Andre opløsningsmidler
Filtrerede søgeresultater
L-Serine-d7, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Kemisk navn eller materiale | L-Serine-d7 |
|---|---|
| Anbefalet opbevaring | Room Temperature |
| Molekylvægt (g/mol) | 112.1357 |
| InChI formel | InChI=1 S/C3H7NO3/c4-2(1-5)3(6)7/h2,5 H,1,4H2,(H,6,7)/t2-/m0/s1/i1D2,2 D,5 D/hD3 |
| CAS | 935275-35-7 |
| Formel vægt | 112.0865 g/mol |
| Synonym | L-Serine-N,N,O,1,2,3,3-d7 (ACI),L-Serine-d7,L-Serine-D7,(2 S)-2-(Amino-d2)-3-(hydroxy-d)propanoic-2,3,3-d3 acid-d |
| Procent renhed | 98 atom % D, min 98% Chemical Purity |
| SMIL | [2 H]OC(=O)[C@@]([2 H])(N([2 H])[2 H])C([2 H])([2 H])O[2 H] |
| IUPAC navn | deuterio (2 S)-2,3,3-trideuterio-3-deuteriooxy-2-(dideuterioamino)propanoate |
| Molekylær formel | C3 D7 N O3 |
2-N,N-Dibenzyl Serine Benzyl Ester-13C3, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Kemisk navn eller materiale | 2-N,N-Dibenzyl Serine Benzyl Ester-13C3 |
|---|---|
| Molekylvægt (g/mol) | 378.438 |
| InChI formel | InChI=1S/C24H25NO3/c26-18-23(24(27)28-19-22-14-8-3-9-15-22)25(16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21/h1-15,23,26H,16-19H2/i18+1,23+1,24+1 |
| Formel vægt | 378.194 |
| Synonym | N,N-Bis(phenylmethyl)serine Phenylmethyl Ester-13C3 |
| SMIL | O[13CH2][13CH](N(Cc1ccccc1)Cc2ccccc2)[13C](=O)OCc3ccccc3 |
| IUPAC navn | benzyl 2-(dibenzylamino)-3-hydroxy(1,2,3-13C3)propanoate |
| Molekylær formel | 13C3 C21 H25 N O3 |
DL-Serine-2,3,3-d3, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Kemisk navn eller materiale | DL-Serine-2,3,3-d3 |
|---|---|
| Anbefalet opbevaring | Room Temperature |
| Molekylvægt (g/mol) | 108.11 |
| InChI formel | InChI=1 S/C3H7NO3/c4-2(1-5)3(6)7/h2,5 H,1,4H2,(H,6,7)/i1D2,2 D |
| CAS | 70094-78-9 |
| Formel vægt | 108.0614 g/mol |
| Procent renhed | 98 atom % D, min 98% Chemical Purity |
| SMIL | [2 H]C([2 H])(O)C([2 H])(N)C(=O)O |
| IUPAC navn | 2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
| Molekylær formel | C3 2H3 H4 N O3 |
L-Serine-2,3,3-d3, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Kemisk navn eller materiale | L-Serine-2,3,3-d3 |
|---|---|
| Anbefalet opbevaring | Room Temperature |
| Molekylvægt (g/mol) | 108.1111 |
| InChI formel | InChI=1 S/C3H7NO3/c4-2(1-5)3(6)7/h2,5 H,1,4H2,(H,6,7)/t2-/m0/s1/i1D2,2 D |
| CAS | 105591-10-4 |
| Formel vægt | 108.0614 g/mol |
| Synonym | L-Serine-2,3,3-d3 (9 CI, ACI),(2 S)-2-Amino-3-hydroxypropanoic-2,3,3-d3 acid,L-Serine-2,3,3-D3 |
| Procent renhed | 98 atom % D, min 98% Chemical Purity |
| SMIL | [2 H]C([2 H])(O)[C@]([2 H])(N)C(=O)O |
| IUPAC navn | (2 S)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
| Molekylær formel | C3 D3 H4 N O3 |
L-Serine-2,3,3-d3-N-FMOC, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Kemisk navn eller materiale | N-[(9 H-Fluoren-9-ylmethoxy)carbonyl]-L-serine-2,3,3-D3 |
|---|---|
| Anbefalet opbevaring | Room Temperature |
| Molekylvægt (g/mol) | 330.3498 |
| InChI formel | InChI=1 S/C18H17NO5/c20-9-16(17(21)22)19-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20 H,9-10H2,(H,19,23)(H,21,22)/t16-/m0/s1/i9D2,16 D |
| CAS | 1380308-48-4 |
| Formel vægt | 330.1295 g/mol |
| Synonym | L-Serine-2,3,3-d3, N-[(9 H-fluoren-9-ylmethoxy)carbonyl]- (ACI),N-[(9 H-Fluoren-9-ylmethoxy)carbonyl]-L-serine-2,3,3-d3 (ACI),N-[(9 H-Fluoren-9-ylmethoxy)carbonyl]-L-serine-2,3,3-D3,(2 S)-2-[[(9 H-Fluoren-9-ylmethoxy)carbonyl]amino]-3-hydroxypropanoic-2,3,3-d3 acid,(2 S)-2-(9 H-Fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic-2,3,3-d3 acid,Fmoc-L-Ser-OH-d3,N-(9-Fluorenylmethoxycarbonyl)-L-serine-2,3,3-d3,N-Fmoc-L-serine-2,3,3-d3,L-Serine-2,3,3-d3-N-FMOC |
| Procent renhed | 98 atom % D, min 98% Chemical Purity |
| SMIL | [2 H]C([2 H])(O)[C@]([2 H])(NC(=O)OCC1c2ccccc2c3ccccc13)C(=O)O |
| IUPAC navn | (2 S)-2,3,3-trideuterio-2-(9 H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid |
| Molekylær formel | C18 D3 H14 N O5 |
N-Palmitoyl-O-phosphocholine Serine-D9, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Kemisk navn eller materiale | N-Palmitoyl-O-phosphocholine Serine-D9 |
|---|---|
| Anbefalet opbevaring | -20°C |
| Molekylvægt (g/mol) | 517.684 |
| InChI formel | InChI=1S/C24H49N2O7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(27)25-22(24(28)29)21-33-34(30,31)32-20-19-26(2,3)4/h22H,5-21H2,1-4H3,(H2-,25,27,28,29,30,31)/t22-/m0/s1/i2D3,3D3,4D3 |
| Formel vægt | 517.384 |
| Synonym | (S)-2-Carboxy-2-palmitamidoethyl (2-(Tris(methyl-d3)ammonio)ethyl)phosphate |
| SMIL | [2H]C([2H])([2H])[N+](CCOP(=O)([O-])OC[C@H](NC(=O)CCCCCCCCCCCCCCC)C(=O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| IUPAC navn | [(2S)-2-carboxy-2-(hexadecanoylamino)ethyl] 2-[tris(trideuteriomethyl)azaniumyl]ethyl phosphate |
| Molekylær formel | C24 D9 H40 N2 O7 P |
N-Acetyl-L-serine-2,3,3-d3, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Kemisk navn eller materiale | N-Acetyl-L-serine-2,3,3-d3 |
|---|---|
| Anbefalet opbevaring | -20°C |
| Molekylvægt (g/mol) | 150.1478 |
| InChI formel | InChI=1 S/C5H9NO4/c1-3(8)6-4(2-7)5(9)10/h4,7 H,2H2,1H3,(H,6,8)(H,9,10)/t4-/m0/s1/i2D2,4 D |
| CAS | 2230887-17-7 |
| Formel vægt | 150.072 g/mol |
| Synonym | N-Acetyl-L-serine-2,3,3-d3,N-Acetyl-L-serine-α,β,β-D3,N-Acetyl-L-serine-d3,(2 S)-2-Acetamido-3-hydroxypropanoic-2,3,3-d3 acid |
| Procent renhed | 98 atom % D, min 98% Chemical Purity |
| SMIL | [2 H]C([2 H])(O)[C@]([2 H])(NC(=O)C)C(=O)O |
| IUPAC navn | (2 S)-2-acetamido-2,3,3-trideuterio-3-hydroxypropanoic acid |
| Molekylær formel | C5 D3 H6 N O4 |
L-Serine-2,3,3-d3-N-t-BOC, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Kemisk navn eller materiale | N-(tert-Butoxycarbonyl)-L-serine-2,3,3-D3 |
|---|---|
| Anbefalet opbevaring | Room Temperature |
| Molekylvægt (g/mol) | 208.2269 |
| InChI formel | InChI=1 S/C8H15NO5/c1-8(2,3)14-7(13)9-5(4-10)6(11)12/h5,10 H,4H2,1-3H3,(H,9,13)(H,11,12)/t5-/m0/s1/i4D2,5 D |
| Formel vægt | 208.1139 g/mol |
| Synonym | N-[(1,1-Dimethylethoxy)carbonyl]-L-serine-2,3,3-d3,(2 S)-3-Hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic-2,3,3-d3 acid,N-(tert-Butoxycarbonyl)-L-serine-2,3,3-D3,L-Serine-2,3,3-d3-N-t-BOC |
| Procent renhed | 98 atom % D, min 98% Chemical Purity |
| SMIL | [2 H]C([2 H])(O)[C@]([2 H])(NC(=O)OC(C)(C)C)C(=O)O |
| IUPAC navn | (2 S)-2,3,3-trideuterio-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| Molekylær formel | C8 D3 H12 N O5 |
N-(4-Nitrobenzoyl)-D-serine-d3 Quinine Salt, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Kemisk navn eller materiale | N-(4-Nitrobenzoyl)-D-serine-d3 Quinine Salt |
|---|---|
| Molekylvægt (g/mol) | 581.63 |
| InChI formel | InChI=1S/C20H24N2O2.C10H10N2O6/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;13-5-8(10(15)16)11-9(14)6-1-3-7(4-2-6)12(17)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1-4,8,13H,5H2,(H,11,14)(H,15,16)/t13-,14-,19-,20+;8-/m01/s1/i;5D2,8D |
| Formel vægt | 581.25 |
| SMIL | OC([C@](C([2H])([2H])O)([2H])NC(C1=CC=C(C=C1)N(=O)=O)=O)=O.[H][C@@]2([C@@H](C3=CC=NC4=CC=C(C=C34)OC)O)C[C@@H]5CC[N@]2C[C@@H]5C=C |
| IUPAC navn | (R)-(6-methoxyquinolin-4-yl)((1S,2S,4S,5R)-5-vinylquinuclidin-2-yl)methanol (4-nitrobenzoyl)-D-serinate-2,3,3-d3 |
| Molekylær formel | C10H7D3N2O6 . C 20H24N2O2 |
L-O-Phosphoserine-13C3, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Kemisk navn eller materiale | L-O-Phosphoserine-13C3 |
|---|---|
| Anbefalet opbevaring | -20°C |
| Molekylvægt (g/mol) | 188.05 |
| InChI formel | InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1/i1+1,2+1,3+1 |
| Formel vægt | 188.019 |
| Synonym | Dihydrogen Phosphate L-Serine-13C3,L-Serine Phosphate-13C3,L-Serine Dihydrogen Phosphate-13C3,3-O-Phosphoserine-13C3,Dexfosfoserine-13C3,Fosforina-13C3,L-3-Phosphoserine-13C3,L-O-Phosphoserine-13C3,L-O-Serine Phosphate-13C3,L-Phosphoserine-13C3,L-Serinephosphoric Acid-13C3,L-Seryl Phosphate-13C3,O-Phospho-L-serine-13C3,O-Phosphoryl-L-serine-13C3,O-Phosphorylserine-13C3,Phospho-L-serine-13C3,Serine O-Phosphate-13C3,Serine Dihydrogen Phosphate-13C3,Seriphos-13C3 |
| SMIL | N[13C@@H]([13CH2]OP(=O)(O)O)[13C](=O)O |
| IUPAC navn | (2S)-2-amino-3-phosphonooxy(1,2,3-13C3)propanoic acid |
| Molekylær formel | 13C3 H8 N O6 P |