Filtrerede søgeresultater
Søgeresultater for "BDS Phenyl"
Thermo Scientific™ Hypersil™ PREP BDS Phenyl HPLC kolonner
Opnå unik selektivitet for aromatiske og let polære forbindelser med en base-deaktiveret Hypersil PREP Phenyl BDS prep LC kolonne, velegnet til USP L11 applikationer.
| Temperatur | 60 °C |
|---|---|
| Stationær fase | Phenyl (Ph) |
| Endcapped | Ja |
| Partikelstørrelse | 5 μm |
| Kulstofbelastning | 5% |
| Porestørrelse | 145Å |
| pH | 2 til 8 |
| Kolonnetype | Omvendt fase |
| Emballagemateriale | Kugleformet, fuldt porøs, base-deaktiveret silica |
| Overfladeareal | 185 m² /g |
| Fase | Omvendt fase |
| USP type | L11 |
Thermo Scientific™ Hypersil™ BDS Phenyl (Ph) omvendt fase HPLC-kolonne, 5μ m, 4 mm x 300 mm
Kolonneformat: Analytisk kolonne; Kulstofbelastning: 5%; Porestørrelse: 130Å ; Kolonnefase: Omvendt fase
Thermo Scientific™ Hypersil™ Phenyl-BDS HPLC-søjler
Bruges som en robust søjle til generelle formål med aromatisk selektivitet til QC/QA-laboratorier.
| Temperatur | 60 °C |
|---|---|
| Stationær fase | Phenyl (Ph) |
| Endcapped | Ja |
| Kulstofbelastning | 5% |
| Porestørrelse | 130 Å |
| Maks. Tryk | 5800 psi (400 bar) |
| Kolonnetype | Omvendt fase |
| Emballagemateriale | Kugleformet, fuldt porøs, base-deaktiveret silica |
| Overfladeareal | 170 m²/g |
| Fase | Omvendt fase |
| USP type | L11 |
Thermo Scientific™ Hypersil™ PREP BDS Si HPLC kolonner
Adskil ikke-polære og moderat polære organiske forbindelser ved hjælp af normal fase Hypersil PREP Si BDS LC-søjler i forberedende skalaformater og XtendedLife-teknologi.
| Temperatur | 60 °C |
|---|---|
| Stationær fase | Silica |
| Endcapped | Nej |
| Kulstofbelastning | 0% |
| Porestørrelse | 145Å |
| pH | 2 til 7 |
| Kolonnetype | Normal fase |
| Emballagemateriale | Kugleformet, fuldt porøs, base-deaktiveret silica |
| Overfladeareal | 185 m² /g |
| Fase | Normal fase |
| USP type | L3 |
2-Phenyl-1,3-propanediol, 98%
CAS: 1570-95-2 Molekylær formel: C9H12O2 Molekylvægt (g/mol): 152.193 MDL nummer: MFCD00236056 InChI nøgle: BPBDZXFJDMJLIB-UHFFFAOYSA-N Synonym: 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a PubChem CID: 254178 IUPAC navn: 2-phenylpropan-1,3-diol SMIL: C1=CC=C(C=C1)C(CO)CO
| MDL nummer | MFCD00236056 |
|---|---|
| PubChem CID | 254178 |
| Molekylvægt (g/mol) | 152.193 |
| CAS | 1570-95-2 |
| Synonym | 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a |
| SMIL | C1=CC=C(C=C1)C(CO)CO |
| IUPAC navn | 2-phenylpropan-1,3-diol |
| InChI nøgle | BPBDZXFJDMJLIB-UHFFFAOYSA-N |
| Molekylær formel | C9H12O2 |
3-chlor-5-fluorbenzylalkohol, 98+%, Thermo Scientific Chemicals
CAS: 79944-64-2 Molekylær formel: C7H6ClFO Molekylvægt (g/mol): 160.57 MDL nummer: MFCD03788554 InChI nøgle: VJTJBAMDTCIMOB-UHFFFAOYSA-N Synonym: 3-chloro-5-fluorobenzyl alcohol,3-chloro-5-fluorophenyl methanol,3-chloro-5-fluoro-phenyl methanol,rarechem al bd 1247,benzenemethanol,3-chloro-5-fluoro,3-chloro-5-fluoro phenyl methanol,3-chloro-5-fluoro-phenyl-methanol,3-chloro-5-fluorophenyl methan-1-ol PubChem CID: 2734835 IUPAC navn: (3-chlor-5-fluorphenyl)methanol SMIL: OCC1=CC(F)=CC(Cl)=C1
| MDL nummer | MFCD03788554 |
|---|---|
| PubChem CID | 2734835 |
| Molekylvægt (g/mol) | 160.57 |
| CAS | 79944-64-2 |
| Synonym | 3-chloro-5-fluorobenzyl alcohol,3-chloro-5-fluorophenyl methanol,3-chloro-5-fluoro-phenyl methanol,rarechem al bd 1247,benzenemethanol,3-chloro-5-fluoro,3-chloro-5-fluoro phenyl methanol,3-chloro-5-fluoro-phenyl-methanol,3-chloro-5-fluorophenyl methan-1-ol |
| SMIL | OCC1=CC(F)=CC(Cl)=C1 |
| IUPAC navn | (3-chlor-5-fluorphenyl)methanol |
| InChI nøgle | VJTJBAMDTCIMOB-UHFFFAOYSA-N |
| Molekylær formel | C7H6ClFO |
4-fluor-2-methylbenzylalkohol, 99 %, Thermo Scientific Chemicals
CAS: 80141-91-9 Molekylær formel: C8H9FO Molekylvægt (g/mol): 140.157 MDL nummer: MFCD03701058 InChI nøgle: YSULUXOLTMBSFF-UHFFFAOYSA-N Synonym: 4-fluoro-2-methylphenyl methanol,4-fluoro-2-methylbenzyl alcohol,4-fluoro-2-methylbenzylalcohol,rarechem al bd 0506,4-fluoro-2-methylbenzenemethanol,benzenemethanol, 4-fluoro-2-methyl,4-fluoro-2-methyl-phenyl-methanol,4-fluoro-2-methylphenyl methan-1-ol,4'-fluoro-2-methylbenzyl alcohol PubChem CID: 3872017 IUPAC navn: (4-fluor-2-methylphenyl)methanol SMIL: CC1=C(C=CC(=C1)F)CO
| MDL nummer | MFCD03701058 |
|---|---|
| PubChem CID | 3872017 |
| Molekylvægt (g/mol) | 140.157 |
| CAS | 80141-91-9 |
| Synonym | 4-fluoro-2-methylphenyl methanol,4-fluoro-2-methylbenzyl alcohol,4-fluoro-2-methylbenzylalcohol,rarechem al bd 0506,4-fluoro-2-methylbenzenemethanol,benzenemethanol, 4-fluoro-2-methyl,4-fluoro-2-methyl-phenyl-methanol,4-fluoro-2-methylphenyl methan-1-ol,4'-fluoro-2-methylbenzyl alcohol |
| SMIL | CC1=C(C=CC(=C1)F)CO |
| IUPAC navn | (4-fluor-2-methylphenyl)methanol |
| InChI nøgle | YSULUXOLTMBSFF-UHFFFAOYSA-N |
| Molekylær formel | C8H9FO |
Fexofenadine hydrochloride 100 μg/mL in Acetonitrile, Dr. Ehrenstorfer
Discover Dr. Ehrenstorfer’s certified reference materials: available in multiple formats, including multi-component regulatory mixtures, to power your food and environmental analysis with traceable, ISO-accredited quality
Fexofenadine Hydrochloride, Mikromol™
Discover Mikromol - your trusted source for high-quality pharmaceutical reference standards. Supporting accurate, compliant analysis with ISO 17034-accredited materials designed for confidence in every result.
Thermo Scientific™ Hypersil™ BDS Phenyl Columns
Exceptional stability and alternative selectivity to C18 and C8 columns
| Stationær fase | Phenyl (Ph) |
|---|---|
| Partikelstørrelse | 5 μm |
| Kulstofbelastning | 5% |
| Porestørrelse | 130 Å |
| Kolonnetype | Reversed Phase |
| Emballagemateriale | Silica |
| Fase | Reversed Phase |
| USP type | L11 |
Thermo Scientific™ Hypersil™ BDS 3μm Phenyl Columns
Exceptional stability and alternative selectivity to C18 and C8 columns
| Stationær fase | Phenyl (Ph) |
|---|---|
| Partikelstørrelse | 3 μm |
| Kulstofbelastning | 5% |
| Porestørrelse | 130 Å |
| Kolonnetype | Reversed Phase |
| Overfladeareal | 170 m²/g |
| Fase | Reversed Phase |
| USP type | L11 |
Thermo Scientific™ Hypersil™ BDS 2.4μm Phenyl Columns
Exceptional stability and alternative selectivity to C18 and C8 columns
| Stationær fase | Phenyl (Ph) |
|---|---|
| Endcapped | Yes |
| Partikelstørrelse | 2.4 μm |
| Kulstofbelastning | 5% |
| Porestørrelse | 130 Å |
| pH | 2 to 9 |
| Kolonnetype | Reversed Phase |
| Diameter (metrisk) | 4.6 mm |
| Emballagemateriale | Base-Deactivated Silica |
| Overfladeareal | 170 m²/g |
| Fase | Reversed Phase |
| USP type | L11 |
2-Phenyl-1,3-propanediol, 98%, Thermo Scientific™
CAS: 1570-95-2 Molekylær formel: C9H12O2 Molekylvægt (g/mol): 152.19 InChI nøgle: BPBDZXFJDMJLIB-UHFFFAOYSA-N Synonym: 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a PubChem CID: 254178 IUPAC navn: 2-phenylpropane-1,3-diol SMIL: C1=CC=C(C=C1)C(CO)CO
| PubChem CID | 254178 |
|---|---|
| Molekylvægt (g/mol) | 152.19 |
| CAS | 1570-95-2 |
| Synonym | 2-phenyl-1,3-propanediol,2-phenyl-1,3-propanediole,2-phenyl-propane-1,3-diol,2-phenyl-1,3-propane diol,unii-9f93674jbb,1,3-propanediol, 2-phenyl,phenylpropanediol,pubchem20386,rarechem al bd 1370,acmc-1bz5a |
| SMIL | C1=CC=C(C=C1)C(CO)CO |
| IUPAC navn | 2-phenylpropane-1,3-diol |
| InChI nøgle | BPBDZXFJDMJLIB-UHFFFAOYSA-N |
| Molekylær formel | C9H12O2 |
2-Chloro-3-(trifluoromethyl)benzyl alcohol, 97+%, Thermo Scientific™
CAS: 261763-20-6 Molekylær formel: C8H6ClF3O Molekylvægt (g/mol): 210.58 MDL nummer: MFCD01631537 InChI nøgle: MQUXXVLMXCHGDZ-UHFFFAOYSA-N Synonym: 2-chloro-3-trifluoromethyl benzyl alcohol,2-chloro-3-trifluoromethyl phenyl methanol,2-chloro-3-trifluoromethyl benzylalcohol,2-chloro-3-trifluoromethyl phenyl methan-1-ol,acmc-1coey,rarechem al bd 0475,rarechem al bd 1301,2-chloro-3-trifluoromethyl-benzylalcohol,2-chloro-3-trifluoromethylbenzyl alcohol PubChem CID: 2778108 IUPAC navn: [2-chloro-3-(trifluoromethyl)phenyl]methanol SMIL: C1=CC(=C(C(=C1)C(F)(F)F)Cl)CO
| MDL nummer | MFCD01631537 |
|---|---|
| PubChem CID | 2778108 |
| Molekylvægt (g/mol) | 210.58 |
| CAS | 261763-20-6 |
| Synonym | 2-chloro-3-trifluoromethyl benzyl alcohol,2-chloro-3-trifluoromethyl phenyl methanol,2-chloro-3-trifluoromethyl benzylalcohol,2-chloro-3-trifluoromethyl phenyl methan-1-ol,acmc-1coey,rarechem al bd 0475,rarechem al bd 1301,2-chloro-3-trifluoromethyl-benzylalcohol,2-chloro-3-trifluoromethylbenzyl alcohol |
| SMIL | C1=CC(=C(C(=C1)C(F)(F)F)Cl)CO |
| IUPAC navn | [2-chloro-3-(trifluoromethyl)phenyl]methanol |
| InChI nøgle | MQUXXVLMXCHGDZ-UHFFFAOYSA-N |
| Molekylær formel | C8H6ClF3O |