Diphenylacetonitriler
- (2)
- (2)
- (4)
- (3)
- (3)
- (3)
- (3)
- (1)
- (1)
- (1)
- (3)
- (1)
- (1)
- (1)
- (2)
- (1)
- (2)
- (1)
- (1)
- (3)
- (1)
- (3)
- (3)
- (3)
- (2)
- (4)
- (3)
- (2)
- (4)
- (1)
- (3)
Filtrerede søgeresultater
Diphenylacetonitrile, 99%
CAS: 86-29-3 Molekylær formel: C14H11N Molekylvægt (g/mol): 193.249 MDL nummer: MFCD00001862 InChI nøgle: NEBPTMCRLHKPOB-UHFFFAOYSA-N Synonym: diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril PubChem CID: 6837 IUPAC navn: 2,2-diphenylacetonitril SMIL: C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2
| MDL nummer | MFCD00001862 |
|---|---|
| PubChem CID | 6837 |
| Molekylvægt (g/mol) | 193.249 |
| CAS | 86-29-3 |
| Synonym | diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril |
| SMIL | C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
| IUPAC navn | 2,2-diphenylacetonitril |
| InChI nøgle | NEBPTMCRLHKPOB-UHFFFAOYSA-N |
| Molekylær formel | C14H11N |
Diphenylacetonitrile, 99+%
CAS: 86-29-3 Molekylær formel: C14H11N Molekylvægt (g/mol): 193.25 InChI nøgle: NEBPTMCRLHKPOB-UHFFFAOYSA-N Synonym: diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril PubChem CID: 6837 IUPAC navn: 2,2-diphenylacetonitril SMIL: C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2
| PubChem CID | 6837 |
|---|---|
| Molekylvægt (g/mol) | 193.25 |
| CAS | 86-29-3 |
| Synonym | diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril |
| SMIL | C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
| IUPAC navn | 2,2-diphenylacetonitril |
| InChI nøgle | NEBPTMCRLHKPOB-UHFFFAOYSA-N |
| Molekylær formel | C14H11N |
2,2-Diphenylpropionitrile, 97%
CAS: 5558-67-8 Molekylær formel: C15H13N Molekylvægt (g/mol): 207.276 MDL nummer: MFCD00001846 InChI nøgle: DPVHBXFSKLKYIQ-UHFFFAOYSA-N PubChem CID: 79677 IUPAC navn: 2,2-diphenylpropannitril SMIL: CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2
| MDL nummer | MFCD00001846 |
|---|---|
| PubChem CID | 79677 |
| Molekylvægt (g/mol) | 207.276 |
| CAS | 5558-67-8 |
| SMIL | CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2 |
| IUPAC navn | 2,2-diphenylpropannitril |
| InChI nøgle | DPVHBXFSKLKYIQ-UHFFFAOYSA-N |
| Molekylær formel | C15H13N |
4-Bromo-2,2-diphenylbutyronitrile, 95%
CAS: 39186-58-8 Molekylær formel: C16H14BrN Molekylvægt (g/mol): 300.199 MDL nummer: MFCD00001845 InChI nøgle: IGYSFJHVFHNOEI-UHFFFAOYSA-N Synonym: 4-bromo-2,2-diphenylbutyronitrile,2,2-diphenyl-4-bromobutyronitrile,4-bromo-2,2-diphenyl-butyronitrile,3-cyano-3,3-diphenylpropyl bromide,benzeneacetonitrile, .alpha.-2-bromoethyl-.alpha.-phenyl,acmc-1csza,butyronitrile,2-diphenyl,ksc495i2r,aronis25014,bromoethyl diphenyl acetonitrile PubChem CID: 96575 IUPAC navn: 4-brom-2,2-diphenylbutanenitril SMIL: C1=CC=C(C=C1)C(CCBr)(C#N)C2=CC=CC=C2
| MDL nummer | MFCD00001845 |
|---|---|
| PubChem CID | 96575 |
| Molekylvægt (g/mol) | 300.199 |
| CAS | 39186-58-8 |
| Synonym | 4-bromo-2,2-diphenylbutyronitrile,2,2-diphenyl-4-bromobutyronitrile,4-bromo-2,2-diphenyl-butyronitrile,3-cyano-3,3-diphenylpropyl bromide,benzeneacetonitrile, .alpha.-2-bromoethyl-.alpha.-phenyl,acmc-1csza,butyronitrile,2-diphenyl,ksc495i2r,aronis25014,bromoethyl diphenyl acetonitrile |
| SMIL | C1=CC=C(C=C1)C(CCBr)(C#N)C2=CC=CC=C2 |
| IUPAC navn | 4-brom-2,2-diphenylbutanenitril |
| InChI nøgle | IGYSFJHVFHNOEI-UHFFFAOYSA-N |
| Molekylær formel | C16H14BrN |
Methyl-Alpha,Alpha-diphenyl-4-morpholinebutyronitrile(Regioisomer Mixture), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Kemisk navn eller materiale | Methyl-alpha,alpha-diphenyl-4-morpholinebutyronitrile(Regioisomer Mixture) |
|---|---|
| Anbefalet opbevaring | +4°C |
| Molekylvægt (g/mol) | 320.43 |
| InChI formel | InChI=1S/2C21H24N2O/c1-18(16-23-12-14-24-15-13-23)21(17-22,19-8-4-2-5-9-19)20-10-6-3-7-11-20;1-18(23-12-14-24-15-13-23)16-21(17-22,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2*2-11,18H,12-16H2,1H3 |
| Formel vægt | 320.19 |
| SMIL | CC(C(C1=CC=CC=C1)(C2=CC=CC=C2)C#N)CN3CCOCC3.CC(CC(C4=CC=CC=C4)(C5=CC=CC=C5)C#N)N6CCOCC6 |
| Molekylær formel | C21H24N2O |
Closantel, TRC
CAS: 57808-65-8 Molekylær formel: C22 H14 Cl2 I2 N2 O2 Molekylvægt (g/mol): 663.07 Synonym: N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide,Closantel,Clozantin,NSC 335306,Seponver,Zycloz IUPAC navn: N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide SMIL: Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c3cc(I)cc(I)c3O
| Molekylvægt (g/mol) | 663.07 |
|---|---|
| CAS | 57808-65-8 |
| Synonym | N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide,Closantel,Clozantin,NSC 335306,Seponver,Zycloz |
| SMIL | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c3cc(I)cc(I)c3O |
| IUPAC navn | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| Molekylær formel | C22 H14 Cl2 I2 N2 O2 |
Diphenylacetonitrile, TRC
CAS: 86-29-3 Molekylær formel: C14 H11 N Molekylvægt (g/mol): 193.24 Synonym: Diphenylacetonitrile,Methadone Hydrochoride Imp. E (EP) IUPAC navn: 2,2-diphenylacetonitrile SMIL: N#CC(c1ccccc1)c2ccccc2
| Molekylvægt (g/mol) | 193.24 |
|---|---|
| CAS | 86-29-3 |
| Synonym | Diphenylacetonitrile,Methadone Hydrochoride Imp. E (EP) |
| SMIL | N#CC(c1ccccc1)c2ccccc2 |
| IUPAC navn | 2,2-diphenylacetonitrile |
| Molekylær formel | C14 H11 N |