Få mere at vide
Pirenzepine dihydrochloride, 99%, Thermo Scientific™
A M1 muscarinic receptor antagonist
Brand: Thermo Scientific Alfa Aesar J62252.03
| Mængde | 1g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 29868-97-1 | |
| 424.326 | |
| FFNMBRCFFADNAO-UHFFFAOYSA-N | |
| 71405 | |
| 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride |
| C19H23Cl2N5O2 | |
| MFCD00055214 | |
| pirenzepine dihydrochloride, pirenzepine hydrochloride, tabe, bisvanil, leblon, maghen, pirenzepine hcl, pirenzepine 2hcl, ls 519 dihydrochloride, unii-10ym403fls | |
| CHEBI:32014 | |
| CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl |
Tekniske data
| Pirenzepine dihydrochloride | |
| C19H23Cl2N5O2 | |
| 1g | |
| 14,7491 | |
| FFNMBRCFFADNAO-UHFFFAOYSA-N | |
| 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride | |
| 71405 | |
| 424.32 |
| 29868-97-1 | |
| MFCD00055214 | |
| Hygroscopic | |
| pirenzepine dihydrochloride, pirenzepine hydrochloride, tabe, bisvanil, leblon, maghen, pirenzepine hcl, pirenzepine 2hcl, ls 519 dihydrochloride, unii-10ym403fls | |
| CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl | |
| 424.326 | |
| CHEBI:32014 | |
| 99% |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.