Få mere at vide
Flumazenil, 98%, Thermo Scientific™
Benzodiazepine antagonist
Brand: Thermo Scientific Alfa Aesar J62537.MC
| Mængde | 100mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 78755-81-4 | |
| 303.293 | |
| OFBIFZUFASYYRE-UHFFFAOYSA-N | |
| 3373 | |
| ethyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| C15H14FN3O3 | |
| MFCD00242764 | |
| flumazenil, anexate, flumazepil, romazicon, lanexat, mazicon, flumazenilum, flumazenilo, flumazenilum latin, flumazenilo spanish | |
| CHEBI:5103 | |
| CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC(=C3)F)C |
Tekniske data
| Flumazenil | |
| C15H14FN3O3 | |
| 100mg | |
| flumazenil, anexate, flumazepil, romazicon, lanexat, mazicon, flumazenilum, flumazenilo, flumazenilum latin, flumazenilo spanish | |
| OFBIFZUFASYYRE-UHFFFAOYSA-N | |
| ethyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate | |
| 3373 | |
| 303.29 |
| 78755-81-4 | |
| MFCD00242764 | |
| 14,4135 | |
| Soluble in DMSO to 25mM | |
| CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC(=C3)F)C | |
| 303.293 | |
| CHEBI:5103 | |
| 98% |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.