Organometalliske forbindelser
Filtrerede søgeresultater
Zinkmononatriumsalt
CAS: 62625-22-3 Molekylær formel: C20H16N4NaO6S Molekylvægt (g/mol): 463.42 MDL nummer: MFCD00064385 InChI nøgle: IABRINWJUBAIIE-JJECXDOKSA-N PubChem CID: 131856391 IUPAC navn: 2-[2-[(Z)-N-[(Z)-(6-oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesyre;natrium SMIL: C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na]
| MDL nummer | MFCD00064385 |
|---|---|
| PubChem CID | 131856391 |
| Molekylvægt (g/mol) | 463.42 |
| CAS | 62625-22-3 |
| SMIL | C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na] |
| IUPAC navn | 2-[2-[(Z)-N-[(Z)-(6-oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesyre;natrium |
| InChI nøgle | IABRINWJUBAIIE-JJECXDOKSA-N |
| Molekylær formel | C20H16N4NaO6S |
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AlH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.701 |
| Sundhedsfare 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Sundhedsfare 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Opløselighed i vand: reagerer |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Navn note | 1M-opløsning i hexan |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.7010g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 110-54-3 |
| Smeltepunkt | -70,0 °C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | −23 °C |
| Molekylær formel | C8H19Al |
Klorofylin, kobberbaseret trinatriumsalt
CAS: 11006-34-1 Molekylær formel: C34H31CuN4Na3O6 MDL nummer: MFCD00012149
| MDL nummer | MFCD00012149 |
|---|---|
| CAS | 11006-34-1 |
| Molekylær formel | C34H31CuN4Na3O6 |
Chlorotrimethylsilan, 98%
CAS: 75-77-4 Molekylær formel: C3H9ClSi Molekylvægt (g/mol): 108.64 MDL nummer: MFCD00000502 InChI nøgle: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC navn: chlor(trimethyl)silan SMIL: C[Si](C)(C)Cl
| MDL nummer | MFCD00000502 |
|---|---|
| PubChem CID | 6397 |
| Molekylvægt (g/mol) | 108.64 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| SMIL | C[Si](C)(C)Cl |
| IUPAC navn | chlor(trimethyl)silan |
| InChI nøgle | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
| Molekylær formel | C3H9ClSi |
3-aminopropyltriethoxysilan, 99 %, AcroSeal™
CAS: 919-30-2 Molekylær formel: C9H23NO3Si Molekylvægt (g/mol): 221.37 MDL nummer: MFCD00008207,MFCD01324904 InChI nøgle: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC navn: 3-triethoxysilylpropan-1-amin SMIL: CCO[Si](CCCN)(OCC)OCC
| MDL nummer | MFCD00008207,MFCD01324904 |
|---|---|
| PubChem CID | 13521 |
| Molekylvægt (g/mol) | 221.37 |
| CAS | 919-30-2 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| SMIL | CCO[Si](CCCN)(OCC)OCC |
| IUPAC navn | 3-triethoxysilylpropan-1-amin |
| InChI nøgle | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| Molekylær formel | C9H23NO3Si |
3-(Trimethoxysilyl)propylmethacrylat, 98%
CAS: 2530-85-0 Molekylær formel: C10H20O5Si Molekylvægt (g/mol): 248.35 MDL nummer: MFCD00008593 InChI nøgle: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC navn: 3-trimethoxysilylpropyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| MDL nummer | MFCD00008593 |
|---|---|
| PubChem CID | 17318 |
| Molekylvægt (g/mol) | 248.35 |
| CAS | 2530-85-0 |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| SMIL | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| IUPAC navn | 3-trimethoxysilylpropyl-2-methylprop-2-enoat |
| InChI nøgle | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| Molekylær formel | C10H20O5Si |
Bis[3-(triethoxysilyl)propyl]tetrasulfid, S 22,3% (typisk)
CAS: 40372-72-3 Molekylær formel: C18H42O6S4Si2 Molekylvægt (g/mol): 538.94 MDL nummer: MFCD00053751 InChI nøgle: VTHOKNTVYKTUPI-UHFFFAOYSA-N Synonym: bis 3-triethoxysilyl propyl tetrasulfide,4,4,15,15-tetraethoxy-3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane,unii-j98v193zry,bis 3-triethoxysilyl propyl tetrasulphide,3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy,silane coupler kh-858,acmc-1akw5,dsstox_cid_9362 PubChem CID: 162012 IUPAC navn: triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silan SMIL: CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC
| MDL nummer | MFCD00053751 |
|---|---|
| PubChem CID | 162012 |
| Molekylvægt (g/mol) | 538.94 |
| CAS | 40372-72-3 |
| Synonym | bis 3-triethoxysilyl propyl tetrasulfide,4,4,15,15-tetraethoxy-3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane,unii-j98v193zry,bis 3-triethoxysilyl propyl tetrasulphide,3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy,silane coupler kh-858,acmc-1akw5,dsstox_cid_9362 |
| SMIL | CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| IUPAC navn | triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silan |
| InChI nøgle | VTHOKNTVYKTUPI-UHFFFAOYSA-N |
| Molekylær formel | C18H42O6S4Si2 |
3-Glycidoxypropyltrimethoxysilan, 97%
CAS: 2530-83-8 Molekylær formel: C9H20O5Si Molekylvægt (g/mol): 236.34 InChI nøgle: BPSIOYPQMFLKFR-UHFFFAOYSA-N Synonym: 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane PubChem CID: 17317 IUPAC navn: trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silan SMIL: CO[Si](CCCOCC1CO1)(OC)OC
| PubChem CID | 17317 |
|---|---|
| Molekylvægt (g/mol) | 236.34 |
| CAS | 2530-83-8 |
| Synonym | 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane |
| SMIL | CO[Si](CCCOCC1CO1)(OC)OC |
| IUPAC navn | trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silan |
| InChI nøgle | BPSIOYPQMFLKFR-UHFFFAOYSA-N |
| Molekylær formel | C9H20O5Si |
Lithium bis(trimethylsilyl)amid, 1M opløsning i THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167,33 g/mol
| Lineær formel | ((CH3)3Si)2NLi |
|---|---|
| Kemisk navn eller materiale | Lithium bis(trimethylsilyl)amide |
| Specifik vægtfylde | 0.9 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 167.33 |
| Opløselighedsinformation | Opløselighed i vand: reagerer. |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.33 |
| Tæthed | 0.9000g/mL |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| EINECS nummer | 223-725-6 |
| CAS | 109-99-9 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Kogepunkt | 65,0 °C |
| Flammepunkt | −21 °C |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
Lithiumbis(trimethylsilyl)amid, 95%
CAS: 4039-32-1 Molekylær formel: C6H18LiNSi2 Molekylvægt (g/mol): 167.33 MDL nummer: MFCD00008261 InChI nøgle: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC navn: lithium;bis(trimethylsilyl)azanid SMIL: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| MDL nummer | MFCD00008261 |
|---|---|
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.33 |
| CAS | 4039-32-1 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
1,1,1,3,3,3-Hexamethyldisilazan, 98%
CAS: 999-97-3 Molekylær formel: C6H19NSi2 Molekylvægt (g/mol): 161.4 InChI nøgle: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC navn: [dimethyl-(trimethylsilylamino)silyl]methan SMIL: C[Si](C)(C)N[Si](C)(C)C
| PubChem CID | 13838 |
|---|---|
| Molekylvægt (g/mol) | 161.4 |
| CAS | 999-97-3 |
| ChEBI | CHEBI:85068 |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| SMIL | C[Si](C)(C)N[Si](C)(C)C |
| IUPAC navn | [dimethyl-(trimethylsilylamino)silyl]methan |
| InChI nøgle | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| Molekylær formel | C6H19NSi2 |
Hexamethyldisiloxan, 98+%
CAS: 107-46-0 InChI nøgle: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC navn: trimethyl(trimethylsilyloxy)silan SMIL: C[Si](C)(C)O[Si](C)(C)C
| PubChem CID | 24764 |
|---|---|
| CAS | 107-46-0 |
| ChEBI | CHEBI:78002 |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
| SMIL | C[Si](C)(C)O[Si](C)(C)C |
| IUPAC navn | trimethyl(trimethylsilyloxy)silan |
| InChI nøgle | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
Dichlordimethylsilan, 99+%, AcroSeal™
CAS: 75-78-5 Molekylær formel: C2H6Cl2Si Molekylvægt (g/mol): 129.06 MDL nummer: MFCD00000491 InChI nøgle: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC navn: dichlor(dimethyl)silan SMIL: C[Si](C)(Cl)Cl
| MDL nummer | MFCD00000491 |
|---|---|
| PubChem CID | 6398 |
| Molekylvægt (g/mol) | 129.06 |
| CAS | 75-78-5 |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
| SMIL | C[Si](C)(Cl)Cl |
| IUPAC navn | dichlor(dimethyl)silan |
| InChI nøgle | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
| Molekylær formel | C2H6Cl2Si |
3-Aminopropyltriethoxysilan, 99%
CAS: 919-30-2 Molekylær formel: C9H23NO3Si Molekylvægt (g/mol): 221.37 MDL nummer: MFCD00008207,MFCD01324904 InChI nøgle: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC navn: 3-triethoxysilylpropan-1-amin SMIL: CCO[Si](CCCN)(OCC)OCC
| MDL nummer | MFCD00008207,MFCD01324904 |
|---|---|
| PubChem CID | 13521 |
| Molekylvægt (g/mol) | 221.37 |
| CAS | 919-30-2 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| SMIL | CCO[Si](CCCN)(OCC)OCC |
| IUPAC navn | 3-triethoxysilylpropan-1-amin |
| InChI nøgle | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| Molekylær formel | C9H23NO3Si |
Diisobutylaluminiumhydrid, 1,2 M (20 vægt%) opløsning i toluen, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142,22 g/mol
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AIH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.848 |
| Sundhedsfare 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Opløselighed i vand: reagerer voldsomt. Andre opløseligheder: blandet med mættet alifatisk og aromatisk kulbrinter |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 108-88-3 |
| Synonym | DIBAL-H |
| Kogepunkt | 110,0 °C |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | 4 °C |
| Molekylær formel | C8H19Al |