Phenol estere
Filtrerede søgeresultater
4-Acetoxybenzoic acid, 98+%
CAS: 2345-34-8 Molekylær formel: C9H8O4 Molekylvægt (g/mol): 180.16 MDL nummer: MFCD00002540 InChI nøgle: GDBUZIKSJGRBJP-UHFFFAOYSA-N Synonym: 4-acetoxybenzoic acid,p-acetoxybenzoic acid,4-acetyloxy benzoic acid,4-carboxyphenyl acetate,benzoic acid, 4-acetyloxy,p-hydroxybenzoic acid acetate,p-acetyloxybenzoic acid,p-carboxyphenyl acetate,benzoic acid, p-hydroxy-, acetate,4-acetoxy benzoic acid PubChem CID: 16865 ChEBI: CHEBI:86560 IUPAC navn: 4-acetyloxybenzoesyre SMIL: CC(=O)OC1=CC=C(C=C1)C(O)=O
| MDL nummer | MFCD00002540 |
|---|---|
| PubChem CID | 16865 |
| Molekylvægt (g/mol) | 180.16 |
| CAS | 2345-34-8 |
| ChEBI | CHEBI:86560 |
| Synonym | 4-acetoxybenzoic acid,p-acetoxybenzoic acid,4-acetyloxy benzoic acid,4-carboxyphenyl acetate,benzoic acid, 4-acetyloxy,p-hydroxybenzoic acid acetate,p-acetyloxybenzoic acid,p-carboxyphenyl acetate,benzoic acid, p-hydroxy-, acetate,4-acetoxy benzoic acid |
| SMIL | CC(=O)OC1=CC=C(C=C1)C(O)=O |
| IUPAC navn | 4-acetyloxybenzoesyre |
| InChI nøgle | GDBUZIKSJGRBJP-UHFFFAOYSA-N |
| Molekylær formel | C9H8O4 |
4-Acetoxybenzeneboronic acid, 97%, Thermo Scientific Chemicals
CAS: 177490-82-3 Molekylær formel: C8H9BO4 Molekylvægt (g/mol): 179.97 MDL nummer: MFCD09027198 InChI nøgle: VILXJXDXZGKJLU-UHFFFAOYSA-N Synonym: 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid PubChem CID: 44119577 IUPAC navn: (4-acetyloxyphenyl)borsyre SMIL: CC(=O)OC1=CC=C(C=C1)B(O)O
| MDL nummer | MFCD09027198 |
|---|---|
| PubChem CID | 44119577 |
| Molekylvægt (g/mol) | 179.97 |
| CAS | 177490-82-3 |
| Synonym | 4-acetoxyphenyl boronic acid,4-acetoxyphenylboronic acid,4-acetoxybenzeneboronic acid,4-acetyloxy phenylboronic acid,boronic acid, 4-acetyloxy phenyl,boronic acid,b-4-acetyloxy phenyl,4-boronophenyl acetate,pubchem20170,acmc-209ecy,4-acetoxyphenyl boronicacid |
| SMIL | CC(=O)OC1=CC=C(C=C1)B(O)O |
| IUPAC navn | (4-acetyloxyphenyl)borsyre |
| InChI nøgle | VILXJXDXZGKJLU-UHFFFAOYSA-N |
| Molekylær formel | C8H9BO4 |
Tannic acid, MedChemExpress
MedChemExpress Tannic acid is a novel hERG channel blocker with IC50 of 3.4 μM.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Kemisk navn eller materiale | Tannic acid |
|---|---|
| Sundhedsfare 1 | H302∣H315∣H319∣H335∣H412 |
| Formel vægt | 1701.2 |
| Opløselighedsinformation | DMSO : 100 mg/mL (58.78 mM; Need ultrasonic) ∣H2O : ≥ 100 mg/mL (58.78 mM) |
| Fysisk form | Solid |
| Farve | Yellow |
| Grad | Research |
| Anbefalet opbevaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Molekylvægt (g/mol) | 1701.2 |
| CAS | 1401-55-4 |
| Holdbarhed | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| SMIL | O=C(C1=CC(OC(C2=CC(O)=C(O)C(O)=C2)=O)=C(O)C(O)=C1)OC3[C@H](OC(C4=CC(OC(C5=CC(O)=C(O)C(O)=C5)=O)=C(O)C(O)=C4)=O)[C@@H](OC(C6=CC(OC(C7=CC(O)=C(O)C(O)=C7)=O)=C(O)C(O)=C6)=O)[C@H](OC(C8=CC(OC(C9=CC(O)=C(O)C(O)=C9)=O)=C(O)C(O)=C8)=O)[C@@H](COC(C%10=CC(OC(C%11=CC(O)=C(O)C(O)=C%11)=O)=C(O)C(O)=C%10)=O)O3 |
| Renhedsgrad noter | Research |
| Molekylær formel | C76H52O46 |
| Til brug med (applikation) | Cancer-programmed cell death |
Ellagic acid, MedChemExpress
MedChemExpress Ellagic acid is a natural antioxidant, and acts as a potent and ATP-competitive CK2 inhibitor, with an IC50 of 40 nM and a Ki of 20 nM.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Kemisk navn eller materiale | Ellagic acid |
|---|---|
| Sundhedsfare 1 | H302 |
| Formel vægt | 302.19 |
| Opløselighedsinformation | DMSO : 5 mg/mL (16.55 mM; ultrasonic and warming and heat to 60°C) ∣Ethanol : < 1 mg/mL (insoluble) ∣H2O : < 0.1 mg/mL (insoluble) |
| Procent renhed | 95.0% |
| Fysisk form | Powder |
| Farve | Light Nude |
| Grad | Research |
| Anbefalet opbevaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Molekylvægt (g/mol) | 302.19 |
| CAS | 476-66-4 |
| Holdbarhed | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| SMIL | O=C1C2=CC(O)=C(O)C(O3)=C2C4=C(C3=O)C=C(O)C(O)=C4O1 |
| Renhedsgrad noter | Research |
| Molekylær formel | C14H6O8 |
| Til brug med (applikation) | Cancer-Kinase/protease |
Chebulinic acid, MedChemExpress
MedChemExpress Chebulinic acid is a potent natural inhibitor of M. tuberculosis DNA gyrase, also can inhibit SMAD-3 phosphorylation, inhibit H+ K+-ATPase activity.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Kemisk navn eller materiale | Chebulinic acid |
|---|---|
| Sundhedsfare 1 | H315∣H319 |
| Formel vægt | 956.68 |
| Opløselighedsinformation | DMSO : 100 mg/mL (104.53 mM; ultrasonic and warming and heat to 60°C) |
| Procent renhed | 97.01% |
| Fysisk form | Solid |
| Farve | White |
| Grad | Research |
| Anbefalet opbevaring | 4°C, protect from light∣In solvent : -80°C, 6 months∣-20°C, 1 month (protect from light) |
| Molekylvægt (g/mol) | 956.68 |
| CAS | 18942-26-2 |
| Holdbarhed | 4°C, protect from light∣In solvent : -80°C, 6 months∣-20°C, 1 month (protect from light) |
| SMIL | OC(C[C@H](C(O[C@@]([C@H](O[C@H]1OC(C2=CC(O)=C(O)C(O)=C2)=O)COC(C3=CC(O)=C(O)C(O)=C3)=O)([H])[C@@](OC(C4=CC(O)=C(O)C(O)=C4)=O)([H])[C@@]1([H])OC5=O)=O)[C@@]([C@H]6O)([H])C(C5=CC(O)=C7O)=C7OC6=O)=O |
| Renhedsgrad noter | Research |
| Molekylær formel | C41H32O27 |
| Til brug med (applikation) | Neuroscience-Neuromodulation |
4-nitrophenylacetat, 97 %, Thermo Scientific Chemicals
CAS: 830-03-5 Molekylær formel: C8H7NO4 Molekylvægt (g/mol): 181.15 MDL nummer: MFCD00007326 InChI nøgle: QAUUDNIGJSLPSX-UHFFFAOYSA-N Synonym: p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester PubChem CID: 13243 ChEBI: CHEBI:82635 IUPAC navn: (4-nitrophenyl)acetat SMIL: CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O
| MDL nummer | MFCD00007326 |
|---|---|
| PubChem CID | 13243 |
| Molekylvægt (g/mol) | 181.15 |
| CAS | 830-03-5 |
| ChEBI | CHEBI:82635 |
| Synonym | p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester |
| SMIL | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| IUPAC navn | (4-nitrophenyl)acetat |
| InChI nøgle | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Molekylær formel | C8H7NO4 |
4-nitrophenylacetat, 97 %, Thermo Scientific Chemicals
CAS: 830-03-5 Molekylær formel: C8H7NO4 Molekylvægt (g/mol): 181.15 MDL nummer: MFCD00007326 InChI nøgle: QAUUDNIGJSLPSX-UHFFFAOYSA-N Synonym: p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester PubChem CID: 13243 ChEBI: CHEBI:82635 SMIL: CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O
| MDL nummer | MFCD00007326 |
|---|---|
| PubChem CID | 13243 |
| Molekylvægt (g/mol) | 181.15 |
| CAS | 830-03-5 |
| ChEBI | CHEBI:82635 |
| Synonym | p-nitrophenyl acetate,p-acetoxynitrobenzene,acetic acid, 4-nitrophenyl ester,p-nitrophenol acetate,acetic acid p-nitrophenyl ester,acetic acid, p-nitrophenyl ester,p-nitrophenyl acetate van,4-nitrophenyl acetate,unii-i902j0qh9s,acetic acid 4-nitrophenyl ester |
| SMIL | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| InChI nøgle | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Molekylær formel | C8H7NO4 |
Phenylacetat, 97%, Thermo Scientific Chemicals
CAS: 122-79-2 Molekylær formel: C8H8O2 Molekylvægt (g/mol): 136.15 MDL nummer: MFCD00008699 InChI nøgle: IPBVNPXQWQGGJP-UHFFFAOYSA-N Synonym: acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech PubChem CID: 31229 ChEBI: CHEBI:8082 IUPAC navn: phenylacetat SMIL: CC(=O)OC1=CC=CC=C1
| MDL nummer | MFCD00008699 |
|---|---|
| PubChem CID | 31229 |
| Molekylvægt (g/mol) | 136.15 |
| CAS | 122-79-2 |
| ChEBI | CHEBI:8082 |
| Synonym | acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech |
| SMIL | CC(=O)OC1=CC=CC=C1 |
| IUPAC navn | phenylacetat |
| InChI nøgle | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Molekylær formel | C8H8O2 |
Phenylacrylat, 97%, Thermo Scientific Chemicals
CAS: 937-41-7 Molekylær formel: C9H8O2 Molekylvægt (g/mol): 148.161 MDL nummer: MFCD00048145 InChI nøgle: WRAQQYDMVSCOTE-UHFFFAOYSA-N Synonym: phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht PubChem CID: 61242 IUPAC navn: phenylprop-2-enoat SMIL: C=CC(=O)OC1=CC=CC=C1
| MDL nummer | MFCD00048145 |
|---|---|
| PubChem CID | 61242 |
| Molekylvægt (g/mol) | 148.161 |
| CAS | 937-41-7 |
| Synonym | phenyl acrylate,phenylacrylate,2-propenoic acid, phenyl ester,phenol acrylate,phenyl-acrylate,acrylic acid phenyl ester,phenyl acrylate 5g,2-propenoic acid,phenyl ester,acrylic acid phenyl ester, stabilized with bht |
| SMIL | C=CC(=O)OC1=CC=CC=C1 |
| IUPAC navn | phenylprop-2-enoat |
| InChI nøgle | WRAQQYDMVSCOTE-UHFFFAOYSA-N |
| Molekylær formel | C9H8O2 |
Phenylacetat, 97%, Thermo Scientific Chemicals
CAS: 122-79-2 Molekylær formel: C8H8O2 Molekylvægt (g/mol): 136.15 MDL nummer: MFCD00008699 InChI nøgle: IPBVNPXQWQGGJP-UHFFFAOYSA-N Synonym: acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech PubChem CID: 31229 ChEBI: CHEBI:8082 IUPAC navn: phenylacetat SMIL: CC(=O)OC1=CC=CC=C1
| MDL nummer | MFCD00008699 |
|---|---|
| PubChem CID | 31229 |
| Molekylvægt (g/mol) | 136.15 |
| CAS | 122-79-2 |
| ChEBI | CHEBI:8082 |
| Synonym | acetic acid phenyl ester,phenol acetate,acetylphenol,acetic acid, phenyl ester,acetyl phenol,acetoxybenzene,acetates,acetic acid,phenyl ester,fenylester kyseliny octove,fenylester kyseliny octove czech |
| SMIL | CC(=O)OC1=CC=CC=C1 |
| IUPAC navn | phenylacetat |
| InChI nøgle | IPBVNPXQWQGGJP-UHFFFAOYSA-N |
| Molekylær formel | C8H8O2 |
Phenylbromacetat, 98%, Thermo Scientific Chemicals
CAS: 620-72-4 Molekylær formel: C8H7BrO2 Molekylvægt (g/mol): 215.046 MDL nummer: MFCD00192391 InChI nøgle: UEWYUCGVQMZMGY-UHFFFAOYSA-N Synonym: phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b PubChem CID: 564919 IUPAC navn: phenyl-2-bromacetat SMIL: C1=CC=C(C=C1)OC(=O)CBr
| MDL nummer | MFCD00192391 |
|---|---|
| PubChem CID | 564919 |
| Molekylvægt (g/mol) | 215.046 |
| CAS | 620-72-4 |
| Synonym | phenyl bromoacetate,acetic acid, bromo-, phenyl ester,bromoacetic acid phenyl ester,bromoacetic acid, phenyl ester,phenylbromessigester,phenyl bromoacetate #,acmc-209mzb,phenyl 2-bromanylethanoate,ksc352o8b |
| SMIL | C1=CC=C(C=C1)OC(=O)CBr |
| IUPAC navn | phenyl-2-bromacetat |
| InChI nøgle | UEWYUCGVQMZMGY-UHFFFAOYSA-N |
| Molekylær formel | C8H7BrO2 |
m-tolylacetat, 97 %, Thermo Scientific Chemicals
CAS: 122-46-3 Molekylær formel: C9H10O2 Molekylvægt (g/mol): 150.18 MDL nummer: MFCD00041910 InChI nøgle: OTGAHJPFNKQGAE-UHFFFAOYSA-N Synonym: m-tolyl acetate,m-cresyl acetate,cresatin,m-acetoxytoluene,m-cresol acetate,acetic acid m-tolyl ester,cresatin-sulzberger,kresatin,acetic acid, 3-methylphenyl ester,m-methylphenyl acetate PubChem CID: 67406 IUPAC navn: (3-methylphenyl)acetat SMIL: CC(=O)OC1=CC=CC(C)=C1
| MDL nummer | MFCD00041910 |
|---|---|
| PubChem CID | 67406 |
| Molekylvægt (g/mol) | 150.18 |
| CAS | 122-46-3 |
| Synonym | m-tolyl acetate,m-cresyl acetate,cresatin,m-acetoxytoluene,m-cresol acetate,acetic acid m-tolyl ester,cresatin-sulzberger,kresatin,acetic acid, 3-methylphenyl ester,m-methylphenyl acetate |
| SMIL | CC(=O)OC1=CC=CC(C)=C1 |
| IUPAC navn | (3-methylphenyl)acetat |
| InChI nøgle | OTGAHJPFNKQGAE-UHFFFAOYSA-N |
| Molekylær formel | C9H10O2 |
4-Nitrophenyl palmitate, 98+%
CAS: 1492-30-4 Molekylær formel: C22H35NO4 Molekylvægt (g/mol): 377.525 MDL nummer: MFCD00047732 InChI nøgle: LVZSQWIWCANHPF-UHFFFAOYSA-N Synonym: 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # PubChem CID: 73891 ChEBI: CHEBI:85645 IUPAC navn: (4-nitrophenyl)hexadecanoat SMIL: CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]
| MDL nummer | MFCD00047732 |
|---|---|
| PubChem CID | 73891 |
| Molekylvægt (g/mol) | 377.525 |
| CAS | 1492-30-4 |
| ChEBI | CHEBI:85645 |
| Synonym | 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # |
| SMIL | CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
| IUPAC navn | (4-nitrophenyl)hexadecanoat |
| InChI nøgle | LVZSQWIWCANHPF-UHFFFAOYSA-N |
| Molekylær formel | C22H35NO4 |
Pentafluorophenyl trifluoroacetate, 98+%
CAS: 14533-84-7 Molekylær formel: C8F8O2 Molekylvægt (g/mol): 280.07 MDL nummer: MFCD00134438 InChI nøgle: VCQURUZYYSOUHP-UHFFFAOYSA-N Synonym: pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 PubChem CID: 4327891 IUPAC navn: (2,3,4,5,6-pentafluorphenyl) 2,2,2-trifluoracetat SMIL: FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F
| MDL nummer | MFCD00134438 |
|---|---|
| PubChem CID | 4327891 |
| Molekylvægt (g/mol) | 280.07 |
| CAS | 14533-84-7 |
| Synonym | pentafluorophenyl trifluoroacetate,perfluorophenyl 2,2,2-trifluoroacetate,trifluoroacetic acid pentafluorophenyl ester,pentafluorphenyl trifluoracetate,pentafluorophenyltrifluoroacetate,pentafluorophenyl 2,2,2-trifluoroacetate,acetic acid, trifluoro-, pentafluorophenyl ester,acetic acid,2,2,2-trifluoro-, 2,3,4,5,6-pentafluorophenyl ester,ambotzrl-1046,acmc-1bui8 |
| SMIL | FC1=C(F)C(F)=C(OC(=O)C(F)(F)F)C(F)=C1F |
| IUPAC navn | (2,3,4,5,6-pentafluorphenyl) 2,2,2-trifluoracetat |
| InChI nøgle | VCQURUZYYSOUHP-UHFFFAOYSA-N |
| Molekylær formel | C8F8O2 |
Pentafluorphenylpyridin-2-carboxylat, 95 %, Thermo Scientific™
CAS: 188837-53-8 Molekylær formel: C12H4F5NO2 Molekylvægt (g/mol): 289.16 MDL nummer: MFCD02916457 InChI nøgle: KFJSLIBBYMXLTG-UHFFFAOYSA-N Synonym: pentafluorophenyl pyridine-2-carboxylate,pentafluorophenyl picolinate,2-pyridinecarboxylicacid, 2,3,4,5,6-pentafluorophenyl ester,2,3,4,5,6-pentafluorophenyl pyridine-2-carboxylate,picolinic acid pentafluorophenyl ester,2-pentafluorophenoxy carbonyl pyridine,2,3,4,5,6-pentakis fluoranyl phenyl pyridine-2-carboxylate,2-pyridinecarboxylic acid 2,3,4,5,6-pentafluorophenyl ester PubChem CID: 2754830 IUPAC navn: (2,3,4,5,6-pentafluorphenyl)pyridin-2-carboxylat SMIL: FC1=C(F)C(F)=C(OC(=O)C2=CC=CC=N2)C(F)=C1F
| MDL nummer | MFCD02916457 |
|---|---|
| PubChem CID | 2754830 |
| Molekylvægt (g/mol) | 289.16 |
| CAS | 188837-53-8 |
| Synonym | pentafluorophenyl pyridine-2-carboxylate,pentafluorophenyl picolinate,2-pyridinecarboxylicacid, 2,3,4,5,6-pentafluorophenyl ester,2,3,4,5,6-pentafluorophenyl pyridine-2-carboxylate,picolinic acid pentafluorophenyl ester,2-pentafluorophenoxy carbonyl pyridine,2,3,4,5,6-pentakis fluoranyl phenyl pyridine-2-carboxylate,2-pyridinecarboxylic acid 2,3,4,5,6-pentafluorophenyl ester |
| SMIL | FC1=C(F)C(F)=C(OC(=O)C2=CC=CC=N2)C(F)=C1F |
| IUPAC navn | (2,3,4,5,6-pentafluorphenyl)pyridin-2-carboxylat |
| InChI nøgle | KFJSLIBBYMXLTG-UHFFFAOYSA-N |
| Molekylær formel | C12H4F5NO2 |