Filtrerede søgeresultater
n-Butyllithium, 1.6M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molekylær formel: C4H9Li Molekylvægt (g/mol): 64.06 MDL nummer: MFCD00009414 InChI nøgle: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMIL: [Li]CCCC
| MDL nummer | MFCD00009414 |
|---|---|
| PubChem CID | 61028 |
| Molekylvægt (g/mol) | 64.06 |
| CAS | 109-72-8 |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| SMIL | [Li]CCCC |
| InChI nøgle | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molekylær formel | C4H9Li |
Lithiumdiisopropylamid, 2M sol. i THF/n-heptan/ethylbenzen, AcroSeal™ , Thermo Scientific Chemicals
CAS: 4111-54-0 Molekylær formel: C6H14LiN Molekylvægt (g/mol): 107.125 MDL nummer: MFCD00064449 InChI nøgle: ZCSHNCUQKCANBX-UHFFFAOYSA-N Synonym: lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli PubChem CID: 2724682 IUPAC navn: lithium;di(propan-2-yl)azanid SMIL: [Li+].CC(C)[N-]C(C)C
| MDL nummer | MFCD00064449 |
|---|---|
| PubChem CID | 2724682 |
| Molekylvægt (g/mol) | 107.125 |
| CAS | 4111-54-0 |
| Synonym | lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli |
| SMIL | [Li+].CC(C)[N-]C(C)C |
| IUPAC navn | lithium;di(propan-2-yl)azanid |
| InChI nøgle | ZCSHNCUQKCANBX-UHFFFAOYSA-N |
| Molekylær formel | C6H14LiN |
n-Butyllithium, 2.5M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molekylær formel: C4H9Li Molekylvægt (g/mol): 64.06 MDL nummer: MFCD00009414 InChI nøgle: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMIL: [Li]CCCC
| MDL nummer | MFCD00009414 |
|---|---|
| PubChem CID | 61028 |
| Molekylvægt (g/mol) | 64.06 |
| CAS | 109-72-8 |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| SMIL | [Li]CCCC |
| InChI nøgle | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molekylær formel | C4H9Li |
N,N-Diisopropylethylamine, 99.5+%, AcroSeal™
CAS: 7087-68-5 Molekylær formel: C8H19N Molekylvægt (g/mol): 129.24 InChI nøgle: JGFZNNIVVJXRND-UHFFFAOYSA-N Synonym: n,n-diisopropylethylamine,ethyldiisopropylamine,n-ethyldiisopropylamine,diisopropylethylamine,diea,hunig's base,n-ethyl-n-isopropylpropan-2-amine,dipea,2-propanamine, n-ethyl-n-1-methylethyl,1,1'-dimethyltriethylamine PubChem CID: 81531 IUPAC navn: N-ethyl-N-propan-2-ylpropan-2-amin SMIL: CCN(C(C)C)C(C)C
| PubChem CID | 81531 |
|---|---|
| Molekylvægt (g/mol) | 129.24 |
| CAS | 7087-68-5 |
| Synonym | n,n-diisopropylethylamine,ethyldiisopropylamine,n-ethyldiisopropylamine,diisopropylethylamine,diea,hunig's base,n-ethyl-n-isopropylpropan-2-amine,dipea,2-propanamine, n-ethyl-n-1-methylethyl,1,1'-dimethyltriethylamine |
| SMIL | CCN(C(C)C)C(C)C |
| IUPAC navn | N-ethyl-N-propan-2-ylpropan-2-amin |
| InChI nøgle | JGFZNNIVVJXRND-UHFFFAOYSA-N |
| Molekylær formel | C8H19N |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Lineær formel | ((CH3)3Si)2NLi |
|---|---|
| Kemisk navn eller materiale | Lithium bis(trimethylsilyl)amide |
| Specifik vægtfylde | 0.9 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 167.33 |
| Opløselighedsinformation | Solubility in water: reacts. |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.33 |
| Tæthed | 0.9000g/mL |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| EINECS nummer | 223-725-6 |
| CAS | 109-99-9 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Kogepunkt | 65.0°C |
| Flammepunkt | −21°C |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
Bortrifluoridetherat, ca. 48 % BF3, AcroSeal™ , Thermo Scientific Chemicals
CAS: 109-63-7 Molekylær formel: C4H10BF3O Molekylvægt (g/mol): 141.93 MDL nummer: MFCD00013194 InChI nøgle: KZMGYPLQYOPHEL-UHFFFAOYSA-N Synonym: Boron trifluoride ethyl ether PubChem CID: 8000 IUPAC navn: ethoxyethan; trifluorboran SMIL: FB(F)F.CCOCC
| MDL nummer | MFCD00013194 |
|---|---|
| PubChem CID | 8000 |
| Molekylvægt (g/mol) | 141.93 |
| CAS | 109-63-7 |
| Synonym | Boron trifluoride ethyl ether |
| SMIL | FB(F)F.CCOCC |
| IUPAC navn | ethoxyethan; trifluorboran |
| InChI nøgle | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molekylær formel | C4H10BF3O |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AIH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.848 |
| Sundhedsfare 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 108-88-3 |
| Synonym | DIBAL-H |
| Kogepunkt | 110.0°C |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | 4°C |
| Molekylær formel | C8H19Al |
Lithium aluminiumhydrid, 2,4M opløsning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 16853-85-3 | AlH4Li | 37.95 g/mol
| MDL nummer | MFCD00011075 |
|---|---|
| Lineær formel | LiAlH4 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| Sundhedsfare 2 | GHS H Statement In contact with water releases flammable gases which may ignite spontaneously. Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. May form explosive peroxides. Suspected of causing cancer. Harmful if swallowed. May cause drowsiness or dizziness. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 37.95 |
| Procent renhed | 9.2 to 10.5% (as LiAlH4) |
| IUPAC navn | lithium(1+)-aluminium |
| Navn note | 2.4M Solution in THF |
| PubChem CID | 21226445 |
| Molekylvægt (g/mol) | 37.95 |
| Tæthed | 0.9000g/mL |
| SMIL | [Li+].[AlH4-] |
| Flammepunkt | −17°C |
| InChI nøgle | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| FN nummer | 1411 |
| Kemisk navn eller materiale | Lithium Aluminum hydride |
| Specifik vægtfylde | 0.9 |
| Opløselighedsinformation | Solubility in water: vigorous reaction. |
| Merck Index | 15, 344 |
| Koncentration | 9.5 to 10.5% (as LiAlH4) |
| Fysisk form | Viskøs væske |
| Farve | Gul |
| CAS | 109-99-9 |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| Molekylær formel | AlH4Li |
Ethynylmagnesiumbromid, 0,5 M opløsning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 4301-14-8 Molekylær formel: C2HBrMg Molekylvægt (g/mol): 129.24 MDL nummer: MFCD00075342 InChI nøgle: HUGJUYPSXULVQQ-UHFFFAOYSA-M Synonym: ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent PubChem CID: 4071243 IUPAC navn: brom(ethynyl)magnesium SMIL: Br[Mg]C#C
| MDL nummer | MFCD00075342 |
|---|---|
| PubChem CID | 4071243 |
| Molekylvægt (g/mol) | 129.24 |
| CAS | 4301-14-8 |
| Synonym | ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent |
| SMIL | Br[Mg]C#C |
| IUPAC navn | brom(ethynyl)magnesium |
| InChI nøgle | HUGJUYPSXULVQQ-UHFFFAOYSA-M |
| Molekylær formel | C2HBrMg |
Lithium aluminum hydride, 4.0M solution in diethyl ether, AcroSeal™
CAS: 16853-85-3 | AlH4Li | 37.95 g/mol
| MDL nummer | MFCD00011075 |
|---|---|
| Lineær formel | LiAIH4 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep away from any possible contact with water, because of violent reaction and possible flash fire. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Do not breathe dust/fume/gas/mist/vapors/spray. |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May cause drowsiness or dizziness. In contact with water releases flammable gases which may ignite spontaneously. Extremely flammable liquid and vapor. May form explosive peroxides. Repeated exposure may cause skin dryness or cracking. |
| Sundhedsfare 1 | Danger |
| Formel vægt | 37.95 |
| Procent renhed | 18.0 to 22.0% (as LiAlH4) |
| IUPAC navn | lithium(1+)-aluminium |
| Navn note | 4.0M Solution in Diethyl Ether |
| PubChem CID | 21226445 |
| Anbefalet opbevaring | Produktet kan udvikle en vis uklarhed eller bundfald |
| Molekylvægt (g/mol) | 37.95 |
| Tæthed | 0.7100g/mL |
| Fieser | 01,581; 02,242; 03,176; 04,291; 05,382; 06,325; 07,196; 08,286; 09,274; 10,236; 11,289; 12,272; 13,61; 14,190; 15,184; 16,133; 17,162 |
| SMIL | [Li+].[AlH4-] |
| Flammepunkt | −017°C |
| InChI nøgle | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| Kemisk navn eller materiale | Lithium Aluminum hydride |
| Specifik vægtfylde | 0.71 |
| Opløselighedsinformation | Solubility in water: vigorous reaction. |
| Merck Index | 15, 344 |
| Fysisk form | Væske |
| Farve | Farveløs |
| CAS | 60-29-7 |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| Molekylær formel | AlH4Li |
Trimethylaluminium, 1,0 M opløsning i heptan, AcroSeal™ , Thermo Scientific Chemicals
CAS: 75-24-1 Molekylær formel: C3H9Al Molekylvægt (g/mol): 72.087 MDL nummer: MFCD00008252 InChI nøgle: JLTRXTDYQLMHGR-UHFFFAOYSA-N Synonym: trimethylaluminum,trimethylaluminium,aluminum, trimethyl,trimethylalane,unii-av210lg46j,ch3 3al,aluminum trimethanide,aluminum trimethyl,trimethylaluminum solution,trimethylaluminum, elec. gr. PubChem CID: 16682925 IUPAC navn: trimethylaluman SMIL: C[Al](C)C
| MDL nummer | MFCD00008252 |
|---|---|
| PubChem CID | 16682925 |
| Molekylvægt (g/mol) | 72.087 |
| CAS | 75-24-1 |
| Synonym | trimethylaluminum,trimethylaluminium,aluminum, trimethyl,trimethylalane,unii-av210lg46j,ch3 3al,aluminum trimethanide,aluminum trimethyl,trimethylaluminum solution,trimethylaluminum, elec. gr. |
| SMIL | C[Al](C)C |
| IUPAC navn | trimethylaluman |
| InChI nøgle | JLTRXTDYQLMHGR-UHFFFAOYSA-N |
| Molekylær formel | C3H9Al |
3-aminopropyltriethoxysilan, 99 %, AcroSeal™ , Thermo Scientific Chemicals
CAS: 919-30-2 Molekylær formel: C9H23NO3Si Molekylvægt (g/mol): 221.37 MDL nummer: MFCD00008207,MFCD01324904 InChI nøgle: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC navn: 3-triethoxysilylpropan-1-amin SMIL: CCO[Si](CCCN)(OCC)OCC
| MDL nummer | MFCD00008207,MFCD01324904 |
|---|---|
| PubChem CID | 13521 |
| Molekylvægt (g/mol) | 221.37 |
| CAS | 919-30-2 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| SMIL | CCO[Si](CCCN)(OCC)OCC |
| IUPAC navn | 3-triethoxysilylpropan-1-amin |
| InChI nøgle | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| Molekylær formel | C9H23NO3Si |
Dichlorodimethylsilane, 99+%, AcroSeal™
CAS: 75-78-5 Molekylær formel: C2H6Cl2Si Molekylvægt (g/mol): 129.06 MDL nummer: MFCD00000491 InChI nøgle: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC navn: dichlor(dimethyl)silan SMIL: C[Si](C)(Cl)Cl
| MDL nummer | MFCD00000491 |
|---|---|
| PubChem CID | 6398 |
| Molekylvægt (g/mol) | 129.06 |
| CAS | 75-78-5 |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
| SMIL | C[Si](C)(Cl)Cl |
| IUPAC navn | dichlor(dimethyl)silan |
| InChI nøgle | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
| Molekylær formel | C2H6Cl2Si |