Få mere at vide
Finasteride, Thermo Scientific™
Inhibitor of steroid 5-a-reductase
Brand: Thermo Scientific Alfa Aesar J63454.MC
| Mængde | 100mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsFinasteride is used as a inhibitor of steroid 5-a-reductase, antiandrogen, an intracellular enzyme that converts the androgen testosterone into 5α dihydrotestosterone.
Solubility
Soluble in water, DMSO, ethanol, methanol, and chloroform.
Notes
Protect from heat. Store away from oxidizing agents.
Kemiske identifikatorer
| 98319-26-7 | |
| 372.553 | |
| DBEPLOCGEIEOCV-WSBQPABSSA-N | |
| 57363 | |
| (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
| C23H36N2O2 | |
| MFCD00869737 | |
| finasteride, proscar, propecia, finastid, prostide, chibro-proscar, finasterida, finasteridum, finpecia, finasteridum inn-latin | |
| CHEBI:5062 | |
| CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C |
Tekniske data
| Finasteride | |
| C23H36N2O2 | |
| 100mg | |
| finasteride, proscar, propecia, finastid, prostide, chibro-proscar, finasterida, finasteridum, finpecia, finasteridum inn-latin | |
| DBEPLOCGEIEOCV-WSBQPABSSA-N | |
| (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide | |
| 57363 | |
| 372.54 |
| 98319-26-7 | |
| MFCD00869737 | |
| 14,4082 | |
| Soluble in water,DMSO,ethanol,methanol,and chloroform. | |
| CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C | |
| 372.553 | |
| CHEBI:5062 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.