Harpikser og understøtninger
Filtrerede søgeresultater
AmberChrom 50Wx8 100-200 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 MDL nummer: MFCD00132726 IUPAC navn: AmberChrom™ 50WX8 ionbytterharpiks
| MDL nummer | MFCD00132726 |
|---|---|
| CAS | 11119-67-8 |
| IUPAC navn | AmberChrom™ 50WX8 ionbytterharpiks |
Amberlyst™ 15(H), ionbytterharpiks, Thermo Scientific Chemicals
CAS: 39389-20-3 Molekylær formel: C18H18O3S Molekylvægt (g/mol): 314.399 MDL nummer: MFCD00145841 InChI nøgle: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC navn: 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre SMIL: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| MDL nummer | MFCD00145841 |
|---|---|
| PubChem CID | 170197 |
| Molekylvægt (g/mol) | 314.399 |
| CAS | 39389-20-3 |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| SMIL | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| IUPAC navn | 1,2-bis(ethenyl)benzen;2-ethenylbenzensulfonsyre |
| InChI nøgle | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molekylær formel | C18H18O3S |
AmberChrom™ , 50WX8 200-400 (H), Thermo Scientific Chemicals
CAS: 11119-67-8 MDL nummer: MFCD00132726 IUPAC navn: AmberChrom™ 50WX8 ionbytterharpiks
| MDL nummer | MFCD00132726 |
|---|---|
| CAS | 11119-67-8 |
| IUPAC navn | AmberChrom™ 50WX8 ionbytterharpiks |
Amberlite™ IRN-78 ionbytterharpiks, OH-form, Thermo Scientific Chemicals
CAS: 11128-95-3 MDL nummer: MFCD00145822
| MDL nummer | MFCD00145822 |
|---|---|
| CAS | 11128-95-3 |
| MDL nummer | MFCD00132710 |
|---|---|
| CAS | 9002-26-0 |
| MDL nummer | MFCD00132705 |
|---|---|
| CAS | 37380-43-1 |
Amberlite™ IRC-120(H), ionbytterharpiks, Thermo Scientific Chemicals
CAS: 78922-04-0 Molekylær formel: C13H10ClNO4S Molekylvægt (g/mol): 311.736 MDL nummer: MFCD00132707 InChI nøgle: APBOVLPLJFJSRI-UHFFFAOYSA-N Synonym: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 IUPAC navn: 3-[(3-chlorphenyl)sulfonylamino]benzoesyre SMIL: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| MDL nummer | MFCD00132707 |
|---|---|
| PubChem CID | 8190984 |
| Molekylvægt (g/mol) | 311.736 |
| CAS | 78922-04-0 |
| Synonym | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
| SMIL | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| IUPAC navn | 3-[(3-chlorphenyl)sulfonylamino]benzoesyre |
| InChI nøgle | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| Molekylær formel | C13H10ClNO4S |
| MDL nummer | 81645 |
|---|
| MDL nummer | MFCD00217899 |
|---|---|
| Kemisk navn eller materiale | TentaGel™ S-NH2 |
| Indlæser | 0.2 to 0.3mmol/g |
| Partikelstørrelse | 90 Micron |
| Synonym | O-(2-Aminoethyl)polyethylene glycol polymer bound |
| Fysisk form | Pulver |
| Farve | Hvid til gul |
Dowtherm™ EN, Thermo Scientific Chemicals
CAS: 8004-13-5 Molekylær formel: C24H20O Molekylvægt (g/mol): 324.423 MDL nummer: MFCD00148859 InChI nøgle: MHCVCKDNQYMGEX-UHFFFAOYSA-N Synonym: diphyl,dowtherm,dowtherm a,dinil,dinyl,therminol vp,phenyl ether-biphenyl mixture,phenyl ether-diphenyl mixture,biphenyl-diphenyl ether mixture,hsdb 137 PubChem CID: 24670 IUPAC navn: 1,1'-biphenyl;phenoxybenzen SMIL: C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2
| MDL nummer | MFCD00148859 |
|---|---|
| PubChem CID | 24670 |
| Molekylvægt (g/mol) | 324.423 |
| CAS | 8004-13-5 |
| Synonym | diphyl,dowtherm,dowtherm a,dinil,dinyl,therminol vp,phenyl ether-biphenyl mixture,phenyl ether-diphenyl mixture,biphenyl-diphenyl ether mixture,hsdb 137 |
| SMIL | C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2 |
| IUPAC navn | 1,1'-biphenyl;phenoxybenzen |
| InChI nøgle | MHCVCKDNQYMGEX-UHFFFAOYSA-N |
| Molekylær formel | C24H20O |
Amberlyst™ A-21, ionbytterharpiks, Thermo Scientific Chemicals
CAS: 9049-93-8 MDL nummer: MFCD00145842
| MDL nummer | MFCD00145842 |
|---|---|
| CAS | 9049-93-8 |
TentaGel™ MB-Br, Thermo Scientific Chemicals
MDL nummer: MFCD00217898 Synonym: O-(2-Bromoethyl)polyethylene glycol polymer bound
| MDL nummer | MFCD00217898 |
|---|---|
| Synonym | O-(2-Bromoethyl)polyethylene glycol polymer bound |
Ambersep™ 900(OH), ionbytterharpiks, Thermo Scientific Chemicals
CAS: 9017-79-2 MDL nummer: MFCD00802695
| MDL nummer | MFCD00802695 |
|---|---|
| CAS | 9017-79-2 |
Amberlite™ XAD 1180 ionbytterharpiks, Thermo Scientific Chemicals
CAS: 9003-69-4 Molekylær formel: C10H10 Molekylvægt (g/mol): 0.00 MDL nummer: MFCD00132704 InChI nøgle: MYRTYDVEIRVNKP-UHFFFAOYSA-N Synonym: divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb PubChem CID: 66666 SMIL: *
| MDL nummer | MFCD00132704 |
|---|---|
| PubChem CID | 66666 |
| Molekylvægt (g/mol) | 0.00 |
| CAS | 9003-69-4 |
| Synonym | divinylbenzene,1,2-divinylbenzene,o-divinylbenzene,benzene, diethenyl,benzene, 1,2-diethenyl,divinylbenzen,divinyl benzen,divinyl-benzene,poly divinylbenzene,divinylbenzene dvb |
| SMIL | * |
| InChI nøgle | MYRTYDVEIRVNKP-UHFFFAOYSA-N |
| Molekylær formel | C10H10 |