Organiske oxoazanforbindelser
Filtrerede søgeresultater
7-nitroindol-2-carboxylsyre, 90%, Thermo Scientific™
CAS: 6960-45-8 Molekylær formel: C9H6N2O4 Molekylvægt (g/mol): 206.157 InChI nøgle: BIUCOFQROHIAEO-UHFFFAOYSA-N Synonym: 7-nitro-1h-indole-2-carboxylic acid,7-nitroindole-2-carboxylic acid,1h-indole-2-carboxylic acid, 7-nitro,7-nitroindole-2-carboxylicacid,dna base excision repair pathway inhibitor,maybridge1_004786,indole-2-carboxylic acid, 7-nitro,pubchem9857,acmc-1b8pb,1h-indole-2-carboxylicacid, 7-nitro PubChem CID: 81409 SMIL: C1=CC2=C(C(=C1)[N+](=O)[O-])NC(=C2)C(=O)O
| PubChem CID | 81409 |
|---|---|
| Molekylvægt (g/mol) | 206.157 |
| CAS | 6960-45-8 |
| Synonym | 7-nitro-1h-indole-2-carboxylic acid,7-nitroindole-2-carboxylic acid,1h-indole-2-carboxylic acid, 7-nitro,7-nitroindole-2-carboxylicacid,dna base excision repair pathway inhibitor,maybridge1_004786,indole-2-carboxylic acid, 7-nitro,pubchem9857,acmc-1b8pb,1h-indole-2-carboxylicacid, 7-nitro |
| SMIL | C1=CC2=C(C(=C1)[N+](=O)[O-])NC(=C2)C(=O)O |
| InChI nøgle | BIUCOFQROHIAEO-UHFFFAOYSA-N |
| Molekylær formel | C9H6N2O4 |
7-Nitroindole-2-carboxylic acid, 96%
CAS: 6960-45-8 Molekylær formel: C9H6N2O4 Molekylvægt (g/mol): 206.157 MDL nummer: MFCD00044720 InChI nøgle: BIUCOFQROHIAEO-UHFFFAOYSA-N Synonym: 7-nitro-1h-indole-2-carboxylic acid,7-nitroindole-2-carboxylic acid,1h-indole-2-carboxylic acid, 7-nitro,7-nitroindole-2-carboxylicacid,dna base excision repair pathway inhibitor,maybridge1_004786,indole-2-carboxylic acid, 7-nitro,pubchem9857,acmc-1b8pb,1h-indole-2-carboxylicacid, 7-nitro PubChem CID: 81409 SMIL: C1=CC2=C(C(=C1)[N+](=O)[O-])NC(=C2)C(=O)O
| MDL nummer | MFCD00044720 |
|---|---|
| PubChem CID | 81409 |
| Molekylvægt (g/mol) | 206.157 |
| CAS | 6960-45-8 |
| Synonym | 7-nitro-1h-indole-2-carboxylic acid,7-nitroindole-2-carboxylic acid,1h-indole-2-carboxylic acid, 7-nitro,7-nitroindole-2-carboxylicacid,dna base excision repair pathway inhibitor,maybridge1_004786,indole-2-carboxylic acid, 7-nitro,pubchem9857,acmc-1b8pb,1h-indole-2-carboxylicacid, 7-nitro |
| SMIL | C1=CC2=C(C(=C1)[N+](=O)[O-])NC(=C2)C(=O)O |
| InChI nøgle | BIUCOFQROHIAEO-UHFFFAOYSA-N |
| Molekylær formel | C9H6N2O4 |
3-nitroanilin, 98%, Thermo Scientific Chemicals
CAS: 99-09-2 Molekylær formel: C6H6N2O2 Molekylvægt (g/mol): 138.13 MDL nummer: MFCD00007782 InChI nøgle: XJCVRTZCHMZPBD-UHFFFAOYSA-N Synonym: m-nitroaniline,benzenamine, 3-nitro,3-nitrophenylamine,nitranilin,3-aminonitrobenzene,fast orange base r,azobase mna,devol orange r,m-nitrophenylamine,3-nitrobenzenamine PubChem CID: 7423 IUPAC navn: 3-nitroanilin SMIL: NC1=CC=CC(=C1)[N+]([O-])=O
| MDL nummer | MFCD00007782 |
|---|---|
| PubChem CID | 7423 |
| Molekylvægt (g/mol) | 138.13 |
| CAS | 99-09-2 |
| Synonym | m-nitroaniline,benzenamine, 3-nitro,3-nitrophenylamine,nitranilin,3-aminonitrobenzene,fast orange base r,azobase mna,devol orange r,m-nitrophenylamine,3-nitrobenzenamine |
| SMIL | NC1=CC=CC(=C1)[N+]([O-])=O |
| IUPAC navn | 3-nitroanilin |
| InChI nøgle | XJCVRTZCHMZPBD-UHFFFAOYSA-N |
| Molekylær formel | C6H6N2O2 |
3-nitroanilin, 98%, Thermo Scientific Chemicals
CAS: 99-09-2 Molekylær formel: C6H6N2O2 Molekylvægt (g/mol): 138.13 MDL nummer: MFCD00007782 InChI nøgle: XJCVRTZCHMZPBD-UHFFFAOYSA-N Synonym: m-nitroaniline,benzenamine, 3-nitro,3-nitrophenylamine,nitranilin,3-aminonitrobenzene,fast orange base r,azobase mna,devol orange r,m-nitrophenylamine,3-nitrobenzenamine PubChem CID: 7423 IUPAC navn: 3-nitroanilin SMIL: NC1=CC=CC(=C1)[N+]([O-])=O
| MDL nummer | MFCD00007782 |
|---|---|
| PubChem CID | 7423 |
| Molekylvægt (g/mol) | 138.13 |
| CAS | 99-09-2 |
| Synonym | m-nitroaniline,benzenamine, 3-nitro,3-nitrophenylamine,nitranilin,3-aminonitrobenzene,fast orange base r,azobase mna,devol orange r,m-nitrophenylamine,3-nitrobenzenamine |
| SMIL | NC1=CC=CC(=C1)[N+]([O-])=O |
| IUPAC navn | 3-nitroanilin |
| InChI nøgle | XJCVRTZCHMZPBD-UHFFFAOYSA-N |
| Molekylær formel | C6H6N2O2 |
Nitrobenzene, 99%, Reagent Grade, Honeywell™
CAS: 98-95-3 Molekylær formel: C6H5NO2 Molekylvægt (g/mol): 123.111 MDL nummer: MFCD00007043 InChI nøgle: LQNUZADURLCDLV-UHFFFAOYSA-N Synonym: nitrobenzol,benzene, nitro,oil of mirbane,mirbane oil,essence of mirbane,nitro-benzene,nitrobenzeen,oil of myrbane,nitrobenzen,mononitrobenzene PubChem CID: 7416 ChEBI: CHEBI:27798 IUPAC navn: nitrobenzene SMIL: C1=CC=C(C=C1)[N+](=O)[O-]
| MDL nummer | MFCD00007043 |
|---|---|
| PubChem CID | 7416 |
| Molekylvægt (g/mol) | 123.111 |
| CAS | 98-95-3 |
| ChEBI | CHEBI:27798 |
| Synonym | nitrobenzol,benzene, nitro,oil of mirbane,mirbane oil,essence of mirbane,nitro-benzene,nitrobenzeen,oil of myrbane,nitrobenzen,mononitrobenzene |
| SMIL | C1=CC=C(C=C1)[N+](=O)[O-] |
| IUPAC navn | nitrobenzene |
| InChI nøgle | LQNUZADURLCDLV-UHFFFAOYSA-N |
| Molekylær formel | C6H5NO2 |
Nitromethane, ≥99.0%, ReagentPlus™, Honeywell™
CAS: 75-52-5 Molekylær formel: CH3NO2 Molekylvægt (g/mol): 61.04 MDL nummer: MFCD00007400 InChI nøgle: LYGJENNIWJXYER-UHFFFAOYSA-N Synonym: methane, nitro,nitrocarbol,nitrometan,nitrometan polish,nitro-methane,unii-ru5wg8c3f4,ccris 1205,hsdb 106,meno2,ru5wg8c3f4 PubChem CID: 6375 ChEBI: CHEBI:77701 IUPAC navn: nitromethane SMIL: C[N+]([O-])=O
| MDL nummer | MFCD00007400 |
|---|---|
| PubChem CID | 6375 |
| Molekylvægt (g/mol) | 61.04 |
| CAS | 75-52-5 |
| ChEBI | CHEBI:77701 |
| Synonym | methane, nitro,nitrocarbol,nitrometan,nitrometan polish,nitro-methane,unii-ru5wg8c3f4,ccris 1205,hsdb 106,meno2,ru5wg8c3f4 |
| SMIL | C[N+]([O-])=O |
| IUPAC navn | nitromethane |
| InChI nøgle | LYGJENNIWJXYER-UHFFFAOYSA-N |
| Molekylær formel | CH3NO2 |
Nitrobenzene, ≥99%, ACS Reagent, Honeywell™ Riedel-de Haën™
CAS: 98-95-3 Molekylær formel: C6H5NO2 Molekylvægt (g/mol): 123.111 MDL nummer: MFCD00007043 InChI nøgle: LQNUZADURLCDLV-UHFFFAOYSA-N Synonym: nitrobenzol,benzene, nitro,oil of mirbane,mirbane oil,essence of mirbane,nitro-benzene,nitrobenzeen,oil of myrbane,nitrobenzen,mononitrobenzene PubChem CID: 7416 ChEBI: CHEBI:27798 IUPAC navn: nitrobenzene SMIL: C1=CC=C(C=C1)[N+](=O)[O-]
| MDL nummer | MFCD00007043 |
|---|---|
| PubChem CID | 7416 |
| Molekylvægt (g/mol) | 123.111 |
| CAS | 98-95-3 |
| ChEBI | CHEBI:27798 |
| Synonym | nitrobenzol,benzene, nitro,oil of mirbane,mirbane oil,essence of mirbane,nitro-benzene,nitrobenzeen,oil of myrbane,nitrobenzen,mononitrobenzene |
| SMIL | C1=CC=C(C=C1)[N+](=O)[O-] |
| IUPAC navn | nitrobenzene |
| InChI nøgle | LQNUZADURLCDLV-UHFFFAOYSA-N |
| Molekylær formel | C6H5NO2 |