Uorganiske salte
Filtrerede søgeresultater
| MDL nummer | MFCD00011747 |
|---|---|
| Lineær formel | [CH3(CH2)3]4NF |
| Specifik vægtfylde | 0.887 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. Highly flammable liquid and vapor. May form explosive peroxides. May cause drowsiness or dizzines |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 261.46 |
| ChEBI | CHEBI:51990 |
| Merck Index | 15,9332 |
| IUPAC navn | tetrabutylazanium;fluorid |
| Fysisk form | Løsning |
| Farve | Brun til Grøn |
| Koncentration eller sammensætning (efter analyt eller komponenter) | 0.90 to 1.10M |
| PubChem CID | 2724141 |
| Tæthed | 0.8870g/mL |
| Molekylvægt (g/mol) | 261.47 |
| EINECS nummer | 207-057-2 |
| CAS | 7732-18-5 |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| SMIL | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Flammepunkt | −17°C |
| InChI nøgle | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Molekylær formel | C16H36FN |
Boron tribromide, 1M solution in methylene chloride, AcroSeal™
CAS: 10294-33-4 | BBr3 | 250.52 g/mol
| MDL nummer | MFCD00011312 |
|---|---|
| Lineær formel | BBr3 |
| Kemisk navn eller materiale | Boron tribromide |
| Specifik vægtfylde | 1.467 |
| Sundhedsfare 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective clothing/eye protection/face protection. |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. Fatal if inhaled. Fatal if swallowed. Suspected of causing cancer. Reacts violently with water. May cause drowsiness or dizziness. |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 250.52 |
| Opløselighedsinformation | Solubility in water: reacts. Other solubilities: decomposes in alcohol, soluble in alcohol and ccl4 |
| Emballage | AcroSeal™ Glasflaske |
| Merck Index | 15,1349 |
| IUPAC navn | tribromoboran |
| PubChem CID | 25134 |
| Tæthed | 1.4670g/mL |
| Molekylvægt (g/mol) | 250.52 |
| EINECS nummer | 233-657-9 |
| CAS | 75-09-2 |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| SMIL | BrB(Br)Br |
| InChI nøgle | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molekylær formel | BBr3 |
Ethynylmagnesiumbromid, 0,5 M opløsning i THF, AcroSeal™ , Thermo Scientific Chemicals
CAS: 4301-14-8 Molekylær formel: C2HBrMg Molekylvægt (g/mol): 129.24 MDL nummer: MFCD00075342 InChI nøgle: HUGJUYPSXULVQQ-UHFFFAOYSA-M Synonym: ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent PubChem CID: 4071243 IUPAC navn: brom(ethynyl)magnesium SMIL: Br[Mg]C#C
| MDL nummer | MFCD00075342 |
|---|---|
| PubChem CID | 4071243 |
| Molekylvægt (g/mol) | 129.24 |
| CAS | 4301-14-8 |
| Synonym | ethynylmagnesium bromide,bromo ethynyl magnesium,ethynylmagnesium bromide solution,ethinylmagnesium bromide,ethynyl magnesiumbromide,pubchem18180,ethynyl-magnesium bromide,ethinyl magnesium bromide,ethynyl magnesium bromide,hugjuypsxulvqq-uhfffaoysa-m,grignard reagent |
| SMIL | Br[Mg]C#C |
| IUPAC navn | brom(ethynyl)magnesium |
| InChI nøgle | HUGJUYPSXULVQQ-UHFFFAOYSA-M |
| Molekylær formel | C2HBrMg |
Natriumethoxid, 21% i ethanol, AcroSeal™ , Thermo Scientific Chemicals
CAS: 141-52-6 Molekylær formel: C2H5NaO Molekylvægt (g/mol): 68.04 MDL nummer: MFCD00012417 InChI nøgle: QDRKDTQENPPHOJ-UHFFFAOYSA-N Synonym: sodium ethoxide,sodium ethylate,sodium ethanolate,sodiumethoxide,ethoxysodium,ethanol, sodium salt,caustic alcohol,naoet,etona,ethanol, sodium salt 1:1 PubChem CID: 2723922 ChEBI: CHEBI:52096 IUPAC navn: natrium; ethanolat SMIL: CC[O-].[Na+]
| MDL nummer | MFCD00012417 |
|---|---|
| PubChem CID | 2723922 |
| Molekylvægt (g/mol) | 68.04 |
| CAS | 141-52-6 |
| ChEBI | CHEBI:52096 |
| Synonym | sodium ethoxide,sodium ethylate,sodium ethanolate,sodiumethoxide,ethoxysodium,ethanol, sodium salt,caustic alcohol,naoet,etona,ethanol, sodium salt 1:1 |
| SMIL | CC[O-].[Na+] |
| IUPAC navn | natrium; ethanolat |
| InChI nøgle | QDRKDTQENPPHOJ-UHFFFAOYSA-N |
| Molekylær formel | C2H5NaO |
Triethylsilan, 99%, AcroSeal™ , Thermo Scientific Chemicals
CAS: 617-86-7 Molekylær formel: C6H16Si Molekylvægt (g/mol): 116.28 InChI nøgle: QXTIBZLKQPJVII-UHFFFAOYSA-N Synonym: triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes PubChem CID: 6327258 IUPAC navn: triethylsilicium SMIL: CC[Si](CC)CC
| PubChem CID | 6327258 |
|---|---|
| Molekylvægt (g/mol) | 116.28 |
| CAS | 617-86-7 |
| Synonym | triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes |
| SMIL | CC[Si](CC)CC |
| IUPAC navn | triethylsilicium |
| InChI nøgle | QXTIBZLKQPJVII-UHFFFAOYSA-N |
| Molekylær formel | C6H16Si |
Sodium methoxide, 5.4M (30 wt.%) solution in methanol, AcroSeal™
CAS: 124-41-4 Molekylær formel: CH3NaO Molekylvægt (g/mol): 54.02 MDL nummer: MFCD00012179 InChI nøgle: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC navn: natrium; methanolat SMIL: C[O-].[Na+]
| MDL nummer | MFCD00012179 |
|---|---|
| PubChem CID | 10942334 |
| Molekylvægt (g/mol) | 54.02 |
| CAS | 124-41-4 |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |
| SMIL | C[O-].[Na+] |
| IUPAC navn | natrium; methanolat |
| InChI nøgle | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| Molekylær formel | CH3NaO |
| MDL nummer | MFCD00011295 |
|---|---|
| Lineær formel | ZnCl2 |
| Kemisk navn eller materiale | Zinc chloride |
| Specifik vægtfylde | 1.07 |
| Sundhedsfare 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May cause respiratory irritation. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. May form explos |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 136.29 |
| ChEBI | CHEBI:49976 |
| Merck Index | 15, 10331 |
| IUPAC navn | dichlorzink |
| Fysisk form | Væske |
| Farve | Farveløs |
| Koncentration eller sammensætning (efter analyt eller komponenter) | 23 to 27% |
| Navn note | 2M solution in 2-Methyltetrahydrofuran |
| PubChem CID | 5727 |
| Tæthed | 1.0700g/mL |
| Molekylvægt (g/mol) | 136.29 |
| EINECS nummer | 231-592- |
| CAS | 96-47-9 |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| SMIL | Cl[Zn]Cl |
| Flammepunkt | −11°C |
| InChI nøgle | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molekylær formel | Cl2Zn |
Tetrabutylammonium hydroxide, 1M solution in methanol, AcroSeal™
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| MDL nummer | MFCD00009425 |
|---|---|
| Lineær formel | [CH3(CH2)3]4NOH |
| Sundhedsfare 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| Sundhedsfare 2 | GHS H Statement Toxic if swallowed. Toxic in contact with skin. Toxic if inhaled. Causes severe skin burns and eye damage. Causes damage to organs. Highly flammable liquid and vapor. |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 259.46 |
| Emballage | AcroSeal™ Glasflaske |
| IUPAC navn | tetrabutylazaniumhydroxid |
| Brydningsindeks | 1.3775 |
| PubChem CID | 2723671 |
| Tæthed | 0.9100g/mL |
| Molekylvægt (g/mol) | 259.48 |
| Smeltepunkt | -98.0°C |
| SMIL | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Kogepunkt | 65.0°C |
| Flammepunkt | 12°C |
| InChI nøgle | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Specifik vægtfylde | 0.91 |
| Opløselighedsinformation | Solubility in water: soluble |
| Fysisk form | Løsning |
| Farve | Farveløs til gul |
| Koncentration eller sammensætning (efter analyt eller komponenter) | 0.95 to 1.1M |
| EINECS nummer | 218-147-6 |
| CAS | 67-56-1 |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| Molekylær formel | C16H37NO |
| MDL nummer | MFCD00011295 |
|---|---|
| Lineær formel | ZnCl2 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. Suspected of causing cancer. May cause respiratory irritation. May form |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 136.3 |
| Emballage | AcroSeal™ Glasflaske |
| ChEBI | CHEBI:49976 |
| IUPAC navn | dichlorzink |
| PubChem CID | 5727 |
| Tæthed | 0.9800g/mL |
| Molekylvægt (g/mol) | 136.3 |
| SMIL | Cl[Zn]Cl |
| Kogepunkt | 66.0°C |
| Flammepunkt | −22°C |
| InChI nøgle | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Kemisk navn eller materiale | Zinc chloride |
| Specifik vægtfylde | 0.98 |
| Opløselighedsinformation | Solubility in water: miscible |
| Merck Index | 15, 10331 |
| Fysisk form | Væske |
| Farve | Rød |
| Koncentration eller sammensætning (efter analyt eller komponenter) | 0.65 to 0.8M (argentometry) |
| EINECS nummer | 231-592- |
| CAS | 109-99-9 |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| Molekylær formel | Cl2Zn |
Propargyl bromide, 80wt.% solution in toluene, stabilized, AcroSeal™
CAS: 106-96-7 | C3H3Br | 118.96 g/mol
| MDL nummer | MFCD00000241 |
|---|---|
| Lineær formel | HC≡CCH2Br |
| Sundhedsfare 3 | GHS P Statement Use personal protective equipment as required. Avoid breathing dust/fume/gas/mist/vapors/spray. Do not breathe dust/fume/gas/mist/vapors/spray. IF SWALLOWED: Immediately call a POISON CENTRE or doctor/physician. Do NOT induce vomiting. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. IF ON SKIN: Wash with plenty of soap and water. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. |
| Sundhedsfare 2 | GHS H Statement May cause damage to organs through prolonged or repeated exposure. Suspected of damaging fertility or the unborn child. May cause drowsiness or dizziness. May be fatal if swallowed and enters airways. Causes severe skin burns and eye damage. Toxic if swallowed. Highly flammable liquid and vapor. |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 118.96 |
| Emballage | AcroSeal™ Glasflaske |
| Procent renhed | 73 to 87% (propargyl bromide) (GC), 13 to 27% (toluene) (GC) |
| IUPAC navn | 3-bromprop-1-yn |
| Brydningsindeks | 1.4900 to 1.4960 |
| Navn note | Stabilized |
| PubChem CID | 7842 |
| Tæthed | 1.3800g/mL |
| Molekylvægt (g/mol) | 118.96 |
| SMIL | C#CCBr |
| Kogepunkt | 88.0°C to 90.0°C |
| Flammepunkt | 4°C |
| InChI nøgle | YORCIIVHUBAYBQ-UHFFFAOYSA-N |
| Kemisk navn eller materiale | Propargyl bromide |
| Specifik vægtfylde | 1.38 |
| Opløselighedsinformation | Solubility in water: immiscible |
| Fysisk form | Krystallinsk pulver |
| Farve | Hvid til gul |
| EINECS nummer | 203-447-1 |
| CAS | 108-88-3 |
| Synonym | propargyl bromide,3-bromopropyne,3-bromo-1-propyne,1-propyne, 3-bromo,2-propynyl bromide,propynyl bromide,1-bromo-2-propyne,propyne, 3-bromo,gamma-bromoallylene,1-brom-2-propin |
| Molekylær formel | C3H3Br |
Sodium methoxide, ACS reagent, 0.5M solution in methanol, AcroSeal™
CAS: 124-41-4 Molekylær formel: CH3NaO Molekylvægt (g/mol): 54.02 MDL nummer: MFCD00012179 InChI nøgle: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC navn: natrium; methanolat SMIL: C[O-].[Na+]
| MDL nummer | MFCD00012179 |
|---|---|
| PubChem CID | 10942334 |
| Molekylvægt (g/mol) | 54.02 |
| CAS | 124-41-4 |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |
| SMIL | C[O-].[Na+] |
| IUPAC navn | natrium; methanolat |
| InChI nøgle | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| Molekylær formel | CH3NaO |
| MDL nummer | MFCD00003516 |
|---|---|
| Lineær formel | NaBH3CN |
| Kemisk navn eller materiale | Sodium cyanoborohydride |
| Specifik vægtfylde | 0.915 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Highly flammable liquid and vapor. Toxic in contact with skin. Toxic if swallowed. Toxic if inhaled. May cause respiratory irritation. Causes severe skin burns and eye damage. Suspected of causin |
| Udseende | Clear colorless solution |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 62.84 |
| Opløselighedsinformation | Solubility in water: reacts. Other solubilities: soluble in methanol; soluble in thf, 372g/L, at 28°C, 410g/L at 46°C, 422g/L at 62°C, soluble in diglyme 176g/L at 25°C, slightly soluble in ethanol, insoluble in ether, benzene, hexane |
| Merck Index | 15, 8742 |
| IUPAC navn | natrium;cyanobor(1-) |
| Navn note | 1M solution in THF |
| PubChem CID | 20587905 |
| Tæthed | 0.9150g/mL |
| Molekylvægt (g/mol) | 62.84 |
| EINECS nummer | 247-317-2 |
| CAS | 109-99-9 |
| Synonym | sodium cyanoborohydride,sodium cyanotrihydridoborate,unii-c4i8c58p9t,zlchem 216,sodium cyanoboron 1- |
| SMIL | [Na+].[BH3-]C#N |
| Flammepunkt | −18°C |
| InChI nøgle | CVDUGUOQTVTBJH-UHFFFAOYSA-N |
| Molekylær formel | CH3BNNa |
Hexylmagnesium chloride, 2M solution in THF, AcroSeal™
CAS: 44767-62-6 Molekylær formel: C6H13ClMg Molekylvægt (g/mol): 144.93 MDL nummer: MFCD06798087 InChI nøgle: ODOOOEXDBNGOOF-UHFFFAOYSA-M Synonym: hexylmagnesium chloride,1-hexylmagnesium chloride,hexylmagnesium chloride solution,hexyl magnesium chloride,n-hexylmagnesium chloride,chloro hexyl magnesium,odoooexdbngoof-uhfffaoysa-m,1-hexylmagnesium chloride, 1m in methf,hexylmagnesium chloride2.0m solution,hexylmagnesium chloride solution, 2.0 m in thf PubChem CID: 10877247 SMIL: CCCCCC[Mg]Cl
| MDL nummer | MFCD06798087 |
|---|---|
| PubChem CID | 10877247 |
| Molekylvægt (g/mol) | 144.93 |
| CAS | 44767-62-6 |
| Synonym | hexylmagnesium chloride,1-hexylmagnesium chloride,hexylmagnesium chloride solution,hexyl magnesium chloride,n-hexylmagnesium chloride,chloro hexyl magnesium,odoooexdbngoof-uhfffaoysa-m,1-hexylmagnesium chloride, 1m in methf,hexylmagnesium chloride2.0m solution,hexylmagnesium chloride solution, 2.0 m in thf |
| SMIL | CCCCCC[Mg]Cl |
| InChI nøgle | ODOOOEXDBNGOOF-UHFFFAOYSA-M |
| Molekylær formel | C6H13ClMg |