Økologiske kaliumsalte
- (2)
- (1)
- (2)
- (3)
- (4)
- (3)
- (3)
- (2)
- (1)
- (2)
- (1)
- (3)
- (1)
- (2)
- (1)
- (1)
- (1)
- (3)
- (1)
- (5)
- (3)
- (2)
- (2)
- (3)
- (5)
- (2)
- (2)
- (5)
- (3)
- (2)
- (2)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
Filtrerede søgeresultater
Kaliumoxalatmonohydrat, 99+%, til analyse
CAS: 6487-48-5 Molekylær formel: C2H2K2O5 Molekylvægt (g/mol): 184.23 MDL nummer: MFCD00150033 InChI nøgle: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC navn: dikalium;oxalat;hydrat SMIL: O.[K+].[K+].[O-]C(=O)C([O-])=O
| MDL nummer | MFCD00150033 |
|---|---|
| PubChem CID | 2724193 |
| Molekylvægt (g/mol) | 184.23 |
| CAS | 6487-48-5 |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| SMIL | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| IUPAC navn | dikalium;oxalat;hydrat |
| InChI nøgle | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molekylær formel | C2H2K2O5 |
Oxalsyre, kaliumsaltdihydrat, 99%, ekstra ren
CAS: 6100-20-5 Molekylær formel: C4H3KO8 Molekylvægt (g/mol): 218.16 MDL nummer: MFCD00150443,MFCD00150443 InChI nøgle: GANDVAJEIJXBQJ-UHFFFAOYSA-M Synonym: potassium trihydrogen dioxalate dihydrate,potassium ion oxalic acid dihydrate hydrogen oxalate,potassium oxalic acid dihydrate hydrogen oxalate PubChem CID: 131698588 IUPAC navn: kalium;hydron;oxalat;dihydrat SMIL: [K+].OC(=O)C(O)=O.OC(=O)C([O-])=O
| MDL nummer | MFCD00150443,MFCD00150443 |
|---|---|
| PubChem CID | 131698588 |
| Molekylvægt (g/mol) | 218.16 |
| CAS | 6100-20-5 |
| Synonym | potassium trihydrogen dioxalate dihydrate,potassium ion oxalic acid dihydrate hydrogen oxalate,potassium oxalic acid dihydrate hydrogen oxalate |
| SMIL | [K+].OC(=O)C(O)=O.OC(=O)C([O-])=O |
| IUPAC navn | kalium;hydron;oxalat;dihydrat |
| InChI nøgle | GANDVAJEIJXBQJ-UHFFFAOYSA-M |
| Molekylær formel | C4H3KO8 |
Kaliumoxalatmonohydrat, 99%, ACS-reagens
CAS: 6487-48-5 Molekylær formel: C2H2K2O5 Molekylvægt (g/mol): 184.23 MDL nummer: MFCD00150033 InChI nøgle: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC navn: dikalium;oxalat;hydrat SMIL: O.[K+].[K+].[O-]C(=O)C([O-])=O
| MDL nummer | MFCD00150033 |
|---|---|
| PubChem CID | 2724193 |
| Molekylvægt (g/mol) | 184.23 |
| CAS | 6487-48-5 |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| SMIL | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| IUPAC navn | dikalium;oxalat;hydrat |
| InChI nøgle | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molekylær formel | C2H2K2O5 |
Kaliumvinyltrifluoroborat, 95%
CAS: 13682-77-4 Molekylær formel: C2H3BF3K Molekylvægt (g/mol): 133.95 MDL nummer: MFCD02093335 InChI nøgle: ZCUMGICZWDOJEM-UHFFFAOYSA-N Synonym: potassium vinyltrifluoroborate,potassium trifluoro vinyl borate,potassium ethenyltrifluoroboranuide,vinyltrifluoroboric acid potassium salt,potassium vinyltrifluorborate,potassium ethenyl trifluoroborate,potassium ethenyltrifluoroborate,potassium trifluoro vinyl boranuide,pubchem11308,potassiumvinyltrifluoroborate PubChem CID: 23679353 IUPAC navn: kalium;ethenyl(trifluor)boranuid SMIL: [B-](C=C)(F)(F)F.[K+]
| MDL nummer | MFCD02093335 |
|---|---|
| PubChem CID | 23679353 |
| Molekylvægt (g/mol) | 133.95 |
| CAS | 13682-77-4 |
| Synonym | potassium vinyltrifluoroborate,potassium trifluoro vinyl borate,potassium ethenyltrifluoroboranuide,vinyltrifluoroboric acid potassium salt,potassium vinyltrifluorborate,potassium ethenyl trifluoroborate,potassium ethenyltrifluoroborate,potassium trifluoro vinyl boranuide,pubchem11308,potassiumvinyltrifluoroborate |
| SMIL | [B-](C=C)(F)(F)F.[K+] |
| IUPAC navn | kalium;ethenyl(trifluor)boranuid |
| InChI nøgle | ZCUMGICZWDOJEM-UHFFFAOYSA-N |
| Molekylær formel | C2H3BF3K |
Kaliumfthalimid, 98+%
CAS: 1074-82-4 Molekylær formel: C8H4KNO2 Molekylvægt (g/mol): 185.22 MDL nummer: MFCD00005887 InChI nøgle: FYRHIOVKTDQVFC-UHFFFAOYSA-M Synonym: potassium phthalimide,potassium 1,3-dioxoisoindolin-2-ide,n-potassiophthalimide,phthalimide potassium salt,n-potassium phthalimide,unii-x6kka27dil,phthalimide, potassium salt,potassium phthalamide,1h-isoindole-1,3 2h-dione, potassium salt,x6kka27dil PubChem CID: 3356745 IUPAC navn: kalium;isoindol-2-ide-1,3-dion SMIL: [K+].O=C1[N-]C(=O)C2=CC=CC=C12
| MDL nummer | MFCD00005887 |
|---|---|
| PubChem CID | 3356745 |
| Molekylvægt (g/mol) | 185.22 |
| CAS | 1074-82-4 |
| Synonym | potassium phthalimide,potassium 1,3-dioxoisoindolin-2-ide,n-potassiophthalimide,phthalimide potassium salt,n-potassium phthalimide,unii-x6kka27dil,phthalimide, potassium salt,potassium phthalamide,1h-isoindole-1,3 2h-dione, potassium salt,x6kka27dil |
| SMIL | [K+].O=C1[N-]C(=O)C2=CC=CC=C12 |
| IUPAC navn | kalium;isoindol-2-ide-1,3-dion |
| InChI nøgle | FYRHIOVKTDQVFC-UHFFFAOYSA-M |
| Molekylær formel | C8H4KNO2 |
| Lineær formel | (CH3)3COK |
|---|---|
| Kemisk navn eller materiale | Potassium tert-butoxide |
| Specifik vægtfylde | 0.929 |
| Sundhedsfare 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides.<br |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 112.21 |
| Opløselighedsinformation | Solubility in water: reacts with water. |
| Emballage | Glasflaske |
| Fysisk form | Løsning |
| IUPAC navn | kalium;2-methylpropan-2-olat |
| Farve | Rav til farveløs |
| Grad | Ren |
| PubChem CID | 23665647 |
| Molekylvægt (g/mol) | 112.21 |
| Tæthed | 0.9290g/mL |
| Fieser | 01,911; 02,336; 03,233; 04,399; 05,544; 06,477; 08,407; 09,380; 10,323; 11,432; 12,97; 14,264; 17,289 |
| EINECS nummer | 212-740-3 |
| CAS | 109-99-9 |
| Synonym | potassium tert-butoxide,potassium tert-butanolate,potassium t-butoxide,potassium 2-methylpropan-2-olate,potassium tert-butylate,kotbu,2-methyl-2-propanol, potassium salt,tert-butoxypotassium,potassium-t-butoxide,t-buok |
| SMIL | CC(C)(C)[O-].[K+] |
| Flammepunkt | −21°C |
| InChI nøgle | LPNYRYFBWFDTMA-UHFFFAOYSA-N |
| Molekylær formel | C4H9KO |
Ethylxanthogensyre kaliumsalt, 97+%
CAS: 140-89-6 Molekylær formel: C3H5KOS2 Molekylvægt (g/mol): 160.29 MDL nummer: MFCD00004931 InChI nøgle: JCBJVAJGLKENNC-UHFFFAOYSA-M Synonym: potassium ethylxanthate,potassium ethyl xanthate,ethylxanthic acid potassium salt,potassium xanthogenate,potassium xanthate,potassium o-ethyl carbonodithioate,potassium ethyl xanthogenate,potassium ethylxanthogenate,potassium o-ethyl dithiocarbonate,z 3 pesticide PubChem CID: 2735045 IUPAC navn: kalium;ethoxymethandihioat SMIL: [K+].CCOC([S-])=S
| MDL nummer | MFCD00004931 |
|---|---|
| PubChem CID | 2735045 |
| Molekylvægt (g/mol) | 160.29 |
| CAS | 140-89-6 |
| Synonym | potassium ethylxanthate,potassium ethyl xanthate,ethylxanthic acid potassium salt,potassium xanthogenate,potassium xanthate,potassium o-ethyl carbonodithioate,potassium ethyl xanthogenate,potassium ethylxanthogenate,potassium o-ethyl dithiocarbonate,z 3 pesticide |
| SMIL | [K+].CCOC([S-])=S |
| IUPAC navn | kalium;ethoxymethandihioat |
| InChI nøgle | JCBJVAJGLKENNC-UHFFFAOYSA-M |
| Molekylær formel | C3H5KOS2 |
Potassium (2-nitrophenyl)trifluoroborate, 97%, Thermo Scientific™
CAS: 850623-64-2 Molekylær formel: C6H4BF3KNO2 Molekylvægt (g/mol): 229.01 InChI nøgle: DZHYOFKWMHZKBK-UHFFFAOYSA-N Synonym: potassium 2-nitrophenyl trifluoroborate,potassium trifluoro 2-nitrophenyl borate,potassium trifluoro 2-nitrophenyl boranuide,potassium trifluoro-2-nitrophenyl boranuide,potassium 2-nitrophenyltrifluoroborate,amtb936,potassium ion trifluoro 2-nitrophenyl boranuide,potassium tris fluoranyl-2-nitrophenyl boranuide PubChem CID: 2782854 IUPAC navn: potassium;trifluoro-(2-nitrophenyl)boranuide SMIL: [B-](C1=CC=CC=C1[N+](=O)[O-])(F)(F)F.[K+]
| PubChem CID | 2782854 |
|---|---|
| Molekylvægt (g/mol) | 229.01 |
| CAS | 850623-64-2 |
| Synonym | potassium 2-nitrophenyl trifluoroborate,potassium trifluoro 2-nitrophenyl borate,potassium trifluoro 2-nitrophenyl boranuide,potassium trifluoro-2-nitrophenyl boranuide,potassium 2-nitrophenyltrifluoroborate,amtb936,potassium ion trifluoro 2-nitrophenyl boranuide,potassium tris fluoranyl-2-nitrophenyl boranuide |
| SMIL | [B-](C1=CC=CC=C1[N+](=O)[O-])(F)(F)F.[K+] |
| IUPAC navn | potassium;trifluoro-(2-nitrophenyl)boranuide |
| InChI nøgle | DZHYOFKWMHZKBK-UHFFFAOYSA-N |
| Molekylær formel | C6H4BF3KNO2 |
Potassium methoxide, 5% w/v in methanol, Thermo Scientific Chemicals
CAS: 865-33-8 Molekylær formel: CH3KO Molekylvægt (g/mol): 70.132 MDL nummer: MFCD00012416 InChI nøgle: BDAWXSQJJCIFIK-UHFFFAOYSA-N Synonym: potassium methoxide,potassium methylate,potassium methanolate,methanol, potassium salt,unii-45myq0gwgb,45myq0gwgb,potassiummethoxide,methanol, potassium salt 1:1,kome,meok PubChem CID: 23664618 IUPAC navn: potassium;methanolate SMIL: C[O-].[K+]
| MDL nummer | MFCD00012416 |
|---|---|
| PubChem CID | 23664618 |
| Molekylvægt (g/mol) | 70.132 |
| CAS | 865-33-8 |
| Synonym | potassium methoxide,potassium methylate,potassium methanolate,methanol, potassium salt,unii-45myq0gwgb,45myq0gwgb,potassiummethoxide,methanol, potassium salt 1:1,kome,meok |
| SMIL | C[O-].[K+] |
| IUPAC navn | potassium;methanolate |
| InChI nøgle | BDAWXSQJJCIFIK-UHFFFAOYSA-N |
| Molekylær formel | CH3KO |
Kaliumtert-pentyloxid, 14-18% w/v i cyclohexan
CAS: 41233-93-6 Molekylær formel: C5H11KO Molekylvægt (g/mol): 126.24 MDL nummer: MFCD00064808 InChI nøgle: ZRLVQFQTCMUIRM-UHFFFAOYSA-N Synonym: potassium 2-methylbutan-2-olate,potassium tert-amylate,potassium tert-pentoxide,potassium tert-pentylate,potassium tert-pentoxide solution,potassium 2-methyl-2-butoxide,2-butanol, 2-methyl-, potassium salt,potassium tert-amyloxide,2-butanol, 2-methyl-, potassium salt 1:1 PubChem CID: 23683543 SMIL: [K+].CCC(C)(C)[O-]
| MDL nummer | MFCD00064808 |
|---|---|
| PubChem CID | 23683543 |
| Molekylvægt (g/mol) | 126.24 |
| CAS | 41233-93-6 |
| Synonym | potassium 2-methylbutan-2-olate,potassium tert-amylate,potassium tert-pentoxide,potassium tert-pentylate,potassium tert-pentoxide solution,potassium 2-methyl-2-butoxide,2-butanol, 2-methyl-, potassium salt,potassium tert-amyloxide,2-butanol, 2-methyl-, potassium salt 1:1 |
| SMIL | [K+].CCC(C)(C)[O-] |
| InChI nøgle | ZRLVQFQTCMUIRM-UHFFFAOYSA-N |
| Molekylær formel | C5H11KO |