CAS RN 5578-73-4
Sanguinarium Chloride, TRC
CAS: 5578-73-4 Molekylær formel: C20 H14 N O4 . Cl Molekylvægt (g/mol): 367.78 Synonym: [1,3]Benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium, 13-methyl-, chloride (9CI),Sanguinarine, chloride (6CI, 8CI),13-Methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium chloride,Sanguinarine hydrochloride,Sanguinarium chloride SMIL: [Cl-].C[n+]1cc2c3OCOc3ccc2c4ccc5cc6OCOc6cc5c14
Tocris Bioscience™ Sanguinarine chloride
Inhibitor of protein phosphatase 2C (PP2C)
Sanguinarine chloride, MedChemExpress
MedChemExpress Sanguinarine (Sanguinarin) chloride, a benzophenanthridine alkaloid derived from the root of Sanguinaria Canadensis, can stimulate apoptosis via activating the production of reactive oxygen species (ROS). Sanguinarine-induced apoptosis is associated with the activation of JNK and NF-κB.