Phenol estere
- (1)
- (2)
- (2)
- (2)
- (4)
- (4)
- (4)
- (2)
- (2)
- (2)
- (2)
- (4)
- (2)
- (2)
- (8)
- (3)
- (3)
- (4)
- (2)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
- (4)
- (2)
- (2)
- (2)
- (10)
- (6)
- (38)
- (17)
- (7)
- (13)
- (2)
- (7)
- (2)
- (1)
- (18)
- (5)
- (3)
- (22)
- (4)
- (1)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
Filtrerede søgeresultater
4-nitrophenylacetat, 97 %, Thermo Scientific Chemicals
CAS: 830-03-5 Molekylær formel: C8H7NO4 Molekylvægt (g/mol): 181.15 MDL nummer: MFCD00007326 InChI nøgle: QAUUDNIGJSLPSX-UHFFFAOYSA-N Synonym: p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester PubChem CID: 13243 ChEBI: CHEBI:82635 IUPAC navn: (4-nitrophenyl)acetat SMIL: CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O
| MDL nummer | MFCD00007326 |
|---|---|
| PubChem CID | 13243 |
| Molekylvægt (g/mol) | 181.15 |
| CAS | 830-03-5 |
| ChEBI | CHEBI:82635 |
| Synonym | p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester |
| SMIL | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| IUPAC navn | (4-nitrophenyl)acetat |
| InChI nøgle | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Molekylær formel | C8H7NO4 |
Phenylacrylat, 97%, Thermo Scientific Chemicals
CAS: 937-41-7 Molekylær formel: C9H8O2 Molekylvægt (g/mol): 148.161 MDL nummer: MFCD00048145 InChI nøgle: WRAQQYDMVSCOTE-UHFFFAOYSA-N Synonym: phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht PubChem CID: 61242 IUPAC navn: phenylprop-2-enoat SMIL: C=CC(=O)OC1=CC=CC=C1
| MDL nummer | MFCD00048145 |
|---|---|
| PubChem CID | 61242 |
| Molekylvægt (g/mol) | 148.161 |
| CAS | 937-41-7 |
| Synonym | phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht |
| SMIL | C=CC(=O)OC1=CC=CC=C1 |
| IUPAC navn | phenylprop-2-enoat |
| InChI nøgle | WRAQQYDMVSCOTE-UHFFFAOYSA-N |
| Molekylær formel | C9H8O2 |
1,3-Diacetoxybenzene, 97%
CAS: 108-58-7 Molekylær formel: C10H10O4 Molekylvægt (g/mol): 194.186 MDL nummer: MFCD00008701 InChI nøgle: STOUHHBZBQBYHH-UHFFFAOYSA-N Synonym: 1,3-diacetoxybenzene,resorcinol diacetate,1,3-benzenediol, diacetate,m-phenylenediacetate,resorcinol, diacetate,m-phenylene di acetate,1,3-dihydroxybenzene diacetate,dihydroxybenzene diacetate,1,3-phenylene diacetate,1,3-benzenediol, 1,3-diacetate PubChem CID: 7942 IUPAC navn: (3-acetyloxyphenyl)acetat SMIL: CC(=O)OC1=CC(=CC=C1)OC(=O)C
| MDL nummer | MFCD00008701 |
|---|---|
| PubChem CID | 7942 |
| Molekylvægt (g/mol) | 194.186 |
| CAS | 108-58-7 |
| Synonym | 1,3-diacetoxybenzene,resorcinol diacetate,1,3-benzenediol, diacetate,m-phenylenediacetate,resorcinol, diacetate,m-phenylene di acetate,1,3-dihydroxybenzene diacetate,dihydroxybenzene diacetate,1,3-phenylene diacetate,1,3-benzenediol, 1,3-diacetate |
| SMIL | CC(=O)OC1=CC(=CC=C1)OC(=O)C |
| IUPAC navn | (3-acetyloxyphenyl)acetat |
| InChI nøgle | STOUHHBZBQBYHH-UHFFFAOYSA-N |
| Molekylær formel | C10H10O4 |
Pentafluorophenyl trifluoroacetate, 98+%
CAS: 14533-84-7 Molekylær formel: C8F8O2 Molekylvægt (g/mol): 280.07 MDL nummer: MFCD00134438 InChI nøgle: VCQURUZYYSOUHP-UHFFFAOYSA-N Synonym: pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 PubChem CID: 4327891 IUPAC navn: (2,3,4,5,6-pentafluorphenyl) 2,2,2-trifluoracetat SMIL: FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F
| MDL nummer | MFCD00134438 |
|---|---|
| PubChem CID | 4327891 |
| Molekylvægt (g/mol) | 280.07 |
| CAS | 14533-84-7 |
| Synonym | pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 |
| SMIL | FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F |
| IUPAC navn | (2,3,4,5,6-pentafluorphenyl) 2,2,2-trifluoracetat |
| InChI nøgle | VCQURUZYYSOUHP-UHFFFAOYSA-N |
| Molekylær formel | C8F8O2 |
4-Acetoxybenzoic acid, 98+%
CAS: 2345-34-8 Molekylær formel: C9H8O4 Molekylvægt (g/mol): 180.16 MDL nummer: MFCD00002540 InChI nøgle: GDBUZIKSJGRBJP-UHFFFAOYSA-N Synonym: 4-acetoxybenzoic acid,p-acetoxybenzoic acid,4-acetyloxy benzoic acid,4-carboxyphenyl acetate,benzoic acid, 4-acetyloxy,p-hydroxybenzoic acid acetate,p-acetyloxybenzoic acid,p-carboxyphenyl acetate,benzoic acid, p-hydroxy-, acetate,4-acetoxy benzoic acid PubChem CID: 16865 ChEBI: CHEBI:86560 IUPAC navn: 4-acetyloxybenzoesyre SMIL: CC(=O)OC1=CC=C(C=C1)C(O)=O
| MDL nummer | MFCD00002540 |
|---|---|
| PubChem CID | 16865 |
| Molekylvægt (g/mol) | 180.16 |
| CAS | 2345-34-8 |
| ChEBI | CHEBI:86560 |
| Synonym | 4-acetoxybenzoic acid,p-acetoxybenzoic acid,4-acetyloxy benzoic acid,4-carboxyphenyl acetate,benzoic acid, 4-acetyloxy,p-hydroxybenzoic acid acetate,p-acetyloxybenzoic acid,p-carboxyphenyl acetate,benzoic acid, p-hydroxy-, acetate,4-acetoxy benzoic acid |
| SMIL | CC(=O)OC1=CC=C(C=C1)C(O)=O |
| IUPAC navn | 4-acetyloxybenzoesyre |
| InChI nøgle | GDBUZIKSJGRBJP-UHFFFAOYSA-N |
| Molekylær formel | C9H8O4 |
m-tolylacetat, 97 %, Thermo Scientific Chemicals
CAS: 122-46-3 Molekylær formel: C9H10O2 Molekylvægt (g/mol): 150.18 MDL nummer: MFCD00041910 InChI nøgle: OTGAHJPFNKQGAE-UHFFFAOYSA-N Synonym: m-tolyl acetate,m-cresyl acetate,cresatin,m-acetoxytoluene,m-cresol acetate,acetic acid m-tolyl ester,cresatin-sulzberger,kresatin,acetic acid, 3-methylphenyl ester,m-methylphenyl acetate PubChem CID: 67406 IUPAC navn: (3-methylphenyl)acetat SMIL: CC(=O)OC1=CC=CC(C)=C1
| MDL nummer | MFCD00041910 |
|---|---|
| PubChem CID | 67406 |
| Molekylvægt (g/mol) | 150.18 |
| CAS | 122-46-3 |
| Synonym | m-tolyl acetate,m-cresyl acetate,cresatin,m-acetoxytoluene,m-cresol acetate,acetic acid m-tolyl ester,cresatin-sulzberger,kresatin,acetic acid, 3-methylphenyl ester,m-methylphenyl acetate |
| SMIL | CC(=O)OC1=CC=CC(C)=C1 |
| IUPAC navn | (3-methylphenyl)acetat |
| InChI nøgle | OTGAHJPFNKQGAE-UHFFFAOYSA-N |
| Molekylær formel | C9H10O2 |
4-Acetoxy-3-methoxybenzaldehyde, 98%
CAS: 881-68-5 Molekylær formel: C10H10O4 Molekylvægt (g/mol): 194.186 MDL nummer: MFCD00003362 InChI nøgle: PZSJOBKRSVRODF-UHFFFAOYSA-N Synonym: vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin PubChem CID: 61229 ChEBI: CHEBI:86956 IUPAC navn: (4-formyl-2-methoxyphenyl)acetat SMIL: CC(=O)OC1=C(C=C(C=C1)C=O)OC
| MDL nummer | MFCD00003362 |
|---|---|
| PubChem CID | 61229 |
| Molekylvægt (g/mol) | 194.186 |
| CAS | 881-68-5 |
| ChEBI | CHEBI:86956 |
| Synonym | vanillin acetate,4-acetoxy-3-methoxybenzaldehyde,acetovanillin,acetylvanillin,vanillin, acetate,4-o-acetylvanillin,o-acetylvanillin,benzaldehyde, 4-acetyloxy-3-methoxy,3-methoxy-4-acetoxybenzaldehyde,acetyl vanillin |
| SMIL | CC(=O)OC1=C(C=C(C=C1)C=O)OC |
| IUPAC navn | (4-formyl-2-methoxyphenyl)acetat |
| InChI nøgle | PZSJOBKRSVRODF-UHFFFAOYSA-N |
| Molekylær formel | C10H10O4 |
Phenylacetat, 97%, Thermo Scientific Chemicals
CAS: 122-79-2 Molekylær formel: C8H8O2 Molekylvægt (g/mol): 136.15 MDL nummer: MFCD00008699 InChI nøgle: IPBVNPXQWQGGJP-UHFFFAOYSA-N Synonym: acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech PubChem CID: 31229 ChEBI: CHEBI:8082 IUPAC navn: phenylacetat SMIL: CC(=O)OC1=CC=CC=C1
| MDL nummer | MFCD00008699 |
|---|---|
| PubChem CID | 31229 |
| Molekylvægt (g/mol) | 136.15 |
| CAS | 122-79-2 |
| ChEBI | CHEBI:8082 |
| Synonym | acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech |
| SMIL | CC(=O)OC1=CC=CC=C1 |
| IUPAC navn | phenylacetat |
| InChI nøgle | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Molekylær formel | C8H8O2 |
4-Acetoxystyren, 95 %, stab., Thermo Scientific Chemicals
CAS: 2628-16-2 Molekylær formel: C10H10O2 Molekylvægt (g/mol): 162.188 MDL nummer: MFCD00075734 InChI nøgle: JAMNSIXSLVPNLC-UHFFFAOYSA-N Synonym: 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester PubChem CID: 75821 IUPAC navn: (4-ethenylphenyl)acetat SMIL: CC(=O)OC1=CC=C(C=C1)C=C
| MDL nummer | MFCD00075734 |
|---|---|
| PubChem CID | 75821 |
| Molekylvægt (g/mol) | 162.188 |
| CAS | 2628-16-2 |
| Synonym | 4-acetoxystyrene,4-vinylphenyl acetate,4-ethenylphenol acetate,p-acetoxystyrene,phenol, 4-ethenyl-, acetate,p-vinylphenol acetate,unii-7s21904ayn,phenol, 4-ethenyl-, 1-acetate,4-ethenylphenyl acetate,acetic acid 4-vinylphenyl ester |
| SMIL | CC(=O)OC1=CC=C(C=C1)C=C |
| IUPAC navn | (4-ethenylphenyl)acetat |
| InChI nøgle | JAMNSIXSLVPNLC-UHFFFAOYSA-N |
| Molekylær formel | C10H10O2 |
Phenylbromacetat, 98%, Thermo Scientific Chemicals
CAS: 620-72-4 Molekylær formel: C8H7BrO2 Molekylvægt (g/mol): 215.046 MDL nummer: MFCD00192391 InChI nøgle: UEWYUCGVQMZMGY-UHFFFAOYSA-N Synonym: phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b PubChem CID: 564919 IUPAC navn: phenyl-2-bromacetat SMIL: C1=CC=C(C=C1)OC(=O)CBr
| MDL nummer | MFCD00192391 |
|---|---|
| PubChem CID | 564919 |
| Molekylvægt (g/mol) | 215.046 |
| CAS | 620-72-4 |
| Synonym | phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b |
| SMIL | C1=CC=C(C=C1)OC(=O)CBr |
| IUPAC navn | phenyl-2-bromacetat |
| InChI nøgle | UEWYUCGVQMZMGY-UHFFFAOYSA-N |
| Molekylær formel | C8H7BrO2 |
4-Nitrophenyl palmitate, 98+%
CAS: 1492-30-4 Molekylær formel: C22H35NO4 Molekylvægt (g/mol): 377.525 MDL nummer: MFCD00047732 InChI nøgle: LVZSQWIWCANHPF-UHFFFAOYSA-N Synonym: 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # PubChem CID: 73891 ChEBI: CHEBI:85645 IUPAC navn: (4-nitrophenyl)hexadecanoat SMIL: CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]
| MDL nummer | MFCD00047732 |
|---|---|
| PubChem CID | 73891 |
| Molekylvægt (g/mol) | 377.525 |
| CAS | 1492-30-4 |
| ChEBI | CHEBI:85645 |
| Synonym | 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # |
| SMIL | CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
| IUPAC navn | (4-nitrophenyl)hexadecanoat |
| InChI nøgle | LVZSQWIWCANHPF-UHFFFAOYSA-N |
| Molekylær formel | C22H35NO4 |
1-Acetoxy-2-methoxybenzen, 98 %, Thermo Scientific Chemicals
CAS: 15212-03-0 Molekylær formel: C9H10O3 Molekylvægt (g/mol): 166.176 MDL nummer: MFCD00017221 InChI nøgle: BHJHPYFAYGAPLS-UHFFFAOYSA-N Synonym: guaiacol acetate,1-acetoxy-2-methoxybenzene,guaiacyl acetate,o-acetoxyanisole,o-methoxyphenyl acetate,o-anisyl acetate,acetyl guaiacol,phenol, 2-methoxy-, acetate,o-acetylguaiacol,eucol PubChem CID: 61155 ChEBI: CHEBI:86645 IUPAC navn: (2-methoxyphenyl)acetat SMIL: CC(=O)OC1=CC=CC=C1OC
| MDL nummer | MFCD00017221 |
|---|---|
| PubChem CID | 61155 |
| Molekylvægt (g/mol) | 166.176 |
| CAS | 15212-03-0 |
| ChEBI | CHEBI:86645 |
| Synonym | guaiacol acetate,1-acetoxy-2-methoxybenzene,guaiacyl acetate,o-acetoxyanisole,o-methoxyphenyl acetate,o-anisyl acetate,acetyl guaiacol,phenol, 2-methoxy-, acetate,o-acetylguaiacol,eucol |
| SMIL | CC(=O)OC1=CC=CC=C1OC |
| IUPAC navn | (2-methoxyphenyl)acetat |
| InChI nøgle | BHJHPYFAYGAPLS-UHFFFAOYSA-N |
| Molekylær formel | C9H10O3 |
4-Acetoxybenzeneboronic acid, 97%, Thermo Scientific Chemicals
CAS: 177490-82-3 Molekylær formel: C8H9BO4 Molekylvægt (g/mol): 179.97 MDL nummer: MFCD09027198 InChI nøgle: VILXJXDXZGKJLU-UHFFFAOYSA-N Synonym: 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid PubChem CID: 44119577 IUPAC navn: (4-acetyloxyphenyl)borsyre SMIL: CC(=O)OC1=CC=C(C=C1)B(O)O
| MDL nummer | MFCD09027198 |
|---|---|
| PubChem CID | 44119577 |
| Molekylvægt (g/mol) | 179.97 |
| CAS | 177490-82-3 |
| Synonym | 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid |
| SMIL | CC(=O)OC1=CC=C(C=C1)B(O)O |
| IUPAC navn | (4-acetyloxyphenyl)borsyre |
| InChI nøgle | VILXJXDXZGKJLU-UHFFFAOYSA-N |
| Molekylær formel | C8H9BO4 |
1,4-Diacetoxybenzen, 98 %, Thermo Scientific Chemicals
CAS: 1205-91-0 Molekylær formel: C10H10O4 Molekylvægt (g/mol): 194.19 MDL nummer: MFCD00011643 InChI nøgle: AKOGNYJNGMLDOA-UHFFFAOYSA-N Synonym: 1,4-diacetoxybenzene,hydroquinone diacetate,p-diacetoxybenzene,1,4-benzenediol, diacetate,p-phenylene diacetate,hydroquinone, diacetate,4-acetyloxy phenyl acetate,1,4-phenylene diacetate,1,4-benzenediol, 1,4-diacetate,benzene-1,4-diyl diacetate PubChem CID: 71006 IUPAC navn: (4-acetyloxyphenyl)acetat SMIL: CC(=O)OC1=CC=C(OC(C)=O)C=C1
| MDL nummer | MFCD00011643 |
|---|---|
| PubChem CID | 71006 |
| Molekylvægt (g/mol) | 194.19 |
| CAS | 1205-91-0 |
| Synonym | 1,4-diacetoxybenzene,hydroquinone diacetate,p-diacetoxybenzene,1,4-benzenediol, diacetate,p-phenylene diacetate,hydroquinone, diacetate,4-acetyloxy phenyl acetate,1,4-phenylene diacetate,1,4-benzenediol, 1,4-diacetate,benzene-1,4-diyl diacetate |
| SMIL | CC(=O)OC1=CC=C(OC(C)=O)C=C1 |
| IUPAC navn | (4-acetyloxyphenyl)acetat |
| InChI nøgle | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| Molekylær formel | C10H10O4 |
3-Fluorophenyl acetate, 98%, Thermo Scientific™
CAS: 701-83-7 Molekylær formel: C8H7FO2 Molekylvægt (g/mol): 154.14 MDL nummer: MFCD00142578 InChI nøgle: IAWZWMGUTKRLQB-UHFFFAOYSA-N Synonym: 1-acetoxy-3-fluorobenzene,3-fluorophenylacetate,acetic acid 3-fluorophenyl ester,pubchem3060,m-fluorophenyl acetate,3-fluorophenyl acetate,phenol, 3-fluoro-, acetate,phenol, 3-fluoro-,1-acetate,iawzwmgutkrlqb-uhfffaoysa PubChem CID: 136542 IUPAC navn: (3-fluorophenyl) acetate SMIL: CC(=O)OC1=CC(=CC=C1)F
| MDL nummer | MFCD00142578 |
|---|---|
| PubChem CID | 136542 |
| Molekylvægt (g/mol) | 154.14 |
| CAS | 701-83-7 |
| Synonym | 1-acetoxy-3-fluorobenzene,3-fluorophenylacetate,acetic acid 3-fluorophenyl ester,pubchem3060,m-fluorophenyl acetate,3-fluorophenyl acetate,phenol, 3-fluoro-, acetate,phenol, 3-fluoro-,1-acetate,iawzwmgutkrlqb-uhfffaoysa |
| SMIL | CC(=O)OC1=CC(=CC=C1)F |
| IUPAC navn | (3-fluorophenyl) acetate |
| InChI nøgle | IAWZWMGUTKRLQB-UHFFFAOYSA-N |
| Molekylær formel | C8H7FO2 |