,1-propen-2-ol, acetate,propen-2-yl acetate,acetic acid isopropenyl ester,1-acetoxy-1-methylethylene,1-propen-2-yl acetate |
| SMIL | CC(=C)OC(C)=O |
| IUPAC navn | prop-1-en-2-ylacetat |
| InChI nøgle | HETCEOQFVDFGSY-UHFFFAOYSA-N |
| Molekylær formel | C5H8O2 |
Methyl chloroacetate, 99+%
CAS: 96-34-4 Molekylær formel: C3H5ClO2 Molekylvægt (g/mol): 108.521 MDL nummer: MFCD00000931 InChI nøgle: QABLOFMHHSOFRJ-UHFFFAOYSA-N Synonym: methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 PubChem CID: 7295 IUPAC navn: methyl-2-chloracetat SMIL: COC(=O)CCl
| MDL nummer | MFCD00000931 |
|---|---|
| PubChem CID | 7295 |
| Molekylvægt (g/mol) | 108.521 |
| CAS | 96-34-4 |
| Synonym | methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 |
| SMIL | COC(=O)CCl |
| IUPAC navn | methyl-2-chloracetat |
| InChI nøgle | QABLOFMHHSOFRJ-UHFFFAOYSA-N |
| Molekylær formel | C3H5ClO2 |
Methyl 2,3-dichloropropionate, 98%
CAS: 3674-09-7 Molekylær formel: C4H6Cl2O2 Molekylvægt (g/mol): 156.99 MDL nummer: MFCD00000944 InChI nøgle: OFHMODDLBXETIK-UHFFFAOYNA-N IUPAC navn: methyl-2,3-dichlorpropanoat
| MDL nummer | MFCD00000944 |
|---|---|
| Molekylvægt (g/mol) | 156.99 |
| CAS | 3674-09-7 |
| IUPAC navn | methyl-2,3-dichlorpropanoat |
| InChI nøgle | OFHMODDLBXETIK-UHFFFAOYNA-N |
| Molekylær formel | C4H6Cl2O2 |
Methylmethacrylat, 99%, stabiliseret, Thermo Scientific Chemicals
CAS: 80-62-6 Molekylær formel: C5H8O2 Molekylvægt (g/mol): 100.12 MDL nummer: MFCD00008587 InChI nøgle: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC navn: methyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OC
| MDL nummer | MFCD00008587 |
|---|---|
| PubChem CID | 6658 |
| Molekylvægt (g/mol) | 100.12 |
| CAS | 80-62-6 |
| ChEBI | CHEBI:34840 |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| SMIL | CC(=C)C(=O)OC |
| IUPAC navn | methyl-2-methylprop-2-enoat |
| InChI nøgle | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molekylær formel | C5H8O2 |
Methylchloracetat, 98 %, Thermo Scientific Chemicals
CAS: 96-34-4 Molekylær formel: C3H5ClO2 Molekylvægt (g/mol): 108.52 MDL nummer: MFCD00000931 InChI nøgle: QABLOFMHHSOFRJ-UHFFFAOYSA-N Synonym: methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 PubChem CID: 7295 IUPAC navn: methyl-2-chloracetat SMIL: COC(=O)CCl
| MDL nummer | MFCD00000931 |
|---|---|
| PubChem CID | 7295 |
| Molekylvægt (g/mol) | 108.52 |
| CAS | 96-34-4 |
| Synonym | methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 |
| SMIL | COC(=O)CCl |
| IUPAC navn | methyl-2-chloracetat |
| InChI nøgle | QABLOFMHHSOFRJ-UHFFFAOYSA-N |
| Molekylær formel | C3H5ClO2 |
Dehydroacetic acid, 98%
CAS: 520-45-6 Molekylær formel: C8H8O4 Molekylvægt (g/mol): 168.15 MDL nummer: MFCD00066709 InChI nøgle: PGRHXDWITVMQBC-UHFFFAOYSA-N Synonym: dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 PubChem CID: 122903 IUPAC navn: 3-acetyl-6-methylpyran-2,4-dion SMIL: CC1=CC(=O)C(C(=O)O1)C(=O)C
| MDL nummer | MFCD00066709 |
|---|---|
| PubChem CID | 122903 |
| Molekylvægt (g/mol) | 168.15 |
| CAS | 520-45-6 |
| Synonym | dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 |
| SMIL | CC1=CC(=O)C(C(=O)O1)C(=O)C |
| IUPAC navn | 3-acetyl-6-methylpyran-2,4-dion |
| InChI nøgle | PGRHXDWITVMQBC-UHFFFAOYSA-N |
| Molekylær formel | C8H8O4 |
Ethylmethacrylat, 99%, stabiliseret, Thermo Scientific Chemicals
CAS: 97-63-2 Molekylær formel: C6H10O2 Molekylvægt (g/mol): 114.14 MDL nummer: MFCD00009161 InChI nøgle: SUPCQIBBMFXVTL-UHFFFAOYSA-N Synonym: ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester PubChem CID: 7343 IUPAC navn: ethyl-2-methylprop-2-enoat SMIL: CCOC(=O)C(=C)C
| MDL nummer | MFCD00009161 |
|---|---|
| PubChem CID | 7343 |
| Molekylvægt (g/mol) | 114.14 |
| CAS | 97-63-2 |
| Synonym | ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester |
| SMIL | CCOC(=O)C(=C)C |
| IUPAC navn | ethyl-2-methylprop-2-enoat |
| InChI nøgle | SUPCQIBBMFXVTL-UHFFFAOYSA-N |
| Molekylær formel | C6H10O2 |
Diethyl fumarate, 98%
CAS: 623-91-6 Molekylær formel: C8H12O4 Molekylvægt (g/mol): 172.18 MDL nummer: MFCD00064455 InChI nøgle: IEPRKVQEAMIZSS-AATRIKPKSA-N Synonym: diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a PubChem CID: 638144 ChEBI: CHEBI:87388 IUPAC navn: diethyl (E)-but-2-endioat SMIL: CCOC(=O)\C=C\C(=O)OCC
| MDL nummer | MFCD00064455 |
|---|---|
| PubChem CID | 638144 |
| Molekylvægt (g/mol) | 172.18 |
| CAS | 623-91-6 |
| ChEBI | CHEBI:87388 |
| Synonym | diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a |
| SMIL | CCOC(=O)\C=C\C(=O)OCC |
| IUPAC navn | diethyl (E)-but-2-endioat |
| InChI nøgle | IEPRKVQEAMIZSS-AATRIKPKSA-N |
| Molekylær formel | C8H12O4 |