Opløsningsmidler
Forskellige organiske opløsningsmidler egnet til industrielle, analytiske, uddannelsesmæssige, medicinske og forskningsmæssige applikationer, herunder kromatografi , kemiske og organiske synteser og oprensningsprocesser. Produkter, herunder en omfattende sortiment af vandprodukter , et essentielt opløsningsmiddel til ethvert laboratorium, fås i en række kemiske sammensætninger, mængder, renhedsniveauer og reagenskvaliteter og er sammensat til at optimere dine arbejdsgange.
Filtrerede søgeresultater
Acetone, Puriss., opfylder analytiske specifikationer. af BP, NF, Ph. Eur.,≥ 99 % (GC), Honeywell Riedel-de Haën™
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
CAS: 67-64-1 Molekylær formel: C3H6O Molekylvægt (g/mol): 58.08 MDL nummer: MFCD00008765 InChI nøgle: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC navn: propan-2-one SMIL: CC(C)=O
| MDL nummer | MFCD00008765 |
|---|---|
| PubChem CID | 180 |
| Molekylvægt (g/mol) | 58.08 |
| CAS | 67-64-1 |
| ChEBI | CHEBI:15347 |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| SMIL | CC(C)=O |
| IUPAC navn | propan-2-one |
| InChI nøgle | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molekylær formel | C3H6O |
3-chlor-2-methylphenyl isothiocyanat, 97 %, Thermo Scientific™
CAS: 19241-35-1 Molekylær formel: C8H6ClNS Molekylvægt (g/mol): 183.653 MDL nummer: MFCD00022056 InChI nøgle: ZXEZATIRZLJXFU-UHFFFAOYSA-N PubChem CID: 140504 IUPAC navn: 1-chlor-3-isothiocyanato-2-methylbenzen SMIL: CC1=C(C=CC=C1Cl)N=C=S
| MDL nummer | MFCD00022056 |
|---|---|
| PubChem CID | 140504 |
| Molekylvægt (g/mol) | 183.653 |
| CAS | 19241-35-1 |
| SMIL | CC1=C(C=CC=C1Cl)N=C=S |
| IUPAC navn | 1-chlor-3-isothiocyanato-2-methylbenzen |
| InChI nøgle | ZXEZATIRZLJXFU-UHFFFAOYSA-N |
| Molekylær formel | C8H6ClNS |
Toluen-d8, til NMR, 99,5+ % atom D, Thermo Scientific Chemicals
CAS: 2037-26-5 Molekylær formel: C7H8 Molekylvægt (g/mol): 100.19 MDL nummer: MFCD00044638 InChI nøgle: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC navn: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzen SMIL: CC1=CC=CC=C1
| MDL nummer | MFCD00044638 |
|---|---|
| PubChem CID | 74861 |
| Molekylvægt (g/mol) | 100.19 |
| CAS | 2037-26-5 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| SMIL | CC1=CC=CC=C1 |
| IUPAC navn | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzen |
| InChI nøgle | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molekylær formel | C7H8 |
4-Pregnen-17alpha,21-diol-3,20-dione-21,21-d2, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Kemisk navn eller materiale | 11-Deoxycortisol-21,21-D2 |
|---|---|
| Anbefalet opbevaring | Room Temperature |
| Molekylvægt (g/mol) | 348.4728 |
| InChI formel | InChI=1 S/C21H30O4/c1-19-8-5-14(23)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,25)18(24)12-22/h11,15-17,22,25 H,3-10,12H2,1-2H3/t15-,16+,17+,19+,20+,21+/m1/s1/i12D2 |
| CAS | 1271728-08-5 |
| Formel vægt | 348.227 g/mol |
| Synonym | Pregn-4-ene-3,20-dione-21,21-d2, 17,21-dihydroxy- (ACI),17,21-Dihydroxypregn-4-ene-3,20-dione-21,21-d2 (ACI),11-Deoxycortisol-21,21-d2,11-Deoxycortisol-21,21-D2,4-Pregnen-17α,21-diol-3,20-dione-21,21-d2 |
| Procent renhed | 98 atom % D, min 98% Chemical Purity |
| SMIL | [2 H]C([2 H])(O)C(=O)[C@@]1(O)CC[C@H]2 [C@@H]3 CCC4=CC(=O)CC[C@]4(C)[C@H]3 CC[C@]12 C |
| IUPAC navn | (8 R,9 S,10 R,13 S,14 S,17 R)-17-(2,2-dideuterio-2-hydroxyacetyl)-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1 H-cyclopenta[a]phenanthren-3-one |
| Molekylær formel | C21 D2 H28 O4 |
Acetonitrile-d3, for NMR, contains 1 v/v% TMS, 99 atom % D
CAS: 2206-26-0 Molekylær formel: C2H3N Molekylvægt (g/mol): 44.07 MDL nummer: MFCD00001881 InChI nøgle: WEVYAHXRMPXWCK-FIBGUPNXSA-N Synonym: acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g PubChem CID: 123151 IUPAC navn: 2,2,2-trideuterioacetonitril SMIL: [2H]C([2H])([2H])C#N
| MDL nummer | MFCD00001881 |
|---|---|
| PubChem CID | 123151 |
| Molekylvægt (g/mol) | 44.07 |
| CAS | 2206-26-0 |
| Synonym | acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g |
| SMIL | [2H]C([2H])([2H])C#N |
| IUPAC navn | 2,2,2-trideuterioacetonitril |
| InChI nøgle | WEVYAHXRMPXWCK-FIBGUPNXSA-N |
| Molekylær formel | C2H3N |
Potassium 3-chlorophenyltrifluoroborate, 96%, Thermo Scientific™
CAS: 411206-75-2 Molekylær formel: C6H4BClF3K Molekylvægt (g/mol): 218.452 MDL nummer: MFCD04115754 InChI nøgle: LRJCVRYGKNDLAD-UHFFFAOYSA-N Synonym: potassium 3-chlorophenyl trifluoroborate,potassium 3-chlorophenyl trifluoroboranuide,potassium 3-chlorophenyltrifluoroborate,amtb707,potassium 3-chlorophenyl-trifluoroboranuide,potassium 3-chlorophenyl trifluoro borate 1-,potassium ion 3-chlorophenyl trifluoroboranuide,potassium 3-chlorophenyl-tris fluoranyl boranuide PubChem CID: 23677818 IUPAC navn: potassium;(3-chlorophenyl)-trifluoroboranuide SMIL: [B-](C1=CC(=CC=C1)Cl)(F)(F)F.[K+]
| MDL nummer | MFCD04115754 |
|---|---|
| PubChem CID | 23677818 |
| Molekylvægt (g/mol) | 218.452 |
| CAS | 411206-75-2 |
| Synonym | potassium 3-chlorophenyl trifluoroborate,potassium 3-chlorophenyl trifluoroboranuide,potassium 3-chlorophenyltrifluoroborate,amtb707,potassium 3-chlorophenyl-trifluoroboranuide,potassium 3-chlorophenyl trifluoro borate 1-,potassium ion 3-chlorophenyl trifluoroboranuide,potassium 3-chlorophenyl-tris fluoranyl boranuide |
| SMIL | [B-](C1=CC(=CC=C1)Cl)(F)(F)F.[K+] |
| IUPAC navn | potassium;(3-chlorophenyl)-trifluoroboranuide |
| InChI nøgle | LRJCVRYGKNDLAD-UHFFFAOYSA-N |
| Molekylær formel | C6H4BClF3K |
Potassium 4-chlorophenyltrifluoroborate, 96%, Thermo Scientific™
CAS: 661465-44-7 Molekylær formel: C6H4BClF3K Molekylvægt (g/mol): 218.452 MDL nummer: MFCD04115770 InChI nøgle: GXBSKMLVYJPMRT-UHFFFAOYSA-N Synonym: potassium 4-chlorophenyltrifluoroborate,potassium 4-chlorophenyl trifluoroborate,potassium 4-chlorophenyl trifluoroboranuide,pubchem11348,potassium 4-chlorophenyl trifluoro borate 1-,potassium ion 4-chlorophenyl trifluoroboranuide PubChem CID: 23682053 IUPAC navn: potassium;(4-chlorophenyl)-trifluoroboranuide SMIL: [B-](C1=CC=C(C=C1)Cl)(F)(F)F.[K+]
| MDL nummer | MFCD04115770 |
|---|---|
| PubChem CID | 23682053 |
| Molekylvægt (g/mol) | 218.452 |
| CAS | 661465-44-7 |
| Synonym | potassium 4-chlorophenyltrifluoroborate,potassium 4-chlorophenyl trifluoroborate,potassium 4-chlorophenyl trifluoroboranuide,pubchem11348,potassium 4-chlorophenyl trifluoro borate 1-,potassium ion 4-chlorophenyl trifluoroboranuide |
| SMIL | [B-](C1=CC=C(C=C1)Cl)(F)(F)F.[K+] |
| IUPAC navn | potassium;(4-chlorophenyl)-trifluoroboranuide |
| InChI nøgle | GXBSKMLVYJPMRT-UHFFFAOYSA-N |
| Molekylær formel | C6H4BClF3K |
Cyclohexane-d12, for NMR, 99.5 atom % D
CAS: 1735-17-7 Molekylær formel: C6H12 Molekylvægt (g/mol): 96.24 MDL nummer: MFCD00044212 InChI nøgle: XDTMQSROBMDMFD-LBTWDOQPSA-N Synonym: cyclohexane-d12,2h12 cyclohexane,cyclohexane d,cyclohexane, d12,2 h?? cyclohexane,cyclohexane-d12, ≥99.6 atom % d,cyclohexane #,cyclohexane-d12, 99.5 atom % d PubChem CID: 123129 IUPAC navn: 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriocyclohexane SMIL: [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H]
| MDL nummer | MFCD00044212 |
|---|---|
| PubChem CID | 123129 |
| Molekylvægt (g/mol) | 96.24 |
| CAS | 1735-17-7 |
| Synonym | cyclohexane-d12,2h12 cyclohexane,cyclohexane d,cyclohexane, d12,2 h?? cyclohexane,cyclohexane-d12, ≥99.6 atom % d,cyclohexane #,cyclohexane-d12, 99.5 atom % d |
| SMIL | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| IUPAC navn | 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriocyclohexane |
| InChI nøgle | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| Molekylær formel | C6H12 |