CAS RN 95058-81-4
CAS RN 95058-81-4
Gemcitabin, 98%, Thermo Scientific Chemicals
CAS: 95058-81-4 Molekylær formel: C9H11F2N3O4 Molekylvægt (g/mol): 263.2 InChI nøgle: SDUQYLNIPVEERB-QPPQHZFASA-N Synonym: gemcitabine,2',2'-difluorodeoxycytidine,gemcitabinum,gamcitabine,gemcitabina,gemcitabine hcl,dfdc,2'-deoxy-2',2'-difluorocytidine,folfugem,gemcel PubChem CID: 60750 ChEBI: CHEBI:175901 IUPAC navn: 4-amino-1-[(2R,4R,5R)-3,3-difluor-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-on SMIL: C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)(F)F
MedChemExpress Gemcitabine
MedChemExpress Gemcitabine (LY 188011) is a pyrimidine nucleoside analog antimetabolite and an antineoplastic agent. Gemcitabine inhibits DNA synthesis and repair, resulting in autophagyand apoptosis.
MedChemExpress Gemcitabine
MedChemExpress Gemcitabine (LY 188011) is a pyrimidine nucleoside analog antimetabolite and an antineoplastic agent. Gemcitabine inhibits DNA synthesis and repair, resulting in autophagyand apoptosis.
MedChemExpress Gemcitabine
MedChemExpress Gemcitabine (LY 188011) is a pyrimidine nucleoside analog antimetabolite and an antineoplastic agent. Gemcitabine inhibits DNA synthesis and repair, resulting in autophagyand apoptosis.
MedChemExpress Gemcitabine
MedChemExpress Gemcitabine (LY 188011) is a pyrimidine nucleoside analog antimetabolite and an antineoplastic agent. Gemcitabine inhibits DNA synthesis and repair, resulting in autophagyand apoptosis.