Isothiocyanater
- (1)
- (3)
- (5)
- (1)
- (2)
- (2)
- (2)
- (3)
- (3)
- (1)
- (1)
- (3)
- (3)
- (3)
- (1)
- (8)
- (4)
- (2)
- (1)
- (4)
- (1)
- (1)
- (4)
- (8)
- (2)
- (2)
- (1)
- (5)
- (2)
- (1)
- (1)
- (10)
- (3)
- (3)
- (2)
- (1)
- (3)
- (2)
- (3)
- (1)
Filtrerede søgeresultater
p-Phenylene diisothiocyanate, 99%
CAS: 4044-65-9 Molekylær formel: C8H4N2S2 Molekylvægt (g/mol): 192.27 MDL nummer: MFCD00004811 InChI nøgle: OMWQUXGVXQELIX-UHFFFAOYSA-N Synonym: bitoscanate,1,4-phenylene diisothiocyanate,jonit,p-phenylene diisothiocyanate,benzene, 1,4-diisothiocyanato,bitoscanat,bitoscanate inn,phenylene thiocyanate,bitoscanatum latin,1,4-phenylenediisothiocyanate PubChem CID: 19958 IUPAC navn: 1,4-diisothiocyanatobenzen SMIL: C1=CC(=CC=C1N=C=S)N=C=S
| MDL nummer | MFCD00004811 |
|---|---|
| PubChem CID | 19958 |
| Molekylvægt (g/mol) | 192.27 |
| CAS | 4044-65-9 |
| Synonym | bitoscanate,1,4-phenylene diisothiocyanate,jonit,p-phenylene diisothiocyanate,benzene, 1,4-diisothiocyanato,bitoscanat,bitoscanate inn,phenylene thiocyanate,bitoscanatum latin,1,4-phenylenediisothiocyanate |
| SMIL | C1=CC(=CC=C1N=C=S)N=C=S |
| IUPAC navn | 1,4-diisothiocyanatobenzen |
| InChI nøgle | OMWQUXGVXQELIX-UHFFFAOYSA-N |
| Molekylær formel | C8H4N2S2 |
Benzyl isothiocyanate, 98%
CAS: 622-78-6 Molekylær formel: C8H7NS Molekylvægt (g/mol): 149.22 MDL nummer: MFCD00004819 InChI nøgle: MDKCFLQDBWCQCV-UHFFFAOYSA-N Synonym: benzyl isothiocyanate,isothiocyanatomethyl benzene,benzyl mustard oil,benzylisothiocyanate,benzylsenfoel,tromacaps,tromalyt,urogran,isothiocyanic acid, benzyl ester,benzyl-isothiocyanate PubChem CID: 2346 ChEBI: CHEBI:17484 IUPAC navn: isothiocyanatomethylbenzen SMIL: C1=CC=C(C=C1)CN=C=S
| MDL nummer | MFCD00004819 |
|---|---|
| PubChem CID | 2346 |
| Molekylvægt (g/mol) | 149.22 |
| CAS | 622-78-6 |
| ChEBI | CHEBI:17484 |
| Synonym | benzyl isothiocyanate,isothiocyanatomethyl benzene,benzyl mustard oil,benzylisothiocyanate,benzylsenfoel,tromacaps,tromalyt,urogran,isothiocyanic acid, benzyl ester,benzyl-isothiocyanate |
| SMIL | C1=CC=C(C=C1)CN=C=S |
| IUPAC navn | isothiocyanatomethylbenzen |
| InChI nøgle | MDKCFLQDBWCQCV-UHFFFAOYSA-N |
| Molekylær formel | C8H7NS |
Allyl isothiocyanate, 94%, stabilized with 0.01% alpha-tocopherol
CAS: 57-06-7 MDL nummer: MFCD00004822 InChI nøgle: ZOJBYZNEUISWFT-UHFFFAOYSA-N Synonym: allyl isothiocyanate,mustard oil,redskin,allylsenevol,allylsenfoel,allyl mustard oil,oleum sinapis,oil of mustard,allylsevenolum,senfoel PubChem CID: 5971 ChEBI: CHEBI:73224 IUPAC navn: 3-isothiocyanatoprop-1-en SMIL: C=CCN=C=S
| MDL nummer | MFCD00004822 |
|---|---|
| PubChem CID | 5971 |
| CAS | 57-06-7 |
| ChEBI | CHEBI:73224 |
| Synonym | allyl isothiocyanate,mustard oil,redskin,allylsenevol,allylsenfoel,allyl mustard oil,oleum sinapis,oil of mustard,allylsevenolum,senfoel |
| SMIL | C=CCN=C=S |
| IUPAC navn | 3-isothiocyanatoprop-1-en |
| InChI nøgle | ZOJBYZNEUISWFT-UHFFFAOYSA-N |
1-Naphthyl isothiocyanate, 98%
CAS: 551-06-4 Molekylær formel: C11H7NS Molekylvægt (g/mol): 185.25 MDL nummer: MFCD00003882 InChI nøgle: JBDOSUUXMYMWQH-UHFFFAOYSA-N Synonym: 1-naphthyl isothiocyanate,1-naphthylisothiocyanate,anit,kesscocide,alpha-naphthyl isothiocyanate,naphthalene, 1-isothiocyanato,naphthalene, isothiocyanato,isothiocyanic acid, 1-naphthyl ester,1-naftylisothiokyanat,isothiocyanic acid 1-naphthyl ester PubChem CID: 11080 ChEBI: CHEBI:35455 IUPAC navn: 1-isothiocyanatonaphthalen SMIL: C1=CC=C2C(=C1)C=CC=C2N=C=S
| MDL nummer | MFCD00003882 |
|---|---|
| PubChem CID | 11080 |
| Molekylvægt (g/mol) | 185.25 |
| CAS | 551-06-4 |
| ChEBI | CHEBI:35455 |
| Synonym | 1-naphthyl isothiocyanate,1-naphthylisothiocyanate,anit,kesscocide,alpha-naphthyl isothiocyanate,naphthalene, 1-isothiocyanato,naphthalene, isothiocyanato,isothiocyanic acid, 1-naphthyl ester,1-naftylisothiokyanat,isothiocyanic acid 1-naphthyl ester |
| SMIL | C1=CC=C2C(=C1)C=CC=C2N=C=S |
| IUPAC navn | 1-isothiocyanatonaphthalen |
| InChI nøgle | JBDOSUUXMYMWQH-UHFFFAOYSA-N |
| Molekylær formel | C11H7NS |
Ethyl isothiocyanate, 96%
CAS: 542-85-8 Molekylær formel: C3H5NS Molekylvægt (g/mol): 87.14 MDL nummer: MFCD00004820 InChI nøgle: HBNYJWAFDZLWRS-UHFFFAOYSA-N Synonym: ethyl isothiocyanate,ethane, isothiocyanato,ethyl mustard oil,ethylisothiocyanate,isothiocyanic acid, ethyl ester,unii-3284mj2t8p,ccris 7323,ethylisothio-cyanate,isothiocyanato-ethane PubChem CID: 10966 ChEBI: CHEBI:85098 IUPAC navn: isothiocyanatoethan SMIL: CCN=C=S
| MDL nummer | MFCD00004820 |
|---|---|
| PubChem CID | 10966 |
| Molekylvægt (g/mol) | 87.14 |
| CAS | 542-85-8 |
| ChEBI | CHEBI:85098 |
| Synonym | ethyl isothiocyanate,ethane, isothiocyanato,ethyl mustard oil,ethylisothiocyanate,isothiocyanic acid, ethyl ester,unii-3284mj2t8p,ccris 7323,ethylisothio-cyanate,isothiocyanato-ethane |
| SMIL | CCN=C=S |
| IUPAC navn | isothiocyanatoethan |
| InChI nøgle | HBNYJWAFDZLWRS-UHFFFAOYSA-N |
| Molekylær formel | C3H5NS |
Phenyl isothiocyanate, 98%
CAS: 103-72-0 Molekylær formel: C7H5NS Molekylvægt (g/mol): 135.18 MDL nummer: MFCD00004798 InChI nøgle: QKFJKGMPGYROCL-UHFFFAOYSA-N Synonym: phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate PubChem CID: 7673 ChEBI: CHEBI:85103 IUPAC navn: isothiocyanatobenzen SMIL: S=C=NC1=CC=CC=C1
| MDL nummer | MFCD00004798 |
|---|---|
| PubChem CID | 7673 |
| Molekylvægt (g/mol) | 135.18 |
| CAS | 103-72-0 |
| ChEBI | CHEBI:85103 |
| Synonym | phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate |
| SMIL | S=C=NC1=CC=CC=C1 |
| IUPAC navn | isothiocyanatobenzen |
| InChI nøgle | QKFJKGMPGYROCL-UHFFFAOYSA-N |
| Molekylær formel | C7H5NS |
2,4-dimethoxyphenyl isothiocyanat, 95 %, Thermo Scientific™
CAS: 33904-03-9 Molekylær formel: C9H9NO2S Molekylvægt (g/mol): 195.24 InChI nøgle: CNXSCEPTSXPBTP-UHFFFAOYSA-N Synonym: 2,4-dimethoxyphenyl isothiocyanate,1-isothiocyanato-2,4-dimethoxy-benzene,2,4-dimethoxybenzenisothiocyanate,acmc-20aock,2,4-dimethoxyphenylisothiocyanate,1-isothiocyanato-2.4-dimethoxybenzene,isothiocyanic acid 2,4-dimethoxyphenyl ester PubChem CID: 2736202 IUPAC navn: 1-isothiocyanato-2,4-dimethoxybenzen SMIL: COC1=CC(=C(C=C1)N=C=S)OC
| PubChem CID | 2736202 |
|---|---|
| Molekylvægt (g/mol) | 195.24 |
| CAS | 33904-03-9 |
| Synonym | 2,4-dimethoxyphenyl isothiocyanate,1-isothiocyanato-2,4-dimethoxy-benzene,2,4-dimethoxybenzenisothiocyanate,acmc-20aock,2,4-dimethoxyphenylisothiocyanate,1-isothiocyanato-2.4-dimethoxybenzene,isothiocyanic acid 2,4-dimethoxyphenyl ester |
| SMIL | COC1=CC(=C(C=C1)N=C=S)OC |
| IUPAC navn | 1-isothiocyanato-2,4-dimethoxybenzen |
| InChI nøgle | CNXSCEPTSXPBTP-UHFFFAOYSA-N |
| Molekylær formel | C9H9NO2S |
o-Tolyl isothiocyanate, 99%
CAS: 614-69-7 MDL nummer: MFCD00004802 InChI nøgle: JYKYYPPZLPVIBY-UHFFFAOYSA-N Synonym: 2-methylphenyl isothiocyanate,o-tolyl isothiocyanate,2-tolyl isothiocyanate,o-tolylisothiocyanate,benzene, 1-isothiocyanato-2-methyl,1-isothiocyanato-2-methyl-benzene,2-methylphenylisothiocyanate,isothiocyanic acid o-tolyl ester,isothiocyanic acid, o-tolyl ester,2-methylbenzenisothiocyanate PubChem CID: 69195 IUPAC navn: 1-isothiocyanato-2-methylbenzene SMIL: CC1=CC=CC=C1N=C=S
| MDL nummer | MFCD00004802 |
|---|---|
| PubChem CID | 69195 |
| CAS | 614-69-7 |
| Synonym | 2-methylphenyl isothiocyanate,o-tolyl isothiocyanate,2-tolyl isothiocyanate,o-tolylisothiocyanate,benzene, 1-isothiocyanato-2-methyl,1-isothiocyanato-2-methyl-benzene,2-methylphenylisothiocyanate,isothiocyanic acid o-tolyl ester,isothiocyanic acid, o-tolyl ester,2-methylbenzenisothiocyanate |
| SMIL | CC1=CC=CC=C1N=C=S |
| IUPAC navn | 1-isothiocyanato-2-methylbenzene |
| InChI nøgle | JYKYYPPZLPVIBY-UHFFFAOYSA-N |