Få mere at vide
Sotalol hydrochloride, 98%, Thermo Scientific™
Potent beta adrenergic antagonist
Brand: Thermo Scientific Alfa Aesar J63772.06
| Mængde | 5g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsSotalol hydrochloride is used as a potent beta adrenergic antagonist, prolongs the action potential and increases the refractory period. Sotalol hydrochloride is also considered a non-selective β blocker and a potassium channel blocker with an IC50 of 43 µM.
Solubility
Soluble in phosphate buffered saline, DMSO, ethanol, water, and methanol.
Notes
Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Kemiske identifikatorer
| 959-24-0 | |
| 308.82 | |
| VIDRYROWYFWGSY-UHFFFAOYNA-N | |
| 66245 | |
| hydrogen N-(4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}phenyl)methanesulfonamide chloride |
| C12H21ClN2O3S | |
| MFCD00242937 | |
| sotalol hydrochloride, sotalol hcl, betapace, betapace af, sotacor, sotalex, berlex, mead johnson 1999, sorine | |
| CHEBI:9207 | |
| [H+].[Cl-].CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1 |
Tekniske data
| Sotalol hydrochloride | |
| C12H21ClN2O3S | |
| 5g | |
| sotalol hydrochloride, sotalol hcl, betapace, betapace af, sotacor, sotalex, berlex, mead johnson 1999, sorine | |
| VIDRYROWYFWGSY-UHFFFAOYNA-N | |
| hydrogen N-(4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}phenyl)methanesulfonamide chloride | |
| 66245 | |
| 308.82 |
| 959-24-0 | |
| MFCD00242937 | |
| 14,8728 | |
| Soluble in phosphate buffered saline,DMSO,ethanol,water,and methanol. | |
| [H+].[Cl-].CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1 | |
| 308.82 | |
| CHEBI:9207 | |
| 98% |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.