Få mere at vide
Tolfenamic acid, 99+%, Thermo Scientific™
NSAID that activates calcium-activated potassium channels
Brand: Thermo Scientific Alfa Aesar J61256.09
| Mængde | 10g |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsTolfenamic acid is a non-steroidal anti-inflammatory agent. It interferes with synthesis of β-amyloid precursor protein, and thus Aβ peptides, by promoting degradation of an essential transcription factor. It inhibits fMLP- and A23187-induced Ca2+ influx in human PMNL with an IC50 value of approximately 20 µM.
Solubility
Soluble in water (slightly), acetone (∼10 mg/ml), DMSO (52 mg/ml at 25°C), methanol (∼10 mg/ml) and ethanol (50 mg/ml).
Notes
Stable under recommended storage conditions. Incompatible with oxidizing agents.
Kemiske identifikatorer
| 13710-19-5 | |
| 261.705 | |
| YEZNLOUZAIOMLT-UHFFFAOYSA-N | |
| 610479 | |
| 2-(3-chloro-2-methylanilino)benzoic acid |
| C14H12ClNO2 | |
| MFCD00133865 | |
| tolfenamic acid, clotam, n-3-chloro-2-methylphenyl anthranilic acid, 2-3-chloro-2-methylphenyl amino benzoic acid, tolfedine, acido tolfenamico, acide tolfenamique, acidum tolfenamicum, tolfine, n-2-methyl-3-chlorophenyl anthranilic acid | |
| CHEBI:32243 | |
| CC1=C(C=CC=C1Cl)NC2=CC=CC=C2C(=O)O |
Tekniske data
| Tolfenamic acid | |
| C14H12ClNO2 | |
| 10g | |
| 14,9513 | |
| Soluble in water (slightly),acetone (∽10mg/ml),DMSO (52mg/ml at 25°C),methanol (∽10mg/ml) and ethanol (50mg/ml). | |
| CC1=C(C=CC=C1Cl)NC2=CC=CC=C2C(=O)O | |
| 261.705 | |
| CHEBI:32243 | |
| ≥99% |
| 13710-19-5 | |
| MFCD00133865 | |
| UN2811 | |
| tolfenamic acid, clotam, n-3-chloro-2-methylphenyl anthranilic acid, 2-3-chloro-2-methylphenyl amino benzoic acid, tolfedine, acido tolfenamico, acide tolfenamique, acidum tolfenamicum, tolfine, n-2-methyl-3-chlorophenyl anthranilic acid | |
| YEZNLOUZAIOMLT-UHFFFAOYSA-N | |
| 2-(3-chloro-2-methylanilino)benzoic acid | |
| 610479 | |
| 261.7 |
Sikkerhed og håndtering
- Tolfenamic acid
Signalord
- Fare
Farekategori
- Akut toksicitet Kategori 3
Faresætning
- H301-Giftig ved indtagelse.
Sikkerhedssætning
- P264-Vask grundigt efter brug.
- P301+P310-I TILFÆLDE AF INDTAGELSE: Ring omgående til en GIFTINFORMATION/læge
Supplerende oplysninger
- MIXTURE LIST-Contain: Tolfenamic acid
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.