Filtrerede søgeresultater
Benzyl bromide, 98%
CAS: 100-39-0 MDL nummer: MFCD00000172 InChI nøgle: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC navn: brommethylbenzen SMIL: C1=CC=C(C=C1)CBr
| MDL nummer | MFCD00000172 |
|---|---|
| PubChem CID | 7498 |
| CAS | 100-39-0 |
| ChEBI | CHEBI:59858 |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
| SMIL | C1=CC=C(C=C1)CBr |
| IUPAC navn | brommethylbenzen |
| InChI nøgle | AGEZXYOZHKGVCM-UHFFFAOYSA-N |
9-Fluorenylmethyl chloroformate, 98%
CAS: 28920-43-6 Molekylær formel: C15H11ClO2 Molekylvægt (g/mol): 258.69 MDL nummer: MFCD00001138 InChI nøgle: IRXSLJNXXZKURP-UHFFFAOYSA-N Synonym: 9-fluorenylmethyl chloroformate,fmoc-cl,fmoc-chloride,fmoc chloride,9h-fluoren-9-ylmethyl chloroformate,carbonochloridic acid, 9h-fluoren-9-ylmethyl ester,9-fluorenylmethoxycarbonyl chloride,9-fluorenylmethylchloroformate,9h-fluoren-9-yl methyl carbonochloridate,9h-fluoren-9-ylmethoxy carbonyl chloride PubChem CID: 34367 IUPAC navn: 9H-fluoren-9-ylmethylcarbonochloridat SMIL: C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl
| MDL nummer | MFCD00001138 |
|---|---|
| PubChem CID | 34367 |
| Molekylvægt (g/mol) | 258.69 |
| CAS | 28920-43-6 |
| Synonym | 9-fluorenylmethyl chloroformate,fmoc-cl,fmoc-chloride,fmoc chloride,9h-fluoren-9-ylmethyl chloroformate,carbonochloridic acid, 9h-fluoren-9-ylmethyl ester,9-fluorenylmethoxycarbonyl chloride,9-fluorenylmethylchloroformate,9h-fluoren-9-yl methyl carbonochloridate,9h-fluoren-9-ylmethoxy carbonyl chloride |
| SMIL | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl |
| IUPAC navn | 9H-fluoren-9-ylmethylcarbonochloridat |
| InChI nøgle | IRXSLJNXXZKURP-UHFFFAOYSA-N |
| Molekylær formel | C15H11ClO2 |
Di-tert-butyl dicarbonate, 99%
CAS: 24424-99-5 Molekylær formel: C10H18O5 Molekylvægt (g/mol): 218.25 MDL nummer: MFCD00008805 InChI nøgle: DYHSDKLCOJIUFX-UHFFFAOYSA-N Synonym: di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate PubChem CID: 90495 ChEBI: CHEBI:48500 IUPAC navn: tert-butyl-(2-methylpropan-2-yl)oxycarbonylcarbonat SMIL: CC(C)(C)OC(=O)OC(=O)OC(C)(C)C
| MDL nummer | MFCD00008805 |
|---|---|
| PubChem CID | 90495 |
| Molekylvægt (g/mol) | 218.25 |
| CAS | 24424-99-5 |
| ChEBI | CHEBI:48500 |
| Synonym | di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate |
| SMIL | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| IUPAC navn | tert-butyl-(2-methylpropan-2-yl)oxycarbonylcarbonat |
| InChI nøgle | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| Molekylær formel | C10H18O5 |
Di-tert-butyldicarbonat, 1 M opløsning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 24424-99-5 | C10H18O5 | 218.25 g/mol
| MDL nummer | MFCD00008805 |
|---|---|
| Lineær formel | O[CO2C(CH3)3]2 |
| Kemisk navn eller materiale | Di-tert-butyl dicarbonate |
| Specifik vægtfylde | 0.913 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF INHALED: Remove to fresh air and keep at rest |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes serious eye damage. May cause respiratory irritation. Causes skin irritation. May cause an allergic skin reaction. Fatal if inhaled. May cause drowsiness |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 218.25 |
| ChEBI | CHEBI:48500 |
| Emballage | AcroSeal™ Glasflaske |
| Merck Index | 15, 3038 |
| Fysisk form | Væske |
| IUPAC navn | tert-butyl-(2-methylpropan-2-yl)oxycarbonylcarbonat |
| Farve | Farveløs |
| Navn note | 1M Solution in THF |
| PubChem CID | 90495 |
| Molekylvægt (g/mol) | 218.25 |
| Tæthed | 0.9130g/mL |
| EINECS nummer | 246-240-1 |
| CAS | 109-99-9 |
| Synonym | di-tert-butyl dicarbonate,boc anhydride,boc-anhydride,di-t-butyl dicarbonate,di-tert-butyl pyrocarbonate,bis tert-butoxycarbonyl oxide,di-tert-butyldicarbonate,boc2o,di-t-butyl pyrocarbonate,di tert-butyl carbonate |
| SMIL | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| Flammepunkt | −17°C |
| InChI nøgle | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| Molekylær formel | C10H18O5 |
Chlorotriphenylmethane, 98%
CAS: 76-83-5 Molekylær formel: C19H15Cl Molekylvægt (g/mol): 278.78 MDL nummer: MFCD00000813,MFCD00284810 InChI nøgle: JBWKIWSBJXDJDT-UHFFFAOYSA-N Synonym: trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris PubChem CID: 6456 IUPAC navn: [chlor(diphenyl)methyl]benzen SMIL: ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00000813,MFCD00284810 |
|---|---|
| PubChem CID | 6456 |
| Molekylvægt (g/mol) | 278.78 |
| CAS | 76-83-5 |
| Synonym | trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris |
| SMIL | ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC navn | [chlor(diphenyl)methyl]benzen |
| InChI nøgle | JBWKIWSBJXDJDT-UHFFFAOYSA-N |
| Molekylær formel | C19H15Cl |
Triphenylmethylchlorid, 98 %, Thermo Scientific Chemicals
CAS: 76-83-5 Molekylær formel: C19H15Cl Molekylvægt (g/mol): 278.78 MDL nummer: MFCD00000813,MFCD00284810 InChI nøgle: JBWKIWSBJXDJDT-UHFFFAOYSA-N Synonym: trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris PubChem CID: 6456 SMIL: ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| MDL nummer | MFCD00000813,MFCD00284810 |
|---|---|
| PubChem CID | 6456 |
| Molekylvægt (g/mol) | 278.78 |
| CAS | 76-83-5 |
| Synonym | trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris |
| SMIL | ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| InChI nøgle | JBWKIWSBJXDJDT-UHFFFAOYSA-N |
| Molekylær formel | C19H15Cl |