Få mere at vide
Phenoxybenzamine hydrochloride, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J61900.MD
| Mængde | 250mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- Selective alpha adrenergic blocking agent
- Irreversible calmodulin inhibitor
Kemiske identifikatorer
| 63-92-3 | |
| 340.288 | |
| VBCPVIWPDJVHAN-UHFFFAOYSA-N | |
| 5284441 | |
| N-benzyl-N-(2-chloroethyl)-1-phenoxypropan-2-amine;hydrochloride |
| C18H23Cl2NO | |
| MFCD00055152 | |
| phenoxybenzamine hydrochloride, dibenzyline, phenoxybenzamine hcl, n-benzyl-n-2-chloroethyl-1-phenoxypropan-2-amine hydrochloride, dibenzyline hydrochloride, phenoxybenzamine.hcl, bensylyt nen, phenoxybenzamine chloride, benzene methanamine | |
| CHEBI:8078 | |
| CC(COC1=CC=CC=C1)N(CCCl)CC2=CC=CC=C2.Cl |
Tekniske data
| Phenoxybenzamine hydrochloride | |
| C18H23Cl2NO | |
| 250mg | |
| phenoxybenzamine hydrochloride, dibenzyline, phenoxybenzamine hcl, n-benzyl-n-2-chloroethyl-1-phenoxypropan-2-amine hydrochloride, dibenzyline hydrochloride, phenoxybenzamine.hcl, bensylyt nen, phenoxybenzamine chloride, benzene methanamine | |
| CC(COC1=CC=CC=C1)N(CCCl)CC2=CC=CC=C2.Cl | |
| 340.288 | |
| CHEBI:8078 |
| 63-92-3 | |
| MFCD00055152 | |
| 14,7256 | |
| VBCPVIWPDJVHAN-UHFFFAOYSA-N | |
| N-benzyl-N-(2-chloroethyl)-1-phenoxypropan-2-amine;hydrochloride | |
| 5284441 | |
| 340.29 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.