Oxepanes
- (3)
- (3)
- (5)
- (3)
- (4)
- (3)
- (2)
- (3)
- (1)
- (2)
- (3)
- (1)
- (5)
- (1)
- (1)
- (1)
- (1)
- (3)
- (1)
- (1)
- (4)
- (1)
- (1)
- (2)
- (6)
- (2)
- (1)
- (3)
- (1)
- (6)
- (5)
- (11)
- (2)
- (1)
- (3)
- (2)
- (3)
- (4)
- (2)
- (3)
- (2)
- (2)
- (1)
- (1)
- (5)
Filtrerede søgeresultater
epsilon-Caprolacton, 99%, Thermo Scientific Chemicals
CAS: 502-44-3 Molekylær formel: C6H10O2 Molekylvægt (g/mol): 114.144 MDL nummer: MFCD00003267 InChI nøgle: PAPBSGBWRJIAAV-UHFFFAOYSA-N Synonym: 6-hexanolactone,epsilon-caprolactone,2-oxepanone,caprolactone,hexan-6-olide,6-hexanolide,hexano-6-lactone,1,6-hexanolide,e-caprolactone,1-oxa-2-oxocycloheptane PubChem CID: 10401 ChEBI: CHEBI:17915 IUPAC navn: oxepan-2-one SMIL: C1CCC(=O)OCC1
| MDL nummer | MFCD00003267 |
|---|---|
| PubChem CID | 10401 |
| Molekylvægt (g/mol) | 114.144 |
| CAS | 502-44-3 |
| ChEBI | CHEBI:17915 |
| Synonym | 6-hexanolactone,epsilon-caprolactone,2-oxepanone,caprolactone,hexan-6-olide,6-hexanolide,hexano-6-lactone,1,6-hexanolide,e-caprolactone,1-oxa-2-oxocycloheptane |
| SMIL | C1CCC(=O)OCC1 |
| IUPAC navn | oxepan-2-one |
| InChI nøgle | PAPBSGBWRJIAAV-UHFFFAOYSA-N |
| Molekylær formel | C6H10O2 |
ε-Caprolactonmonomer, 99%, Thermo Scientific Chemicals
CAS: 502-44-3 MDL nummer: MFCD00003267 InChI nøgle: PAPBSGBWRJIAAV-UHFFFAOYSA-N Synonym: 6-hexanolactone,epsilon-caprolactone,2-oxepanone,caprolactone,hexan-6-olide,6-hexanolide,hexano-6-lactone,1,6-hexanolide,e-caprolactone,1-oxa-2-oxocycloheptane PubChem CID: 10401 ChEBI: CHEBI:17915 IUPAC navn: oxepan-2-one SMIL: C1CCC(=O)OCC1
| MDL nummer | MFCD00003267 |
|---|---|
| PubChem CID | 10401 |
| CAS | 502-44-3 |
| ChEBI | CHEBI:17915 |
| Synonym | 6-hexanolactone,epsilon-caprolactone,2-oxepanone,caprolactone,hexan-6-olide,6-hexanolide,hexano-6-lactone,1,6-hexanolide,e-caprolactone,1-oxa-2-oxocycloheptane |
| SMIL | C1CCC(=O)OCC1 |
| IUPAC navn | oxepan-2-one |
| InChI nøgle | PAPBSGBWRJIAAV-UHFFFAOYSA-N |
Cyclohexenoxid, 98%, Thermo Scientific Chemicals
CAS: 286-20-4 Molekylær formel: C6H10O Molekylvægt (g/mol): 98.14 MDL nummer: MFCD00005162 InChI nøgle: ZWAJLVLEBYIOTI-UHFFFAOYSA-N Synonym: cyclohexene oxide,7-oxabicyclo 4.1.0 heptane,1,2-epoxycyclohexane,cyclohexene epoxide,cyclohexylene oxide,tetramethyleneoxirane,cyclohexene 1-oxide,epoxycyclohexane,cyclohexeneoxide,1,2-cyclohexene oxide PubChem CID: 9246 IUPAC navn: 7-oxabicyclo[4.1.0]heptan SMIL: C1CCC2C(C1)O2
| MDL nummer | MFCD00005162 |
|---|---|
| PubChem CID | 9246 |
| Molekylvægt (g/mol) | 98.14 |
| CAS | 286-20-4 |
| Synonym | cyclohexene oxide,7-oxabicyclo 4.1.0 heptane,1,2-epoxycyclohexane,cyclohexene epoxide,cyclohexylene oxide,tetramethyleneoxirane,cyclohexene 1-oxide,epoxycyclohexane,cyclohexeneoxide,1,2-cyclohexene oxide |
| SMIL | C1CCC2C(C1)O2 |
| IUPAC navn | 7-oxabicyclo[4.1.0]heptan |
| InChI nøgle | ZWAJLVLEBYIOTI-UHFFFAOYSA-N |
| Molekylær formel | C6H10O |
Perhydrocyclobuta[c]furan-1,3-dion, 97 %, Thermo Scientific™
CAS: 4462-96-8 Molekylær formel: C6H6O3 Molekylvægt (g/mol): 126.111 InChI nøgle: NMNZZIMBGSGRPN-UHFFFAOYSA-N Synonym: 3-oxabicyclo 3.2.0 heptane-2,4-dione,perhydrocyclobuta c furan-1,3-dione,1,2-cyclobutanedicarboxylic anhydride,cyclobutane-1,2-dicarboxylic anhydride,1,2-cyclobutanedicarboxylic anhydride, cis-,,acmc-1ahmk,3-oxabicyclo 3.2.0 heptane-2, cis PubChem CID: 138261 IUPAC navn: 3-oxabicyclo[3.2.0]heptan-2,4-dion SMIL: C1CC2C1C(=O)OC2=O
| PubChem CID | 138261 |
|---|---|
| Molekylvægt (g/mol) | 126.111 |
| CAS | 4462-96-8 |
| Synonym | 3-oxabicyclo 3.2.0 heptane-2,4-dione,perhydrocyclobuta c furan-1,3-dione,1,2-cyclobutanedicarboxylic anhydride,cyclobutane-1,2-dicarboxylic anhydride,1,2-cyclobutanedicarboxylic anhydride, cis-,,acmc-1ahmk,3-oxabicyclo 3.2.0 heptane-2, cis |
| SMIL | C1CC2C1C(=O)OC2=O |
| IUPAC navn | 3-oxabicyclo[3.2.0]heptan-2,4-dion |
| InChI nøgle | NMNZZIMBGSGRPN-UHFFFAOYSA-N |
| Molekylær formel | C6H6O3 |
4-Methyl-1,2-cyclohexene oxide, cis + trans, 97%
CAS: 36099-51-1 Molekylær formel: C7H12O Molekylvægt (g/mol): 112.172 MDL nummer: MFCD09742280 InChI nøgle: ULPDSNLBZMHGPI-UHFFFAOYSA-N Synonym: 3-methyl-7-oxabicyclo 4.1.0 heptane,7-oxabicyclo 4.1.0 heptane, 3-methyl,4-methyl-1,2-cyclohexene oxide,4-methyl-1,2-cyclohexene oxide, cis + trans,4-methyl-7-oxabicyclo 4.1.0 heptane,7-oxabicyclo 4.1.0 heptane,3-methyl,3-methyl-7-oxabicyclo 4.1.0 heptane #,4-methyl-1,2-cyclohexene oxide, cis+trans PubChem CID: 535184 IUPAC navn: 4-methyl-7-oxabicyclo[4.1.0]heptan SMIL: CC1CCC2C(C1)O2
| MDL nummer | MFCD09742280 |
|---|---|
| PubChem CID | 535184 |
| Molekylvægt (g/mol) | 112.172 |
| CAS | 36099-51-1 |
| Synonym | 3-methyl-7-oxabicyclo 4.1.0 heptane,7-oxabicyclo 4.1.0 heptane, 3-methyl,4-methyl-1,2-cyclohexene oxide,4-methyl-1,2-cyclohexene oxide, cis + trans,4-methyl-7-oxabicyclo 4.1.0 heptane,7-oxabicyclo 4.1.0 heptane,3-methyl,3-methyl-7-oxabicyclo 4.1.0 heptane #,4-methyl-1,2-cyclohexene oxide, cis+trans |
| SMIL | CC1CCC2C(C1)O2 |
| IUPAC navn | 4-methyl-7-oxabicyclo[4.1.0]heptan |
| InChI nøgle | ULPDSNLBZMHGPI-UHFFFAOYSA-N |
| Molekylær formel | C7H12O |
1,6-anhydro-beta-D-glucopyranose, 99 %, Thermo Scientific Chemicals
CAS: 498-07-7 Molekylær formel: C6H10O5 Molekylvægt (g/mol): 162.14 MDL nummer: MFCD00063248 InChI nøgle: TWNIBLMWSKIRAT-UHFFFAOYNA-N Synonym: 1,6-anhydro-beta-d-glucopyranose,levoglucosan,leucoglucosan,1,6-anhydro-beta-d-glucose,1,6-anhydro-beta-glucopyranose,glucosan,1,6-anhydroglucose,unii-5132n17fsd,anhydroglucose,1,6-anhydro-d-glucose PubChem CID: 2724705 ChEBI: CHEBI:30997 IUPAC navn: (1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octan-2,3,4-triol SMIL: OC1C2COC(O2)C(O)C1O
| MDL nummer | MFCD00063248 |
|---|---|
| PubChem CID | 2724705 |
| Molekylvægt (g/mol) | 162.14 |
| CAS | 498-07-7 |
| ChEBI | CHEBI:30997 |
| Synonym | 1,6-anhydro-beta-d-glucopyranose,levoglucosan,leucoglucosan,1,6-anhydro-beta-d-glucose,1,6-anhydro-beta-glucopyranose,glucosan,1,6-anhydroglucose,unii-5132n17fsd,anhydroglucose,1,6-anhydro-d-glucose |
| SMIL | OC1C2COC(O2)C(O)C1O |
| IUPAC navn | (1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octan-2,3,4-triol |
| InChI nøgle | TWNIBLMWSKIRAT-UHFFFAOYNA-N |
| Molekylær formel | C6H10O5 |
Cyclohexene oxide, 98+%
CAS: 286-20-4 Molekylær formel: C6H10O Molekylvægt (g/mol): 98.145 MDL nummer: MFCD00005162 InChI nøgle: ZWAJLVLEBYIOTI-UHFFFAOYSA-N Synonym: cyclohexene oxide,7-oxabicyclo 4.1.0 heptane,1,2-epoxycyclohexane,cyclohexene epoxide,cyclohexylene oxide,tetramethyleneoxirane,cyclohexene 1-oxide,epoxycyclohexane,cyclohexeneoxide,1,2-cyclohexene oxide PubChem CID: 9246 IUPAC navn: 7-oxabicyclo[4.1.0]heptan SMIL: C1CCC2C(C1)O2
| MDL nummer | MFCD00005162 |
|---|---|
| PubChem CID | 9246 |
| Molekylvægt (g/mol) | 98.145 |
| CAS | 286-20-4 |
| Synonym | cyclohexene oxide,7-oxabicyclo 4.1.0 heptane,1,2-epoxycyclohexane,cyclohexene epoxide,cyclohexylene oxide,tetramethyleneoxirane,cyclohexene 1-oxide,epoxycyclohexane,cyclohexeneoxide,1,2-cyclohexene oxide |
| SMIL | C1CCC2C(C1)O2 |
| IUPAC navn | 7-oxabicyclo[4.1.0]heptan |
| InChI nøgle | ZWAJLVLEBYIOTI-UHFFFAOYSA-N |
| Molekylær formel | C6H10O |
Dicyclopentadien diepoxid, 98%, Thermo Scientific Chemicals
CAS: 81-21-0 Molekylær formel: C10H12O2 Molekylvægt (g/mol): 164.204 MDL nummer: MFCD00077209 InChI nøgle: BQQUFAMSJAKLNB-UHFFFAOYSA-N Synonym: dicyclopentadiene dioxide,dicyclopentadiene diepoxide,unox epoxide 207,epoxide 207,bicyclopentadiene dioxide,unox 207x,unox 207,dicyclopentadiene dioxide van,1,2:5,6-diepoxyhexahydro-4,7-methanoindan,4,7-methanoindan, 1,2:5,6-diepoxyhexahydro PubChem CID: 6673 SMIL: C1C2C3CC4C(C3C1C5C2O5)O4
| MDL nummer | MFCD00077209 |
|---|---|
| PubChem CID | 6673 |
| Molekylvægt (g/mol) | 164.204 |
| CAS | 81-21-0 |
| Synonym | dicyclopentadiene dioxide,dicyclopentadiene diepoxide,unox epoxide 207,epoxide 207,bicyclopentadiene dioxide,unox 207x,unox 207,dicyclopentadiene dioxide van,1,2:5,6-diepoxyhexahydro-4,7-methanoindan,4,7-methanoindan, 1,2:5,6-diepoxyhexahydro |
| SMIL | C1C2C3CC4C(C3C1C5C2O5)O4 |
| InChI nøgle | BQQUFAMSJAKLNB-UHFFFAOYSA-N |
| Molekylær formel | C10H12O2 |
Thermo Scientific Chemicals 1,6-anhydro-β -D-glucopyranose, 99+%
CAS: 498-07-7 Molekylær formel: C6H10O5 Molekylvægt (g/mol): 162.14 MDL nummer: MFCD00063248 InChI nøgle: TWNIBLMWSKIRAT-UHFFFAOYNA-N Synonym: 1,6-anhydro-beta-d-glucopyranose,levoglucosan,leucoglucosan,1,6-anhydro-beta-d-glucose,1,6-anhydro-beta-glucopyranose,glucosan,1,6-anhydroglucose,unii-5132n17fsd,anhydroglucose,1,6-anhydro-d-glucose PubChem CID: 2724705 ChEBI: CHEBI:30997 SMIL: OC1C2COC(O2)C(O)C1O
| MDL nummer | MFCD00063248 |
|---|---|
| PubChem CID | 2724705 |
| Molekylvægt (g/mol) | 162.14 |
| CAS | 498-07-7 |
| ChEBI | CHEBI:30997 |
| Synonym | 1,6-anhydro-beta-d-glucopyranose,levoglucosan,leucoglucosan,1,6-anhydro-beta-d-glucose,1,6-anhydro-beta-glucopyranose,glucosan,1,6-anhydroglucose,unii-5132n17fsd,anhydroglucose,1,6-anhydro-d-glucose |
| SMIL | OC1C2COC(O2)C(O)C1O |
| InChI nøgle | TWNIBLMWSKIRAT-UHFFFAOYNA-N |
| Molekylær formel | C6H10O5 |
Dexamethasone 9,11-epoxide, MedChemExpress
MedChemExpress Dexamethasone 9,11-epoxide, a compound extracted from patent CN 106520896 A and RU 2532902 C1, is an intermediate in the preparation of dexamethasone.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Kemisk navn eller materiale | Dexamethasone 9,11-epoxide |
|---|---|
| Sundhedsfare 1 | H315∣H319∣H335 |
| Formel vægt | 372.45 |
| Opløselighedsinformation | DMSO : 100 mg/mL (268.49 mM; Need ultrasonic) ∣H2O : < 0.1 mg/mL (insoluble) |
| Procent renhed | 99.3% |
| Fysisk form | Solid |
| Farve | White |
| Grad | Research |
| Anbefalet opbevaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Molekylvægt (g/mol) | 372.45 |
| CAS | 24916-90-3 |
| Holdbarhed | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| SMIL | C[C@@]12[C@](C(CO)=O)(O)[C@H](C)C[C@@]1([H])[C@]3([H])CCC4=CC(C=C[C@]4(C)[C@]3(O5)[C@]5([H])C2)=O |
| Renhedsgrad noter | Research |
| Molekylær formel | C22H28O5 |
| Til brug med (applikation) | COVID-19-immunoregulation |
4-(1,3,3-Trimethyl-7-oxabicyclo[4.1.0]hept-2-yl)-3-buten-2-one, tech., Thermo Scientific™
CAS: 190059-33-7 Molekylær formel: C13H20O2 Molekylvægt (g/mol): 208.30 MDL nummer: MFCD07784337 InChI nøgle: ODMUHAHUBCUABS-UHFFFAOYNA-N Synonym: 4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 hept-2-yl-3-buten-2-one,4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 heptan-2-yl but-3-en-2-one,3-buten-2-one,4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 hept-2-yl-, 3e,4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 hept-2-yl-3-buten-2-one, mixture of cis and trans PubChem CID: 11041982 SMIL: CC(=O)C=CC1C2(C)OC2CCC1(C)C
| MDL nummer | MFCD07784337 |
|---|---|
| PubChem CID | 11041982 |
| Molekylvægt (g/mol) | 208.30 |
| CAS | 190059-33-7 |
| Synonym | 4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 hept-2-yl-3-buten-2-one,4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 heptan-2-yl but-3-en-2-one,3-buten-2-one,4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 hept-2-yl-, 3e,4-1,3,3-trimethyl-7-oxabicyclo 4.1.0 hept-2-yl-3-buten-2-one, mixture of cis and trans |
| SMIL | CC(=O)C=CC1C2(C)OC2CCC1(C)C |
| InChI nøgle | ODMUHAHUBCUABS-UHFFFAOYNA-N |
| Molekylær formel | C13H20O2 |
Dicyclopentadiene diepoxide, 98%, Thermo Scientific Chemicals
CAS: 81-21-0 Molekylær formel: C10H12O2 Molekylvægt (g/mol): 164.2 MDL nummer: MFCD00077209 InChI nøgle: BQQUFAMSJAKLNB-UHFFFAOYSA-N Synonym: dicyclopentadiene dioxide,dicyclopentadiene diepoxide,unox epoxide 207,epoxide 207,bicyclopentadiene dioxide,unox 207x,unox 207,dicyclopentadiene dioxide van,1,2:5,6-diepoxyhexahydro-4,7-methanoindan,4,7-methanoindan, 1,2:5,6-diepoxyhexahydro PubChem CID: 6673 SMIL: C1C2C3CC4C(C3C1C5C2O5)O4
| MDL nummer | MFCD00077209 |
|---|---|
| PubChem CID | 6673 |
| Molekylvægt (g/mol) | 164.2 |
| CAS | 81-21-0 |
| Synonym | dicyclopentadiene dioxide,dicyclopentadiene diepoxide,unox epoxide 207,epoxide 207,bicyclopentadiene dioxide,unox 207x,unox 207,dicyclopentadiene dioxide van,1,2:5,6-diepoxyhexahydro-4,7-methanoindan,4,7-methanoindan, 1,2:5,6-diepoxyhexahydro |
| SMIL | C1C2C3CC4C(C3C1C5C2O5)O4 |
| InChI nøgle | BQQUFAMSJAKLNB-UHFFFAOYSA-N |
| Molekylær formel | C10H12O2 |