Organiske polymerer
- (3)
- (2)
- (3)
- (4)
- (2)
- (2)
- (1)
- (6)
- (2)
- (3)
- (2)
- (1)
- (5)
- (2)
- (3)
- (1)
- (3)
- (3)
- (3)
- (3)
- (9)
- (10)
- (2)
Filtrerede søgeresultater
Polysulfonharpiks, pellets, Thermo Scientific Chemicals
CAS: 25135-51-7 Molekylær formel: (C27H22O4S)n Molekylvægt (g/mol): NaN MDL nummer: MFCD00134387 InChI nøgle: ZUZZUJNBGCVPLQ-UHFFFAOYSA-N PubChem CID: 16211415 SMIL: CC(C)(C1=CC=C(O-*)C=C1)C1=CC=C(OC2=CC=C(C=C2)S(=O)(=O)C2=CC=C(-*)C=C2)C=C1
| MDL nummer | MFCD00134387 |
|---|---|
| PubChem CID | 16211415 |
| Molekylvægt (g/mol) | NaN |
| CAS | 25135-51-7 |
| SMIL | CC(C)(C1=CC=C(O-*)C=C1)C1=CC=C(OC2=CC=C(C=C2)S(=O)(=O)C2=CC=C(-*)C=C2)C=C1 |
| InChI nøgle | ZUZZUJNBGCVPLQ-UHFFFAOYSA-N |
| Molekylær formel | (C27H22O4S)n |
Polyethyleneimine on silica beads, anion exchange resin, 20-40 mesh
CAS: 9002-98-6 Molekylær formel: ((C2H5N)zC2H4N)y(C2H5N)x Molekylvægt (g/mol): 43.07 MDL nummer: MFCD00084427 InChI nøgle: NOWKCMXCCJGMRR-UHFFFAOYSA-N Synonym: ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin PubChem CID: 9033 ChEBI: CHEBI:30969 IUPAC navn: aziridin SMIL: *-CCNCCN(-*)CCN-*
| MDL nummer | MFCD00084427 |
|---|---|
| PubChem CID | 9033 |
| Molekylvægt (g/mol) | 43.07 |
| CAS | 9002-98-6 |
| ChEBI | CHEBI:30969 |
| Synonym | ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin |
| SMIL | *-CCNCCN(-*)CCN-* |
| IUPAC navn | aziridin |
| InChI nøgle | NOWKCMXCCJGMRR-UHFFFAOYSA-N |
| Molekylær formel | ((C2H5N)zC2H4N)y(C2H5N)x |
Polyimidfilm, 0,013 mm tyk, Thermo Scientific Chemicals
CAS: 62929-02-6 Molekylær formel: C35H28N2O7 Molekylvægt (g/mol): 588.62 MDL nummer: MFCD00677744 InChI nøgle: CDTDIQLZIBORMV-UHFFFAOYNA-N Synonym: polyimide resin,polyimide resin 10g,1,3-isobenzofurandione, 5,5'-carbonylbis-, polymer with 1 or 3-4-aminophenyl-2,3-dihydro-1,3,3 or 1,1,3-trimethyl-1h-inden-5-amine,1-4-aminophenyl-1,3,3-trimethyl-2h-inden-5-amine; 5-1,3-dioxo-2-benzofuran-5-carbonyl-2-benzofuran-1,3-dione PubChem CID: 6454485 SMIL: CC1(C)CC(C)(C2=CC=C(N)C=C12)C1=CC=C(N)C=C1.O=C(C1=CC=C2C(=O)OC(=O)C2=C1)C1=CC=C2C(=O)OC(=O)C2=C1
| MDL nummer | MFCD00677744 |
|---|---|
| PubChem CID | 6454485 |
| Molekylvægt (g/mol) | 588.62 |
| CAS | 62929-02-6 |
| Synonym | polyimide resin,polyimide resin 10g,1,3-isobenzofurandione, 5,5'-carbonylbis-, polymer with 1 or 3-4-aminophenyl-2,3-dihydro-1,3,3 or 1,1,3-trimethyl-1h-inden-5-amine,1-4-aminophenyl-1,3,3-trimethyl-2h-inden-5-amine; 5-1,3-dioxo-2-benzofuran-5-carbonyl-2-benzofuran-1,3-dione |
| SMIL | CC1(C)CC(C)(C2=CC=C(N)C=C12)C1=CC=C(N)C=C1.O=C(C1=CC=C2C(=O)OC(=O)C2=C1)C1=CC=C2C(=O)OC(=O)C2=C1 |
| InChI nøgle | CDTDIQLZIBORMV-UHFFFAOYNA-N |
| Molekylær formel | C35H28N2O7 |
Polyimidfilm, 0,008 mm tyk, Thermo Scientific Chemicals
CAS: 62929-02-6 Molekylær formel: C35H28N2O7 Molekylvægt (g/mol): 588.62 MDL nummer: MFCD00677744 InChI nøgle: CDTDIQLZIBORMV-UHFFFAOYNA-N Synonym: polyimide resin,polyimide resin 10g,1,3-isobenzofurandione, 5,5'-carbonylbis-, polymer with 1 or 3-4-aminophenyl-2,3-dihydro-1,3,3 or 1,1,3-trimethyl-1h-inden-5-amine,1-4-aminophenyl-1,3,3-trimethyl-2h-inden-5-amine; 5-1,3-dioxo-2-benzofuran-5-carbonyl-2-benzofuran-1,3-dione PubChem CID: 6454485 IUPAC navn: 1-(4-aminophenyl)-1,3,3-trimethyl-2H-inden-5-amin;5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dion SMIL: CC1(C)CC(C)(C2=CC=C(N)C=C12)C1=CC=C(N)C=C1.O=C(C1=CC=C2C(=O)OC(=O)C2=C1)C1=CC=C2C(=O)OC(=O)C2=C1
| MDL nummer | MFCD00677744 |
|---|---|
| PubChem CID | 6454485 |
| Molekylvægt (g/mol) | 588.62 |
| CAS | 62929-02-6 |
| Synonym | polyimide resin,polyimide resin 10g,1,3-isobenzofurandione, 5,5'-carbonylbis-, polymer with 1 or 3-4-aminophenyl-2,3-dihydro-1,3,3 or 1,1,3-trimethyl-1h-inden-5-amine,1-4-aminophenyl-1,3,3-trimethyl-2h-inden-5-amine; 5-1,3-dioxo-2-benzofuran-5-carbonyl-2-benzofuran-1,3-dione |
| SMIL | CC1(C)CC(C)(C2=CC=C(N)C=C12)C1=CC=C(N)C=C1.O=C(C1=CC=C2C(=O)OC(=O)C2=C1)C1=CC=C2C(=O)OC(=O)C2=C1 |
| IUPAC navn | 1-(4-aminophenyl)-1,3,3-trimethyl-2H-inden-5-amin;5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dion |
| InChI nøgle | CDTDIQLZIBORMV-UHFFFAOYNA-N |
| Molekylær formel | C35H28N2O7 |
2-chlortritylchlorid på polystyren, 1 % tværbundet, 100-200 mesh, 1,0-1,4 mmol/g, Thermo Scientific Chemicals
CAS: 42074-68-0 Molekylær formel: C19H14Cl2 Molekylvægt (g/mol): 313.221 MDL nummer: MFCD00040399 InChI nøgle: JFLSOKIMYBSASW-UHFFFAOYSA-N Synonym: 2-chlorotrityl chloride,chloro 2-chlorophenyl methylene dibenzene,1-chloro-2-chlorodiphenylmethyl benzene,2-chlorophenyldiphenylmethyl chloride,2-chlorotrityl chloride resin,2-chlorophenyl diphenylmethyl chloride,2-chlorotrityl resin,2-chlorotritylchloride,chloro 2-chlorophenyl diphenylmethane,2-chlorotrityl chloride, polymer-bound PubChem CID: 94524 IUPAC navn: 1-chlor-2-[chlor(diphenyl)methyl]benzen SMIL: C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)Cl
| MDL nummer | MFCD00040399 |
|---|---|
| PubChem CID | 94524 |
| Molekylvægt (g/mol) | 313.221 |
| CAS | 42074-68-0 |
| Synonym | 2-chlorotrityl chloride,chloro 2-chlorophenyl methylene dibenzene,1-chloro-2-chlorodiphenylmethyl benzene,2-chlorophenyldiphenylmethyl chloride,2-chlorotrityl chloride resin,2-chlorophenyl diphenylmethyl chloride,2-chlorotrityl resin,2-chlorotritylchloride,chloro 2-chlorophenyl diphenylmethane,2-chlorotrityl chloride, polymer-bound |
| SMIL | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)Cl |
| IUPAC navn | 1-chlor-2-[chlor(diphenyl)methyl]benzen |
| InChI nøgle | JFLSOKIMYBSASW-UHFFFAOYSA-N |
| Molekylær formel | C19H14Cl2 |
4-Nitrophenylketoxim på polystren, 2% tværbundet, 200-400 mesh, 0,8-1,0 mmol/g, Thermo Scientific Chemicals
MDL nummer: MFCD00165078 Synonym: Kaiser Oxime resin; 4-Nitrobenzophenone oxime, polymer supported
| MDL nummer | MFCD00165078 |
|---|---|
| Synonym | Kaiser Oxime resin; 4-Nitrobenzophenone oxime, polymer supported |
| CAS | 921213-39-0 |
|---|
| CAS | 921214-61-1 |
|---|
Poly(styrene-divinylbenzene), 2% cross-linked, 200-400 mesh
CAS: 9003-70-7 Molekylær formel: C24H27NO5 Molekylvægt (g/mol): 409.48 MDL nummer: 9003-70-7 InChI nøgle: BCIPGSZQUDLGSY-UHFFFAOYNA-N Synonym: styrene/divinylbenzen,divinylbenzene-styrene,styrene divinylbenzene,styrene-divinylbenzene,styrene/divinylbenzene,styrene-divinyl benzene,benzene, diethenyl-, polymer with ethenylbenzene, brominated,st dvb,divinylbenzene; styrene,1,2-diethenylbenzene; styrene PubChem CID: 174664 SMIL: CC(C)(C)OC(=O)CCC(NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C=O
| MDL nummer | 9003-70-7 |
|---|---|
| PubChem CID | 174664 |
| Molekylvægt (g/mol) | 409.48 |
| CAS | 9003-70-7 |
| Synonym | styrene/divinylbenzen,divinylbenzene-styrene,styrene divinylbenzene,styrene-divinylbenzene,styrene/divinylbenzene,styrene-divinyl benzene,benzene, diethenyl-, polymer with ethenylbenzene, brominated,st dvb,divinylbenzene; styrene,1,2-diethenylbenzene; styrene |
| SMIL | CC(C)(C)OC(=O)CCC(NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C=O |
| InChI nøgle | BCIPGSZQUDLGSY-UHFFFAOYNA-N |
| Molekylær formel | C24H27NO5 |
Poly(styren-divinylbenzen), aminomethyleret, 1% tværbundet, 100-200 mesh, Thermo Scientific Chemicals
CAS: 89551-24-6 Molekylær formel: C7H9N Molekylvægt (g/mol): 107.156 MDL nummer: MFCD00146442 InChI nøgle: WGQKYBSKWIADBV-UHFFFAOYSA-N Synonym: benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine PubChem CID: 7504 ChEBI: CHEBI:40538 IUPAC navn: phenylmethanamin SMIL: C1=CC=C(C=C1)CN
| MDL nummer | MFCD00146442 |
|---|---|
| PubChem CID | 7504 |
| Molekylvægt (g/mol) | 107.156 |
| CAS | 89551-24-6 |
| ChEBI | CHEBI:40538 |
| Synonym | benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine |
| SMIL | C1=CC=C(C=C1)CN |
| IUPAC navn | phenylmethanamin |
| InChI nøgle | WGQKYBSKWIADBV-UHFFFAOYSA-N |
| Molekylær formel | C7H9N |
Polyimide resin, Thermo Scientific Chemicals
CAS: 62929-02-6 Molekylær formel: C35H28N2O7 Molekylvægt (g/mol): 588.62 MDL nummer: MFCD01868102 InChI nøgle: CDTDIQLZIBORMV-UHFFFAOYNA-N Synonym: polyimide resin,polyimide resin 10g,1,3-isobenzofurandione, 5,5'-carbonylbis-, polymer with 1 or 3-4-aminophenyl-2,3-dihydro-1,3,3 or 1,1,3-trimethyl-1h-inden-5-amine,1-4-aminophenyl-1,3,3-trimethyl-2h-inden-5-amine; 5-1,3-dioxo-2-benzofuran-5-carbonyl-2-benzofuran-1,3-dione PubChem CID: 6454485 SMIL: CC1(C)CC(C)(C2=CC=C(N)C=C12)C1=CC=C(N)C=C1.O=C(C1=CC=C2C(=O)OC(=O)C2=C1)C1=CC=C2C(=O)OC(=O)C2=C1
| MDL nummer | MFCD01868102 |
|---|---|
| PubChem CID | 6454485 |
| Molekylvægt (g/mol) | 588.62 |
| CAS | 62929-02-6 |
| Synonym | polyimide resin,polyimide resin 10g,1,3-isobenzofurandione, 5,5'-carbonylbis-, polymer with 1 or 3-4-aminophenyl-2,3-dihydro-1,3,3 or 1,1,3-trimethyl-1h-inden-5-amine,1-4-aminophenyl-1,3,3-trimethyl-2h-inden-5-amine; 5-1,3-dioxo-2-benzofuran-5-carbonyl-2-benzofuran-1,3-dione |
| SMIL | CC1(C)CC(C)(C2=CC=C(N)C=C12)C1=CC=C(N)C=C1.O=C(C1=CC=C2C(=O)OC(=O)C2=C1)C1=CC=C2C(=O)OC(=O)C2=C1 |
| InChI nøgle | CDTDIQLZIBORMV-UHFFFAOYNA-N |
| Molekylær formel | C35H28N2O7 |
Thiomorpholine, polymer-supported, 0.8-1.1mmol/g on Merrifield resin, Thermo Scientific™
CAS: 123-90-0 Molekylær formel: C4H9NS Molekylvægt (g/mol): 103.183 MDL nummer: MFCD03458715 InChI nøgle: BRNULMACUQOKMR-UHFFFAOYSA-N Synonym: thiamorpholine,thiazolidinane,parathiazan,4-thiomorpholine,tetrahydro-1,4-thiazine,1,4-thiazane,1,4-thiazan,1-thia-4-azacyclohexane,unii-3a8r61g6qv,1,4-thiazaperhydroine PubChem CID: 67164 ChEBI: CHEBI:36392 IUPAC navn: thiomorpholine SMIL: C1CSCCN1
| MDL nummer | MFCD03458715 |
|---|---|
| PubChem CID | 67164 |
| Molekylvægt (g/mol) | 103.183 |
| CAS | 123-90-0 |
| ChEBI | CHEBI:36392 |
| Synonym | thiamorpholine,thiazolidinane,parathiazan,4-thiomorpholine,tetrahydro-1,4-thiazine,1,4-thiazane,1,4-thiazan,1-thia-4-azacyclohexane,unii-3a8r61g6qv,1,4-thiazaperhydroine |
| SMIL | C1CSCCN1 |
| IUPAC navn | thiomorpholine |
| InChI nøgle | BRNULMACUQOKMR-UHFFFAOYSA-N |
| Molekylær formel | C4H9NS |
S-Thiouronium chloride, polymer-supported, 0.8-1.0 mmol/g on Merrifield resin, Thermo Scientific™
MDL nummer: MFCD03458600 Synonym: S-Methylisothiouronium choride on polystyrene
| MDL nummer | MFCD03458600 |
|---|---|
| Synonym | S-Methylisothiouronium choride on polystyrene |
Polyethyleneimine on silica beads, anion exchange resin, benzylated, 40-200 mesh, Thermo Scientific™
CAS: 9002-98-6 Molekylær formel: ((C2H5N)zC2H4N)y(C2H5N)x Molekylvægt (g/mol): 43.07 MDL nummer: MFCD00084427 InChI nøgle: NOWKCMXCCJGMRR-UHFFFAOYSA-N Synonym: ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin PubChem CID: 9033 ChEBI: CHEBI:30969 IUPAC navn: aziridine SMIL: *-CCNCCN(-*)CCN-*
| MDL nummer | MFCD00084427 |
|---|---|
| PubChem CID | 9033 |
| Molekylvægt (g/mol) | 43.07 |
| CAS | 9002-98-6 |
| ChEBI | CHEBI:30969 |
| Synonym | ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin |
| SMIL | *-CCNCCN(-*)CCN-* |
| IUPAC navn | aziridine |
| InChI nøgle | NOWKCMXCCJGMRR-UHFFFAOYSA-N |
| Molekylær formel | ((C2H5N)zC2H4N)y(C2H5N)x |
Polyethyleneimine on silica beads, anion exchange resin, benzylated, 20-40 mesh, Thermo Scientific™
CAS: 9002-98-6 Molekylær formel: ((C2H5N)zC2H4N)y(C2H5N)x Molekylvægt (g/mol): 43.07 MDL nummer: MFCD00084427 InChI nøgle: NOWKCMXCCJGMRR-UHFFFAOYSA-N Synonym: ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin PubChem CID: 9033 ChEBI: CHEBI:30969 IUPAC navn: aziridine SMIL: *-CCNCCN(-*)CCN-*
| MDL nummer | MFCD00084427 |
|---|---|
| PubChem CID | 9033 |
| Molekylvægt (g/mol) | 43.07 |
| CAS | 9002-98-6 |
| ChEBI | CHEBI:30969 |
| Synonym | ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin |
| SMIL | *-CCNCCN(-*)CCN-* |
| IUPAC navn | aziridine |
| InChI nøgle | NOWKCMXCCJGMRR-UHFFFAOYSA-N |
| Molekylær formel | ((C2H5N)zC2H4N)y(C2H5N)x |