Acylchlorider
- (2)
- (2)
- (1)
- (1)
- (1)
- (1)
- (4)
- (2)
- (1)
- (2)
- (2)
- (2)
- (2)
- (1)
- (2)
- (2)
Filtrerede søgeresultater
Oxalylchlorid, 2,0 M opløsning i dichlormethan, AcroSeal™ , Thermo Scientific Chemicals
CAS: 79-37-8 | C2Cl2O2 | 126.93 g/mol
| MDL nummer | MFCD00000704 |
|---|---|
| Lineær formel | ClCOCOCl |
| Sundhedsfare 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. |
| Sundhedsfare 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if inhaled. Suspected of causing cancer. Harmful if swallowed. Reacts violently with water. Contact with water liberates toxic gas. Corrosive to t |
| Sundhedsfare 1 | GHS-signalord: Fare |
| Formel vægt | 126.93 |
| IUPAC navn | oxalyldichlorid |
| Navn note | 2.0M solution in dichloromethane |
| PubChem CID | 65578 |
| Anbefalet opbevaring | Køleskab+ 4 °C |
| Molekylvægt (g/mol) | 126.93 |
| Tæthed | 1.3350g/mL |
| Fieser | 01,767; 02,301; 03,216; 04,361; 05,481; 06,424; 07,257; 08,366; 11,379; 14,150; 16,149; 17,241 |
| SMIL | C(=O)(C(=O)Cl)Cl |
| InChI nøgle | CTSLXHKWHWQRSH-UHFFFAOYSA-N |
| Kemisk navn eller materiale | Oxalyl chloride |
| Specifik vægtfylde | 1.335 |
| Opløselighedsinformation | Solubility in water: reacts |
| Merck Index | 15, 7013 |
| Fysisk form | Væske |
| Farve | Farveløs til gul |
| EINECS nummer | 201-200-2 |
| CAS | 75-09-2 |
| Synonym | oxalyl chloride,ethanedioyl dichloride,oxalic dichloride,oxaloyl chloride,oxalic acid dichloride,oxalic acid chloride,ethanedioyl chloride,oxalylchloride,unii-r4y96317dw,cocl 2 |
| Beilstein | 02, 542 |
| Molekylær formel | C2Cl2O2 |
Phthaloyl chloride, 90%, AcroSeal™, Thermo Scientific™
CAS: 88-95-9 InChI nøgle: FYXKZNLBZKRYSS-UHFFFAOYSA-N Synonym: phthaloyl chloride,phthaloyl dichloride,phthalic chloride,phthalyl chloride,phthalic dichloride,phthalic acid dichloride,phthalyl dichloride,1,2-benzenedicarbonyl dichloride,o-phthaloyl dichloride,phthaloyldichloride PubChem CID: 6955 IUPAC navn: benzene-1,2-dicarbonyl chloride SMIL: C1=CC=C(C(=C1)C(=O)Cl)C(=O)Cl
| PubChem CID | 6955 |
|---|---|
| CAS | 88-95-9 |
| Synonym | phthaloyl chloride,phthaloyl dichloride,phthalic chloride,phthalyl chloride,phthalic dichloride,phthalic acid dichloride,phthalyl dichloride,1,2-benzenedicarbonyl dichloride,o-phthaloyl dichloride,phthaloyldichloride |
| SMIL | C1=CC=C(C(=C1)C(=O)Cl)C(=O)Cl |
| IUPAC navn | benzene-1,2-dicarbonyl chloride |
| InChI nøgle | FYXKZNLBZKRYSS-UHFFFAOYSA-N |
Methacryloyl chloride, 95%, contains 200 ppm MEHQ as stabilizer, AcroSeal™, Thermo Scientific™
CAS: 920-46-7 InChI nøgle: VHRYZQNGTZXDNX-UHFFFAOYSA-N Synonym: methacryloyl chloride,methacryloylchloride,methacrylyl chloride,2-methyl-2-propenoyl chloride,methacryl chloride,methacrylic chloride,methacrylic acid chloride,2-propenoyl chloride, 2-methyl,2-methylpropenoyl chloride,methylacryloyl chloride PubChem CID: 13528 IUPAC navn: 2-methylprop-2-enoyl chloride SMIL: CC(=C)C(=O)Cl
| PubChem CID | 13528 |
|---|---|
| CAS | 920-46-7 |
| Synonym | methacryloyl chloride,methacryloylchloride,methacrylyl chloride,2-methyl-2-propenoyl chloride,methacryl chloride,methacrylic chloride,methacrylic acid chloride,2-propenoyl chloride, 2-methyl,2-methylpropenoyl chloride,methylacryloyl chloride |
| SMIL | CC(=C)C(=O)Cl |
| IUPAC navn | 2-methylprop-2-enoyl chloride |
| InChI nøgle | VHRYZQNGTZXDNX-UHFFFAOYSA-N |