Filtrerede søgeresultater
n-Pentane, anhydrous, 99.8+%, over molecular sieves, packaged under Argon in resealable ChemSeal™ bottles
CAS: 109-66-0 Molekylær formel: C5H12 Molekylvægt (g/mol): 72.15 MDL nummer: MFCD00009498 InChI nøgle: OFBQJSOFQDEBGM-UHFFFAOYSA-N Synonym: n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish PubChem CID: 8003 ChEBI: CHEBI:37830 IUPAC navn: pentane SMIL: CCCCC
| MDL nummer | MFCD00009498 |
|---|---|
| PubChem CID | 8003 |
| Molekylvægt (g/mol) | 72.15 |
| CAS | 109-66-0 |
| ChEBI | CHEBI:37830 |
| Synonym | n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish |
| SMIL | CCCCC |
| IUPAC navn | pentane |
| InChI nøgle | OFBQJSOFQDEBGM-UHFFFAOYSA-N |
| Molekylær formel | C5H12 |
N,N-dimethylformamid-d7, til NMR, 99,5 % atom D, Thermo Scientific Chemicals
CAS: 4472-41-7 Molekylær formel: C3H7NO MDL nummer: MFCD00003286 InChI nøgle: ZMXDDKWLCZADIW-YYWVXINBSA-N Synonym: dimethylformamide d,formamide-1-d, n,n-di methyl-d3,deuterated dmf,n,n-dimethylformamide-d7,n,n-dimethylformamide-d7 99.5atom%d,n,n-dimethylformamide-d7 dmf-d7,dimethyl formamide-d7,heptadeutero-n,n-dimethylformamide,dmf-d7,n,n-di 2h3 methyl 2h formamide PubChem CID: 78225
| MDL nummer | MFCD00003286 |
|---|---|
| PubChem CID | 78225 |
| CAS | 4472-41-7 |
| Synonym | dimethylformamide d,formamide-1-d, n,n-di methyl-d3,deuterated dmf,n,n-dimethylformamide-d7,n,n-dimethylformamide-d7 99.5atom%d,n,n-dimethylformamide-d7 dmf-d7,dimethyl formamide-d7,heptadeutero-n,n-dimethylformamide,dmf-d7,n,n-di 2h3 methyl 2h formamide |
| InChI nøgle | ZMXDDKWLCZADIW-YYWVXINBSA-N |
| Molekylær formel | C3H7NO |
2-Amino-3-chlorobenzonitrile, 97%
CAS: 53312-77-9 Molekylær formel: C7H5ClN2 Molekylvægt (g/mol): 152.581 MDL nummer: MFCD03425881 InChI nøgle: FAHVRFGAGJMXHW-UHFFFAOYSA-N Synonym: benzonitrile, 2-amino-3-chloro,pubchem4612,acmc-20a0rc,amino-3-chlorobenzonitrile,ksc494a6d,2-amino-3-chloro-benzonitrile,3-chloroanthranilonitrile,2-amino-3-chlorobenzenecarbonitrile PubChem CID: 12627363 IUPAC navn: 2-amino-3-chlorobenzonitrile SMIL: C1=CC(=C(C(=C1)Cl)N)C#N
| MDL nummer | MFCD03425881 |
|---|---|
| PubChem CID | 12627363 |
| Molekylvægt (g/mol) | 152.581 |
| CAS | 53312-77-9 |
| Synonym | benzonitrile, 2-amino-3-chloro,pubchem4612,acmc-20a0rc,amino-3-chlorobenzonitrile,ksc494a6d,2-amino-3-chloro-benzonitrile,3-chloroanthranilonitrile,2-amino-3-chlorobenzenecarbonitrile |
| SMIL | C1=CC(=C(C(=C1)Cl)N)C#N |
| IUPAC navn | 2-amino-3-chlorobenzonitrile |
| InChI nøgle | FAHVRFGAGJMXHW-UHFFFAOYSA-N |
| Molekylær formel | C7H5ClN2 |
1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid, 95%
CAS: 58880-37-8 Molekylær formel: C13H14ClO2 Molekylvægt (g/mol): 237.70 MDL nummer: MFCD00019350 InChI nøgle: UPNXUJXIIZGXLQ-UHFFFAOYSA-M Synonym: 1-4-chlorophenyl cyclohexanecarboxylic acid,1-4-chlorophenyl cyclohexane-1-carboxylic acid,1-4-chlorophenyl-1-cyclohexanecarboxylic acid,1-4-chlorophenyl-1-cyclohexane-carboxylic acid,cyclohexanecarboxylic acid, 1-4-chlorophenyl,acmc-1cuiq,4-chlorophenylcyclohexanecarboxylic acid,4-chlorophenyl cyclohexanecarboxylic acid,1-4-chlorophenyl cyclohexanecarboxylicacid PubChem CID: 100873 SMIL: [O-]C(=O)C1(CCCCC1)C1=CC=C(Cl)C=C1
| MDL nummer | MFCD00019350 |
|---|---|
| PubChem CID | 100873 |
| Molekylvægt (g/mol) | 237.70 |
| CAS | 58880-37-8 |
| Synonym | 1-4-chlorophenyl cyclohexanecarboxylic acid,1-4-chlorophenyl cyclohexane-1-carboxylic acid,1-4-chlorophenyl-1-cyclohexanecarboxylic acid,1-4-chlorophenyl-1-cyclohexane-carboxylic acid,cyclohexanecarboxylic acid, 1-4-chlorophenyl,acmc-1cuiq,4-chlorophenylcyclohexanecarboxylic acid,4-chlorophenyl cyclohexanecarboxylic acid,1-4-chlorophenyl cyclohexanecarboxylicacid |
| SMIL | [O-]C(=O)C1(CCCCC1)C1=CC=C(Cl)C=C1 |
| InChI nøgle | UPNXUJXIIZGXLQ-UHFFFAOYSA-M |
| Molekylær formel | C13H14ClO2 |
2-Chlorophenyl isothiocyanate, 99%
CAS: 2740-81-0 Molekylær formel: C7H4ClNS Molekylvægt (g/mol): 169.63 MDL nummer: MFCD00004801 InChI nøgle: DASSPOJBUMBXLU-UHFFFAOYSA-N Synonym: 2-chlorophenyl isothiocyanate,2-chlorophenylisothiocyanate,benzene, 1-chloro-2-isothiocyanato,benzene, chloroisothiocyanato,1-chloro-2-isothiocyanato-benzene,isothiocyanic acid 2-chlorophenyl ester,2-chlorobenzenisothiocyanate,acmc-1ccw5,o-chlorophenylisothiocyanate,o-chlorophenyl isothiocyanate PubChem CID: 123171 IUPAC navn: 1-chloro-2-isothiocyanatobenzene SMIL: C1=CC=C(C(=C1)N=C=S)Cl
| MDL nummer | MFCD00004801 |
|---|---|
| PubChem CID | 123171 |
| Molekylvægt (g/mol) | 169.63 |
| CAS | 2740-81-0 |
| Synonym | 2-chlorophenyl isothiocyanate,2-chlorophenylisothiocyanate,benzene, 1-chloro-2-isothiocyanato,benzene, chloroisothiocyanato,1-chloro-2-isothiocyanato-benzene,isothiocyanic acid 2-chlorophenyl ester,2-chlorobenzenisothiocyanate,acmc-1ccw5,o-chlorophenylisothiocyanate,o-chlorophenyl isothiocyanate |
| SMIL | C1=CC=C(C(=C1)N=C=S)Cl |
| IUPAC navn | 1-chloro-2-isothiocyanatobenzene |
| InChI nøgle | DASSPOJBUMBXLU-UHFFFAOYSA-N |
| Molekylær formel | C7H4ClNS |
3,5-Dimethylphenyl isothiocyanate, 99%
CAS: 40046-30-8 Molekylær formel: C9H9NS Molekylvægt (g/mol): 163.238 MDL nummer: MFCD00041082 InChI nøgle: DSMXCADWIFIJEX-UHFFFAOYSA-N Synonym: 3,5-dimethylphenyl isothiocyanate,3,5-dimethylphenylisothiocyanate,3,5-dimethylbenzenisothiocyanate,acmc-20anca,3,5-xylyl isothiocyanate,1-isothiocyanato-3,5-dimethyl-benzene,#,isothiocyanic acid 3,5-dimethylphenyl ester PubChem CID: 142406 IUPAC navn: 1-isothiocyanato-3,5-dimethylbenzene SMIL: CC1=CC(=CC(=C1)N=C=S)C
| MDL nummer | MFCD00041082 |
|---|---|
| PubChem CID | 142406 |
| Molekylvægt (g/mol) | 163.238 |
| CAS | 40046-30-8 |
| Synonym | 3,5-dimethylphenyl isothiocyanate,3,5-dimethylphenylisothiocyanate,3,5-dimethylbenzenisothiocyanate,acmc-20anca,3,5-xylyl isothiocyanate,1-isothiocyanato-3,5-dimethyl-benzene,#,isothiocyanic acid 3,5-dimethylphenyl ester |
| SMIL | CC1=CC(=CC(=C1)N=C=S)C |
| IUPAC navn | 1-isothiocyanato-3,5-dimethylbenzene |
| InChI nøgle | DSMXCADWIFIJEX-UHFFFAOYSA-N |
| Molekylær formel | C9H9NS |
(R)-1-(3-Chlorophenyl)ethylamine, ChiPros™, 99%, ee 98+%
CAS: 17061-53-9 Molekylær formel: C8H10ClN Molekylvægt (g/mol): 155.625 MDL nummer: MFCD06761822 InChI nøgle: DQEYVZASLGNODG-ZCFIWIBFSA-N Synonym: r-1-3-chlorophenyl ethanamine,1r-1-3-chlorophenyl ethanamine,r-1-3-chlorophenyl ethylamine,r-3-chloro-,a-methylbenzylamine,1r-1-3-chlorophenyl ethan-1-amine,r-3-chloro-methylbenzylamine,r-+-1-3-chlorophenyl ethylamine,r-1-3-chlorophenyl ethylamine, chipros,r-alpha-methyl-3-chlorobenzenemethaneamine,benzenemethanamine,3-chloro-a-methyl-, ar PubChem CID: 2507697 IUPAC navn: (1R)-1-(3-chlorophenyl)ethanamine SMIL: CC(C1=CC(=CC=C1)Cl)N
| MDL nummer | MFCD06761822 |
|---|---|
| PubChem CID | 2507697 |
| Molekylvægt (g/mol) | 155.625 |
| CAS | 17061-53-9 |
| Synonym | r-1-3-chlorophenyl ethanamine,1r-1-3-chlorophenyl ethanamine,r-1-3-chlorophenyl ethylamine,r-3-chloro-,a-methylbenzylamine,1r-1-3-chlorophenyl ethan-1-amine,r-3-chloro-methylbenzylamine,r-+-1-3-chlorophenyl ethylamine,r-1-3-chlorophenyl ethylamine, chipros,r-alpha-methyl-3-chlorobenzenemethaneamine,benzenemethanamine,3-chloro-a-methyl-, ar |
| SMIL | CC(C1=CC(=CC=C1)Cl)N |
| IUPAC navn | (1R)-1-(3-chlorophenyl)ethanamine |
| InChI nøgle | DQEYVZASLGNODG-ZCFIWIBFSA-N |
| Molekylær formel | C8H10ClN |
4-(4-Chlorophenyl)-3-thiosemicarbazide, 97%, Thermo Scientific Chemicals
CAS: 22814-92-2 Molekylær formel: C7H8ClN3S Molekylvægt (g/mol): 201.672 MDL nummer: MFCD00041295 InChI nøgle: GFTWJLUVFRTLIL-UHFFFAOYSA-N Synonym: 4-4-chlorophenyl-3-thiosemicarbazide,n-4-chlorophenyl hydrazinecarbothioamide,3-amino-1-4-chlorophenyl thiourea,1-amino-3-4-chlorophenyl thiourea,4-chlorophenyl amino hydrazinomethane-1-thione,acmc-20amw7,maybridge1_006895,4-p-chlorphenylthiosemicarbazid,4-4-chlorophenyl thiosemicarbazide,1-azanyl-3-4-chlorophenyl thiourea PubChem CID: 706988 IUPAC navn: 1-amino-3-(4-chlorophenyl)thiourea SMIL: C1=CC(=CC=C1NC(=S)NN)Cl
| MDL nummer | MFCD00041295 |
|---|---|
| PubChem CID | 706988 |
| Molekylvægt (g/mol) | 201.672 |
| CAS | 22814-92-2 |
| Synonym | 4-4-chlorophenyl-3-thiosemicarbazide,n-4-chlorophenyl hydrazinecarbothioamide,3-amino-1-4-chlorophenyl thiourea,1-amino-3-4-chlorophenyl thiourea,4-chlorophenyl amino hydrazinomethane-1-thione,acmc-20amw7,maybridge1_006895,4-p-chlorphenylthiosemicarbazid,4-4-chlorophenyl thiosemicarbazide,1-azanyl-3-4-chlorophenyl thiourea |
| SMIL | C1=CC(=CC=C1NC(=S)NN)Cl |
| IUPAC navn | 1-amino-3-(4-chlorophenyl)thiourea |
| InChI nøgle | GFTWJLUVFRTLIL-UHFFFAOYSA-N |
| Molekylær formel | C7H8ClN3S |
2,5-Dimethylaniline, 99%
CAS: 95-78-3 Molekylær formel: C8H11N Molekylvægt (g/mol): 121.18 MDL nummer: MFCD00007743 InChI nøgle: VOWZNBNDMFLQGM-UHFFFAOYSA-N Synonym: 2,5-xylidine,p-xylidine,2,5-dimethylphenylamine,2-amino-1,4-xylene,2,5-dimethylbenzenamine,benzenamine, 2,5-dimethyl,5-methyl-o-toluidine,6-methyl-m-toluidine,1-amino-2,5-dimethylbenzene,p-dimethylaniline PubChem CID: 7259 ChEBI: CHEBI:518305 IUPAC navn: 2,5-dimethylaniline SMIL: CC1=CC=C(C)C(N)=C1
| MDL nummer | MFCD00007743 |
|---|---|
| PubChem CID | 7259 |
| Molekylvægt (g/mol) | 121.18 |
| CAS | 95-78-3 |
| ChEBI | CHEBI:518305 |
| Synonym | 2,5-xylidine,p-xylidine,2,5-dimethylphenylamine,2-amino-1,4-xylene,2,5-dimethylbenzenamine,benzenamine, 2,5-dimethyl,5-methyl-o-toluidine,6-methyl-m-toluidine,1-amino-2,5-dimethylbenzene,p-dimethylaniline |
| SMIL | CC1=CC=C(C)C(N)=C1 |
| IUPAC navn | 2,5-dimethylaniline |
| InChI nøgle | VOWZNBNDMFLQGM-UHFFFAOYSA-N |
| Molekylær formel | C8H11N |
3,4-Dimethylaniline, 99+%
CAS: 95-64-7 Molekylær formel: C8H11N Molekylvægt (g/mol): 121.18 MDL nummer: MFCD00007810 InChI nøgle: DOLQYFPDPKPQSS-UHFFFAOYSA-N Synonym: 3,4-xylidine,4-amino-o-xylene,3,4-xylylamine,3,4-dimethylphenylamine,benzenamine, 3,4-dimethyl,3,4-dimethylbenzenamine,3,4-dimethylaminobenzene,1-amino-3,4-dimethylbenzene,4-amino-1,2-dimethylbenzene,aniline, 3,4-dimethyl PubChem CID: 7248 ChEBI: CHEBI:39901 IUPAC navn: 3,4-dimethylaniline SMIL: CC1=CC=C(N)C=C1C
| MDL nummer | MFCD00007810 |
|---|---|
| PubChem CID | 7248 |
| Molekylvægt (g/mol) | 121.18 |
| CAS | 95-64-7 |
| ChEBI | CHEBI:39901 |
| Synonym | 3,4-xylidine,4-amino-o-xylene,3,4-xylylamine,3,4-dimethylphenylamine,benzenamine, 3,4-dimethyl,3,4-dimethylbenzenamine,3,4-dimethylaminobenzene,1-amino-3,4-dimethylbenzene,4-amino-1,2-dimethylbenzene,aniline, 3,4-dimethyl |
| SMIL | CC1=CC=C(N)C=C1C |
| IUPAC navn | 3,4-dimethylaniline |
| InChI nøgle | DOLQYFPDPKPQSS-UHFFFAOYSA-N |
| Molekylær formel | C8H11N |
2,3-Dimethylbenzoyl chloride, 96%
CAS: 21900-46-9 Molekylær formel: C9H9ClO Molekylvægt (g/mol): 168.62 MDL nummer: MFCD00045217 InChI nøgle: WFNKMVDATNLZBX-UHFFFAOYSA-N Synonym: 2,3-dimethylbenzene-1-carbonyl chloride,benzoyl chloride, dimethyl,xylic acid chloride,acmc-20aog3,2,3 dimethylbenzoyl chloride,2,3-dimethyl-benzoyl chloride,2,3-dimethylbenzene-1-carbonylchloride,2,3-dimethyl-1-benzenecarbonyl chloride,benzoyl chloride, 2,3-dimethyl-6ci,7ci,8ci,9ci PubChem CID: 2800899 IUPAC navn: 2,3-dimethylbenzoyl chloride SMIL: CC1=CC=CC(=C1C)C(=O)Cl
| MDL nummer | MFCD00045217 |
|---|---|
| PubChem CID | 2800899 |
| Molekylvægt (g/mol) | 168.62 |
| CAS | 21900-46-9 |
| Synonym | 2,3-dimethylbenzene-1-carbonyl chloride,benzoyl chloride, dimethyl,xylic acid chloride,acmc-20aog3,2,3 dimethylbenzoyl chloride,2,3-dimethyl-benzoyl chloride,2,3-dimethylbenzene-1-carbonylchloride,2,3-dimethyl-1-benzenecarbonyl chloride,benzoyl chloride, 2,3-dimethyl-6ci,7ci,8ci,9ci |
| SMIL | CC1=CC=CC(=C1C)C(=O)Cl |
| IUPAC navn | 2,3-dimethylbenzoyl chloride |
| InChI nøgle | WFNKMVDATNLZBX-UHFFFAOYSA-N |
| Molekylær formel | C9H9ClO |
Chlorobis(4-chlorophenyl)phosphine, 97%
CAS: 13685-26-2 Molekylær formel: C12H8Cl3P Molekylvægt (g/mol): 289.52 MDL nummer: MFCD09909564 InChI nøgle: UISLTICQIVPVGS-UHFFFAOYSA-N Synonym: chlorobis 4-chlorophenyl phosphine,chlorobis 4-chlorophenyl phosphane,bis 4-chlorophenyl chlorophosphine,chloro-bis 4-chlorophenyl phosphane,bis 4-chlorophenyl phosphinous chloride,chlorobis 4-chlorophenyl phosphine,98+% PubChem CID: 18705966 IUPAC navn: chloro-bis(4-chlorophenyl)phosphane SMIL: C1=CC(=CC=C1P(C2=CC=C(C=C2)Cl)Cl)Cl
| MDL nummer | MFCD09909564 |
|---|---|
| PubChem CID | 18705966 |
| Molekylvægt (g/mol) | 289.52 |
| CAS | 13685-26-2 |
| Synonym | chlorobis 4-chlorophenyl phosphine,chlorobis 4-chlorophenyl phosphane,bis 4-chlorophenyl chlorophosphine,chloro-bis 4-chlorophenyl phosphane,bis 4-chlorophenyl phosphinous chloride,chlorobis 4-chlorophenyl phosphine,98+% |
| SMIL | C1=CC(=CC=C1P(C2=CC=C(C=C2)Cl)Cl)Cl |
| IUPAC navn | chloro-bis(4-chlorophenyl)phosphane |
| InChI nøgle | UISLTICQIVPVGS-UHFFFAOYSA-N |
| Molekylær formel | C12H8Cl3P |
| Lineær formel | CH3(CH2)4CH3 |
|---|---|
| Kemisk navn eller materiale | Hexanes |
| Specifik vægtfylde | 0.659 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF exposed or concerned: Get medical advice/attention. |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. May be fatal if swallowed and enters airways. Causes skin irritation. May cause drowsiness or dizziness. Suspected of damaging fertility. May cause damage to organs through prolonged or repeated exposure. Toxic to aquatic life with long lasting effects. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 86.18 |
| Opløselighedsinformation | Solubility in water: insoluble. Other solubilities: soluble in alcohol, acetone, ether and chloroform |
| Viskositet | 0.31 mPa.s (20°C) |
| Vand | 0.01% max. |
| Fysisk form | Liquid |
| Grad | Analytical |
| Brydningsindeks | 1.3748 to 1.3810 |
| Tæthed | 0.6590g/mL |
| CAS | 110-54-3 |
| Smeltepunkt | -95.0°C |
| Rester efter fordampning | 0.0005% max. |
| Synonym | Hex |
| Kogepunkt | 69.0°C |
| Flammepunkt | −22°C |
| Molekylær formel | C6H14 |
| Surhed | 0.0002 meq/g max. |