Filtrerede søgeresultater
n-Butyllithium, 2.5M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molekylær formel: C4H9Li Molekylvægt (g/mol): 64.06 MDL nummer: MFCD00009414 InChI nøgle: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMIL: [Li]CCCC
| MDL nummer | MFCD00009414 |
|---|---|
| PubChem CID | 61028 |
| Molekylvægt (g/mol) | 64.06 |
| CAS | 109-72-8 |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| SMIL | [Li]CCCC |
| InChI nøgle | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molekylær formel | C4H9Li |
n-Butyllithium, 1.6M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molekylær formel: C4H9Li Molekylvægt (g/mol): 64.06 MDL nummer: MFCD00009414 InChI nøgle: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMIL: [Li]CCCC
| MDL nummer | MFCD00009414 |
|---|---|
| PubChem CID | 61028 |
| Molekylvægt (g/mol) | 64.06 |
| CAS | 109-72-8 |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| SMIL | [Li]CCCC |
| InChI nøgle | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molekylær formel | C4H9Li |
Lithiumdiisopropylamid, 2M sol. i THF/n-heptan/ethylbenzen, AcroSeal™ , Thermo Scientific Chemicals
CAS: 4111-54-0 Molekylær formel: C6H14LiN Molekylvægt (g/mol): 107.125 MDL nummer: MFCD00064449 InChI nøgle: ZCSHNCUQKCANBX-UHFFFAOYSA-N Synonym: lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli PubChem CID: 2724682 IUPAC navn: lithium;di(propan-2-yl)azanid SMIL: [Li+].CC(C)[N-]C(C)C
| MDL nummer | MFCD00064449 |
|---|---|
| PubChem CID | 2724682 |
| Molekylvægt (g/mol) | 107.125 |
| CAS | 4111-54-0 |
| Synonym | lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli |
| SMIL | [Li+].CC(C)[N-]C(C)C |
| IUPAC navn | lithium;di(propan-2-yl)azanid |
| InChI nøgle | ZCSHNCUQKCANBX-UHFFFAOYSA-N |
| Molekylær formel | C6H14LiN |
tert-butyllithium, 1,9 M opløsning i pentan, AcroSeal™ , Thermo Scientific Chemicals
CAS: 594-19-4 Molekylær formel: C4H9Li Molekylvægt (g/mol): 64.06 MDL nummer: MFCD00008795 InChI nøgle: BKDLGMUIXWPYGD-UHFFFAOYSA-N Synonym: tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn PubChem CID: 638178 SMIL: [Li]C(C)(C)C
| MDL nummer | MFCD00008795 |
|---|---|
| PubChem CID | 638178 |
| Molekylvægt (g/mol) | 64.06 |
| CAS | 594-19-4 |
| Synonym | tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn |
| SMIL | [Li]C(C)(C)C |
| InChI nøgle | BKDLGMUIXWPYGD-UHFFFAOYSA-N |
| Molekylær formel | C4H9Li |
N,N-Diisopropylethylamine, 99.5+%, AcroSeal™
CAS: 7087-68-5 Molekylær formel: C8H19N Molekylvægt (g/mol): 129.24 InChI nøgle: JGFZNNIVVJXRND-UHFFFAOYSA-N Synonym: n,n-diisopropylethylamine,ethyldiisopropylamine,n-ethyldiisopropylamine,diisopropylethylamine,diea,hunig's base,n-ethyl-n-isopropylpropan-2-amine,dipea,2-propanamine, n-ethyl-n-1-methylethyl,1,1'-dimethyltriethylamine PubChem CID: 81531 IUPAC navn: N-ethyl-N-propan-2-ylpropan-2-amin SMIL: CCN(C(C)C)C(C)C
| PubChem CID | 81531 |
|---|---|
| Molekylvægt (g/mol) | 129.24 |
| CAS | 7087-68-5 |
| Synonym | n,n-diisopropylethylamine,ethyldiisopropylamine,n-ethyldiisopropylamine,diisopropylethylamine,diea,hunig's base,n-ethyl-n-isopropylpropan-2-amine,dipea,2-propanamine, n-ethyl-n-1-methylethyl,1,1'-dimethyltriethylamine |
| SMIL | CCN(C(C)C)C(C)C |
| IUPAC navn | N-ethyl-N-propan-2-ylpropan-2-amin |
| InChI nøgle | JGFZNNIVVJXRND-UHFFFAOYSA-N |
| Molekylær formel | C8H19N |
Borane-tetrahydrofuran complex, 1M solution in THF, Stabilized, AcroSeal™
CAS: 14044-65-6 | C4H11BO | 85.94 g/mol
| MDL nummer | MFCD00012429 |
|---|---|
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Sundhedsfare 2 | GHS H Statement May cause respiratory irritation. Causes serious eye damage. In contact with water releases flammable gases which may ignite spontaneously. Causes skin irritation. Harmful if swallowed. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides. May cause drowsiness or dizziness. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 85.94 |
| Emballage | AcroSeal™ Glasflaske |
| IUPAC navn | oxolan boran |
| Navn note | 1M solution in tetrahydrofuran, stabilized |
| PubChem CID | 11062302 |
| Molekylvægt (g/mol) | 85.94 |
| Tæthed | 0.8760g/mL |
| Fieser | 01,199; 02,106; 03,76; 04,124; 05,184; 06,161; 07,89; 12,65; 17,101 |
| SMIL | B.C1CCOC1 |
| Flammepunkt | −22°C |
| InChI nøgle | RMCYTHFAWCWRFA-UHFFFAOYSA-N |
| Behandling(er) | Stabilized |
| Kemisk navn eller materiale | Borane-tetrahydrofuran complex |
| Specifik vægtfylde | 0.876 |
| Opløselighedsinformation | Solubility in water: reacts. |
| Merck Index | 15, 1336 |
| Koncentration | 0.96 to 1.08M |
| Fysisk form | Væske |
| Farve | Farveløs |
| EINECS nummer | 237-881-8 |
| CAS | 109-99-9 |
| Synonym | borane-tetrahydrofuran complex,tetrahydrofuran borane,bh3.thf,borane tetrahydrofuran complex solution,borane-d3-thf complex solution,borane-tetrahydrofuran,unii-5ear4err1l,oxolane borane,boron; oxolane,borane thf |
| TSCA | TSCA |
| Molekylær formel | C4H11BO |
| MDL nummer | MFCD00011747 |
|---|---|
| Lineær formel | [CH3(CH2)3]4NF |
| Specifik vægtfylde | 0.887 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. Highly flammable liquid and vapor. May form explosive peroxides. May cause drowsiness or dizzines |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 261.46 |
| ChEBI | CHEBI:51990 |
| Merck Index | 15,9332 |
| IUPAC navn | tetrabutylazanium;fluorid |
| Fysisk form | Løsning |
| Farve | Brun til Grøn |
| Koncentration eller sammensætning (efter analyt eller komponenter) | 0.90 to 1.10M |
| PubChem CID | 2724141 |
| Tæthed | 0.8870g/mL |
| Molekylvægt (g/mol) | 261.47 |
| EINECS nummer | 207-057-2 |
| CAS | 7732-18-5 |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| SMIL | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Flammepunkt | −17°C |
| InChI nøgle | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Molekylær formel | C16H36FN |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Lineær formel | ((CH3)3Si)2NLi |
|---|---|
| Kemisk navn eller materiale | Lithium bis(trimethylsilyl)amide |
| Specifik vægtfylde | 0.9 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 167.33 |
| Opløselighedsinformation | Solubility in water: reacts. |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.33 |
| Tæthed | 0.9000g/mL |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| EINECS nummer | 223-725-6 |
| CAS | 109-99-9 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Kogepunkt | 65.0°C |
| Flammepunkt | −21°C |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
Vinylmagnesium bromide, 0.7M solution in THF, AcroSeal™
CAS: 1826-67-1 Molekylær formel: C2H3BrMg Molekylvægt (g/mol): 131.26 MDL nummer: MFCD00000042 InChI nøgle: XHHHAXOHMKAOSL-UHFFFAOYSA-M Synonym: vinylmagnesium bromide,bromo ethenyl magnesium,vinyl magnesium bromide,magnesium, bromoethenyl,vinylmagnesium bromide solution,vinylmagnesium bromide solution, 1.0 m in thf,bromovinylmagnesium,bromo vinyl magnesium,vinyl magnesiumbromide,grignard reagent PubChem CID: 74584 SMIL: Br[Mg]C=C
| MDL nummer | MFCD00000042 |
|---|---|
| PubChem CID | 74584 |
| Molekylvægt (g/mol) | 131.26 |
| CAS | 1826-67-1 |
| Synonym | vinylmagnesium bromide,bromo ethenyl magnesium,vinyl magnesium bromide,magnesium, bromoethenyl,vinylmagnesium bromide solution,vinylmagnesium bromide solution, 1.0 m in thf,bromovinylmagnesium,bromo vinyl magnesium,vinyl magnesiumbromide,grignard reagent |
| SMIL | Br[Mg]C=C |
| InChI nøgle | XHHHAXOHMKAOSL-UHFFFAOYSA-M |
| Molekylær formel | C2H3BrMg |
Diisobutylaluminium hydride, 1M solution in hexane, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AlH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.701 |
| Sundhedsfare 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Sundhedsfare 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Solubility in water: reacts |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Navn note | 1M Solution in Hexane |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.7010g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 110-54-3 |
| Smeltepunkt | -70.0°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | −23°C |
| Molekylær formel | C8H19Al |
Isopropylmagnesium chloride - Lithium chloride complex, 1.3M solution in THF, AcroSeal™
CAS: 745038-86-2 Molekylær formel: C3H7Cl2LiMg Molekylvægt (g/mol): 145.23 MDL nummer: MFCD07784514 InChI nøgle: CWTUREABAILGIK-UHFFFAOYSA-L Synonym: turbo grignard,iprmgcl licl,i-prmgcl licl,i-prmgcl.licl,isopropylmagnesiumchloride licl,isopropylmagnesium chloride licl,isopropyl magnesium chloride licl,cwtureabailgik-uhfffaoysa-l,isopropylmagnesium lithium chloride,isopropyl magnesium chloride li-cl PubChem CID: 11275082 SMIL: [Li+].[Cl-].CC(C)[Mg]Cl
| MDL nummer | MFCD07784514 |
|---|---|
| PubChem CID | 11275082 |
| Molekylvægt (g/mol) | 145.23 |
| CAS | 745038-86-2 |
| Synonym | turbo grignard,iprmgcl licl,i-prmgcl licl,i-prmgcl.licl,isopropylmagnesiumchloride licl,isopropylmagnesium chloride licl,isopropyl magnesium chloride licl,cwtureabailgik-uhfffaoysa-l,isopropylmagnesium lithium chloride,isopropyl magnesium chloride li-cl |
| SMIL | [Li+].[Cl-].CC(C)[Mg]Cl |
| InChI nøgle | CWTUREABAILGIK-UHFFFAOYSA-L |
| Molekylær formel | C3H7Cl2LiMg |
Bortrifluoridetherat, ca. 48 % BF3, AcroSeal™ , Thermo Scientific Chemicals
CAS: 109-63-7 Molekylær formel: C4H10BF3O Molekylvægt (g/mol): 141.93 MDL nummer: MFCD00013194 InChI nøgle: KZMGYPLQYOPHEL-UHFFFAOYSA-N Synonym: Boron trifluoride ethyl ether PubChem CID: 8000 IUPAC navn: ethoxyethan; trifluorboran SMIL: FB(F)F.CCOCC
| MDL nummer | MFCD00013194 |
|---|---|
| PubChem CID | 8000 |
| Molekylvægt (g/mol) | 141.93 |
| CAS | 109-63-7 |
| Synonym | Boron trifluoride ethyl ether |
| SMIL | FB(F)F.CCOCC |
| IUPAC navn | ethoxyethan; trifluorboran |
| InChI nøgle | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molekylær formel | C4H10BF3O |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AIH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.848 |
| Sundhedsfare 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 108-88-3 |
| Synonym | DIBAL-H |
| Kogepunkt | 110.0°C |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | 4°C |
| Molekylær formel | C8H19Al |
Ethynylmagnesiumbromid, 0,5 M opløsning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 4301-14-8 Molekylær formel: C2HBrMg Molekylvægt (g/mol): 129.24 MDL nummer: MFCD00075342 InChI nøgle: HUGJUYPSXULVQQ-UHFFFAOYSA-M Synonym: ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent PubChem CID: 4071243 IUPAC navn: brom(ethynyl)magnesium SMIL: Br[Mg]C#C
| MDL nummer | MFCD00075342 |
|---|---|
| PubChem CID | 4071243 |
| Molekylvægt (g/mol) | 129.24 |
| CAS | 4301-14-8 |
| Synonym | ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent |
| SMIL | Br[Mg]C#C |
| IUPAC navn | brom(ethynyl)magnesium |
| InChI nøgle | HUGJUYPSXULVQQ-UHFFFAOYSA-M |
| Molekylær formel | C2HBrMg |