CAS RN 81-88-9
CAS RN 81-88-9
Thermo Scientific Chemicals Rhodamin B, 98+ %
CAS: 81-88-9 Molekylær formel: C28H31ClN2O3 Molekylvægt (g/mol): 479.02 MDL nummer: MFCD00011931 InChI nøgle: PYWVYCXTNDRMGF-UHFFFAOYSA-N Synonym: Basic Violet 10,C.I. 45170 PubChem CID: 6694 ChEBI: CHEBI:52334 IUPAC navn: [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-yliden]-diethylazanium;chlorid SMIL: [Cl-].CCN(CC)C1=CC2=[O+]C3=CC(=CC=C3C(C3=CC=CC=C3C(O)=O)=C2C=C1)N(CC)CC
Thermo Scientific Chemicals Rhodamine B
CAS: 81-88-9 Molekylær formel: C28H31ClN2O3 Molekylvægt (g/mol): 479.02 MDL nummer: MFCD00011931 InChI nøgle: PYWVYCXTNDRMGF-UHFFFAOYSA-N PubChem CID: 6694 ChEBI: CHEBI:52334 IUPAC navn: [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-yliden]-diethylazanium;chlorid SMIL: [Cl-].CCN(CC)C1=CC2=[O+]C3=CC(=CC=C3C(C3=CC=CC=C3C(O)=O)=C2C=C1)N(CC)CC
Thermo Scientific Chemicals Rhodamine B
CAS: 81-88-9 Molekylær formel: C28H31ClN2O3 Molekylvægt (g/mol): 479.02 MDL nummer: MFCD00011931 InChI nøgle: PYWVYCXTNDRMGF-UHFFFAOYSA-N Synonym: Basic Violet 10,C.I. 45170 PubChem CID: 6694 ChEBI: CHEBI:52334 IUPAC navn: [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-yliden]-diethylazanium;chlorid SMIL: [Cl-].CCN(CC)C1=CC2=[O+]C3=CC(=CC=C3C(C3=CC=CC=C3C(O)=O)=C2C=C1)N(CC)CC
Rhodamine B, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Rhodamine B, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
Rhodamine B, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
MedChemExpress Rhodamine B
MedChemExpress Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and drugs.