Filtrerede søgeresultater
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Lineær formel | ((CH3)3Si)2NLi |
|---|---|
| Kemisk navn eller materiale | Lithium bis(trimethylsilyl)amide |
| Specifik vægtfylde | 0.9 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 167.33 |
| Opløselighedsinformation | Solubility in water: reacts. |
| IUPAC navn | lithium;bis(trimethylsilyl)azanid |
| PubChem CID | 2733832 |
| Molekylvægt (g/mol) | 167.33 |
| Tæthed | 0.9000g/mL |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| EINECS nummer | 223-725-6 |
| CAS | 109-99-9 |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| SMIL | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Kogepunkt | 65.0°C |
| Flammepunkt | −21°C |
| InChI nøgle | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molekylær formel | C6H18LiNSi2 |
Sodium tetraethylborate, 97%, pure, Thermo Scientific Chemicals
CAS: 15523-24-7 Molekylær formel: C8H20BNa Molekylvægt (g/mol): 150.04 MDL nummer: MFCD00061547 InChI nøgle: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC navn: natrium;tetraethylboranuid SMIL: [B-](CC)(CC)(CC)CC.[Na+]
| MDL nummer | MFCD00061547 |
|---|---|
| PubChem CID | 23681030 |
| Molekylvægt (g/mol) | 150.04 |
| CAS | 15523-24-7 |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| SMIL | [B-](CC)(CC)(CC)CC.[Na+] |
| IUPAC navn | natrium;tetraethylboranuid |
| InChI nøgle | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
| Molekylær formel | C8H20BNa |
Dichlorodimethylsilane, 99+%, AcroSeal™
CAS: 75-78-5 Molekylær formel: C2H6Cl2Si Molekylvægt (g/mol): 129.06 MDL nummer: MFCD00000491 InChI nøgle: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC navn: dichlor(dimethyl)silan SMIL: C[Si](C)(Cl)Cl
| MDL nummer | MFCD00000491 |
|---|---|
| PubChem CID | 6398 |
| Molekylvægt (g/mol) | 129.06 |
| CAS | 75-78-5 |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
| SMIL | C[Si](C)(Cl)Cl |
| IUPAC navn | dichlor(dimethyl)silan |
| InChI nøgle | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
| Molekylær formel | C2H6Cl2Si |
Chlortrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 75-77-4 Molekylær formel: C3H9ClSi Molekylvægt (g/mol): 108.64 MDL nummer: MFCD00000502 InChI nøgle: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC navn: chlor(trimethyl)silan SMIL: C[Si](C)(C)Cl
| MDL nummer | MFCD00000502 |
|---|---|
| PubChem CID | 6397 |
| Molekylvægt (g/mol) | 108.64 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| SMIL | C[Si](C)(C)Cl |
| IUPAC navn | chlor(trimethyl)silan |
| InChI nøgle | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
| Molekylær formel | C3H9ClSi |
N,O-Bis(trimethylsilyl)trifluoroacetamide, 98+%
CAS: 25561-30-2 Molekylær formel: C8H18F3NOSi2 MDL nummer: MFCD00008269 Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896
| MDL nummer | MFCD00008269 |
|---|---|
| PubChem CID | 9601896 |
| CAS | 25561-30-2 |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Molekylær formel | C8H18F3NOSi2 |
Hexamethyldisiloxane, 98+%
CAS: 107-46-0 InChI nøgle: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC navn: trimethyl(trimethylsilyloxy)silan SMIL: C[Si](C)(C)O[Si](C)(C)C
| PubChem CID | 24764 |
|---|---|
| CAS | 107-46-0 |
| ChEBI | CHEBI:78002 |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
| SMIL | C[Si](C)(C)O[Si](C)(C)C |
| IUPAC navn | trimethyl(trimethylsilyloxy)silan |
| InChI nøgle | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
3-aminopropyltriethoxysilan, 99 %, AcroSeal™ , Thermo Scientific Chemicals
CAS: 919-30-2 Molekylær formel: C9H23NO3Si Molekylvægt (g/mol): 221.37 MDL nummer: MFCD00008207,MFCD01324904 InChI nøgle: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC navn: 3-triethoxysilylpropan-1-amin SMIL: CCO[Si](CCCN)(OCC)OCC
| MDL nummer | MFCD00008207,MFCD01324904 |
|---|---|
| PubChem CID | 13521 |
| Molekylvægt (g/mol) | 221.37 |
| CAS | 919-30-2 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| SMIL | CCO[Si](CCCN)(OCC)OCC |
| IUPAC navn | 3-triethoxysilylpropan-1-amin |
| InChI nøgle | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| Molekylær formel | C9H23NO3Si |
Diisobutylaluminium hydride, 1M solution in hexane, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AlH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.701 |
| Sundhedsfare 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Sundhedsfare 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Solubility in water: reacts |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Navn note | 1M Solution in Hexane |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.7010g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 110-54-3 |
| Smeltepunkt | -70.0°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | −23°C |
| Molekylær formel | C8H19Al |
3-(Trimethoxysilyl)propyl methacrylate, 98%
CAS: 2530-85-0 Molekylær formel: C10H20O5Si Molekylvægt (g/mol): 248.35 MDL nummer: MFCD00008593 InChI nøgle: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC navn: 3-trimethoxysilylpropyl-2-methylprop-2-enoat SMIL: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| MDL nummer | MFCD00008593 |
|---|---|
| PubChem CID | 17318 |
| Molekylvægt (g/mol) | 248.35 |
| CAS | 2530-85-0 |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| SMIL | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| IUPAC navn | 3-trimethoxysilylpropyl-2-methylprop-2-enoat |
| InChI nøgle | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| Molekylær formel | C10H20O5Si |
3-Aminopropyltriethoxysilane, 99%
CAS: 919-30-2 Molekylær formel: C9H23NO3Si Molekylvægt (g/mol): 221.37 MDL nummer: MFCD00008207,MFCD01324904 InChI nøgle: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC navn: 3-triethoxysilylpropan-1-amin SMIL: CCO[Si](CCCN)(OCC)OCC
| MDL nummer | MFCD00008207,MFCD01324904 |
|---|---|
| PubChem CID | 13521 |
| Molekylvægt (g/mol) | 221.37 |
| CAS | 919-30-2 |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| SMIL | CCO[Si](CCCN)(OCC)OCC |
| IUPAC navn | 3-triethoxysilylpropan-1-amin |
| InChI nøgle | WYTZZXDRDKSJID-UHFFFAOYSA-N |
| Molekylær formel | C9H23NO3Si |
Hexamethyldisilazane, 98+%
CAS: 999-97-3 Molekylær formel: C6H19NSi2 Molekylvægt (g/mol): 161.395 MDL nummer: MFCD00008259 InChI nøgle: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC navn: [dimethyl-(trimethylsilylamino)silyl]methan SMIL: C[Si](C)(C)N[Si](C)(C)C
| MDL nummer | MFCD00008259 |
|---|---|
| PubChem CID | 13838 |
| Molekylvægt (g/mol) | 161.395 |
| CAS | 999-97-3 |
| ChEBI | CHEBI:85068 |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| SMIL | C[Si](C)(C)N[Si](C)(C)C |
| IUPAC navn | [dimethyl-(trimethylsilylamino)silyl]methan |
| InChI nøgle | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| Molekylær formel | C6H19NSi2 |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| MDL nummer | MFCD00008928 |
|---|---|
| Lineær formel | [(CH3)2CHCH2]2AIH |
| Kemisk navn eller materiale | Diisobutylaluminium hydride |
| Specifik vægtfylde | 0.848 |
| Sundhedsfare 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 142.22 |
| Opløselighedsinformation | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Merck Index | 15, 3212 |
| Fysisk form | Løsning |
| Molekylvægt (g/mol) | 142.22 |
| Tæthed | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| EINECS nummer | 214-729-9 |
| CAS | 108-88-3 |
| Synonym | DIBAL-H |
| Kogepunkt | 110.0°C |
| Beilstein | 04, IV, 4400 |
| Flammepunkt | 4°C |
| Molekylær formel | C8H19Al |
| CAS | 109-72-8 |
|---|---|
| Fysisk form | Væske |
| Molekylær formel | C{4}H{9}Li |