Phenoxyforbindelser
Filtrerede søgeresultater
Veratrole, 99+%
CAS: 91-16-7 Molekylær formel: C8H10O2 Molekylvægt (g/mol): 138.17 MDL nummer: MFCD00008357 InChI nøgle: ABDKAPXRBAPSQN-UHFFFAOYSA-N Synonym: veratrole,veratrol,pyrocatechol dimethyl ether,o-dimethoxybenzene,catechol dimethyl ether,benzene, 1,2-dimethoxy,2-methoxyanisole,o,o-dimethyl catechol,2-dimethoxybenzol,benzene, o-dimethoxy PubChem CID: 7043 ChEBI: CHEBI:59114 IUPAC navn: 1,2-dimethoxybenzen SMIL: COC1=CC=CC=C1OC
| MDL nummer | MFCD00008357 |
|---|---|
| PubChem CID | 7043 |
| Molekylvægt (g/mol) | 138.17 |
| CAS | 91-16-7 |
| ChEBI | CHEBI:59114 |
| Synonym | veratrole,veratrol,pyrocatechol dimethyl ether,o-dimethoxybenzene,catechol dimethyl ether,benzene, 1,2-dimethoxy,2-methoxyanisole,o,o-dimethyl catechol,2-dimethoxybenzol,benzene, o-dimethoxy |
| SMIL | COC1=CC=CC=C1OC |
| IUPAC navn | 1,2-dimethoxybenzen |
| InChI nøgle | ABDKAPXRBAPSQN-UHFFFAOYSA-N |
| Molekylær formel | C8H10O2 |
2-Phenoxyethanol, 99 %, Thermo Scientific Chemicals
CAS: 122-99-6 Molekylær formel: C8H10O2 Molekylvægt (g/mol): 138.17 MDL nummer: MFCD00002857 InChI nøgle: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC navn: 2-phenoxyethanol SMIL: C1=CC=C(C=C1)OCCO
| MDL nummer | MFCD00002857 |
|---|---|
| PubChem CID | 31236 |
| Molekylvægt (g/mol) | 138.17 |
| CAS | 122-99-6 |
| ChEBI | CHEBI:64275 |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
| SMIL | C1=CC=C(C=C1)OCCO |
| IUPAC navn | 2-phenoxyethanol |
| InChI nøgle | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
| Molekylær formel | C8H10O2 |
Diphenylphosphonic azide, 97%
CAS: 26386-88-9 Molekylær formel: C12H10N3O3P Molekylvægt (g/mol): 275.20 MDL nummer: MFCD00001987 InChI nøgle: SORGEQQSQGNZFI-UHFFFAOYSA-N Synonym: diphenylphosphoryl azide,diphenyl azidophosphate,diphenylphosphonic azide,diphenyl phosphoryl azide,diphenyl phosphorazidate,phosphorazidic acid, diphenyl ester,azido phenoxy phosphoryl oxy benzene,dppa polymer-bound,diphenylphosphorazidate,unii-gxm91165av PubChem CID: 123414 IUPAC navn: [azido(phenoxy)phosphoryl]oxybenzen SMIL: [N-]=[N+]=NP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1
| MDL nummer | MFCD00001987 |
|---|---|
| PubChem CID | 123414 |
| Molekylvægt (g/mol) | 275.20 |
| CAS | 26386-88-9 |
| Synonym | diphenylphosphoryl azide,diphenyl azidophosphate,diphenylphosphonic azide,diphenyl phosphoryl azide,diphenyl phosphorazidate,phosphorazidic acid, diphenyl ester,azido phenoxy phosphoryl oxy benzene,dppa polymer-bound,diphenylphosphorazidate,unii-gxm91165av |
| SMIL | [N-]=[N+]=NP(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| IUPAC navn | [azido(phenoxy)phosphoryl]oxybenzen |
| InChI nøgle | SORGEQQSQGNZFI-UHFFFAOYSA-N |
| Molekylær formel | C12H10N3O3P |
Phenyl chlorothionoformate, 98+%
CAS: 1005-56-7 Molekylær formel: C7H5ClOS Molekylvægt (g/mol): 172.63 MDL nummer: MFCD00004920 InChI nøgle: KOSYAAIZOGNATQ-UHFFFAOYSA-N Synonym: o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate PubChem CID: 70498 SMIL: ClC(=S)OC1=CC=CC=C1
| MDL nummer | MFCD00004920 |
|---|---|
| PubChem CID | 70498 |
| Molekylvægt (g/mol) | 172.63 |
| CAS | 1005-56-7 |
| Synonym | o-phenyl carbonochloridothioate,phenyl chlorothionoformate,o-phenyl chlorothioformate,phenyl chlorothioformate,phenyl thioxochloroformate,phenyl chlorothionocarbonate,phenoxythiocarbonyl chloride,chlorothioformic acid phenyl ester,o-phenyl chlorothionoformate,o-phenyl chlorothiocarbonate |
| SMIL | ClC(=S)OC1=CC=CC=C1 |
| InChI nøgle | KOSYAAIZOGNATQ-UHFFFAOYSA-N |
| Molekylær formel | C7H5ClOS |
p-Tolyl chlorothionoformate, 97%
CAS: 937-63-3 Molekylær formel: C8H7ClOS Molekylvægt (g/mol): 186.65 MDL nummer: MFCD00014466 InChI nøgle: UNCAXIZUVRKBMN-UHFFFAOYSA-N Synonym: 4-methylphenyl chlorothioformate,o-p-tolyl chlorothioformate,p-tolyl chlorothionoformate,4-tolyl chlorothionoformate,4-methylphenyl chloromethanethioate,o-4-methylphenyl chlorothioformate,carbonochloridothioic acid, o-4-methylphenyl ester,o-4-methylphenyl carbonochloridothioate,chlorothioformic acid p-tolyl ester,4-methylphenoxy methanethioyl chloride PubChem CID: 70305 IUPAC navn: O-(4-methylphenyl)-chlormethanthioat SMIL: CC1=CC=C(OC(Cl)=S)C=C1
| MDL nummer | MFCD00014466 |
|---|---|
| PubChem CID | 70305 |
| Molekylvægt (g/mol) | 186.65 |
| CAS | 937-63-3 |
| Synonym | 4-methylphenyl chlorothioformate,o-p-tolyl chlorothioformate,p-tolyl chlorothionoformate,4-tolyl chlorothionoformate,4-methylphenyl chloromethanethioate,o-4-methylphenyl chlorothioformate,carbonochloridothioic acid, o-4-methylphenyl ester,o-4-methylphenyl carbonochloridothioate,chlorothioformic acid p-tolyl ester,4-methylphenoxy methanethioyl chloride |
| SMIL | CC1=CC=C(OC(Cl)=S)C=C1 |
| IUPAC navn | O-(4-methylphenyl)-chlormethanthioat |
| InChI nøgle | UNCAXIZUVRKBMN-UHFFFAOYSA-N |
| Molekylær formel | C8H7ClOS |
Phenyl chloroformate, 99%
CAS: 1885-14-9 Molekylær formel: C7H5ClO2 Molekylvægt (g/mol): 156.57 MDL nummer: MFCD00000637 InChI nøgle: AHWALFGBDFAJAI-UHFFFAOYSA-N Synonym: phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y PubChem CID: 15891 IUPAC navn: phenylcarbonochloridat SMIL: ClC(=O)OC1=CC=CC=C1
| MDL nummer | MFCD00000637 |
|---|---|
| PubChem CID | 15891 |
| Molekylvægt (g/mol) | 156.57 |
| CAS | 1885-14-9 |
| Synonym | phenyl chloroformate,chloroformic acid phenyl ester,phenyl chlorocarbonate,carbonochloridic acid, phenyl ester,phenoxycarbonyl chloride,formic acid, chloro-, phenyl ester,fenylester kyseliny chlormravenci,phenylchloroformate,unii-6tnd0d6d3y,6tnd0d6d3y |
| SMIL | ClC(=O)OC1=CC=CC=C1 |
| IUPAC navn | phenylcarbonochloridat |
| InChI nøgle | AHWALFGBDFAJAI-UHFFFAOYSA-N |
| Molekylær formel | C7H5ClO2 |
Ethyl 4-ethoxybenzoat, 98 %, Thermo Scientific Chemicals
CAS: 23676-09-7 Molekylær formel: C11H14O3 Molekylvægt (g/mol): 194.23 MDL nummer: MFCD00009116 InChI nøgle: HRAQMGWTPNOILP-UHFFFAOYSA-N Synonym: benzoic acid, 4-ethoxy-, ethyl ester,4-ethoxybenzoic acid ethyl ester,4-ethoxy ethylbenzoate,benzoic acid, p-ethoxy-, ethyl ester,4-ethoxyethylbenzoate,peeb,ethyl p-ethoxybenzoate,ethyl-4-ethoxybenzoate,p-ethoxy ethyl benzoate,ethyl-p-ethoxy benzoate PubChem CID: 90232 IUPAC navn: ethyl-4-ethoxybenzoat SMIL: CCOC1=CC=C(C=C1)C(=O)OCC
| MDL nummer | MFCD00009116 |
|---|---|
| PubChem CID | 90232 |
| Molekylvægt (g/mol) | 194.23 |
| CAS | 23676-09-7 |
| Synonym | benzoic acid, 4-ethoxy-, ethyl ester,4-ethoxybenzoic acid ethyl ester,4-ethoxy ethylbenzoate,benzoic acid, p-ethoxy-, ethyl ester,4-ethoxyethylbenzoate,peeb,ethyl p-ethoxybenzoate,ethyl-4-ethoxybenzoate,p-ethoxy ethyl benzoate,ethyl-p-ethoxy benzoate |
| SMIL | CCOC1=CC=C(C=C1)C(=O)OCC |
| IUPAC navn | ethyl-4-ethoxybenzoat |
| InChI nøgle | HRAQMGWTPNOILP-UHFFFAOYSA-N |
| Molekylær formel | C11H14O3 |
Trimebutine, MedChemExpress
MedChemExpress Trimebutine is a drug with antimuscarinic and weak mu opioid agonist effects.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Ivabradine metabolite N-Demethyl Ivabradine hydrochloride, MedChemExpress
MedChemExpress N-Demethyl Ivabradine Hcl is a metabolite of Ivabradine, which is a specific inhibitor of the funny channel.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
(-)-PX20606 trans isomer, MedChemExpress
MedChemExpress (-)-PX20606 trans isomer is a FXR agonist with EC50s of 18 and 29 nM for FXR in FRET and M1H assay, respectively.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Kemisk navn eller materiale | (-)-PX20606 trans isomer |
|---|---|
| Anbefalet opbevaring | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Molekylvægt (g/mol) | 554.85 |
| CAS | 1268244-88-7 |
| Formel vægt | 554.85 |
| Opløselighedsinformation | Ethanol : ≥ 50 mg/mL (90.11 mM) |
| Synonym | (-)-PX-102 trans isomer (-)-PX-104 |
| Holdbarhed | Please store the product under the recommended conditions in the Certificate of Analysis. |
| SMIL | ClC1=C(C2=NOC(C3CC3)=C2COC4=CC=C([C@@H]5C[C@H]5C6=CC=C(C(O)=O)C=C6)C(Cl)=C4)C(Cl)=CC=C1.[(-)].[Rotation] |
| Renhedsgrad noter | Research |
| Molekylær formel | C29H22Cl3NO4 |
| Til brug med (applikation) | Metabolism-sugar/lipid metabolism |
| Grad | Research |
| MDL nummer | MFCD00063268 |
|---|---|
| CAS | 7283-09-2 |
4-Benzyloxyphenylacetic acid, 99%, Thermo Scientific™
CAS: 6547-53-1 Molekylær formel: C15H14O3 Molekylvægt (g/mol): 242.274 MDL nummer: MFCD00017540 InChI nøgle: XJHGAJLIKDAOPE-UHFFFAOYSA-N Synonym: 4-benzyloxyphenylacetic acid,2-4-benzyloxy phenyl acetic acid,4-benzyloxy phenyl acetic acid,4-benzyloxyphenyl acetic acid,benzeneacetic acid, 4-phenylmethoxy,4-benzyloxy phenylacetic acid,4-benzyloxy-phenyl-acetic acid,2-4-phenylmethoxyphenyl acetic acid,2-4-phenylmethoxy phenyl acetic acid PubChem CID: 81033 IUPAC navn: 2-(4-phenylmethoxyphenyl)acetic acid SMIL: C1=CC=C(C=C1)COC2=CC=C(C=C2)CC(=O)O
| MDL nummer | MFCD00017540 |
|---|---|
| PubChem CID | 81033 |
| Molekylvægt (g/mol) | 242.274 |
| CAS | 6547-53-1 |
| Synonym | 4-benzyloxyphenylacetic acid,2-4-benzyloxy phenyl acetic acid,4-benzyloxy phenyl acetic acid,4-benzyloxyphenyl acetic acid,benzeneacetic acid, 4-phenylmethoxy,4-benzyloxy phenylacetic acid,4-benzyloxy-phenyl-acetic acid,2-4-phenylmethoxyphenyl acetic acid,2-4-phenylmethoxy phenyl acetic acid |
| SMIL | C1=CC=C(C=C1)COC2=CC=C(C=C2)CC(=O)O |
| IUPAC navn | 2-(4-phenylmethoxyphenyl)acetic acid |
| InChI nøgle | XJHGAJLIKDAOPE-UHFFFAOYSA-N |
| Molekylær formel | C15H14O3 |
Azaphen, MedChemExpress
MedChemExpress Pipofezine(Azafen or Azaphen) is a potent inhibitor of the reuptake of serotonin.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Kemisk navn eller materiale | Azaphen |
|---|---|
| Anbefalet opbevaring | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Molekylvægt (g/mol) | 370.28 |
| CAS | 24853-80-3 |
| Formel vægt | 370.28 |
| Synonym | Azafen Pipofezin hydrochloride Pipofezine hydrochloride |
| Holdbarhed | Please store the product under the recommended conditions in the Certificate of Analysis. |
| SMIL | [H]Cl.[H]Cl.CN1C2=CC=CC=C2OC3=C1C=C(N4CCN(C)CC4)N=N3 |
| Renhedsgrad noter | Research |
| Molekylær formel | C16H21Cl2N5O |
| Til brug med (applikation) | Neuroscience-Neuromodulation |
| Grad | Research |